feat(xo-server): multi processes

If a single VM has been imported, redirect to its page.

If multiple VMs has been imported, redirect to the homepage with all other VMs filtered out.

.gitignore

@@ -8,6 +8,8 @@
 /packages/*/dist/
 /packages/*/node_modules/
 
+/packages/vhd-cli/src/commands/index.js
+
 /packages/xen-api/plot.dat
 
 /packages/xo-server/.xo-server.*

.travis.yml

@@ -12,6 +12,7 @@ addons:
     packages:
     - qemu-utils
     - blktap-utils
+    - vmdk-stream-converter
 
 before_install:
   - curl -o- -L https://yarnpkg.com/install.sh | bash

@xen-orchestra/fs/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/fs/package.json

@@ -0,0 +1,54 @@
+{
+  "name": "@xen-orchestra/fs",
+  "version": "0.0.0",
+  "license": "AGPL-3.0",
+  "description": "The File System for Xen Orchestra backups.",
+  "keywords": [],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/fs",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "preferGlobal": true,
+  "main": "dist/",
+  "bin": {},
+  "files": [
+    "dist/"
+  ],
+  "engines": {
+    "node": ">=6"
+  },
+  "dependencies": {
+    "@babel/runtime": "^7.0.0-beta.44",
+    "@marsaud/smb2-promise": "^0.2.1",
+    "execa": "^0.10.0",
+    "fs-extra": "^5.0.0",
+    "get-stream": "^3.0.0",
+    "lodash": "^4.17.4",
+    "promise-toolbox": "^0.9.5",
+    "through2": "^2.0.3",
+    "tmp": "^0.0.33",
+    "xo-remote-parser": "^0.3"
+  },
+  "devDependencies": {
+    "@babel/cli": "7.0.0-beta.44",
+    "@babel/core": "7.0.0-beta.44",
+    "@babel/plugin-proposal-function-bind": "7.0.0-beta.44",
+    "@babel/plugin-transform-runtime": "^7.0.0-beta.44",
+    "@babel/preset-env": "7.0.0-beta.44",
+    "@babel/preset-flow": "7.0.0-beta.44",
+    "babel-plugin-lodash": "^3.3.2",
+    "cross-env": "^5.1.3",
+    "index-modules": "^0.3.0",
+    "rimraf": "^2.6.2"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "clean": "rimraf dist/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "yarn run clean",
+    "predev": "yarn run clean",
+    "prepare": "yarn run build"
+  }
+}

@xen-orchestra/fs/src/abstract.js

@@ -1,11 +1,11 @@
 // @flow
 
+import getStream from 'get-stream'
+import { randomBytes } from 'crypto'
+import { fromCallback, fromEvent, ignoreErrors } from 'promise-toolbox'
 import { type Readable, type Writable } from 'stream'
-import { fromEvent, ignoreErrors } from 'promise-toolbox'
 import { parse } from 'xo-remote-parser'
 
-import { getPseudoRandomBytes, streamToBuffer } from '../utils'
-
 import { createChecksumStream, validChecksumOfReadStream } from './checksum'
 
 type Data = Buffer | Readable | string
@@ -54,7 +54,7 @@ export default class RemoteHandlerAbstract {
 
   async test (): Promise<Object> {
     const testFileName = `${Date.now()}.test`
-    const data = getPseudoRandomBytes(1024 * 1024)
+    const data = await fromCallback(cb => randomBytes(1024 * 1024, cb))
     let step = 'write'
     try {
       await this.outputFile(testFileName, data)
@@ -97,7 +97,7 @@ export default class RemoteHandlerAbstract {
   }
 
   _readFile (file: string, options?: Object): Promise<Buffer> {
-    return this.createReadStream(file, options).then(streamToBuffer)
+    return this.createReadStream(file, options).then(getStream.buffer)
   }
 
   async rename (

@xen-orchestra/fs/src/fs.integ.spec.js

@@ -0,0 +1,26 @@
+/* eslint-env jest */
+
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+
+import { fromCallback as pFromCallback } from 'promise-toolbox'
+import { getHandler } from '.'
+
+const initialDir = process.cwd()
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+test("fs test doesn't crash", async () => {
+  const handler = getHandler({ url: 'file://' + process.cwd() })
+  const result = await handler.test()
+  expect(result.success).toBeTruthy()
+})

@xen-orchestra/fs/src/index.js

@@ -5,6 +5,7 @@ import RemoteHandlerLocal from './local'
 import RemoteHandlerNfs from './nfs'
 import RemoteHandlerSmb from './smb'
 
+export type { default as RemoteHandler } from './abstract'
 export type Remote = { url: string }
 
 const HANDLERS = {

@xen-orchestra/fs/src/smb.js

@@ -1,7 +1,9 @@
 import Smb2 from '@marsaud/smb2-promise'
+import { lastly as pFinally } from 'promise-toolbox'
 
 import RemoteHandlerAbstract from './abstract'
-import { noop, pFinally } from '../utils'
+
+const noop = () => {}
 
 // Normalize the error code for file not found.
 const normalizeError = error => {

@xen-orchestra/log/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/log/.npmignore

@@ -0,0 +1,24 @@
+/benchmark/
+/benchmarks/
+*.bench.js
+*.bench.js.map
+
+/examples/
+example.js
+example.js.map
+*.example.js
+*.example.js.map
+
+/fixture/
+/fixtures/
+*.fixture.js
+*.fixture.js.map
+*.fixtures.js
+*.fixtures.js.map
+
+/test/
+/tests/
+*.spec.js
+*.spec.js.map
+
+__snapshots__/

@xen-orchestra/log/README.md

@@ -0,0 +1,149 @@
+# @xen-orchestra/log [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+
+> ${pkg.description}
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/log):
+
+```
+> npm install --save @xen-orchestra/log
+```
+
+## Usage
+
+Everywhere something should be logged:
+
+```js
+import { createLogger } from '@xen-orchestra/log'
+
+const log = createLogger('xo-server-api')
+log.warn('foo')
+```
+
+Then at application level you can choose how to handle these logs:
+
+```js
+import configure from '@xen-orchestra/log/configure'
+import createConsoleTransport from '@xen-orchestra/log/transports/console'
+import createEmailTransport from '@xen-orchestra/log/transports/email'
+
+configure([
+  {
+    // if filter is a string, then it is pattern
+    // (https://github.com/visionmedia/debug#wildcards) which is
+    // matched against the namespace of the logs
+    filter: process.env.DEBUG,
+
+    transport: createConsoleTransport()
+  },
+  {
+    // only levels >= warn
+    level: 'warn',
+
+    transport: createEmaileTransport({
+      service: 'gmail',
+      auth: {
+        user: 'jane.smith@gmail.com',
+        pass: 'H&NbECcpXF|pyXe#%ZEb'
+      },
+      from: 'jane.smith@gmail.com',
+      to: [
+        'jane.smith@gmail.com',
+        'sam.doe@yahoo.com'
+      ]
+    })
+  }
+])
+```
+
+### Transports
+
+#### Console
+
+```js
+import createConsoleTransport from '@xen-orchestra/log/transports/console'
+
+configure(createConsoleTransport())
+```
+
+#### Email
+
+Optional dependency:
+
+```
+> yarn add nodemailer pretty-format
+```
+
+Configuration:
+
+```js
+import createEmailTransport from '@xen-orchestra/log/transports/email'
+
+configure(createEmailTransport({
+  service: 'gmail',
+  auth: {
+    user: 'jane.smith@gmail.com',
+    pass: 'H&NbECcpXF|pyXe#%ZEb'
+  },
+  from: 'jane.smith@gmail.com',
+  to: [
+    'jane.smith@gmail.com',
+    'sam.doe@yahoo.com'
+  ]
+}))
+```
+
+#### Syslog
+
+Optional dependency:
+
+```
+> yarn add split-host syslog-client
+```
+
+Configuration:
+
+```js
+import createSyslogTransport from '@xen-orchestra/log/transports/syslog'
+
+// By default, log to udp://localhost:514
+configure(createSyslogTransport())
+
+// But TCP, a different host, or a different port can be used
+configure(createSyslogTransport('tcp://syslog.company.lan'))
+```
+
+## Development
+
+```
+# Install dependencies
+> yarn
+
+# Run the tests
+> yarn test
+
+# Continuously compile
+> yarn dev
+
+# Continuously run the tests
+> yarn dev-test
+
+# Build for production (automatically called by npm install)
+> yarn build
+```
+
+## Contributions
+
+Contributions are *very* welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xo-web/issues/)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+ISC © [Vates SAS](https://vates.fr)

@xen-orchestra/log/configure.js

@@ -0,0 +1 @@
+module.exports = require('./dist/configure')

@xen-orchestra/log/package.json

@@ -0,0 +1,52 @@
+{
+  "private": true,
+  "name": "@xen-orchestra/log",
+  "version": "0.0.0",
+  "license": "ISC",
+  "description": "",
+  "keywords": [],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/packages/@xen-orchestra/log",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Julien Fontanet",
+    "email": "julien.fontanet@vates.fr"
+  },
+  "preferGlobal": false,
+  "main": "dist/",
+  "bin": {},
+  "files": [
+    "dist/"
+  ],
+  "browserslist": [
+    ">2%"
+  ],
+  "engines": {
+    "node": ">=4"
+  },
+  "dependencies": {
+    "@babel/polyfill": "7.0.0-beta.42",
+    "lodash": "^4.17.4",
+    "promise-toolbox": "^0.9.5"
+  },
+  "devDependencies": {
+    "@babel/cli": "7.0.0-beta.42",
+    "@babel/core": "7.0.0-beta.42",
+    "@babel/preset-env": "7.0.0-beta.42",
+    "@babel/preset-flow": "7.0.0-beta.42",
+    "babel-plugin-lodash": "^3.3.2",
+    "cross-env": "^5.1.3",
+    "rimraf": "^2.6.2"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "clean": "rimraf dist/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "yarn run clean",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build"
+  }
+}

@xen-orchestra/log/src/configure.js

@@ -0,0 +1,105 @@
+import createConsoleTransport from './transports/console'
+import LEVELS, { resolve } from './levels'
+import { compileGlobPattern } from './utils'
+
+// ===================================================================
+
+const createTransport = config => {
+  if (typeof config === 'function') {
+    return config
+  }
+
+  if (Array.isArray(config)) {
+    const transports = config.map(createTransport)
+    const { length } = transports
+    return function () {
+      for (let i = 0; i < length; ++i) {
+        transports[i].apply(this, arguments)
+      }
+    }
+  }
+
+  let { filter, transport } = config
+  const level = resolve(config.level)
+
+  if (filter !== undefined) {
+    if (typeof filter === 'string') {
+      const re = compileGlobPattern(filter)
+      filter = log => re.test(log.namespace)
+    }
+
+    const orig = transport
+    transport = function (log) {
+      if ((level !== undefined && log.level >= level) || filter(log)) {
+        return orig.apply(this, arguments)
+      }
+    }
+  } else if (level !== undefined) {
+    const orig = transport
+    transport = function (log) {
+      if (log.level >= level) {
+        return orig.apply(this, arguments)
+      }
+    }
+  }
+
+  return transport
+}
+
+let transport = createTransport({
+  // display warnings or above, and all that are enabled via DEBUG or
+  // NODE_DEBUG env
+  filter: process.env.DEBUG || process.env.NODE_DEBUG,
+  level: LEVELS.INFO,
+
+  transport: createConsoleTransport(),
+})
+
+const symbol =
+  typeof Symbol !== 'undefined'
+    ? Symbol.for('@xen-orchestra/log')
+    : '@@@xen-orchestra/log'
+global[symbol] = log => transport(log)
+
+export const configure = config => {
+  transport = createTransport(config)
+}
+
+// -------------------------------------------------------------------
+
+export const catchGlobalErrors = logger => {
+  // patch process
+  const onUncaughtException = error => {
+    logger.error('uncaught exception', { error })
+  }
+  const onUnhandledRejection = error => {
+    logger.warn('possibly unhandled rejection', { error })
+  }
+  const onWarning = error => {
+    logger.warn('Node warning', { error })
+  }
+  process.on('uncaughtException', onUncaughtException)
+  process.on('unhandledRejection', onUnhandledRejection)
+  process.on('warning', onWarning)
+
+  // patch EventEmitter
+  const EventEmitter = require('events')
+  const { prototype } = EventEmitter
+  const { emit } = prototype
+  function patchedEmit (event, error) {
+    event === 'error' && !this.listenerCount(event)
+      ? logger.error('unhandled error event', { error })
+      : emit.apply(this, arguments)
+  }
+  prototype.emit = patchedEmit
+
+  return () => {
+    process.removeListener('uncaughtException', onUncaughtException)
+    process.removeListener('unhandledRejection', onUnhandledRejection)
+    process.removeListener('warning', onWarning)
+
+    if (prototype.emit === patchedEmit) {
+      prototype.emit = emit
+    }
+  }
+}

@xen-orchestra/log/src/index.js

@@ -0,0 +1,65 @@
+import createTransport from './transports/console'
+import LEVELS from './levels'
+
+const symbol =
+  typeof Symbol !== 'undefined'
+    ? Symbol.for('@xen-orchestra/log')
+    : '@@@xen-orchestra/log'
+if (!(symbol in global)) {
+  // the default behavior, without requiring `configure` is to avoid
+  // logging anything unless it's a real error
+  const transport = createTransport()
+  global[symbol] = log => log.level > LEVELS.WARN && transport(log)
+}
+
+// -------------------------------------------------------------------
+
+function Log (data, level, namespace, message, time) {
+  this.data = data
+  this.level = level
+  this.namespace = namespace
+  this.message = message
+  this.time = time
+}
+
+function Logger (namespace) {
+  this._namespace = namespace
+
+  // bind all logging methods
+  for (const name in LEVELS) {
+    const lowerCase = name.toLowerCase()
+    this[lowerCase] = this[lowerCase].bind(this)
+  }
+}
+
+const { prototype } = Logger
+
+for (const name in LEVELS) {
+  const level = LEVELS[name]
+
+  prototype[name.toLowerCase()] = function (message, data) {
+    global[symbol](new Log(data, level, this._namespace, message, new Date()))
+  }
+}
+
+prototype.wrap = function (message, fn) {
+  const logger = this
+  const warnAndRethrow = error => {
+    logger.warn(message, { error })
+    throw error
+  }
+  return function () {
+    try {
+      const result = fn.apply(this, arguments)
+      const then = result != null && result.then
+      return typeof then === 'function'
+        ? then.call(result, warnAndRethrow)
+        : result
+    } catch (error) {
+      warnAndRethrow(error)
+    }
+  }
+}
+
+const createLogger = namespace => new Logger(namespace)
+export { createLogger }

@xen-orchestra/log/src/levels.js

@@ -0,0 +1,24 @@
+const LEVELS = Object.create(null)
+export { LEVELS as default }
+
+// https://github.com/trentm/node-bunyan#levels
+LEVELS.FATAL = 60 // service/app is going to down
+LEVELS.ERROR = 50 // fatal for current action
+LEVELS.WARN = 40 // something went wrong but it's not fatal
+LEVELS.INFO = 30 // detail on unusual but normal operation
+LEVELS.DEBUG = 20
+
+export const NAMES = Object.create(null)
+for (const name in LEVELS) {
+  NAMES[LEVELS[name]] = name
+}
+
+export const resolve = level => {
+  if (typeof level === 'string') {
+    level = LEVELS[level.toUpperCase()]
+  }
+  return level
+}
+
+Object.freeze(LEVELS)
+Object.freeze(NAMES)

@xen-orchestra/log/src/levels.spec.js

@@ -0,0 +1,32 @@
+/* eslint-env jest */
+
+import { forEach, isInteger } from 'lodash'
+
+import LEVELS, { NAMES, resolve } from './levels'
+
+describe('LEVELS', () => {
+  it('maps level names to their integer values', () => {
+    forEach(LEVELS, (value, name) => {
+      expect(isInteger(value)).toBe(true)
+    })
+  })
+})
+
+describe('NAMES', () => {
+  it('maps level values to their names', () => {
+    forEach(LEVELS, (value, name) => {
+      expect(NAMES[value]).toBe(name)
+    })
+  })
+})
+
+describe('resolve()', () => {
+  it('returns level values either from values or names', () => {
+    forEach(LEVELS, value => {
+      expect(resolve(value)).toBe(value)
+    })
+    forEach(NAMES, (name, value) => {
+      expect(resolve(name)).toBe(+value)
+    })
+  })
+})

@xen-orchestra/log/src/transports/console.js

@@ -0,0 +1,20 @@
+import LEVELS, { NAMES } from '../levels'
+
+// Bind console methods (necessary for browsers)
+const debugConsole = console.log.bind(console)
+const infoConsole = console.info.bind(console)
+const warnConsole = console.warn.bind(console)
+const errorConsole = console.error.bind(console)
+
+const { ERROR, INFO, WARN } = LEVELS
+
+const consoleTransport = ({ data, level, namespace, message, time }) => {
+  const fn =
+    level < INFO
+      ? debugConsole
+      : level < WARN ? infoConsole : level < ERROR ? warnConsole : errorConsole
+
+  fn('%s - %s - [%s] %s', time.toISOString(), namespace, NAMES[level], message)
+  data != null && fn(data)
+}
+export default () => consoleTransport

@xen-orchestra/log/src/transports/email.js

@@ -0,0 +1,68 @@
+import prettyFormat from 'pretty-format' // eslint-disable-line node/no-extraneous-import
+import { createTransport } from 'nodemailer' // eslint-disable-line node/no-extraneous-import
+import { fromCallback } from 'promise-toolbox'
+
+import { evalTemplate, required } from '../utils'
+import { NAMES } from '../levels'
+
+export default ({
+  // transport options (https://nodemailer.com/smtp/)
+  auth,
+  authMethod,
+  host,
+  ignoreTLS,
+  port,
+  proxy,
+  requireTLS,
+  secure,
+  service,
+  tls,
+
+  // message options (https://nodemailer.com/message/)
+  bcc,
+  cc,
+  from = required('from'),
+  to = required('to'),
+  subject = '[{{level}} - {{namespace}}] {{time}} {{message}}',
+}) => {
+  const transporter = createTransport(
+    {
+      auth,
+      authMethod,
+      host,
+      ignoreTLS,
+      port,
+      proxy,
+      requireTLS,
+      secure,
+      service,
+      tls,
+
+      disableFileAccess: true,
+      disableUrlAccess: true,
+    },
+    {
+      bcc,
+      cc,
+      from,
+      to,
+    }
+  )
+
+  return log =>
+    fromCallback(cb =>
+      transporter.sendMail(
+        {
+          subject: evalTemplate(
+            subject,
+            key =>
+              key === 'level'
+                ? NAMES[log.level]
+                : key === 'time' ? log.time.toISOString() : log[key]
+          ),
+          text: prettyFormat(log.data),
+        },
+        cb
+      )
+    )
+}

@xen-orchestra/log/src/transports/syslog.js

@@ -0,0 +1,42 @@
+import splitHost from 'split-host' // eslint-disable-line node/no-extraneous-import node/no-missing-import
+import { createClient, Facility, Severity, Transport } from 'syslog-client' // eslint-disable-line node/no-extraneous-import node/no-missing-import
+import { fromCallback } from 'promise-toolbox'
+import { startsWith } from 'lodash'
+
+import LEVELS from '../levels'
+
+// https://github.com/paulgrove/node-syslog-client#syslogseverity
+const LEVEL_TO_SEVERITY = {
+  [LEVELS.FATAL]: Severity.Critical,
+  [LEVELS.ERROR]: Severity.Error,
+  [LEVELS.WARN]: Severity.Warning,
+  [LEVELS.INFO]: Severity.Informational,
+  [LEVELS.DEBUG]: Severity.Debug,
+}
+
+const facility = Facility.User
+
+export default target => {
+  const opts = {}
+  if (target !== undefined) {
+    if (startsWith(target, 'tcp://')) {
+      target = target.slice(6)
+      opts.transport = Transport.Tcp
+    } else if (startsWith(target, 'udp://')) {
+      target = target.slice(6)
+      opts.transport = Transport.Ucp
+    }
+
+    ;({ host: target, port: opts.port } = splitHost(target))
+  }
+
+  const client = createClient(target, opts)
+
+  return log =>
+    fromCallback(cb =>
+      client.log(log.message, {
+        facility,
+        severity: LEVEL_TO_SEVERITY[log.level],
+      })
+    )
+}

@xen-orchestra/log/src/utils.js

@@ -0,0 +1,62 @@
+import escapeRegExp from 'lodash/escapeRegExp'
+
+// ===================================================================
+
+const TPL_RE = /\{\{(.+?)\}\}/g
+export const evalTemplate = (tpl, data) => {
+  const getData =
+    typeof data === 'function' ? (_, key) => data(key) : (_, key) => data[key]
+
+  return tpl.replace(TPL_RE, getData)
+}
+
+// -------------------------------------------------------------------
+
+const compileGlobPatternFragment = pattern =>
+  pattern
+    .split('*')
+    .map(escapeRegExp)
+    .join('.*')
+
+export const compileGlobPattern = pattern => {
+  const no = []
+  const yes = []
+  pattern.split(/[\s,]+/).forEach(pattern => {
+    if (pattern[0] === '-') {
+      no.push(pattern.slice(1))
+    } else {
+      yes.push(pattern)
+    }
+  })
+
+  const raw = ['^']
+
+  if (no.length !== 0) {
+    raw.push('(?!', no.map(compileGlobPatternFragment).join('|'), ')')
+  }
+
+  if (yes.length !== 0) {
+    raw.push('(?:', yes.map(compileGlobPatternFragment).join('|'), ')')
+  } else {
+    raw.push('.*')
+  }
+
+  raw.push('$')
+
+  return new RegExp(raw.join(''))
+}
+
+// -------------------------------------------------------------------
+
+export const required = name => {
+  throw new Error(`missing required arg ${name}`)
+}
+
+// -------------------------------------------------------------------
+
+export const serializeError = error => ({
+  ...error,
+  message: error.message,
+  name: error.name,
+  stack: error.stack,
+})

@xen-orchestra/log/src/utils.spec.js

@@ -0,0 +1,13 @@
+/* eslint-env jest */
+
+import { compileGlobPattern } from './utils'
+
+describe('compileGlobPattern()', () => {
+  it('works', () => {
+    const re = compileGlobPattern('foo, ba*, -bar')
+    expect(re.test('foo')).toBe(true)
+    expect(re.test('bar')).toBe(false)
+    expect(re.test('baz')).toBe(true)
+    expect(re.test('qux')).toBe(false)
+  })
+})

@xen-orchestra/log/transports

@@ -0,0 +1 @@
+dist/transports

CHANGELOG.md

@@ -1,9 +1,104 @@
 # ChangeLog
 
+## **5.20.0** (planned 2018-05-31)
+
+### Enhancements
+
+- Add VDI UUID in SR coalesce view [#2903](https://github.com/vatesfr/xen-orchestra/issues/2903)
+- Create new VDI from SR view not attached to any VM [#2229](https://github.com/vatesfr/xen-orchestra/issues/2229)
+- [Patches] ignore XS upgrade in missing patches counter [#2866](https://github.com/vatesfr/xen-orchestra/issues/2866)
+- [Health] List VM snapshots related to non-existing backup jobs/schedules [#2828](https://github.com/vatesfr/xen-orchestra/issues/2828)
+
+### Bugs
+
+## **5.19.0** (2018-05-01)
+
+### Enhancements
+
+- Expose vendor device in VM advanced tab [#2883](https://github.com/vatesfr/xen-orchestra/issues/2883)
+- Networks created in XO are missing the "automatic" parameter [#2818](https://github.com/vatesfr/xen-orchestra/issues/2818)
+- Performance alert disk space monitoring XS [#2737](https://github.com/vatesfr/xen-orchestra/issues/2737)
+- Add ability to create NFSv4 storage repository [#2706](https://github.com/vatesfr/xen-orchestra/issues/2706)
+- [SortedTable] Support link actions [#2691](https://github.com/vatesfr/xen-orchestra/issues/2691)
+- Additional sort option: by host name [#2680](https://github.com/vatesfr/xen-orchestra/issues/2680)
+- Expose XenTools version numbers in data model and UI [#2650](https://github.com/vatesfr/xen-orchestra/issues/2650)
+- RRDs stats for SR object [#2644](https://github.com/vatesfr/xen-orchestra/issues/2644)
+- composite jobs [#2367](https://github.com/vatesfr/xen-orchestra/issues/2367)
+- Better error message [#2344](https://github.com/vatesfr/xen-orchestra/issues/2344)
+- Avoid using backup tag with special characters [#2336](https://github.com/vatesfr/xen-orchestra/issues/2336)
+- Prefix/suffix for temporary files [#2333](https://github.com/vatesfr/xen-orchestra/issues/2333)
+- Continuous Replication - better interface matching on destination [#2093](https://github.com/vatesfr/xen-orchestra/issues/2093)
+- Creation of LVMoHBA SRs [#1992](https://github.com/vatesfr/xen-orchestra/issues/1992)
+- [Delta backup] Improve restoration by creating a virtual full VHD [#1943](https://github.com/vatesfr/xen-orchestra/issues/1943)
+- VM Backups should be done in a dedicated remote directory [#1752](https://github.com/vatesfr/xen-orchestra/issues/1752)
+- Add Pool / SR filter in backup view [#1762](https://github.com/vatesfr/xen-orchestra/issues/1762)
+- Hide/Disable upgrade button when no upgrade exists [#1594](https://github.com/vatesfr/xen-orchestra/issues/1594)
+- "Upgrade" button should display "Downgrade" when trial is over [#1483](https://github.com/vatesfr/xen-orchestra/issues/1483)
+
+### Bugs
+
+- Allowed-ips don't works displaying index.js:1 Uncaught TypeError: (0 , z.isIp) is not a function [#2891](https://github.com/vatesfr/xen-orchestra/issues/2891)
+- Error on "usage-report" [#2876](https://github.com/vatesfr/xen-orchestra/issues/2876)
+- SR selection combo only listing local storage [#2875](https://github.com/vatesfr/xen-orchestra/issues/2875)
+- [Backup NG - Delta] Issue while importing delta [#2857](https://github.com/vatesfr/xen-orchestra/issues/2857)
+- Create New SR page broken with past commit [#2853](https://github.com/vatesfr/xen-orchestra/issues/2853)
+- [Backup NG] a target should only be preset once [#2848](https://github.com/vatesfr/xen-orchestra/issues/2848)
+- Auth Method iSCSI [#2835](https://github.com/vatesfr/xen-orchestra/issues/2835)
+- [Backup NG] ENOENT with Delta Backup [#2833](https://github.com/vatesfr/xen-orchestra/issues/2833)
+- Different backup logs [#2732](https://github.com/vatesfr/xen-orchestra/issues/2732)
+- Creating network fails silently when omitting Description [#2719](https://github.com/vatesfr/xen-orchestra/issues/2719)
+- Can't create ISO NFS SR via XOA [#1845](https://github.com/vatesfr/xen-orchestra/issues/1845)
+
+## **5.18.0** (2018-03-31)
+
+### Enhancements
+
+- Support huge VHDs [#2785](https://github.com/vatesfr/xen-orchestra/issues/2785)
+- Usage report extended usage [#2770](https://github.com/vatesfr/xen-orchestra/issues/2770)
+- Improve host available RAM display [#2750](https://github.com/vatesfr/xen-orchestra/issues/2750)
+- Hide IP field during VM creation if not configured [#2739](https://github.com/vatesfr/xen-orchestra/issues/2739)
+- [Home] Delete VMs modal should autofocus the input field [#2736](https://github.com/vatesfr/xen-orchestra/issues/2736)
+- Backup restore view load icon [#2692](https://github.com/vatesfr/xen-orchestra/issues/2692)
+- Deleting default templates doesn't work [#2666](https://github.com/vatesfr/xen-orchestra/issues/2666)
+- DR clean previous "failed" snapshots [#2656](https://github.com/vatesfr/xen-orchestra/issues/2656)
+- [Home] Put sort criteria in URL like the filter [#2585](https://github.com/vatesfr/xen-orchestra/issues/2585)
+- Allow disconnect VDI in SR disk view [#2505](https://github.com/vatesfr/xen-orchestra/issues/2505)
+- Add confirmation modal for manual backup run [#2355](https://github.com/vatesfr/xen-orchestra/issues/2355)
+- Multiple schedule for backup jobs [#2286](https://github.com/vatesfr/xen-orchestra/issues/2286)
+- Checks before web update [#2250](https://github.com/vatesfr/xen-orchestra/issues/2250)
+- Backup logs should truly reflect if the job is running [#2206](https://github.com/vatesfr/xen-orchestra/issues/2206)
+- Hook/action if an export stream is cut [#1929](https://github.com/vatesfr/xen-orchestra/issues/1929)
+- Backup paths should not contain tags but job ids [#1854](https://github.com/vatesfr/xen-orchestra/issues/1854)
+- Add a button to delete a backup [#1751](https://github.com/vatesfr/xen-orchestra/issues/1751)
+- Dashboard available for Pool and Host level  [#1631](https://github.com/vatesfr/xen-orchestra/issues/1631)
+- UI Enhancement - VM list - Allways show the Toolbar  [#1581](https://github.com/vatesfr/xen-orchestra/issues/1581)
+- xoa-updater --register:  unable to define proxy using the CLI [#873](https://github.com/vatesfr/xen-orchestra/issues/873)
+
+
+### Bugs
+
+- [Backup NG] CR/DR fail with multiple VMs [#2807](https://github.com/vatesfr/xen-orchestra/issues/2807)
+- HTTPS Crash [#2803](https://github.com/vatesfr/xen-orchestra/issues/2803)
+- Backup NG "cannot fork the stream after it has been created" [#2790](https://github.com/vatesfr/xen-orchestra/issues/2790)
+- [XOSAN] Make temporary `boundObjectId` unique [#2758](https://github.com/vatesfr/xen-orchestra/issues/2758)
+- First VIF ignored at VM creation [#2794](https://github.com/vatesfr/xen-orchestra/issues/2794)
+- VM creation from snapshot does not work [#2748](https://github.com/vatesfr/xen-orchestra/issues/2748)
+- Error: no such object with CentOS 7 template [#2747](https://github.com/vatesfr/xen-orchestra/issues/2747)
+- [Tasks] Filter does not work [#2740](https://github.com/vatesfr/xen-orchestra/issues/2740)
+- Pagination broken when listing pool VMs [#2730](https://github.com/vatesfr/xen-orchestra/issues/2730)
+- All jobs show error icon with message "This backup's creator no longer exists" [#2728](https://github.com/vatesfr/xen-orchestra/issues/2728)
+- [Basic backup] Continous Replication VM names [#2727](https://github.com/vatesfr/xen-orchestra/issues/2727)
+- Continuous replication clone removed [#2724](https://github.com/vatesfr/xen-orchestra/issues/2724)
+- [Backup] "See matching VMs" issue [#2704](https://github.com/vatesfr/xen-orchestra/issues/2704)
+- How to exclude CR targets from a smart backup using tags? [#2613](https://github.com/vatesfr/xen-orchestra/issues/2613)
+- Successful VM import reported as failed [#2056](https://github.com/vatesfr/xen-orchestra/issues/2056)
+- Delta backup: issue if a disk is once again backed up [#1824](https://github.com/vatesfr/xen-orchestra/issues/1824)
+
 ## **5.17.0** (2018-03-02)
 
 ### Enhancements
 
+- Username field labeled inconsistently [#2651](https://github.com/vatesfr/xen-orchestra/issues/2651)
 - Add modal confirmation for host emergency mode [#2230](https://github.com/vatesfr/xen-orchestra/issues/2230)
 - Authorize stats fetching in RO mode [#2678](https://github.com/vatesfr/xen-orchestra/issues/2678)
 - Limit VM.export concurrency [#2669](https://github.com/vatesfr/xen-orchestra/issues/2669)
@@ -22,6 +117,9 @@
 - Cant attach XenTools on User side.  [#2503](https://github.com/vatesfr/xen-orchestra/issues/2503)
 - Pool filter for health view [#2302](https://github.com/vatesfr/xen-orchestra/issues/2302)
 - [Smart Backup] Improve feedback [#2253](https://github.com/vatesfr/xen-orchestra/issues/2253)
+- Backup jobs stuck if no space left on NFS remote [#2116](https://github.com/vatesfr/xen-orchestra/issues/2116)
+- Link between backup and XS tasks [#1193](https://github.com/vatesfr/xen-orchestra/issues/1193)
+- Move delta backup grouping to server side [#1008](https://github.com/vatesfr/xen-orchestra/issues/1008)
 
 ### Bugs
 
@@ -41,6 +139,7 @@
 - Self-service: allow VIF create [#2593](https://github.com/vatesfr/xen-orchestra/issues/2593)
 - Ghost tasks [#2579](https://github.com/vatesfr/xen-orchestra/issues/2579)
 - Autopatching: ignore 7.3 update patch for 7.2 [#2564](https://github.com/vatesfr/xen-orchestra/issues/2564)
+- Better Handling of suspending VMs from the Home screen [#2547](https://github.com/vatesfr/xen-orchestra/issues/2547)
 - Allow deleting VMs for which `destroy` is blocked [#2525](https://github.com/vatesfr/xen-orchestra/issues/2525)
 - Better confirmation on mass destructive actions [#2522](https://github.com/vatesfr/xen-orchestra/issues/2522)
 - Move VM In to/Out of Self Service Group [#1913](https://github.com/vatesfr/xen-orchestra/issues/1913)
@@ -50,6 +149,8 @@
 - Remove CoffeeScript in xo-server [#189](https://github.com/vatesfr/xen-orchestra/issues/189)
 - Better Handling of suspending VMs from the Home screen [#2547](https://github.com/vatesfr/xen-orchestra/issues/2547)
 - [xen-api] Stronger reconnection policy [#2410](https://github.com/vatesfr/xen-orchestra/issues/2410)
+- home view - allow selecting more than 25 items [#1210](https://github.com/vatesfr/xen-orchestra/issues/1210)
+- Performances alerts [#511](https://github.com/vatesfr/xen-orchestra/issues/511)
 
 ### Bugs
 
@@ -79,6 +180,7 @@
 - Graphs in VM list view [#2469](https://github.com/vatesfr/xen-orchestra/issues/2469)
 - [Delta Backups] Do not include merge duration in transfer speed stat [#2426](https://github.com/vatesfr/xen-orchestra/issues/2426)
 - Warning for disperse mode [#2537](https://github.com/vatesfr/xen-orchestra/issues/2537)
+- Select components: auto select value if only 1 choice possible [#1479](https://github.com/vatesfr/xen-orchestra/issues/1479)
 
 ### Bugs
 

flow-typed/lodash.js

@@ -1,4 +1,12 @@
 declare module 'lodash' {
+  declare export function forEach<K, V>(
+    object: { [K]: V },
+    iteratee: (V, K) => void
+  ): void
+  declare export function groupBy<K, V>(
+    object: { [K]: V },
+    iteratee: K | ((V, K) => string)
+  ): { [string]: V[] }
   declare export function invert<K, V>(object: { [K]: V }): { [V]: K }
   declare export function isEmpty(mixed): boolean
   declare export function keyBy<T>(array: T[], iteratee: string): boolean

flow-typed/promise-toolbox.js

@@ -5,6 +5,9 @@ declare module 'promise-toolbox' {
     reject: T => void,
     resolve: T => void,
   |}
+  declare export function fromCallback<T>(
+    (cb: (error: any, value: T) => void) => void
+  ): Promise<T>
   declare export function fromEvent(emitter: mixed, string): Promise<mixed>
   declare export function ignoreErrors(): Promise<void>
   declare export function timeout<T>(delay: number): Promise<T>

package.json

@@ -34,16 +34,18 @@
     "testEnvironment": "node",
     "testPathIgnorePatterns": [
       "/dist/",
-      "/xo-vmdk-to-vhd/",
       "/xo-web/"
     ],
     "testRegex": "\\.spec\\.js$",
     "transform": {
       "/@xen-orchestra/cron/.+\\.jsx?$": "babel-7-jest",
+      "/@xen-orchestra/fs/.+\\.jsx?$": "babel-7-jest",
       "/packages/complex-matcher/.+\\.jsx?$": "babel-7-jest",
       "/packages/value-matcher/.+\\.jsx?$": "babel-7-jest",
+      "/packages/vhd-lib/.+\\.jsx?$": "babel-7-jest",
       "/packages/xo-cli/.+\\.jsx?$": "babel-7-jest",
       "/packages/xo-server/.+\\.jsx?$": "babel-7-jest",
+      "/packages/xo-vmdk-to-vhd/.+\\.jsx?$": "babel-7-jest",
       "\\.jsx?$": "babel-jest"
     }
   },

packages/vhd-cli/package.json

@@ -1,6 +1,6 @@
 {
   "name": "vhd-cli",
-  "version": "0.0.0",
+  "version": "0.0.1",
   "license": "ISC",
   "description": "",
   "keywords": [],
@@ -26,10 +26,11 @@
     "node": ">=4"
   },
   "dependencies": {
-    "struct-fu": "^1.2.0",
-    "@nraynaud/xo-fs": "^0.0.5",
+    "@xen-orchestra/fs": "^0.0.0",
     "babel-runtime": "^6.22.0",
-    "exec-promise": "^0.7.0"
+    "exec-promise": "^0.7.0",
+    "struct-fu": "^1.2.0",
+    "vhd-lib": "^0.0.0"
   },
   "devDependencies": {
     "babel-cli": "^6.24.1",
@@ -38,14 +39,18 @@
     "babel-preset-env": "^1.5.2",
     "babel-preset-stage-3": "^6.24.1",
     "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "execa": "^0.10.0",
+    "index-modules": "^0.3.0",
+    "promise-toolbox": "^0.9.5",
+    "rimraf": "^2.6.1",
+    "tmp": "^0.0.33"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
-    "prebuild": "rimraf dist/",
+    "prebuild": "rimraf dist/ && index-modules --cjs-lazy src/commands",
     "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build"
+    "prepare": "yarn run build"
   },
   "babel": {
     "plugins": [

packages/vhd-cli/src/commands/check.js

@@ -0,0 +1,15 @@
+import Vhd from 'vhd-lib'
+import { getHandler } from '@xen-orchestra/fs'
+import { resolve } from 'path'
+
+export default async args => {
+  const handler = getHandler({ url: 'file:///' })
+  for (const vhd of args) {
+    try {
+      await new Vhd(handler, resolve(vhd)).readHeaderAndFooter()
+      console.log('ok:', vhd)
+    } catch (error) {
+      console.error('nok:', vhd, error)
+    }
+  }
+}

packages/vhd-cli/src/commands/info.js

@@ -0,0 +1,12 @@
+import Vhd from 'vhd-lib'
+import { getHandler } from '@xen-orchestra/fs'
+import { resolve } from 'path'
+
+export default async args => {
+  const vhd = new Vhd(getHandler({ url: 'file:///' }), resolve(args[0]))
+
+  await vhd.readHeaderAndFooter()
+
+  console.log(vhd.header)
+  console.log(vhd.footer)
+}

packages/vhd-cli/src/commands/synthetize.js

@@ -0,0 +1,21 @@
+import path from 'path'
+import { createSyntheticStream } from 'vhd-lib'
+import { createWriteStream } from 'fs'
+import { getHandler } from '@xen-orchestra/fs'
+
+export default async function main (args) {
+  if (args.length < 2 || args.some(_ => _ === '-h' || _ === '--help')) {
+    return `Usage: ${this.command} <input VHD> <output VHD>`
+  }
+
+  const handler = getHandler({ url: 'file:///' })
+  return new Promise((resolve, reject) => {
+    createSyntheticStream(handler, path.resolve(args[0]))
+      .on('error', reject)
+      .pipe(
+        createWriteStream(args[1])
+          .on('error', reject)
+          .on('finish', resolve)
+      )
+  })
+}

packages/vhd-cli/src/index.js

@@ -1,19 +1,44 @@
 #!/usr/bin/env node
 
 import execPromise from 'exec-promise'
-import { RemoteHandlerLocal } from '@nraynaud/xo-fs'
-import { resolve } from 'path'
 
-import Vhd from './vhd'
+import commands from './commands'
 
-execPromise(async args => {
-  const vhd = new Vhd(
-    new RemoteHandlerLocal({ url: 'file:///' }),
-    resolve(args[0])
+function runCommand (commands, [command, ...args]) {
+  if (command === undefined || command === '-h' || command === '--help') {
+    command = 'help'
+  }
+
+  const fn = commands[command]
+
+  if (fn === undefined) {
+    if (command === 'help') {
+      return `Usage:
+
+${Object.keys(commands)
+        .filter(command => command !== 'help')
+        .map(command => `    ${this.command} ${command}`)
+        .join('\n\n')}`
+    }
+
+    throw `invalid command ${command}` // eslint-disable-line no-throw-literal
+  }
+
+  return fn.call(
+    {
+      __proto__: this,
+      command: `${this.command} ${command}`,
+    },
+    args
   )
+}
 
-  await vhd.readHeaderAndFooter()
-
-  console.log(vhd._header)
-  console.log(vhd._footer)
-})
+execPromise(
+  runCommand.bind(
+    {
+      command: 'vhd-cli',
+      runCommand,
+    },
+    commands
+  )
+)

packages/vhd-cli/src/info.integ.spec.js

@@ -0,0 +1,28 @@
+/* eslint-env jest */
+
+import execa from 'execa'
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+import { fromCallback as pFromCallback } from 'promise-toolbox'
+
+import command from './commands/info'
+
+const initialDir = process.cwd()
+
+jest.setTimeout(10000)
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+test('can run the command', async () => {
+  await execa('qemu-img', ['create', '-fvpc', 'empty.vhd', '1G'])
+  await command(['empty.vhd'])
+})

packages/vhd-cli/src/vhd.js

@@ -1,461 +0,0 @@
-import assert from 'assert'
-import fu from 'struct-fu'
-import { dirname } from 'path'
-
-// ===================================================================
-//
-// Spec:
-// https://www.microsoft.com/en-us/download/details.aspx?id=23850
-//
-// C implementation:
-// https://github.com/rubiojr/vhd-util-convert
-//
-// ===================================================================
-
-/* eslint-disable no-unused-vars */
-
-const HARD_DISK_TYPE_DIFFERENCING = 4
-const HARD_DISK_TYPE_DYNAMIC = 3
-const HARD_DISK_TYPE_FIXED = 2
-const PLATFORM_CODE_NONE = 0
-export const SECTOR_SIZE = 512
-
-/* eslint-enable no-unused vars */
-
-// ===================================================================
-
-const fuFooter = fu.struct([
-  fu.char('cookie', 8), // 0
-  fu.uint32('features'), // 8
-  fu.uint32('fileFormatVersion'), // 12
-  fu.struct('dataOffset', [
-    fu.uint32('high'), // 16
-    fu.uint32('low'), // 20
-  ]),
-  fu.uint32('timestamp'), // 24
-  fu.char('creatorApplication', 4), // 28
-  fu.uint32('creatorVersion'), // 32
-  fu.uint32('creatorHostOs'), // 36
-  fu.struct('originalSize', [
-    // At the creation, current size of the hard disk.
-    fu.uint32('high'), // 40
-    fu.uint32('low'), // 44
-  ]),
-  fu.struct('currentSize', [
-    // Current size of the virtual disk. At the creation: currentSize = originalSize.
-    fu.uint32('high'), // 48
-    fu.uint32('low'), // 52
-  ]),
-  fu.struct('diskGeometry', [
-    fu.uint16('cylinders'), // 56
-    fu.uint8('heads'), // 58
-    fu.uint8('sectorsPerTrackCylinder'), // 59
-  ]),
-  fu.uint32('diskType'), // 60 Disk type, must be equal to HARD_DISK_TYPE_DYNAMIC/HARD_DISK_TYPE_DIFFERENCING.
-  fu.uint32('checksum'), // 64
-  fu.uint8('uuid', 16), // 68
-  fu.char('saved'), // 84
-  fu.char('hidden'), // 85
-  fu.byte('reserved', 426), // 86
-])
-const FOOTER_SIZE = fuFooter.size
-
-const fuHeader = fu.struct([
-  fu.char('cookie', 8),
-  fu.struct('dataOffset', [fu.uint32('high'), fu.uint32('low')]),
-  fu.struct('tableOffset', [
-    // Absolute byte offset of the Block Allocation Table.
-    fu.uint32('high'),
-    fu.uint32('low'),
-  ]),
-  fu.uint32('headerVersion'),
-  fu.uint32('maxTableEntries'), // Max entries in the Block Allocation Table.
-  fu.uint32('blockSize'), // Block size (without bitmap) in bytes.
-  fu.uint32('checksum'),
-  fu.uint8('parentUuid', 16),
-  fu.uint32('parentTimestamp'),
-  fu.byte('reserved1', 4),
-  fu.char16be('parentUnicodeName', 512),
-  fu.struct(
-    'parentLocatorEntry',
-    [
-      fu.uint32('platformCode'),
-      fu.uint32('platformDataSpace'),
-      fu.uint32('platformDataLength'),
-      fu.uint32('reserved'),
-      fu.struct('platformDataOffset', [
-        // Absolute byte offset of the locator data.
-        fu.uint32('high'),
-        fu.uint32('low'),
-      ]),
-    ],
-    8
-  ),
-  fu.byte('reserved2', 256),
-])
-const HEADER_SIZE = fuHeader.size
-
-// ===================================================================
-// Helpers
-// ===================================================================
-
-const SIZE_OF_32_BITS = Math.pow(2, 32)
-const uint32ToUint64 = fu => fu.high * SIZE_OF_32_BITS + fu.low
-
-// Returns a 32 bits integer corresponding to a Vhd version.
-const getVhdVersion = (major, minor) => (major << 16) | (minor & 0x0000ffff)
-
-// bytes[] bit manipulation
-const testBit = (map, bit) => map[bit >> 3] & (1 << (bit & 7))
-const setBit = (map, bit) => {
-  map[bit >> 3] |= 1 << (bit & 7)
-}
-const unsetBit = (map, bit) => {
-  map[bit >> 3] &= ~(1 << (bit & 7))
-}
-
-const addOffsets = (...offsets) =>
-  offsets.reduce(
-    (a, b) =>
-      b == null
-        ? a
-        : typeof b === 'object'
-          ? { bytes: a.bytes + b.bytes, bits: a.bits + b.bits }
-          : { bytes: a.bytes + b, bits: a.bits },
-    { bytes: 0, bits: 0 }
-  )
-
-const pack = (field, value, buf, offset) => {
-  field.pack(value, buf, addOffsets(field.offset, offset))
-}
-
-const unpack = (field, buf, offset) =>
-  field.unpack(buf, addOffsets(field.offset, offset))
-
-// ===================================================================
-
-const streamToNewBuffer = stream =>
-  new Promise((resolve, reject) => {
-    const chunks = []
-    let length = 0
-
-    const onData = chunk => {
-      chunks.push(chunk)
-      length += chunk.length
-    }
-    stream.on('data', onData)
-
-    const clean = () => {
-      stream.removeListener('data', onData)
-      stream.removeListener('end', onEnd)
-      stream.removeListener('error', onError)
-    }
-    const onEnd = () => {
-      resolve(Buffer.concat(chunks, length))
-      clean()
-    }
-    stream.on('end', onEnd)
-    const onError = error => {
-      reject(error)
-      clean()
-    }
-    stream.on('error', onError)
-  })
-
-const streamToExistingBuffer = (
-  stream,
-  buffer,
-  offset = 0,
-  end = buffer.length
-) =>
-  new Promise((resolve, reject) => {
-    assert(offset >= 0)
-    assert(end > offset)
-    assert(end <= buffer.length)
-
-    let i = offset
-
-    const onData = chunk => {
-      const prev = i
-      i += chunk.length
-
-      if (i > end) {
-        return onError(new Error('too much data'))
-      }
-
-      chunk.copy(buffer, prev)
-    }
-    stream.on('data', onData)
-
-    const clean = () => {
-      stream.removeListener('data', onData)
-      stream.removeListener('end', onEnd)
-      stream.removeListener('error', onError)
-    }
-    const onEnd = () => {
-      resolve(i - offset)
-      clean()
-    }
-    stream.on('end', onEnd)
-    const onError = error => {
-      reject(error)
-      clean()
-    }
-    stream.on('error', onError)
-  })
-
-// ===================================================================
-
-// Returns the checksum of a raw struct.
-const computeChecksum = (struct, buf, offset = 0) => {
-  let sum = 0
-
-  // Do not use the stored checksum to compute the new checksum.
-  const checksumField = struct.fields.checksum
-  const checksumOffset = offset + checksumField.offset
-  for (let i = offset, n = checksumOffset; i < n; ++i) {
-    sum += buf[i]
-  }
-  for (
-    let i = checksumOffset + checksumField.size, n = offset + struct.size;
-    i < n;
-    ++i
-  ) {
-    sum += buf[i]
-  }
-
-  return ~sum >>> 0
-}
-
-const verifyChecksum = (struct, buf, offset) =>
-  unpack(struct.fields.checksum, buf, offset) ===
-  computeChecksum(struct, buf, offset)
-
-const getParentLocatorSize = parentLocatorEntry => {
-  const { platformDataSpace } = parentLocatorEntry
-
-  if (platformDataSpace < SECTOR_SIZE) {
-    return platformDataSpace * SECTOR_SIZE
-  }
-
-  return platformDataSpace % SECTOR_SIZE === 0 ? platformDataSpace : 0
-}
-
-// ===================================================================
-
-// Euclidean division, returns the quotient and the remainder of a / b.
-const div = (a, b) => [Math.floor(a / b), a % b]
-
-export default class Vhd {
-  constructor (handler, path) {
-    this._handler = handler
-    this._path = path
-
-    this._blockAllocationTable = null
-    this._blockBitmapSize = null
-    this._footer = null
-    this._header = null
-    this._parent = null
-    this._sectorsPerBlock = null
-  }
-
-  // Read `length` bytes starting from `begin`.
-  //
-  // - if `buffer`: it is filled starting from `offset`, and the
-  //   number of written bytes is returned;
-  // - otherwise: a new buffer is allocated and returned.
-  _read (begin, length, buf, offset) {
-    assert(begin >= 0)
-    assert(length > 0)
-
-    return this._handler
-      .createReadStream(this._path, {
-        end: begin + length - 1,
-        start: begin,
-      })
-      .then(
-        buf
-          ? stream =>
-            streamToExistingBuffer(
-              stream,
-              buf,
-              offset,
-              (offset || 0) + length
-            )
-          : streamToNewBuffer
-      )
-  }
-
-  // - if `buffer`: it is filled with 0 starting from `offset`, and
-  //   the number of written bytes is returned;
-  // - otherwise: a new buffer is allocated and returned.
-  _zeroes (length, buf, offset = 0) {
-    if (buf) {
-      assert(offset >= 0)
-      assert(length > 0)
-
-      const end = offset + length
-      assert(end <= buf.length)
-
-      buf.fill(0, offset, end)
-      return Promise.resolve(length)
-    }
-
-    return Promise.resolve(Buffer.alloc(length))
-  }
-
-  // Return the position of a block in the VHD or undefined if not found.
-  _getBlockAddress (block) {
-    assert(block >= 0)
-    assert(block < this._header.maxTableEntries)
-
-    const blockAddr = this._blockAllocationTable[block]
-    if (blockAddr !== 0xffffffff) {
-      return blockAddr * SECTOR_SIZE
-    }
-  }
-
-  // -----------------------------------------------------------------
-
-  async readHeaderAndFooter () {
-    const buf = await this._read(0, FOOTER_SIZE + HEADER_SIZE)
-
-    if (!verifyChecksum(fuFooter, buf)) {
-      throw new Error('footer checksum does not match')
-    }
-
-    if (!verifyChecksum(fuHeader, buf, FOOTER_SIZE)) {
-      throw new Error('header checksum does not match')
-    }
-
-    return this._initMetadata(
-      unpack(fuHeader, buf, FOOTER_SIZE),
-      unpack(fuFooter, buf)
-    )
-  }
-
-  async _initMetadata (header, footer) {
-    const sectorsPerBlock = header.blockSize / SECTOR_SIZE
-    assert(sectorsPerBlock % 1 === 0)
-
-    // 1 bit per sector, rounded up to full sectors
-    this._blockBitmapSize =
-      Math.ceil(sectorsPerBlock / 8 / SECTOR_SIZE) * SECTOR_SIZE
-    assert(this._blockBitmapSize === SECTOR_SIZE)
-
-    this._footer = footer
-    this._header = header
-    this.size = uint32ToUint64(this._footer.currentSize)
-
-    if (footer.diskType === HARD_DISK_TYPE_DIFFERENCING) {
-      const parent = new Vhd(
-        this._handler,
-        `${dirname(this._path)}/${header.parentUnicodeName}`
-      )
-      await parent.readHeaderAndFooter()
-      await parent.readBlockAllocationTable()
-
-      this._parent = parent
-    }
-  }
-
-  // -----------------------------------------------------------------
-
-  async readBlockAllocationTable () {
-    const { maxTableEntries, tableOffset } = this._header
-    const fuTable = fu.uint32(maxTableEntries)
-
-    this._blockAllocationTable = unpack(
-      fuTable,
-      await this._read(uint32ToUint64(tableOffset), fuTable.size)
-    )
-  }
-
-  // -----------------------------------------------------------------
-
-  // read a single sector in a block
-  async _readBlockSector (block, sector, begin, length, buf, offset) {
-    assert(begin >= 0)
-    assert(length > 0)
-    assert(begin + length <= SECTOR_SIZE)
-
-    const blockAddr = this._getBlockAddress(block)
-    const blockBitmapSize = this._blockBitmapSize
-    const parent = this._parent
-
-    if (
-      blockAddr &&
-      (!parent || testBit(await this._read(blockAddr, blockBitmapSize), sector))
-    ) {
-      return this._read(
-        blockAddr + blockBitmapSize + sector * SECTOR_SIZE + begin,
-        length,
-        buf,
-        offset
-      )
-    }
-
-    return parent
-      ? parent._readBlockSector(block, sector, begin, length, buf, offset)
-      : this._zeroes(length, buf, offset)
-  }
-
-  _readBlock (block, begin, length, buf, offset) {
-    assert(begin >= 0)
-    assert(length > 0)
-
-    const { blockSize } = this._header
-    assert(begin + length <= blockSize)
-
-    const blockAddr = this._getBlockAddress(block)
-    const parent = this._parent
-
-    if (!blockAddr) {
-      return parent
-        ? parent._readBlock(block, begin, length, buf, offset)
-        : this._zeroes(length, buf, offset)
-    }
-
-    if (!parent) {
-      return this._read(
-        blockAddr + this._blockBitmapSize + begin,
-        length,
-        buf,
-        offset
-      )
-    }
-
-    // FIXME: we should read as many sectors in a single pass as
-    // possible for maximum perf.
-    const [sector, beginInSector] = div(begin, SECTOR_SIZE)
-    return this._readBlockSector(
-      block,
-      sector,
-      beginInSector,
-      Math.min(length, SECTOR_SIZE - beginInSector),
-      buf,
-      offset
-    )
-  }
-
-  read (buf, begin, length = buf.length, offset) {
-    assert(Buffer.isBuffer(buf))
-    assert(begin >= 0)
-
-    const { size } = this
-    if (begin >= size) {
-      return Promise.resolve(0)
-    }
-
-    const { blockSize } = this._header
-    const [block, beginInBlock] = div(begin, blockSize)
-
-    return this._readBlock(
-      block,
-      beginInBlock,
-      Math.min(length, blockSize - beginInBlock, size - begin),
-      buf,
-      offset
-    )
-  }
-}

packages/vhd-lib/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

packages/vhd-lib/package.json

@@ -0,0 +1,56 @@
+{
+  "name": "vhd-lib",
+  "version": "0.0.0",
+  "license": "AGPL-3.0",
+  "description": "Primitives for VHD file handling",
+  "keywords": [],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/packages/vhd-lib",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "preferGlobal": true,
+  "main": "dist/",
+  "bin": {},
+  "files": [
+    "dist/"
+  ],
+  "engines": {
+    "node": ">=6"
+  },
+  "dependencies": {
+    "@babel/runtime": "^7.0.0-beta.44",
+    "@xen-orchestra/fs": "^0.0.0",
+    "async-iterator-to-stream": "^1.0.2",
+    "execa": "^0.10.0",
+    "from2": "^2.3.0",
+    "fs-extra": "^5.0.0",
+    "get-stream": "^3.0.0",
+    "limit-concurrency-decorator": "^0.4.0",
+    "promise-toolbox": "^0.9.5",
+    "struct-fu": "^1.2.0",
+    "uuid": "^3.0.1",
+    "tmp": "^0.0.33"
+  },
+  "devDependencies": {
+    "@babel/cli": "7.0.0-beta.44",
+    "@babel/core": "7.0.0-beta.44",
+    "@babel/plugin-transform-runtime": "^7.0.0-beta.44",
+    "@babel/preset-env": "7.0.0-beta.44",
+    "@babel/preset-flow": "7.0.0-beta.44",
+    "babel-plugin-lodash": "^3.3.2",
+    "cross-env": "^5.1.3",
+    "fs-promise": "^2.0.0",
+    "index-modules": "^0.3.0",
+    "rimraf": "^2.6.2"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "clean": "rimraf dist/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "yarn run clean",
+    "predev": "yarn run clean",
+    "prepare": "yarn run build"
+  }
+}

packages/vhd-lib/src/_bitmap.js

@@ -0,0 +1,7 @@
+const MASK = 0x80
+
+export const set = (map, bit) => {
+  map[bit >> 3] |= MASK >> (bit & 7)
+}
+
+export const test = (map, bit) => ((map[bit >> 3] << (bit & 7)) & MASK) !== 0

packages/vhd-lib/src/_computeGeometryForSize.js

@@ -0,0 +1,37 @@
+import { SECTOR_SIZE } from './_constants'
+
+export default function computeGeometryForSize (size) {
+  const totalSectors = Math.ceil(size / 512)
+  let sectorsPerTrackCylinder
+  let heads
+  let cylinderTimesHeads
+  if (totalSectors > 65535 * 16 * 255) {
+    throw Error('disk is too big')
+  }
+  // straight copypasta from the file spec appendix on CHS Calculation
+  if (totalSectors >= 65535 * 16 * 63) {
+    sectorsPerTrackCylinder = 255
+    heads = 16
+    cylinderTimesHeads = totalSectors / sectorsPerTrackCylinder
+  } else {
+    sectorsPerTrackCylinder = 17
+    cylinderTimesHeads = totalSectors / sectorsPerTrackCylinder
+    heads = Math.floor((cylinderTimesHeads + 1023) / 1024)
+    if (heads < 4) {
+      heads = 4
+    }
+    if (cylinderTimesHeads >= heads * 1024 || heads > 16) {
+      sectorsPerTrackCylinder = 31
+      heads = 16
+      cylinderTimesHeads = totalSectors / sectorsPerTrackCylinder
+    }
+    if (cylinderTimesHeads >= heads * 1024) {
+      sectorsPerTrackCylinder = 63
+      heads = 16
+      cylinderTimesHeads = totalSectors / sectorsPerTrackCylinder
+    }
+  }
+  const cylinders = Math.ceil(cylinderTimesHeads / heads)
+  const actualSize = cylinders * heads * sectorsPerTrackCylinder * SECTOR_SIZE
+  return { cylinders, heads, sectorsPerTrackCylinder, actualSize }
+}

packages/vhd-lib/src/_constants.js

@@ -0,0 +1,30 @@
+export const BLOCK_UNUSED = 0xffffffff
+
+// This lib has been extracted from the Xen Orchestra project.
+export const CREATOR_APPLICATION = 'xo  '
+
+// Sizes in bytes.
+export const FOOTER_SIZE = 512
+export const HEADER_SIZE = 1024
+export const SECTOR_SIZE = 512
+export const DEFAULT_BLOCK_SIZE = 0x00200000 // from the spec
+
+export const FOOTER_COOKIE = 'conectix'
+export const HEADER_COOKIE = 'cxsparse'
+
+export const DISK_TYPE_FIXED = 2
+export const DISK_TYPE_DYNAMIC = 3
+export const DISK_TYPE_DIFFERENCING = 4
+
+export const PARENT_LOCATOR_ENTRIES = 8
+
+export const PLATFORM_NONE = 0
+export const PLATFORM_WI2R = 0x57693272
+export const PLATFORM_WI2K = 0x5769326b
+export const PLATFORM_W2RU = 0x57327275
+export const PLATFORM_W2KU = 0x57326b75
+export const PLATFORM_MAC = 0x4d616320
+export const PLATFORM_MACX = 0x4d616358
+
+export const FILE_FORMAT_VERSION = 1 << 16
+export const HEADER_VERSION = 1 << 16

packages/vhd-lib/src/_createFooterHeader.js

@@ -0,0 +1,56 @@
+import { v4 as generateUuid } from 'uuid'
+
+import { checksumStruct, fuFooter, fuHeader } from './_structs'
+import {
+  CREATOR_APPLICATION,
+  DEFAULT_BLOCK_SIZE as VHD_BLOCK_SIZE_BYTES,
+  DISK_TYPE_FIXED,
+  FILE_FORMAT_VERSION,
+  FOOTER_COOKIE,
+  FOOTER_SIZE,
+  HEADER_COOKIE,
+  HEADER_SIZE,
+  HEADER_VERSION,
+  PLATFORM_WI2K,
+} from './_constants'
+
+export function createFooter (
+  size,
+  timestamp,
+  geometry,
+  dataOffset,
+  diskType = DISK_TYPE_FIXED
+) {
+  const footer = fuFooter.pack({
+    cookie: FOOTER_COOKIE,
+    features: 2,
+    fileFormatVersion: FILE_FORMAT_VERSION,
+    dataOffset,
+    timestamp,
+    creatorApplication: CREATOR_APPLICATION,
+    creatorHostOs: PLATFORM_WI2K, // it looks like everybody is using Wi2k
+    originalSize: size,
+    currentSize: size,
+    diskGeometry: geometry,
+    diskType,
+    uuid: generateUuid(null, []),
+  })
+  checksumStruct(footer, fuFooter)
+  return footer
+}
+
+export function createHeader (
+  maxTableEntries,
+  tableOffset = HEADER_SIZE + FOOTER_SIZE,
+  blockSize = VHD_BLOCK_SIZE_BYTES
+) {
+  const header = fuHeader.pack({
+    cookie: HEADER_COOKIE,
+    tableOffset,
+    headerVersion: HEADER_VERSION,
+    maxTableEntries,
+    blockSize,
+  })
+  checksumStruct(header, fuHeader)
+  return header
+}

packages/vhd-lib/src/_structs.js

@@ -0,0 +1,121 @@
+import assert from 'assert'
+import fu from 'struct-fu'
+
+import { FOOTER_SIZE, HEADER_SIZE, PARENT_LOCATOR_ENTRIES } from './_constants'
+
+const SIZE_OF_32_BITS = Math.pow(2, 32)
+
+const uint64 = fu.derive(
+  fu.uint32(2),
+  number => [Math.floor(number / SIZE_OF_32_BITS), number % SIZE_OF_32_BITS],
+  _ => _[0] * SIZE_OF_32_BITS + _[1]
+)
+const uint64Undefinable = fu.derive(
+  fu.uint32(2),
+  number =>
+    number === undefined
+      ? [0xffffffff, 0xffffffff]
+      : [Math.floor(number / SIZE_OF_32_BITS), number % SIZE_OF_32_BITS],
+  _ =>
+    _[0] === 0xffffffff && _[1] === 0xffffffff
+      ? undefined
+      : _[0] * SIZE_OF_32_BITS + _[1]
+)
+
+export const fuFooter = fu.struct([
+  fu.char('cookie', 8), // 0
+  fu.uint32('features'), // 8
+  fu.uint32('fileFormatVersion'), // 12
+  uint64Undefinable('dataOffset'), // offset of the header
+  fu.uint32('timestamp'), // 24
+  fu.char('creatorApplication', 4), // 28
+  fu.uint32('creatorVersion'), // 32
+  fu.uint32('creatorHostOs'), // 36
+  uint64('originalSize'),
+  uint64('currentSize'),
+  fu.struct('diskGeometry', [
+    fu.uint16('cylinders'), // 56
+    fu.uint8('heads'), // 58
+    fu.uint8('sectorsPerTrackCylinder'), // 59
+  ]),
+  fu.uint32('diskType'), // 60 Disk type, must be equal to HARD_DISK_TYPE_DYNAMIC/HARD_DISK_TYPE_DIFFERENCING.
+  fu.uint32('checksum'), // 64
+  fu.uint8('uuid', 16), // 68
+  fu.char('saved'), // 84
+  fu.char('hidden'), // 85 TODO: should probably be merged in reserved
+  fu.char('reserved', 426), // 86
+])
+assert.strictEqual(fuFooter.size, FOOTER_SIZE)
+
+export const fuHeader = fu.struct([
+  fu.char('cookie', 8),
+  uint64Undefinable('dataOffset'),
+  uint64('tableOffset'),
+  fu.uint32('headerVersion'),
+  fu.uint32('maxTableEntries'), // Max entries in the Block Allocation Table.
+  fu.uint32('blockSize'), // Block size in bytes. Default (2097152 => 2MB)
+  fu.uint32('checksum'),
+  fu.uint8('parentUuid', 16),
+  fu.uint32('parentTimestamp'),
+  fu.uint32('reserved1'),
+  fu.char16be('parentUnicodeName', 512),
+  fu.struct(
+    'parentLocatorEntry',
+    [
+      fu.uint32('platformCode'),
+      fu.uint32('platformDataSpace'),
+      fu.uint32('platformDataLength'),
+      fu.uint32('reserved'),
+      uint64('platformDataOffset'), // Absolute byte offset of the locator data.
+    ],
+    PARENT_LOCATOR_ENTRIES
+  ),
+  fu.char('reserved2', 256),
+])
+assert.strictEqual(fuHeader.size, HEADER_SIZE)
+
+export const packField = (field, value, buf) => {
+  const { offset } = field
+
+  field.pack(
+    value,
+    buf,
+    typeof offset !== 'object' ? { bytes: offset, bits: 0 } : offset
+  )
+}
+
+export const unpackField = (field, buf) => {
+  const { offset } = field
+
+  return field.unpack(
+    buf,
+    typeof offset !== 'object' ? { bytes: offset, bits: 0 } : offset
+  )
+}
+
+// Returns the checksum of a raw struct.
+// The raw struct (footer or header) is altered with the new sum.
+export function checksumStruct (buf, struct) {
+  const checksumField = struct.fields.checksum
+  let sum = 0
+
+  // Do not use the stored checksum to compute the new checksum.
+  const checksumOffset = checksumField.offset
+  for (let i = 0, n = checksumOffset; i < n; ++i) {
+    sum += buf[i]
+  }
+  for (
+    let i = checksumOffset + checksumField.size, n = struct.size;
+    i < n;
+    ++i
+  ) {
+    sum += buf[i]
+  }
+
+  sum = ~sum >>> 0
+
+  // Write new sum.
+  packField(checksumField, sum, buf)
+
+  return sum
+}

packages/vhd-lib/src/chain.js

@@ -0,0 +1,37 @@
+import { dirname, relative } from 'path'
+
+import Vhd from './vhd'
+import { DISK_TYPE_DIFFERENCING } from './_constants'
+
+export default async function chain (
+  parentHandler,
+  parentPath,
+  childHandler,
+  childPath,
+  force = false
+) {
+  const parentVhd = new Vhd(parentHandler, parentPath)
+  const childVhd = new Vhd(childHandler, childPath)
+
+  await childVhd.readHeaderAndFooter()
+  const { header, footer } = childVhd
+
+  if (footer.diskType !== DISK_TYPE_DIFFERENCING) {
+    if (!force) {
+      throw new Error('cannot chain disk of type ' + footer.diskType)
+    }
+    footer.diskType = DISK_TYPE_DIFFERENCING
+  }
+
+  await Promise.all([
+    childVhd.readBlockAllocationTable(),
+    parentVhd.readHeaderAndFooter(),
+  ])
+
+  const parentName = relative(dirname(childPath), parentPath)
+  header.parentUuid = parentVhd.footer.uuid
+  header.parentUnicodeName = parentName
+  await childVhd.setUniqueParentLocator(parentName)
+  await childVhd.writeHeader()
+  await childVhd.writeFooter()
+}

packages/vhd-lib/src/createReadableRawStream.js

@@ -0,0 +1,42 @@
+import asyncIteratorToStream from 'async-iterator-to-stream'
+
+import computeGeometryForSize from './_computeGeometryForSize'
+import { createFooter } from './_createFooterHeader'
+
+export default asyncIteratorToStream(async function * (size, blockParser) {
+  const geometry = computeGeometryForSize(size)
+  const actualSize = geometry.actualSize
+  const footer = createFooter(
+    actualSize,
+    Math.floor(Date.now() / 1000),
+    geometry
+  )
+  let position = 0
+
+  function * filePadding (paddingLength) {
+    if (paddingLength > 0) {
+      const chunkSize = 1024 * 1024 // 1Mo
+      for (
+        let paddingPosition = 0;
+        paddingPosition + chunkSize < paddingLength;
+        paddingPosition += chunkSize
+      ) {
+        yield Buffer.alloc(chunkSize)
+      }
+      yield Buffer.alloc(paddingLength % chunkSize)
+    }
+  }
+
+  let next
+  while ((next = await blockParser.next()) !== null) {
+    const paddingLength = next.offsetBytes - position
+    if (paddingLength < 0) {
+      throw new Error('Received out of order blocks')
+    }
+    yield * filePadding(paddingLength)
+    yield next.data
+    position = next.offsetBytes + next.data.length
+  }
+  yield * filePadding(actualSize - position)
+  yield footer
+})

packages/vhd-lib/src/createReadableSparseStream.js

@@ -0,0 +1,143 @@
+import asyncIteratorToStream from 'async-iterator-to-stream'
+
+import computeGeometryForSize from './_computeGeometryForSize'
+import { createFooter, createHeader } from './_createFooterHeader'
+import {
+  BLOCK_UNUSED,
+  DEFAULT_BLOCK_SIZE as VHD_BLOCK_SIZE_BYTES,
+  DISK_TYPE_DYNAMIC,
+  FOOTER_SIZE,
+  HEADER_SIZE,
+  SECTOR_SIZE,
+} from './_constants'
+
+import { set as setBitmap } from './_bitmap'
+
+const VHD_BLOCK_SIZE_SECTORS = VHD_BLOCK_SIZE_BYTES / SECTOR_SIZE
+
+/**
+ * @returns {Array} an array of occupation bitmap, each bit mapping an input block size of bytes
+ */
+function createBAT (
+  firstBlockPosition,
+  blockAddressList,
+  ratio,
+  bat,
+  bitmapSize
+) {
+  const vhdOccupationTable = []
+  let currentVhdPositionSector = firstBlockPosition / SECTOR_SIZE
+  blockAddressList.forEach(blockPosition => {
+    const scaled = blockPosition / VHD_BLOCK_SIZE_BYTES
+    const vhdTableIndex = Math.floor(scaled)
+    if (bat.readUInt32BE(vhdTableIndex * 4) === BLOCK_UNUSED) {
+      bat.writeUInt32BE(currentVhdPositionSector, vhdTableIndex * 4)
+      currentVhdPositionSector +=
+        (bitmapSize + VHD_BLOCK_SIZE_BYTES) / SECTOR_SIZE
+    }
+    // not using bit operators to avoid the int32 coercion, that way we can go to 53 bits
+    vhdOccupationTable[vhdTableIndex] =
+      (vhdOccupationTable[vhdTableIndex] || 0) +
+      Math.pow(2, (scaled % 1) * ratio)
+  })
+  return vhdOccupationTable
+}
+
+function createBitmap (bitmapSize, ratio, vhdOccupationBucket) {
+  const bitmap = Buffer.alloc(bitmapSize)
+  for (let i = 0; i < VHD_BLOCK_SIZE_SECTORS / ratio; i++) {
+    // do not shift to avoid int32 coercion
+    if ((vhdOccupationBucket * Math.pow(2, -i)) & 1) {
+      for (let j = 0; j < ratio; j++) {
+        setBitmap(bitmap, i * ratio + j)
+      }
+    }
+  }
+  return bitmap
+}
+
+function * yieldIfNotEmpty (buffer) {
+  if (buffer.length > 0) {
+    yield buffer
+  }
+}
+
+async function * generateFileContent (
+  blockIterator,
+  bitmapSize,
+  ratio,
+  vhdOccupationTable
+) {
+  let currentVhdBlockIndex = -1
+  let currentBlockBuffer = Buffer.alloc(0)
+  for await (const next of blockIterator) {
+    const batEntry = Math.floor(next.offsetBytes / VHD_BLOCK_SIZE_BYTES)
+    if (batEntry !== currentVhdBlockIndex) {
+      yield * yieldIfNotEmpty(currentBlockBuffer)
+      currentBlockBuffer = Buffer.alloc(VHD_BLOCK_SIZE_BYTES)
+      currentVhdBlockIndex = batEntry
+      yield createBitmap(bitmapSize, ratio, vhdOccupationTable[batEntry])
+    }
+    next.data.copy(currentBlockBuffer, next.offsetBytes % VHD_BLOCK_SIZE_BYTES)
+  }
+  yield * yieldIfNotEmpty(currentBlockBuffer)
+}
+
+export default asyncIteratorToStream(async function * (
+  diskSize,
+  incomingBlockSize,
+  blockAddressList,
+  blockIterator
+) {
+  const ratio = VHD_BLOCK_SIZE_BYTES / incomingBlockSize
+  if (ratio % 1 !== 0) {
+    throw new Error(
+      `Can't import file, grain size (${incomingBlockSize}) is not a divider of VHD block size ${VHD_BLOCK_SIZE_BYTES}`
+    )
+  }
+  if (ratio > 53) {
+    throw new Error(
+      `Can't import file, grain size / block size ratio is > 53 (${ratio})`
+    )
+  }
+
+  const maxTableEntries = Math.ceil(diskSize / VHD_BLOCK_SIZE_BYTES) + 1
+  const tablePhysicalSizeBytes = Math.ceil(maxTableEntries * 4 / 512) * 512
+
+  const batPosition = FOOTER_SIZE + HEADER_SIZE
+  const firstBlockPosition = batPosition + tablePhysicalSizeBytes
+  const geometry = computeGeometryForSize(diskSize)
+  const actualSize = geometry.actualSize
+  const footer = createFooter(
+    actualSize,
+    Math.floor(Date.now() / 1000),
+    geometry,
+    FOOTER_SIZE,
+    DISK_TYPE_DYNAMIC
+  )
+  const header = createHeader(
+    maxTableEntries,
+    batPosition,
+    VHD_BLOCK_SIZE_BYTES
+  )
+  const bitmapSize =
+    Math.ceil(VHD_BLOCK_SIZE_SECTORS / 8 / SECTOR_SIZE) * SECTOR_SIZE
+  const bat = Buffer.alloc(tablePhysicalSizeBytes, 0xff)
+  const vhdOccupationTable = createBAT(
+    firstBlockPosition,
+    blockAddressList,
+    ratio,
+    bat,
+    bitmapSize
+  )
+  yield footer
+  yield header
+  yield bat
+  yield * generateFileContent(
+    blockIterator,
+    bitmapSize,
+    ratio,
+    vhdOccupationTable
+  )
+  yield footer
+})

packages/vhd-lib/src/createSyntheticStream.js

@@ -0,0 +1,153 @@
+import asyncIteratorToStream from 'async-iterator-to-stream'
+import { dirname, resolve } from 'path'
+
+import Vhd from './vhd'
+import {
+  BLOCK_UNUSED,
+  DISK_TYPE_DYNAMIC,
+  FOOTER_SIZE,
+  HEADER_SIZE,
+  SECTOR_SIZE,
+} from './_constants'
+import { fuFooter, fuHeader, checksumStruct } from './_structs'
+import { test as mapTestBit } from './_bitmap'
+
+const resolveRelativeFromFile = (file, path) =>
+  resolve('/', dirname(file), path).slice(1)
+
+export default asyncIteratorToStream(function * (handler, path) {
+  const fds = []
+
+  try {
+    const vhds = []
+    while (true) {
+      const fd = yield handler.openFile(path, 'r')
+      fds.push(fd)
+      const vhd = new Vhd(handler, fd)
+      vhds.push(vhd)
+      yield vhd.readHeaderAndFooter()
+      yield vhd.readBlockAllocationTable()
+
+      if (vhd.footer.diskType === DISK_TYPE_DYNAMIC) {
+        break
+      }
+
+      path = resolveRelativeFromFile(path, vhd.header.parentUnicodeName)
+    }
+    const nVhds = vhds.length
+
+    // this the VHD we want to synthetize
+    const vhd = vhds[0]
+
+    // this is the root VHD
+    const rootVhd = vhds[nVhds - 1]
+
+    // data of our synthetic VHD
+    // TODO: set parentLocatorEntry-s in header
+    let header = {
+      ...vhd.header,
+      tableOffset: FOOTER_SIZE + HEADER_SIZE,
+      parentTimestamp: rootVhd.header.parentTimestamp,
+      parentUnicodeName: rootVhd.header.parentUnicodeName,
+      parentUuid: rootVhd.header.parentUuid,
+    }
+
+    const bat = Buffer.allocUnsafe(vhd.batSize)
+    let footer = {
+      ...vhd.footer,
+      dataOffset: FOOTER_SIZE,
+      diskType: rootVhd.footer.diskType,
+    }
+    const sectorsPerBlockData = vhd.sectorsPerBlock
+    const sectorsPerBlock = sectorsPerBlockData + vhd.bitmapSize / SECTOR_SIZE
+
+    const nBlocks = Math.ceil(footer.currentSize / header.blockSize)
+
+    const blocksOwner = new Array(nBlocks)
+    for (
+      let iBlock = 0,
+        blockOffset = Math.ceil(
+          (header.tableOffset + bat.length) / SECTOR_SIZE
+        );
+      iBlock < nBlocks;
+      ++iBlock
+    ) {
+      let blockSector = BLOCK_UNUSED
+      for (let i = 0; i < nVhds; ++i) {
+        if (vhds[i].containsBlock(iBlock)) {
+          blocksOwner[iBlock] = i
+          blockSector = blockOffset
+          blockOffset += sectorsPerBlock
+          break
+        }
+      }
+      bat.writeUInt32BE(blockSector, iBlock * 4)
+    }
+
+    footer = fuFooter.pack(footer)
+    checksumStruct(footer, fuFooter)
+    yield footer
+
+    header = fuHeader.pack(header)
+    checksumStruct(header, fuHeader)
+    yield header
+
+    yield bat
+
+    // TODO: for generic usage the bitmap needs to be properly computed for each block
+    const bitmap = Buffer.alloc(vhd.bitmapSize, 0xff)
+    for (let iBlock = 0; iBlock < nBlocks; ++iBlock) {
+      const owner = blocksOwner[iBlock]
+      if (owner === undefined) {
+        continue
+      }
+
+      yield bitmap
+
+      const blocksByVhd = new Map()
+      const emitBlockSectors = function * (iVhd, i, n) {
+        const vhd = vhds[iVhd]
+        const isRootVhd = vhd === rootVhd
+        if (!vhd.containsBlock(iBlock)) {
+          if (isRootVhd) {
+            yield Buffer.alloc((n - i) * SECTOR_SIZE)
+          } else {
+            yield * emitBlockSectors(iVhd + 1, i, n)
+          }
+          return
+        }
+        let block = blocksByVhd.get(vhd)
+        if (block === undefined) {
+          block = yield vhd._readBlock(iBlock)
+          blocksByVhd.set(vhd, block)
+        }
+        const { bitmap, data } = block
+        if (isRootVhd) {
+          yield data.slice(i * SECTOR_SIZE, n * SECTOR_SIZE)
+          return
+        }
+        while (i < n) {
+          const hasData = mapTestBit(bitmap, i)
+          const start = i
+          do {
+            ++i
+          } while (i < n && mapTestBit(bitmap, i) === hasData)
+          if (hasData) {
+            yield data.slice(start * SECTOR_SIZE, i * SECTOR_SIZE)
+          } else {
+            yield * emitBlockSectors(iVhd + 1, start, i)
+          }
+        }
+      }
+      yield * emitBlockSectors(owner, 0, sectorsPerBlockData)
+    }
+
+    yield footer
+  } finally {
+    for (let i = 0, n = fds.length; i < n; ++i) {
+      handler.closeFile(fds[i]).catch(error => {
+        console.warn('createReadStream, closeFd', i, error)
+      })
+    }
+  }
+})

packages/vhd-lib/src/index.js

@@ -0,0 +1,8 @@
+export { default } from './vhd'
+export { default as chainVhd } from './chain'
+export { default as createReadableRawStream } from './createReadableRawStream'
+export {
+  default as createReadableSparseStream,
+} from './createReadableSparseStream'
+export { default as createSyntheticStream } from './createSyntheticStream'
+export { default as mergeVhd } from './merge'

packages/vhd-lib/src/merge.integ.spec.js

@@ -2,25 +2,25 @@
 
 import execa from 'execa'
 import fs from 'fs-extra'
+import getStream from 'get-stream'
 import rimraf from 'rimraf'
+import tmp from 'tmp'
+import { getHandler } from '@xen-orchestra/fs'
 import { randomBytes } from 'crypto'
-import { fromEvent } from 'promise-toolbox'
+import { fromEvent, fromCallback as pFromCallback } from 'promise-toolbox'
 
-import LocalHandler from './remote-handlers/local'
-import vhdMerge, {
-  chainVhd,
-  createReadStream,
-  Vhd,
-  VHD_SECTOR_SIZE,
-} from './vhd-merge'
-import { pFromCallback, streamToBuffer, tmpDir } from './utils'
+import chainVhd from './chain'
+import createReadStream from './createSyntheticStream'
+import Vhd from './vhd'
+import vhdMerge from './merge'
+import { SECTOR_SIZE } from './_constants'
 
 const initialDir = process.cwd()
 
 jest.setTimeout(60000)
 
 beforeEach(async () => {
-  const dir = await tmpDir()
+  const dir = await pFromCallback(cb => tmp.dir(cb))
   process.chdir(dir)
 })
 
@@ -57,11 +57,11 @@ test('blocks can be moved', async () => {
   const initalSize = 4
   await createRandomFile('randomfile', initalSize)
   await convertFromRawToVhd('randomfile', 'randomfile.vhd')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler.getSize('randomfile')
   const newVhd = new Vhd(handler, 'randomfile.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   await newVhd._freeFirstBlockSpace(8000000)
   await recoverRawContent('randomfile.vhd', 'recovered', originalSize)
   expect(await fs.readFile('recovered')).toEqual(
@@ -70,20 +70,18 @@ test('blocks can be moved', async () => {
 })
 
 test('the BAT MSB is not used for sign', async () => {
-  const randomBuffer = await pFromCallback(cb =>
-    randomBytes(VHD_SECTOR_SIZE, cb)
-  )
+  const randomBuffer = await pFromCallback(cb => randomBytes(SECTOR_SIZE, cb))
   await execa('qemu-img', ['create', '-fvpc', 'empty.vhd', '1.8T'])
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const vhd = new Vhd(handler, 'empty.vhd')
   await vhd.readHeaderAndFooter()
-  await vhd.readBlockTable()
+  await vhd.readBlockAllocationTable()
   // we want the bit 31 to be on, to prove it's not been used for sign
   const hugeWritePositionSectors = Math.pow(2, 31) + 200
   await vhd.writeData(hugeWritePositionSectors, randomBuffer)
   await checkFile('empty.vhd')
   // here we are moving the first sector very far in the VHD to prove the BAT doesn't use signed int32
-  const hugePositionBytes = hugeWritePositionSectors * VHD_SECTOR_SIZE
+  const hugePositionBytes = hugeWritePositionSectors * SECTOR_SIZE
   await vhd._freeFirstBlockSpace(hugePositionBytes)
 
   // we recover the data manually for speed reasons.
@@ -93,7 +91,7 @@ test('the BAT MSB is not used for sign', async () => {
   try {
     const vhd2 = new Vhd(handler, 'empty.vhd')
     await vhd2.readHeaderAndFooter()
-    await vhd2.readBlockTable()
+    await vhd2.readBlockAllocationTable()
     for (let i = 0; i < vhd.header.maxTableEntries; i++) {
       const entry = vhd._getBatEntry(i)
       if (entry !== 0xffffffff) {
@@ -110,7 +108,7 @@ test('the BAT MSB is not used for sign', async () => {
   } finally {
     fs.close(recoveredFile)
   }
-  const recovered = await streamToBuffer(
+  const recovered = await getStream.buffer(
     await fs.createReadStream('recovered', {
       start: hugePositionBytes,
       end: hugePositionBytes + randomBuffer.length - 1,
@@ -124,11 +122,11 @@ test('writeData on empty file', async () => {
   await createRandomFile('randomfile', mbOfRandom)
   await execa('qemu-img', ['create', '-fvpc', 'empty.vhd', mbOfRandom + 'M'])
   const randomData = await fs.readFile('randomfile')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler.getSize('randomfile')
   const newVhd = new Vhd(handler, 'empty.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   await newVhd.writeData(0, randomData)
   await recoverRawContent('empty.vhd', 'recovered', originalSize)
   expect(await fs.readFile('recovered')).toEqual(randomData)
@@ -139,11 +137,11 @@ test('writeData in 2 non-overlaping operations', async () => {
   await createRandomFile('randomfile', mbOfRandom)
   await execa('qemu-img', ['create', '-fvpc', 'empty.vhd', mbOfRandom + 'M'])
   const randomData = await fs.readFile('randomfile')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler.getSize('randomfile')
   const newVhd = new Vhd(handler, 'empty.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   const splitPointSectors = 2
   await newVhd.writeData(0, randomData.slice(0, splitPointSectors * 512))
   await newVhd.writeData(
@@ -159,11 +157,11 @@ test('writeData in 2 overlaping operations', async () => {
   await createRandomFile('randomfile', mbOfRandom)
   await execa('qemu-img', ['create', '-fvpc', 'empty.vhd', mbOfRandom + 'M'])
   const randomData = await fs.readFile('randomfile')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler.getSize('randomfile')
   const newVhd = new Vhd(handler, 'empty.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   const endFirstWrite = 3
   const startSecondWrite = 2
   await newVhd.writeData(0, randomData.slice(0, endFirstWrite * 512))
@@ -179,11 +177,11 @@ test('BAT can be extended and blocks moved', async () => {
   const initalSize = 4
   await createRandomFile('randomfile', initalSize)
   await convertFromRawToVhd('randomfile', 'randomfile.vhd')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler.getSize('randomfile')
   const newVhd = new Vhd(handler, 'randomfile.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   await newVhd.ensureBatSize(2000)
   await recoverRawContent('randomfile.vhd', 'recovered', originalSize)
   expect(await fs.readFile('recovered')).toEqual(
@@ -203,7 +201,7 @@ test('coalesce works with empty parent files', async () => {
   ])
   await checkFile('randomfile.vhd')
   await checkFile('empty.vhd')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const originalSize = await handler._getSize('randomfile')
   await chainVhd(handler, 'empty.vhd', handler, 'randomfile.vhd', true)
   await checkFile('randomfile.vhd')
@@ -226,11 +224,11 @@ test('coalesce works in normal cases', async () => {
     mbOfRandom + 1 + 'M',
   ])
   await convertFromRawToVhd('randomfile', 'child1.vhd')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   await execa('vhd-util', ['snapshot', '-n', 'child2.vhd', '-p', 'child1.vhd'])
   const vhd = new Vhd(handler, 'child2.vhd')
   await vhd.readHeaderAndFooter()
-  await vhd.readBlockTable()
+  await vhd.readBlockAllocationTable()
   vhd.footer.creatorApplication = 'xoa'
   await vhd.writeFooter()
 
@@ -242,7 +240,7 @@ test('coalesce works in normal cases', async () => {
   const smallRandom = await fs.readFile('small_randomfile')
   const newVhd = new Vhd(handler, 'child2.vhd')
   await newVhd.readHeaderAndFooter()
-  await newVhd.readBlockTable()
+  await newVhd.readBlockAllocationTable()
   await newVhd.writeData(5, smallRandom)
   await checkFile('child2.vhd')
   await checkFile('child1.vhd')
@@ -261,7 +259,7 @@ test('coalesce works in normal cases', async () => {
   await execa('cp', ['randomfile', 'randomfile2'])
   const fd = await fs.open('randomfile2', 'r+')
   try {
-    await fs.write(fd, smallRandom, 0, smallRandom.length, 5 * VHD_SECTOR_SIZE)
+    await fs.write(fd, smallRandom, 0, smallRandom.length, 5 * SECTOR_SIZE)
   } finally {
     await fs.close(fd)
   }
@@ -270,15 +268,16 @@ test('coalesce works in normal cases', async () => {
   )
 })
 
-test('createReadStream passes vhd-util check', async () => {
+test('createSyntheticStream passes vhd-util check', async () => {
   const initalSize = 4
   await createRandomFile('randomfile', initalSize)
   await convertFromRawToVhd('randomfile', 'randomfile.vhd')
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
+  const handler = getHandler({ url: 'file://' + process.cwd() })
   const stream = createReadStream(handler, 'randomfile.vhd')
   await fromEvent(
     stream.pipe(await fs.createWriteStream('recovered.vhd')),
     'finish'
   )
   await checkFile('recovered.vhd')
+  await execa('qemu-img', ['compare', 'recovered.vhd', 'randomfile'])
 })

packages/vhd-lib/src/merge.js

@@ -0,0 +1,77 @@
+// TODO: remove once completely merged in vhd.js
+
+import assert from 'assert'
+import concurrency from 'limit-concurrency-decorator'
+
+import Vhd from './vhd'
+import { DISK_TYPE_DIFFERENCING, DISK_TYPE_DYNAMIC } from './_constants'
+
+// Merge vhd child into vhd parent.
+export default concurrency(2)(async function merge (
+  parentHandler,
+  parentPath,
+  childHandler,
+  childPath
+) {
+  const parentFd = await parentHandler.openFile(parentPath, 'r+')
+  try {
+    const parentVhd = new Vhd(parentHandler, parentFd)
+    const childFd = await childHandler.openFile(childPath, 'r')
+    try {
+      const childVhd = new Vhd(childHandler, childFd)
+
+      // Reading footer and header.
+      await Promise.all([
+        parentVhd.readHeaderAndFooter(),
+        childVhd.readHeaderAndFooter(),
+      ])
+
+      assert(childVhd.header.blockSize === parentVhd.header.blockSize)
+
+      const parentDiskType = parentVhd.footer.diskType
+      assert(
+        parentDiskType === DISK_TYPE_DIFFERENCING ||
+          parentDiskType === DISK_TYPE_DYNAMIC
+      )
+      assert.strictEqual(childVhd.footer.diskType, DISK_TYPE_DIFFERENCING)
+
+      // Read allocation table of child/parent.
+      await Promise.all([
+        parentVhd.readBlockAllocationTable(),
+        childVhd.readBlockAllocationTable(),
+      ])
+
+      await parentVhd.ensureBatSize(childVhd.header.maxTableEntries)
+
+      let mergedDataSize = 0
+      for (
+        let blockId = 0;
+        blockId < childVhd.header.maxTableEntries;
+        blockId++
+      ) {
+        if (childVhd.containsBlock(blockId)) {
+          mergedDataSize += await parentVhd.coalesceBlock(childVhd, blockId)
+        }
+      }
+
+      const cFooter = childVhd.footer
+      const pFooter = parentVhd.footer
+
+      pFooter.currentSize = cFooter.currentSize
+      pFooter.diskGeometry = { ...cFooter.diskGeometry }
+      pFooter.originalSize = cFooter.originalSize
+      pFooter.timestamp = cFooter.timestamp
+      pFooter.uuid = cFooter.uuid
+
+      // necessary to update values and to recreate the footer after block
+      // creation
+      await parentVhd.writeFooter()
+
+      return mergedDataSize
+    } finally {
+      await childHandler.closeFile(childFd)
+    }
+  } finally {
+    await parentHandler.closeFile(parentFd)
+  }
+})

packages/vhd-lib/src/vhd.integ.spec.js

@@ -0,0 +1,134 @@
+/* eslint-env jest */
+import execa from 'execa'
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+import { createWriteStream, readFile } from 'fs-promise'
+import { fromCallback as pFromCallback, fromEvent } from 'promise-toolbox'
+
+import { createFooter } from './_createFooterHeader'
+import createReadableRawVHDStream from './createReadableRawStream'
+import createReadableSparseVHDStream from './createReadableSparseStream'
+
+const initialDir = process.cwd()
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+test('createFooter() does not crash', () => {
+  createFooter(104448, Math.floor(Date.now() / 1000), {
+    cylinders: 3,
+    heads: 4,
+    sectorsPerTrack: 17,
+  })
+})
+
+test('ReadableRawVHDStream does not crash', async () => {
+  const data = [
+    {
+      offsetBytes: 100,
+      data: Buffer.from('azerzaerazeraze', 'ascii'),
+    },
+    {
+      offsetBytes: 700,
+      data: Buffer.from('gdfslkdfguer', 'ascii'),
+    },
+  ]
+  let index = 0
+  const mockParser = {
+    next: () => {
+      if (index < data.length) {
+        const result = data[index]
+        index++
+        return result
+      } else {
+        return null
+      }
+    },
+  }
+  const fileSize = 1000
+  const stream = createReadableRawVHDStream(fileSize, mockParser)
+  const pipe = stream.pipe(createWriteStream('output.vhd'))
+  await fromEvent(pipe, 'finish')
+  await execa('vhd-util', ['check', '-t', '-i', '-n', 'output.vhd'])
+})
+
+test('ReadableRawVHDStream detects when blocks are out of order', async () => {
+  const data = [
+    {
+      offsetBytes: 700,
+      data: Buffer.from('azerzaerazeraze', 'ascii'),
+    },
+    {
+      offsetBytes: 100,
+      data: Buffer.from('gdfslkdfguer', 'ascii'),
+    },
+  ]
+  let index = 0
+  const mockParser = {
+    next: () => {
+      if (index < data.length) {
+        const result = data[index]
+        index++
+        return result
+      } else {
+        return null
+      }
+    },
+  }
+  return expect(
+    new Promise((resolve, reject) => {
+      const stream = createReadableRawVHDStream(100000, mockParser)
+      stream.on('error', reject)
+      const pipe = stream.pipe(createWriteStream('outputStream'))
+      pipe.on('finish', resolve)
+      pipe.on('error', reject)
+    })
+  ).rejects.toThrow('Received out of order blocks')
+})
+
+test('ReadableSparseVHDStream can handle a sparse file', async () => {
+  const blockSize = Math.pow(2, 16)
+  const blocks = [
+    {
+      offsetBytes: blockSize * 3,
+      data: Buffer.alloc(blockSize, 'azerzaerazeraze', 'ascii'),
+    },
+    {
+      offsetBytes: blockSize * 5,
+      data: Buffer.alloc(blockSize, 'gdfslkdfguer', 'ascii'),
+    },
+  ]
+  const fileSize = blockSize * 10
+  const stream = createReadableSparseVHDStream(
+    fileSize,
+    blockSize,
+    [100, 700],
+    blocks
+  )
+  const pipe = stream.pipe(createWriteStream('output.vhd'))
+  await fromEvent(pipe, 'finish')
+  await execa('vhd-util', ['check', '-t', '-i', '-n', 'output.vhd'])
+  await execa('qemu-img', [
+    'convert',
+    '-f',
+    'vpc',
+    '-O',
+    'raw',
+    'output.vhd',
+    'out1.raw',
+  ])
+  const out1 = await readFile('out1.raw')
+  const expected = Buffer.alloc(fileSize)
+  blocks.forEach(b => {
+    b.data.copy(expected, b.offsetBytes)
+  })
+  await expect(out1.slice(0, expected.length)).toEqual(expected)
+})

packages/vhd-lib/src/vhd.js

@@ -1,18 +1,30 @@
-// TODO: remove once completely merged in vhd.js
-
 import assert from 'assert'
-import asyncIteratorToStream from 'async-iterator-to-stream'
-import concurrency from 'limit-concurrency-decorator'
-import fu from 'struct-fu'
-import { dirname, relative } from 'path'
+import getStream from 'get-stream'
 import { fromEvent } from 'promise-toolbox'
 
-import type RemoteHandler from './remote-handlers/abstract'
-import constantStream from './constant-stream'
-import { noop, resolveRelativeFromFile, streamToBuffer } from './utils'
+import constantStream from './_constant-stream'
+import { fuFooter, fuHeader, checksumStruct, unpackField } from './_structs'
+import { set as mapSetBit, test as mapTestBit } from './_bitmap'
+import {
+  BLOCK_UNUSED,
+  DISK_TYPE_DIFFERENCING,
+  DISK_TYPE_DYNAMIC,
+  FILE_FORMAT_VERSION,
+  FOOTER_COOKIE,
+  FOOTER_SIZE,
+  HEADER_COOKIE,
+  HEADER_SIZE,
+  HEADER_VERSION,
+  PARENT_LOCATOR_ENTRIES,
+  PLATFORM_NONE,
+  PLATFORM_W2KU,
+  SECTOR_SIZE,
+} from './_constants'
 
 const VHD_UTIL_DEBUG = 0
-const debug = VHD_UTIL_DEBUG ? str => console.log(`[vhd-merge]${str}`) : noop
+const debug = VHD_UTIL_DEBUG
+  ? str => console.log(`[vhd-merge]${str}`)
+  : () => null
 
 // ===================================================================
 //
@@ -24,160 +36,12 @@ const debug = VHD_UTIL_DEBUG ? str => console.log(`[vhd-merge]${str}`) : noop
 //
 // ===================================================================
 
-// Sizes in bytes.
-const VHD_FOOTER_SIZE = 512
-const VHD_HEADER_SIZE = 1024
-export const VHD_SECTOR_SIZE = 512
-
-// Block allocation table entry size. (Block addr)
-const VHD_ENTRY_SIZE = 4
-
-const VHD_PARENT_LOCATOR_ENTRIES = 8
-const VHD_PLATFORM_CODE_NONE = 0
-
-// Types of backup treated. Others are not supported.
-export const HARD_DISK_TYPE_DYNAMIC = 3 // Full backup.
-export const HARD_DISK_TYPE_DIFFERENCING = 4 // Delta backup.
-
-export const PLATFORM_NONE = 0
-export const PLATFORM_W2RU = 0x57327275
-export const PLATFORM_W2KU = 0x57326b75
-export const PLATFORM_MAC = 0x4d616320
-export const PLATFORM_MACX = 0x4d616358
-
-// Other.
-const BLOCK_UNUSED = 0xffffffff
-const BIT_MASK = 0x80
-
-// unused block as buffer containing a uint32BE
-const BUF_BLOCK_UNUSED = Buffer.allocUnsafe(VHD_ENTRY_SIZE)
-BUF_BLOCK_UNUSED.writeUInt32BE(BLOCK_UNUSED, 0)
-
-// ===================================================================
-
-const SIZE_OF_32_BITS = Math.pow(2, 32)
-const uint64 = fu.derive(
-  fu.uint32(2),
-  number => [Math.floor(number / SIZE_OF_32_BITS), number % SIZE_OF_32_BITS],
-  _ => _[0] * SIZE_OF_32_BITS + _[1]
-)
-
-const fuFooter = fu.struct([
-  fu.char('cookie', 8), // 0
-  fu.uint32('features'), // 8
-  fu.uint32('fileFormatVersion'), // 12
-  uint64('dataOffset'), // offset of the header, should always be 512
-  fu.uint32('timestamp'), // 24
-  fu.char('creatorApplication', 4), // 28
-  fu.uint32('creatorVersion'), // 32
-  fu.uint32('creatorHostOs'), // 36
-  uint64('originalSize'),
-  uint64('currentSize'),
-  fu.struct('diskGeometry', [
-    fu.uint16('cylinders'), // 56
-    fu.uint8('heads'), // 58
-    fu.uint8('sectorsPerTrackCylinder'), // 59
-  ]),
-  fu.uint32('diskType'), // 60 Disk type, must be equal to HARD_DISK_TYPE_DYNAMIC/HARD_DISK_TYPE_DIFFERENCING.
-  fu.uint32('checksum'), // 64
-  fu.uint8('uuid', 16), // 68
-  fu.char('saved'), // 84
-  fu.char('hidden'), // 85
-  fu.char('reserved', 426), // 86
-])
-
-const fuHeader = fu.struct([
-  fu.char('cookie', 8),
-  fu.uint8('dataOffsetUnused', 8),
-  uint64('tableOffset'),
-  fu.uint32('headerVersion'),
-  fu.uint32('maxTableEntries'), // Max entries in the Block Allocation Table.
-  fu.uint32('blockSize'), // Block size in bytes. Default (2097152 => 2MB)
-  fu.uint32('checksum'),
-  fu.uint8('parentUuid', 16),
-  fu.uint32('parentTimestamp'),
-  fu.uint32('reserved1'),
-  fu.char16be('parentUnicodeName', 512),
-  fu.struct(
-    'parentLocatorEntry',
-    [
-      fu.uint32('platformCode'),
-      fu.uint32('platformDataSpace'),
-      fu.uint32('platformDataLength'),
-      fu.uint32('reserved'),
-      uint64('platformDataOffset'), // Absolute byte offset of the locator data.
-    ],
-    VHD_PARENT_LOCATOR_ENTRIES
-  ),
-  fu.char('reserved2', 256),
-])
-
-// ===================================================================
-// Helpers
-// ===================================================================
-
 const computeBatSize = entries =>
-  sectorsToBytes(sectorsRoundUpNoZero(entries * VHD_ENTRY_SIZE))
-
-// Returns a 32 bits integer corresponding to a Vhd version.
-const getVhdVersion = (major, minor) => (major << 16) | (minor & 0x0000ffff)
+  sectorsToBytes(sectorsRoundUpNoZero(entries * 4))
 
 // Sectors conversions.
-const sectorsRoundUpNoZero = bytes => Math.ceil(bytes / VHD_SECTOR_SIZE) || 1
-const sectorsToBytes = sectors => sectors * VHD_SECTOR_SIZE
-
-// Check/Set a bit on a vhd map.
-const mapTestBit = (map, bit) => ((map[bit >> 3] << (bit & 7)) & BIT_MASK) !== 0
-const mapSetBit = (map, bit) => {
-  map[bit >> 3] |= BIT_MASK >> (bit & 7)
-}
-
-const packField = (field, value, buf) => {
-  const { offset } = field
-
-  field.pack(
-    value,
-    buf,
-    typeof offset !== 'object' ? { bytes: offset, bits: 0 } : offset
-  )
-}
-
-const unpackField = (field, buf) => {
-  const { offset } = field
-
-  return field.unpack(
-    buf,
-    typeof offset !== 'object' ? { bytes: offset, bits: 0 } : offset
-  )
-}
-// ===================================================================
-
-// Returns the checksum of a raw struct.
-// The raw struct (footer or header) is altered with the new sum.
-function checksumStruct (buf, struct) {
-  const checksumField = struct.fields.checksum
-  let sum = 0
-
-  // Do not use the stored checksum to compute the new checksum.
-  const checksumOffset = checksumField.offset
-  for (let i = 0, n = checksumOffset; i < n; ++i) {
-    sum += buf[i]
-  }
-  for (
-    let i = checksumOffset + checksumField.size, n = struct.size;
-    i < n;
-    ++i
-  ) {
-    sum += buf[i]
-  }
-
-  sum = ~sum >>> 0
-
-  // Write new sum.
-  packField(checksumField, sum, buf)
-
-  return sum
-}
+const sectorsRoundUpNoZero = bytes => Math.ceil(bytes / SECTOR_SIZE) || 1
+const sectorsToBytes = sectors => sectors * SECTOR_SIZE
 
 const assertChecksum = (name, buf, struct) => {
   const actual = unpackField(struct.fields.checksum, buf)
@@ -187,6 +51,10 @@ const assertChecksum = (name, buf, struct) => {
   }
 }
 
+// unused block as buffer containing a uint32BE
+const BUF_BLOCK_UNUSED = Buffer.allocUnsafe(4)
+BUF_BLOCK_UNUSED.writeUInt32BE(BLOCK_UNUSED, 0)
+
 // ===================================================================
 
 // Format:
@@ -210,7 +78,8 @@ const assertChecksum = (name, buf, struct) => {
 // - parentLocatorOffset(i) = header.parentLocatorEntry[i].platformDataOffset
 // - parentLocatorSize(i) = header.parentLocatorEntry[i].platformDataSpace * sectorSize
 // - sectorSize = 512
-export class Vhd {
+
+export default class Vhd {
   get batSize () {
     return computeBatSize(this.header.maxTableEntries)
   }
@@ -232,7 +101,12 @@ export class Vhd {
   }
 
   _read (start, n) {
-    return this._readStream(start, n).then(streamToBuffer)
+    return this._readStream(start, n)
+      .then(getStream.buffer)
+      .then(buf => {
+        assert.equal(buf.length, n)
+        return buf
+      })
   }
 
   containsBlock (id) {
@@ -243,15 +117,15 @@ export class Vhd {
   getEndOfHeaders () {
     const { header } = this
 
-    let end = VHD_FOOTER_SIZE + VHD_HEADER_SIZE
+    let end = FOOTER_SIZE + HEADER_SIZE
 
     // Max(end, block allocation table end)
     end = Math.max(end, header.tableOffset + this.batSize)
 
-    for (let i = 0; i < VHD_PARENT_LOCATOR_ENTRIES; i++) {
+    for (let i = 0; i < PARENT_LOCATOR_ENTRIES; i++) {
       const entry = header.parentLocatorEntry[i]
 
-      if (entry.platformCode !== VHD_PLATFORM_CODE_NONE) {
+      if (entry.platformCode !== PLATFORM_NONE) {
         end = Math.max(
           end,
           entry.platformDataOffset + sectorsToBytes(entry.platformDataSpace)
@@ -266,7 +140,7 @@ export class Vhd {
 
   // Returns the first sector after data.
   getEndOfData () {
-    let end = Math.ceil(this.getEndOfHeaders() / VHD_SECTOR_SIZE)
+    let end = Math.ceil(this.getEndOfHeaders() / SECTOR_SIZE)
 
     const fullBlockSize = this.sectorsOfBitmap + this.sectorsPerBlock
     const { maxTableEntries } = this.header
@@ -283,25 +157,46 @@ export class Vhd {
     return sectorsToBytes(end)
   }
 
-  // Get the beginning (footer + header) of a vhd file.
-  async readHeaderAndFooter () {
-    const buf = await this._read(0, VHD_FOOTER_SIZE + VHD_HEADER_SIZE)
-    const bufFooter = buf.slice(0, VHD_FOOTER_SIZE)
-    const bufHeader = buf.slice(VHD_FOOTER_SIZE)
+  // TODO: extract the checks into reusable functions:
+  // - better human reporting
+  // - auto repair if possible
+  async readHeaderAndFooter (checkSecondFooter = true) {
+    const buf = await this._read(0, FOOTER_SIZE + HEADER_SIZE)
+    const bufFooter = buf.slice(0, FOOTER_SIZE)
+    const bufHeader = buf.slice(FOOTER_SIZE)
 
     assertChecksum('footer', bufFooter, fuFooter)
     assertChecksum('header', bufHeader, fuHeader)
 
+    if (checkSecondFooter) {
+      const size = await this._handler.getSize(this._path)
+      assert(
+        bufFooter.equals(await this._read(size - FOOTER_SIZE, FOOTER_SIZE)),
+        'footer1 !== footer2'
+      )
+    }
+
     const footer = (this.footer = fuFooter.unpack(bufFooter))
-    assert.strictEqual(footer.dataOffset, VHD_FOOTER_SIZE)
+    assert.strictEqual(footer.cookie, FOOTER_COOKIE, 'footer cookie')
+    assert.strictEqual(footer.dataOffset, FOOTER_SIZE)
+    assert.strictEqual(footer.fileFormatVersion, FILE_FORMAT_VERSION)
+    assert(footer.originalSize <= footer.currentSize)
+    assert(
+      footer.diskType === DISK_TYPE_DIFFERENCING ||
+        footer.diskType === DISK_TYPE_DYNAMIC
+    )
 
     const header = (this.header = fuHeader.unpack(bufHeader))
+    assert.strictEqual(header.cookie, HEADER_COOKIE)
+    assert.strictEqual(header.dataOffset, undefined)
+    assert.strictEqual(header.headerVersion, HEADER_VERSION)
+    assert(header.maxTableEntries >= footer.currentSize / header.blockSize)
+    assert(Number.isInteger(Math.log2(header.blockSize / SECTOR_SIZE)))
 
     // Compute the number of sectors in one block.
     // Default: One block contains 4096 sectors of 512 bytes.
-    const sectorsPerBlock = (this.sectorsPerBlock = Math.floor(
-      header.blockSize / VHD_SECTOR_SIZE
-    ))
+    const sectorsPerBlock = (this.sectorsPerBlock =
+      header.blockSize / SECTOR_SIZE)
 
     // Compute bitmap size in sectors.
     // Default: 1.
@@ -317,23 +212,18 @@ export class Vhd {
     this.bitmapSize = sectorsToBytes(sectorsOfBitmap)
   }
 
-  // Check if a vhd object has a block allocation table.
-  hasBlockAllocationTableMap () {
-    return this.footer.fileFormatVersion > getVhdVersion(1, 0)
-  }
-
   // Returns a buffer that contains the block allocation table of a vhd file.
-  async readBlockTable () {
+  async readBlockAllocationTable () {
     const { header } = this
     this.blockTable = await this._read(
       header.tableOffset,
-      header.maxTableEntries * VHD_ENTRY_SIZE
+      header.maxTableEntries * 4
     )
   }
 
   // return the first sector (bitmap) of a block
   _getBatEntry (block) {
-    return this.blockTable.readUInt32BE(block * VHD_ENTRY_SIZE)
+    return this.blockTable.readUInt32BE(block * 4)
   }
 
   _readBlock (blockId, onlyBitmap = false) {
@@ -371,7 +261,7 @@ export class Vhd {
     // get first allocated block for initialization
     while ((firstSector = bat.readUInt32BE(j)) === BLOCK_UNUSED) {
       i += 1
-      j += VHD_ENTRY_SIZE
+      j += 4
 
       if (i === n) {
         const error = new Error('no allocated block found')
@@ -395,7 +285,7 @@ export class Vhd {
       }
 
       i += 1
-      j += VHD_ENTRY_SIZE
+      j += 4
     }
 
     return { first, firstSector, last, lastSector }
@@ -431,7 +321,7 @@ export class Vhd {
       const tableOffset = this.header.tableOffset
       const { batSize } = this
       const newMinSector = Math.ceil(
-        (tableOffset + batSize + spaceNeededBytes) / VHD_SECTOR_SIZE
+        (tableOffset + batSize + spaceNeededBytes) / SECTOR_SIZE
       )
       if (
         tableOffset + batSize + spaceNeededBytes >=
@@ -439,7 +329,7 @@ export class Vhd {
       ) {
         const { fullBlockSize } = this
         const newFirstSector = Math.max(
-          lastSector + fullBlockSize / VHD_SECTOR_SIZE,
+          lastSector + fullBlockSize / SECTOR_SIZE,
           newMinSector
         )
         debug(
@@ -478,7 +368,7 @@ export class Vhd {
     const prevBat = this.blockTable
     const bat = (this.blockTable = Buffer.allocUnsafe(newBatSize))
     prevBat.copy(bat)
-    bat.fill(BUF_BLOCK_UNUSED, prevMaxTableEntries * VHD_ENTRY_SIZE)
+    bat.fill(BUF_BLOCK_UNUSED, prevMaxTableEntries * 4)
     debug(
       `ensureBatSize: extend BAT ${prevMaxTableEntries} -> ${maxTableEntries}`
     )
@@ -491,21 +381,18 @@ export class Vhd {
 
   // set the first sector (bitmap) of a block
   _setBatEntry (block, blockSector) {
-    const i = block * VHD_ENTRY_SIZE
+    const i = block * 4
     const { blockTable } = this
 
     blockTable.writeUInt32BE(blockSector, i)
 
-    return this._write(
-      blockTable.slice(i, i + VHD_ENTRY_SIZE),
-      this.header.tableOffset + i
-    )
+    return this._write(blockTable.slice(i, i + 4), this.header.tableOffset + i)
   }
 
   // Make a new empty block at vhd end.
   // Update block allocation table in context and in file.
   async createBlock (blockId) {
-    const blockAddr = Math.ceil(this.getEndOfData() / VHD_SECTOR_SIZE)
+    const blockAddr = Math.ceil(this.getEndOfData() / SECTOR_SIZE)
 
     debug(`create block ${blockId} at ${blockAddr}`)
 
@@ -647,7 +534,7 @@ export class Vhd {
     const { header } = this
     const rawHeader = fuHeader.pack(header)
     header.checksum = checksumStruct(rawHeader, fuHeader)
-    const offset = VHD_FOOTER_SIZE
+    const offset = FOOTER_SIZE
     debug(
       `Write header at: ${offset} (checksum=${
         header.checksum
@@ -657,12 +544,12 @@ export class Vhd {
   }
 
   async writeData (offsetSectors, buffer) {
-    const bufferSizeSectors = Math.ceil(buffer.length / VHD_SECTOR_SIZE)
+    const bufferSizeSectors = Math.ceil(buffer.length / SECTOR_SIZE)
     const startBlock = Math.floor(offsetSectors / this.sectorsPerBlock)
     const endBufferSectors = offsetSectors + bufferSizeSectors
     const lastBlock = Math.ceil(endBufferSectors / this.sectorsPerBlock) - 1
     await this.ensureBatSize(lastBlock)
-    const blockSizeBytes = this.sectorsPerBlock * VHD_SECTOR_SIZE
+    const blockSizeBytes = this.sectorsPerBlock * SECTOR_SIZE
     const coversWholeBlock = (offsetInBlockSectors, endInBlockSectors) =>
       offsetInBlockSectors === 0 && endInBlockSectors === this.sectorsPerBlock
 
@@ -681,11 +568,11 @@ export class Vhd {
       )
       const startInBuffer = Math.max(
         0,
-        (currentBlock * this.sectorsPerBlock - offsetSectors) * VHD_SECTOR_SIZE
+        (currentBlock * this.sectorsPerBlock - offsetSectors) * SECTOR_SIZE
       )
       const endInBuffer = Math.min(
         ((currentBlock + 1) * this.sectorsPerBlock - offsetSectors) *
-          VHD_SECTOR_SIZE,
+          SECTOR_SIZE,
         buffer.length
       )
       let inputBuffer
@@ -695,7 +582,7 @@ export class Vhd {
         inputBuffer = Buffer.alloc(blockSizeBytes, 0)
         buffer.copy(
           inputBuffer,
-          offsetInBlockSectors * VHD_SECTOR_SIZE,
+          offsetInBlockSectors * SECTOR_SIZE,
           startInBuffer,
           endInBuffer
         )
@@ -710,10 +597,10 @@ export class Vhd {
   }
 
   async ensureSpaceForParentLocators (neededSectors) {
-    const firstLocatorOffset = VHD_FOOTER_SIZE + VHD_HEADER_SIZE
+    const firstLocatorOffset = FOOTER_SIZE + HEADER_SIZE
     const currentSpace =
-      Math.floor(this.header.tableOffset / VHD_SECTOR_SIZE) -
-      firstLocatorOffset / VHD_SECTOR_SIZE
+      Math.floor(this.header.tableOffset / SECTOR_SIZE) -
+      firstLocatorOffset / SECTOR_SIZE
     if (currentSpace < neededSectors) {
       const deltaSectors = neededSectors - currentSpace
       await this._freeFirstBlockSpace(sectorsToBytes(deltaSectors))
@@ -722,279 +609,23 @@ export class Vhd {
     }
     return firstLocatorOffset
   }
-}
 
-// Merge vhd child into vhd parent.
-//
-// Child must be a delta backup !
-// Parent must be a full backup !
-//
-// TODO: update the identifier of the parent VHD.
-export default concurrency(2)(async function vhdMerge (
-  parentHandler,
-  parentPath,
-  childHandler,
-  childPath
-) {
-  const parentFd = await parentHandler.openFile(parentPath, 'r+')
-  try {
-    const parentVhd = new Vhd(parentHandler, parentFd)
-    const childFd = await childHandler.openFile(childPath, 'r')
-    try {
-      const childVhd = new Vhd(childHandler, childFd)
-
-      // Reading footer and header.
-      await Promise.all([
-        parentVhd.readHeaderAndFooter(),
-        childVhd.readHeaderAndFooter(),
-      ])
-
-      assert(childVhd.header.blockSize === parentVhd.header.blockSize)
-
-      // Child must be a delta.
-      if (childVhd.footer.diskType !== HARD_DISK_TYPE_DIFFERENCING) {
-        throw new Error('Unable to merge, child is not a delta backup.')
-      }
-
-      // Allocation table map is not yet implemented.
-      if (
-        parentVhd.hasBlockAllocationTableMap() ||
-        childVhd.hasBlockAllocationTableMap()
-      ) {
-        throw new Error('Unsupported allocation table map.')
-      }
-
-      // Read allocation table of child/parent.
-      await Promise.all([parentVhd.readBlockTable(), childVhd.readBlockTable()])
-
-      await parentVhd.ensureBatSize(childVhd.header.maxTableEntries)
-
-      let mergedDataSize = 0
-      for (
-        let blockId = 0;
-        blockId < childVhd.header.maxTableEntries;
-        blockId++
-      ) {
-        if (childVhd.containsBlock(blockId)) {
-          mergedDataSize += await parentVhd.coalesceBlock(childVhd, blockId)
-        }
-      }
-
-      const cFooter = childVhd.footer
-      const pFooter = parentVhd.footer
-
-      pFooter.currentSize = cFooter.currentSize
-      pFooter.diskGeometry = { ...cFooter.diskGeometry }
-      pFooter.originalSize = cFooter.originalSize
-      pFooter.timestamp = cFooter.timestamp
-      pFooter.uuid = cFooter.uuid
-
-      // necessary to update values and to recreate the footer after block
-      // creation
-      await parentVhd.writeFooter()
-
-      return mergedDataSize
-    } finally {
-      await childHandler.closeFile(childFd)
+  async setUniqueParentLocator (fileNameString) {
+    const { header } = this
+    header.parentLocatorEntry[0].platformCode = PLATFORM_W2KU
+    const encodedFilename = Buffer.from(fileNameString, 'utf16le')
+    const dataSpaceSectors = Math.ceil(encodedFilename.length / SECTOR_SIZE)
+    const position = await this.ensureSpaceForParentLocators(dataSpaceSectors)
+    await this._write(encodedFilename, position)
+    header.parentLocatorEntry[0].platformDataSpace =
+      dataSpaceSectors * SECTOR_SIZE
+    header.parentLocatorEntry[0].platformDataLength = encodedFilename.length
+    header.parentLocatorEntry[0].platformDataOffset = position
+    for (let i = 1; i < 8; i++) {
+      header.parentLocatorEntry[i].platformCode = PLATFORM_NONE
+      header.parentLocatorEntry[i].platformDataSpace = 0
+      header.parentLocatorEntry[i].platformDataLength = 0
+      header.parentLocatorEntry[i].platformDataOffset = 0
     }
-  } finally {
-    await parentHandler.closeFile(parentFd)
-  }
-})
-
-// returns true if the child was actually modified
-export async function chainVhd (
-  parentHandler,
-  parentPath,
-  childHandler,
-  childPath,
-  force = false
-) {
-  const parentVhd = new Vhd(parentHandler, parentPath)
-  const childVhd = new Vhd(childHandler, childPath)
-
-  await childVhd.readHeaderAndFooter()
-  const { header, footer } = childVhd
-
-  if (footer.diskType !== HARD_DISK_TYPE_DIFFERENCING) {
-    if (!force) {
-      throw new Error('cannot chain disk of type ' + footer.diskType)
-    }
-    footer.diskType = HARD_DISK_TYPE_DIFFERENCING
-  }
-
-  await Promise.all([
-    childVhd.readBlockTable(),
-    parentVhd.readHeaderAndFooter(),
-  ])
-
-  const parentName = relative(dirname(childPath), parentPath)
-
-  header.parentUuid = parentVhd.footer.uuid
-  header.parentUnicodeName = parentName
-
-  header.parentLocatorEntry[0].platformCode = PLATFORM_W2KU
-  const encodedFilename = Buffer.from(parentName, 'utf16le')
-  const dataSpaceSectors = Math.ceil(encodedFilename.length / VHD_SECTOR_SIZE)
-  const position = await childVhd.ensureSpaceForParentLocators(dataSpaceSectors)
-  await childVhd._write(encodedFilename, position)
-  header.parentLocatorEntry[0].platformDataSpace = sectorsToBytes(
-    dataSpaceSectors
-  )
-  header.parentLocatorEntry[0].platformDataLength = encodedFilename.length
-  header.parentLocatorEntry[0].platformDataOffset = position
-  for (let i = 1; i < 8; i++) {
-    header.parentLocatorEntry[i].platformCode = VHD_PLATFORM_CODE_NONE
-    header.parentLocatorEntry[i].platformDataSpace = 0
-    header.parentLocatorEntry[i].platformDataLength = 0
-    header.parentLocatorEntry[i].platformDataOffset = 0
-  }
-  await childVhd.writeHeader()
-  await childVhd.writeFooter()
-  return true
-}
-
-export const createReadStream = asyncIteratorToStream(function * (handler, path) {
-  const fds = []
-
-  try {
-    const vhds = []
-    while (true) {
-      const fd = yield handler.openFile(path, 'r')
-      fds.push(fd)
-      const vhd = new Vhd(handler, fd)
-      vhds.push(vhd)
-      yield vhd.readHeaderAndFooter()
-      yield vhd.readBlockTable()
-
-      if (vhd.footer.diskType === HARD_DISK_TYPE_DYNAMIC) {
-        break
-      }
-
-      path = resolveRelativeFromFile(path, vhd.header.parentUnicodeName)
-    }
-    const nVhds = vhds.length
-
-    // this the VHD we want to synthetize
-    const vhd = vhds[0]
-
-    // this is the root VHD
-    const rootVhd = vhds[nVhds - 1]
-
-    // data of our synthetic VHD
-    // TODO: set parentLocatorEntry-s in header
-    let header = {
-      ...vhd.header,
-      tableOffset: 512 + 1024,
-      parentTimestamp: rootVhd.header.parentTimestamp,
-      parentUnicodeName: rootVhd.header.parentUnicodeName,
-      parentUuid: rootVhd.header.parentUuid,
-    }
-
-    const bat = Buffer.allocUnsafe(
-      Math.ceil(4 * header.maxTableEntries / VHD_SECTOR_SIZE) * VHD_SECTOR_SIZE
-    )
-    let footer = {
-      ...vhd.footer,
-      diskType: rootVhd.footer.diskType,
-    }
-    const sectorsPerBlockData = vhd.sectorsPerBlock
-    const sectorsPerBlock =
-      sectorsPerBlockData + vhd.bitmapSize / VHD_SECTOR_SIZE
-
-    const nBlocks = Math.ceil(footer.currentSize / header.blockSize)
-
-    const blocksOwner = new Array(nBlocks)
-    for (
-      let iBlock = 0,
-        blockOffset = Math.ceil((512 + 1024 + bat.length) / VHD_SECTOR_SIZE);
-      iBlock < nBlocks;
-      ++iBlock
-    ) {
-      let blockSector = BLOCK_UNUSED
-      for (let i = 0; i < nVhds; ++i) {
-        if (vhds[i].containsBlock(iBlock)) {
-          blocksOwner[iBlock] = i
-          blockSector = blockOffset
-          blockOffset += sectorsPerBlock
-          break
-        }
-      }
-      bat.writeUInt32BE(blockSector, iBlock * 4)
-    }
-
-    footer = fuFooter.pack(footer)
-    checksumStruct(footer, fuFooter)
-    yield footer
-
-    header = fuHeader.pack(header)
-    checksumStruct(header, fuHeader)
-    yield header
-
-    yield bat
-
-    const bitmap = Buffer.alloc(vhd.bitmapSize, 0xff)
-    for (let iBlock = 0; iBlock < nBlocks; ++iBlock) {
-      const owner = blocksOwner[iBlock]
-      if (owner === undefined) {
-        continue
-      }
-
-      yield bitmap
-
-      const blocksByVhd = new Map()
-      const emitBlockSectors = function * (iVhd, i, n) {
-        const vhd = vhds[iVhd]
-        const isRootVhd = vhd === rootVhd
-        if (!vhd.containsBlock(iBlock)) {
-          if (isRootVhd) {
-            yield Buffer.alloc((n - i) * VHD_SECTOR_SIZE)
-          } else {
-            yield * emitBlockSectors(iVhd + 1, i, n)
-          }
-          return
-        }
-        let block = blocksByVhd.get(vhd)
-        if (block === undefined) {
-          block = yield vhd._readBlock(iBlock)
-          blocksByVhd.set(vhd, block)
-        }
-        const { bitmap, data } = block
-        if (isRootVhd) {
-          yield data.slice(i * VHD_SECTOR_SIZE, n * VHD_SECTOR_SIZE)
-          return
-        }
-        while (i < n) {
-          const hasData = mapTestBit(bitmap, i)
-          const start = i
-          do {
-            ++i
-          } while (i < n && mapTestBit(bitmap, i) === hasData)
-          if (hasData) {
-            yield data.slice(start * VHD_SECTOR_SIZE, i * VHD_SECTOR_SIZE)
-          } else {
-            yield * emitBlockSectors(iVhd + 1, start, i)
-          }
-        }
-      }
-      yield * emitBlockSectors(owner, 0, sectorsPerBlockData)
-    }
-
-    yield footer
-  } finally {
-    for (let i = 0, n = fds.length; i < n; ++i) {
-      handler.closeFile(fds[i]).catch(error => {
-        console.warn('createReadStream, closeFd', i, error)
-      })
-    }
-  }
-})
-
-export async function readVhdMetadata (handler: RemoteHandler, path: string) {
-  const vhd = new Vhd(handler, path)
-  await vhd.readHeaderAndFooter()
-  return {
-    footer: vhd.footer,
-    header: vhd.header,
   }
 }

packages/xo-server-backup-reports/package.json

@@ -1,6 +1,6 @@
 {
   "name": "xo-server-backup-reports",
-  "version": "0.10.0",
+  "version": "0.11.0",
   "license": "AGPL-3.0",
   "description": "Backup reports plugin for XO-Server",
   "keywords": [
@@ -35,6 +35,7 @@
     "node": ">=4"
   },
   "dependencies": {
+    "babel-runtime": "^6.26.0",
     "human-format": "^0.10.0",
     "lodash": "^4.13.1",
     "moment-timezone": "^0.5.13"
@@ -42,6 +43,7 @@
   "devDependencies": {
     "babel-cli": "^6.24.1",
     "babel-plugin-lodash": "^3.3.2",
+    "babel-plugin-transform-runtime": "^6.23.0",
     "babel-preset-env": "^1.5.2",
     "cross-env": "^5.1.3",
     "rimraf": "^2.6.1"
@@ -56,7 +58,8 @@
   },
   "babel": {
     "plugins": [
-      "lodash"
+      "lodash",
+      "transform-runtime"
     ],
     "presets": [
       [

packages/xo-server-backup-reports/src/index.js

@@ -1,6 +1,6 @@
 import humanFormat from 'human-format'
 import moment from 'moment-timezone'
-import { forEach, startCase } from 'lodash'
+import { find, forEach, get, startCase } from 'lodash'
 
 import pkg from '../package'
 
@@ -41,9 +41,9 @@ const DATE_FORMAT = 'dddd, MMMM Do YYYY, h:mm:ss a'
 const createDateFormater = timezone =>
   timezone !== undefined
     ? timestamp =>
-      moment(timestamp)
-        .tz(timezone)
-        .format(DATE_FORMAT)
+        moment(timestamp)
+          .tz(timezone)
+          .format(DATE_FORMAT)
     : timestamp => moment(timestamp).format(DATE_FORMAT)
 
 const formatDuration = milliseconds => moment.duration(milliseconds).humanize()
@@ -66,6 +66,7 @@ const logError = e => {
   console.error('backup report error:', e)
 }
 
+const NO_VMS_MATCH_THIS_PATTERN = 'no VMs match this pattern'
 const NO_SUCH_OBJECT_ERROR = 'no such object'
 const UNHEALTHY_VDI_CHAIN_ERROR = 'unhealthy VDI chain'
 const UNHEALTHY_VDI_CHAIN_MESSAGE =
@@ -94,14 +95,351 @@ class BackupReportsXoPlugin {
     this._xo.removeListener('job:terminated', this._report)
   }
 
-  _wrapper (status) {
-    return new Promise(resolve => resolve(this._listener(status))).catch(
-      logError
-    )
+  _wrapper (status, job, schedule) {
+    return new Promise(resolve =>
+      resolve(
+        job.type === 'backup'
+          ? this._backupNgListener(status, job, schedule)
+          : this._listener(status, job, schedule)
+      )
+    ).catch(logError)
+  }
+
+  async _backupNgListener (runJobId, _, { timezone }) {
+    const xo = this._xo
+    const logs = await xo.getBackupNgLogs(runJobId)
+    const jobLog = logs['roots'][0]
+    const vmsTaskLog = logs[jobLog.id]
+
+    const { reportWhen, mode } = jobLog.data || {}
+    if (reportWhen === 'never') {
+      return
+    }
+
+    const formatDate = createDateFormater(timezone)
+    const jobName = (await xo.getJob(jobLog.jobId, 'backup')).name
+
+    if (jobLog.error !== undefined) {
+      const [globalStatus, icon] =
+        jobLog.error.message === NO_VMS_MATCH_THIS_PATTERN
+          ? ['Skipped', ICON_SKIPPED]
+          : ['Failure', ICON_FAILURE]
+      let markdown = [
+        `##  Global status: ${globalStatus}`,
+        '',
+        `- **mode**: ${mode}`,
+        `- **Start time**: ${formatDate(jobLog.start)}`,
+        `- **End time**: ${formatDate(jobLog.end)}`,
+        `- **Duration**: ${formatDuration(jobLog.duration)}`,
+        `- **Error**: ${jobLog.error.message}`,
+        '---',
+        '',
+        `*${pkg.name} v${pkg.version}*`,
+      ]
+
+      markdown = markdown.join('\n')
+      return this._sendReport({
+        subject: `[Xen Orchestra] ${globalStatus} − Backup report for ${jobName} ${icon}`,
+        markdown,
+        nagiosStatus: 2,
+        nagiosMarkdown: `[Xen Orchestra] [${globalStatus}] Backup report for ${jobName} - Error : ${
+          jobLog.error.message
+        }`,
+      })
+    }
+
+    const failedVmsText = []
+    const skippedVmsText = []
+    const successfulVmsText = []
+    const nagiosText = []
+
+    let globalMergeSize = 0
+    let globalTransferSize = 0
+    let nFailures = 0
+    let nSkipped = 0
+
+    for (const vmTaskLog of vmsTaskLog || []) {
+      const vmTaskStatus = vmTaskLog.status
+      if (vmTaskStatus === 'success' && reportWhen === 'failure') {
+        return
+      }
+
+      const vmId = vmTaskLog.data.id
+      let vm
+      try {
+        vm = xo.getObject(vmId)
+      } catch (e) {}
+      const text = [
+        `### ${vm !== undefined ? vm.name_label : 'VM not found'}`,
+        '',
+        `- **UUID**: ${vm !== undefined ? vm.uuid : vmId}`,
+        `- **Start time**: ${formatDate(vmTaskLog.start)}`,
+        `- **End time**: ${formatDate(vmTaskLog.end)}`,
+        `- **Duration**: ${formatDuration(vmTaskLog.duration)}`,
+      ]
+
+      const failedSubTasks = []
+      const operationsText = []
+      const srsText = []
+      const remotesText = []
+      for (const subTaskLog of logs[vmTaskLog.taskId] || []) {
+        const { data, status, result, message } = subTaskLog
+        const icon =
+          subTaskLog.status === 'success' ? ICON_SUCCESS : ICON_FAILURE
+        const errorMessage = `  **Error**: ${get(result, 'message')}`
+
+        if (message === 'snapshot') {
+          operationsText.push(`- **Snapshot** ${icon}`)
+          if (status === 'failure') {
+            failedSubTasks.push('Snapshot')
+            operationsText.push('', errorMessage)
+          }
+        } else if (data.type === 'remote') {
+          const remoteId = data.id
+          const remote = await xo.getRemote(remoteId).catch(() => {})
+          remotesText.push(
+            `- **${
+              remote !== undefined ? remote.name : `Remote Not found`
+            }** (${remoteId}) ${icon}`
+          )
+          if (status === 'failure') {
+            failedSubTasks.push(remote !== undefined ? remote.name : remoteId)
+            remotesText.push('', errorMessage)
+          }
+        } else {
+          const srId = data.id
+          let sr
+          try {
+            sr = xo.getObject(srId)
+          } catch (e) {}
+          const [srName, srUuid] =
+            sr !== undefined ? [sr.name_label, sr.uuid] : [`SR Not found`, srId]
+          srsText.push(`- **${srName}** (${srUuid}) ${icon}`)
+          if (status === 'failure') {
+            failedSubTasks.push(sr !== undefined ? sr.name_label : srId)
+            srsText.push('', errorMessage)
+          }
+        }
+      }
+
+      if (operationsText.length !== 0) {
+        operationsText.unshift(`#### Operations`, '')
+      }
+      if (srsText.length !== 0) {
+        srsText.unshift(`#### SRs`, '')
+      }
+      if (remotesText.length !== 0) {
+        remotesText.unshift(`#### remotes`, '')
+      }
+      const subText = [...operationsText, '', ...srsText, '', ...remotesText]
+      const result = vmTaskLog.result
+      if (vmTaskStatus === 'failure' && result !== undefined) {
+        const { message } = result
+        if (isSkippedError(result)) {
+          ++nSkipped
+          skippedVmsText.push(
+            ...text,
+            `- **Reason**: ${
+              message === UNHEALTHY_VDI_CHAIN_ERROR
+                ? UNHEALTHY_VDI_CHAIN_MESSAGE
+                : message
+            }`,
+            ''
+          )
+          nagiosText.push(
+            `[(Skipped) ${
+              vm !== undefined ? vm.name_label : 'undefined'
+            } : ${message} ]`
+          )
+        } else {
+          ++nFailures
+          failedVmsText.push(...text, `- **Error**: ${message}`, '')
+
+          nagiosText.push(
+            `[(Failed) ${
+              vm !== undefined ? vm.name_label : 'undefined'
+            } : ${message} ]`
+          )
+        }
+      } else {
+        let transferSize, transferDuration, mergeSize, mergeDuration
+
+        forEach(logs[vmTaskLog.taskId], ({ taskId }) => {
+          if (transferSize !== undefined) {
+            return false
+          }
+
+          const transferTask = find(logs[taskId], { message: 'transfer' })
+          if (transferTask !== undefined) {
+            transferSize = transferTask.result.size
+            transferDuration = transferTask.end - transferTask.start
+          }
+
+          const mergeTask = find(logs[taskId], { message: 'merge' })
+          if (mergeTask !== undefined) {
+            mergeSize = mergeTask.result.size
+            mergeDuration = mergeTask.end - mergeTask.start
+          }
+        })
+        if (transferSize !== undefined) {
+          globalTransferSize += transferSize
+          text.push(
+            `- **Transfer size**: ${formatSize(transferSize)}`,
+            `- **Transfer speed**: ${formatSpeed(
+              transferSize,
+              transferDuration
+            )}`
+          )
+        }
+        if (mergeSize !== undefined) {
+          globalMergeSize += mergeSize
+          text.push(
+            `- **Merge size**: ${formatSize(mergeSize)}`,
+            `- **Merge speed**: ${formatSpeed(mergeSize, mergeDuration)}`
+          )
+        }
+        if (vmTaskStatus === 'failure') {
+          ++nFailures
+          failedVmsText.push(...text, '', '', ...subText, '')
+          nagiosText.push(
+            `[(Failed) ${
+              vm !== undefined ? vm.name_label : 'undefined'
+            }: (failed)[${failedSubTasks.toString()}]]`
+          )
+        } else {
+          successfulVmsText.push(...text, '', '', ...subText, '')
+        }
+      }
+    }
+    const globalSuccess = nFailures === 0 && nSkipped === 0
+    if (reportWhen === 'failure' && globalSuccess) {
+      return
+    }
+
+    const nVms = vmsTaskLog.length
+    const nSuccesses = nVms - nFailures - nSkipped
+    const globalStatus = globalSuccess
+      ? `Success`
+      : nFailures !== 0 ? `Failure` : `Skipped`
+    let markdown = [
+      `##  Global status: ${globalStatus}`,
+      '',
+      `- **mode**: ${mode}`,
+      `- **Start time**: ${formatDate(jobLog.start)}`,
+      `- **End time**: ${formatDate(jobLog.end)}`,
+      `- **Duration**: ${formatDuration(jobLog.duration)}`,
+      `- **Successes**: ${nSuccesses} / ${nVms}`,
+    ]
+
+    if (globalTransferSize !== 0) {
+      markdown.push(`- **Transfer size**: ${formatSize(globalTransferSize)}`)
+    }
+    if (globalMergeSize !== 0) {
+      markdown.push(`- **Merge size**: ${formatSize(globalMergeSize)}`)
+    }
+    markdown.push('')
+
+    if (nFailures !== 0) {
+      markdown.push(
+        '---',
+        '',
+        `## ${nFailures} Failure${nFailures === 1 ? '' : 's'}`,
+        '',
+        ...failedVmsText
+      )
+    }
+
+    if (nSkipped !== 0) {
+      markdown.push('---', '', `## ${nSkipped} Skipped`, '', ...skippedVmsText)
+    }
+
+    if (nSuccesses !== 0 && reportWhen !== 'failure') {
+      markdown.push(
+        '---',
+        '',
+        `## ${nSuccesses} Success${nSuccesses === 1 ? '' : 'es'}`,
+        '',
+        ...successfulVmsText
+      )
+    }
+
+    markdown.push('---', '', `*${pkg.name} v${pkg.version}*`)
+    markdown = markdown.join('\n')
+    return this._sendReport({
+      markdown,
+      subject: `[Xen Orchestra] ${globalStatus} − Backup report for ${jobName} ${
+        globalSuccess
+          ? ICON_SUCCESS
+          : nFailures !== 0 ? ICON_FAILURE : ICON_SKIPPED
+      }`,
+      nagiosStatus: globalSuccess ? 0 : 2,
+      nagiosMarkdown: globalSuccess
+        ? `[Xen Orchestra] [Success] Backup report for ${jobName}`
+        : `[Xen Orchestra] [${
+            nFailures !== 0 ? 'Failure' : 'Skipped'
+          }] Backup report for ${jobName} - VMs : ${nagiosText.join(' ')}`,
+    })
+  }
+
+  _sendReport ({ markdown, subject, nagiosStatus, nagiosMarkdown }) {
+    const xo = this._xo
+    return Promise.all([
+      xo.sendEmail !== undefined &&
+        xo.sendEmail({
+          to: this._mailsReceivers,
+          subject,
+          markdown,
+        }),
+      xo.sendToXmppClient !== undefined &&
+        xo.sendToXmppClient({
+          to: this._xmppReceivers,
+          message: markdown,
+        }),
+      xo.sendSlackMessage !== undefined &&
+        xo.sendSlackMessage({
+          message: markdown,
+        }),
+      xo.sendPassiveCheck !== undefined &&
+        xo.sendPassiveCheck({
+          nagiosStatus,
+          message: nagiosMarkdown,
+        }),
+    ])
   }
 
   _listener (status) {
-    const { calls } = status
+    const { calls, timezone, error } = status
+    const formatDate = createDateFormater(timezone)
+
+    if (status.error !== undefined) {
+      const [globalStatus, icon] =
+        error.message === NO_VMS_MATCH_THIS_PATTERN
+          ? ['Skipped', ICON_SKIPPED]
+          : ['Failure', ICON_FAILURE]
+
+      let markdown = [
+        `##  Global status: ${globalStatus}`,
+        '',
+        `- **Start time**: ${formatDate(status.start)}`,
+        `- **End time**: ${formatDate(status.end)}`,
+        `- **Duration**: ${formatDuration(status.end - status.start)}`,
+        `- **Error**: ${error.message}`,
+        '---',
+        '',
+        `*${pkg.name} v${pkg.version}*`,
+      ]
+
+      markdown = markdown.join('\n')
+      return this._sendReport({
+        subject: `[Xen Orchestra] ${globalStatus} ${icon}`,
+        markdown,
+        nagiosStatus: 2,
+        nagiosMarkdown: `[Xen Orchestra] [${globalStatus}] Error : ${
+          error.message
+        }`,
+      })
+    }
+
     const callIds = Object.keys(calls)
 
     const nCalls = callIds.length
@@ -139,8 +477,6 @@ class BackupReportsXoPlugin {
     const skippedBackupsText = []
     const successfulBackupText = []
 
-    const formatDate = createDateFormater(status.timezone)
-
     forEach(calls, call => {
       const { id = call.params.vm } = call.params
 
@@ -226,9 +562,8 @@ class BackupReportsXoPlugin {
       return
     }
 
-    const { end, start } = status
     const { tag } = oneCall.params
-    const duration = end - start
+    const duration = status.end - status.start
     const nSuccesses = nCalls - nFailures - nSkipped
     const globalStatus = globalSuccess
       ? `Success`
@@ -238,8 +573,8 @@ class BackupReportsXoPlugin {
       `##  Global status: ${globalStatus}`,
       '',
       `- **Type**: ${formatMethod(method)}`,
-      `- **Start time**: ${formatDate(start)}`,
-      `- **End time**: ${formatDate(end)}`,
+      `- **Start time**: ${formatDate(status.start)}`,
+      `- **End time**: ${formatDate(status.end)}`,
       `- **Duration**: ${formatDuration(duration)}`,
       `- **Successes**: ${nSuccesses} / ${nCalls}`,
     ]
@@ -285,37 +620,20 @@ class BackupReportsXoPlugin {
 
     markdown = markdown.join('\n')
 
-    const xo = this._xo
-    return Promise.all([
-      xo.sendEmail !== undefined &&
-        xo.sendEmail({
-          to: this._mailsReceivers,
-          subject: `[Xen Orchestra] ${globalStatus} − Backup report for ${tag} ${
-            globalSuccess
-              ? ICON_SUCCESS
-              : nFailures !== 0 ? ICON_FAILURE : ICON_SKIPPED
-          }`,
-          markdown,
-        }),
-      xo.sendToXmppClient !== undefined &&
-        xo.sendToXmppClient({
-          to: this._xmppReceivers,
-          message: markdown,
-        }),
-      xo.sendSlackMessage !== undefined &&
-        xo.sendSlackMessage({
-          message: markdown,
-        }),
-      xo.sendPassiveCheck !== undefined &&
-        xo.sendPassiveCheck({
-          status: globalSuccess ? 0 : 2,
-          message: globalSuccess
-            ? `[Xen Orchestra] [Success] Backup report for ${tag}`
-            : `[Xen Orchestra] [${
-              nFailures !== 0 ? 'Failure' : 'Skipped'
-            }] Backup report for ${tag} - VMs : ${nagiosText.join(' ')}`,
-        }),
-    ])
+    return this._sendReport({
+      markdown,
+      subject: `[Xen Orchestra] ${globalStatus} − Backup report for ${tag} ${
+        globalSuccess
+          ? ICON_SUCCESS
+          : nFailures !== 0 ? ICON_FAILURE : ICON_SKIPPED
+      }`,
+      nagiosStatus: globalSuccess ? 0 : 2,
+      nagiosMarkdown: globalSuccess
+        ? `[Xen Orchestra] [Success] Backup report for ${tag}`
+        : `[Xen Orchestra] [${
+            nFailures !== 0 ? 'Failure' : 'Skipped'
+          }] Backup report for ${tag} - VMs : ${nagiosText.join(' ')}`,
+    })
   }
 }
 

packages/xo-server/bin/xo-server

@@ -1,31 +0,0 @@
-#!/usr/bin/env node
-
-'use strict'
-
-// ===================================================================
-
-// Better stack traces if possible.
-require('../better-stacks')
-
-// Use Bluebird for all promises as it provides better performance and
-// less memory usage.
-global.Promise = require('bluebird')
-
-// Make unhandled rejected promises visible.
-process.on('unhandledRejection', function (reason) {
-  console.warn('[Warn] Possibly unhandled rejection:', reason && reason.stack || reason)
-})
-
-;(function (EE) {
-  var proto = EE.prototype
-  var emit = proto.emit
-  proto.emit = function patchedError (event, error) {
-    if (event === 'error' && !this.listenerCount(event)) {
-      return console.warn('[Warn] Unhandled error event:', error && error.stack || error)
-    }
-
-    return emit.apply(this, arguments)
-  }
-})(require('events').EventEmitter)
-
-require('exec-promise')(require('../'))

packages/xo-server/index.js

@@ -1,11 +0,0 @@
-'use strict'
-
-// ===================================================================
-
-// Enable xo logs by default.
-if (process.env.DEBUG === undefined) {
-  process.env.DEBUG = 'app-conf,xo:*,-xo:api'
-}
-
-// Import the real main module.
-module.exports = require('./dist').default

packages/xo-server/package.json

@@ -1,6 +1,6 @@
 {
   "name": "xo-server",
-  "version": "5.19.2",
+  "version": "5.19.4",
   "license": "AGPL-3.0",
   "description": "Server part of Xen-Orchestra",
   "keywords": [
@@ -16,6 +16,9 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "preferGlobal": true,
+  "bin": {
+    "xo-server": "dist/cli"
+  },
   "files": [
     "better-stacks.js",
     "bin/",
@@ -34,6 +37,7 @@
     "@babel/polyfill": "7.0.0-beta.44",
     "@marsaud/smb2-promise": "^0.2.1",
     "@xen-orchestra/cron": "^1.0.3",
+    "@xen-orchestra/fs": "^0.0.0",
     "ajv": "^6.1.1",
     "app-conf": "^0.5.0",
     "archiver": "^2.1.0",
@@ -59,6 +63,7 @@
     "fatfs": "^0.10.4",
     "from2": "^2.3.0",
     "fs-extra": "^5.0.0",
+    "get-stream": "^3.0.0",
     "golike-defer": "^0.4.1",
     "hashy": "^0.6.2",
     "helmet": "^3.9.0",
@@ -109,6 +114,7 @@
     "tmp": "^0.0.33",
     "uuid": "^3.0.1",
     "value-matcher": "^0.2.0",
+    "vhd-lib": "^0.0.0",
     "ws": "^5.0.0",
     "xen-api": "^0.16.9",
     "xml2js": "^0.4.19",
@@ -116,7 +122,8 @@
     "xo-collection": "^0.4.1",
     "xo-common": "^0.1.1",
     "xo-remote-parser": "^0.3",
-    "xo-vmdk-to-vhd": "0.0.12"
+    "xo-vmdk-to-vhd": "0.1.0",
+    "yazl": "^2.4.3"
   },
   "devDependencies": {
     "@babel/cli": "7.0.0-beta.44",

packages/xo-server/src/api/backup-ng.js

@@ -1,3 +1,7 @@
+import { basename } from 'path'
+
+import { safeDateFormat } from '../utils'
+
 export function createJob ({ schedules, ...job }) {
   job.userId = this.user.id
   return this.createBackupNgJob(job, schedules)
@@ -130,6 +134,14 @@ runJob.params = {
 
 // -----------------------------------------------------------------------------
 
+export function getAllLogs () {
+  return this.getBackupNgLogs()
+}
+
+getAllLogs.permission = 'admin'
+
+// -----------------------------------------------------------------------------
+
 export function deleteVmBackup ({ id }) {
   return this.deleteVmBackupNg(id)
 }
@@ -171,3 +183,88 @@ importVmBackup.params = {
     type: 'string',
   },
 }
+
+// -----------------------------------------------------------------------------
+
+export function listPartitions ({ remote, disk }) {
+  return this.listBackupNgDiskPartitions(remote, disk)
+}
+
+listPartitions.permission = 'admin'
+
+listPartitions.params = {
+  disk: {
+    type: 'string',
+  },
+  remote: {
+    type: 'string',
+  },
+}
+
+export function listFiles ({ remote, disk, partition, path }) {
+  return this.listBackupNgPartitionFiles(remote, disk, partition, path)
+}
+
+listFiles.permission = 'admin'
+
+listFiles.params = {
+  disk: {
+    type: 'string',
+  },
+  partition: {
+    type: 'string',
+    optional: true,
+  },
+  path: {
+    type: 'string',
+  },
+  remote: {
+    type: 'string',
+  },
+}
+
+async function handleFetchFiles (req, res, { remote, disk, partition, paths }) {
+  const zipStream = await this.fetchBackupNgPartitionFiles(
+    remote,
+    disk,
+    partition,
+    paths
+  )
+
+  res.setHeader('content-disposition', 'attachment')
+  res.setHeader('content-type', 'application/octet-stream')
+  return zipStream
+}
+
+export async function fetchFiles (params) {
+  const { paths } = params
+  let filename = `restore_${safeDateFormat(new Date())}`
+  if (paths.length === 1) {
+    filename += `_${basename(paths[0])}`
+  }
+  filename += '.zip'
+
+  return this.registerHttpRequest(handleFetchFiles, params, {
+    suffix: encodeURI(`/${filename}`),
+  }).then(url => ({ $getFrom: url }))
+}
+
+fetchFiles.permission = 'admin'
+
+fetchFiles.params = {
+  disk: {
+    type: 'string',
+  },
+  partition: {
+    optional: true,
+    type: 'string',
+  },
+  paths: {
+    items: { type: 'string' },
+    minLength: 1,
+    type: 'array',
+  },
+  remote: {
+    type: 'string',
+  },
+}

packages/xo-server/src/api/log.js

@@ -1,19 +1,5 @@
-export async function get ({ namespace }) {
-  const logger = await this.getLogger(namespace)
-
-  return new Promise((resolve, reject) => {
-    const logs = {}
-
-    logger
-      .createReadStream()
-      .on('data', data => {
-        logs[data.key] = data.value
-      })
-      .on('end', () => {
-        resolve(logs)
-      })
-      .on('error', reject)
-  })
+export function get ({ namespace }) {
+  return this.getLogs(namespace)
 }
 
 get.description = 'returns logs list for one namespace'

packages/xo-server/src/api/xo.js

@@ -1,7 +1,6 @@
+import getStream from 'get-stream'
 import { forEach } from 'lodash'
 
-import { streamToBuffer } from '../utils'
-
 // ===================================================================
 
 export function clean () {
@@ -61,7 +60,7 @@ getAllObjects.params = {
 export async function importConfig () {
   return {
     $sendTo: await this.registerHttpRequest(async (req, res) => {
-      await this.importConfig(JSON.parse(await streamToBuffer(req)))
+      await this.importConfig(JSON.parse(await getStream.buffer(req)))
 
       res.end('config successfully imported')
     }),

packages/xo-server/src/cli.js

@@ -0,0 +1,176 @@
+#!/usr/bin/env node
+
+const APP_NAME = 'xo-server'
+
+// Enable xo logs by default.
+if (process.env.DEBUG === undefined) {
+  process.env.DEBUG = 'app-conf,xo:*,-xo:api'
+}
+
+// -------------------------------------------------------------------
+
+require('@xen-orchestra/log/configure').configure([
+  {
+    filter: process.env.DEBUG,
+    level: 'warn',
+
+    transport: require('@xen-orchestra/log/transports/console').default(),
+  },
+])
+
+const { info, warn } = require('@xen-orchestra/log').createLogger('bootstrap')
+
+process.on('unhandledRejection', reason => {
+  warn('possibly unhandled rejection', reason)
+})
+process.on('warning', warning => {
+  warn('Node warning', warning)
+})
+;(({ prototype }) => {
+  const { emit } = prototype
+  prototype.emit = function (event, error) {
+    event === 'error' && !this.listenerCount(event)
+      ? warn('unhandled error event', error)
+      : emit.apply(this, arguments)
+  }
+})(require('events').EventEmitter)
+
+// Use Bluebird for all promises as it provides better performance and
+// less memory usage.
+const Bluebird = require('bluebird')
+Bluebird.config({
+  longStackTraces: true,
+  warnings: true,
+})
+global.Promise = Bluebird
+
+// -------------------------------------------------------------------
+
+const main = async args => {
+  if (args.includes('--help') || args.includes('-h')) {
+    const { name, version } = require('../package.json')
+    return console.log(`Usage: ${name} [--safe-mode]
+
+${name} v${version}`)
+  }
+
+  info('starting')
+
+  const config = await require('app-conf').load(APP_NAME, {
+    appDir: `${__dirname}/..`,
+    ignoreUnknownFormats: true,
+  })
+
+  // Print a message if deprecated entries are specified.
+  ;['users', 'servers'].forEach(entry => {
+    if (entry in config) {
+      warn(`${entry} configuration is deprecated`)
+    }
+  })
+
+  const httpServer = require('stoppable')(new (require('http-server-plus'))())
+
+  const readFile = Bluebird.promisify(require('fs').readFile)
+  await Promise.all(
+    config.http.listen.map(
+      async ({
+        certificate,
+        // The properties was called `certificate` before.
+        cert = certificate,
+        key,
+        ...opts
+      }) => {
+        if (cert !== undefined && key !== undefined) {
+          ;[opts.cert, opts.key] = await Promise.all([
+            readFile(cert),
+            readFile(key),
+          ])
+        }
+
+        try {
+          const niceAddress = await httpServer.listen(opts)
+          info(`web server listening on ${niceAddress}`)
+        } catch (error) {
+          if (error.niceAddress !== undefined) {
+            warn(`web server could not listen on ${error.niceAddress}`)
+
+            const { code } = error
+            if (code === 'EACCES') {
+              warn('  access denied.')
+              warn('  ports < 1024 are often reserved to privileges users.')
+            } else if (code === 'EADDRINUSE') {
+              warn('  address already in use.')
+            }
+          } else {
+            warn('web server could not listen', error)
+          }
+        }
+      }
+    )
+  )
+
+  // Now the web server is listening, drop privileges.
+  try {
+    const { group, user } = config
+    if (group !== undefined) {
+      process.setgid(group)
+      info('group changed to', group)
+    }
+    if (user !== undefined) {
+      process.setuid(user)
+      info('user changed to', user)
+    }
+  } catch (error) {
+    warn('failed to change group/user', error)
+  }
+
+  const child = require('child_process').fork(require.resolve('./worker.js'))
+  child.send([''])
+
+  const App = require('./xo').default
+  const app = new App({
+    appName: APP_NAME,
+    config,
+    httpServer,
+    safeMode: require('lodash/includes')(args, '--safe-mode'),
+  })
+
+  // Register web server close on XO stop.
+  app.on('stop', () => Bluebird.fromCallback(cb => httpServer.stop(cb)))
+
+  await app.start()
+
+  // Trigger a clean job.
+  await app.clean()
+
+  // Gracefully shutdown on signals.
+  //
+  // TODO: implements a timeout? (or maybe it is the services launcher
+  // responsibility?)
+  require('lodash/forEach')(['SIGINT', 'SIGTERM'], signal => {
+    let alreadyCalled = false
+
+    process.on(signal, () => {
+      if (alreadyCalled) {
+        warn('forced exit')
+        process.exit(1)
+      }
+      alreadyCalled = true
+
+      info(`${signal} caught, closing…`)
+      app.stop()
+    })
+  })
+
+  await require('event-to-promise')(app, 'stopped')
+}
+main(process.argv.slice(2)).then(
+  () => info('bye :-)'),
+  error => {
+    if (typeof error === 'number') {
+      process.exitCode = error
+    } else {
+      warn('fatal error', error)
+    }
+  }
+)

packages/xo-server/src/front/index.js

@@ -0,0 +1,348 @@
+const compilePug = require('pug').compile
+const createProxyServer = require('http-proxy').createServer
+const JsonRpcPeer = require('json-rpc-peer')
+const LocalStrategy = require('passport-local').Strategy
+const parseCookies = require('cookie').parse
+const Passport = require('passport')
+const serveStatic = require('serve-static')
+const WebSocket = require('ws')
+const { fromCallback } = require('promise-toolbox')
+const { invalidCredentials } = require('xo-common/api-errors')
+const { readFile } = require('fs')
+
+const proxyConsole = require('../proxy-console')
+
+const { debug, warn } = require('@xen-orchestra/log').createLogger('front')
+
+function createExpressApp ({ http: config }, httpServer) {
+  const express = require('express')()
+
+  express.use(require('helmet')())
+
+  if (config.redirectToHttps) {
+    const https = config.listen.find(
+      _ =>
+        _.port !== undefined &&
+        (_.cert !== undefined || _.certificate !== undefined)
+    )
+
+    if (https === undefined) {
+      warn('could not setup HTTPs redirection: no HTTPs config found')
+    } else {
+      const { port } = https
+      express.use((req, res, next) => {
+        if (req.secure) {
+          return next()
+        }
+
+        res.redirect(`https://${req.hostname}:${port}${req.originalUrl}`)
+      })
+    }
+  }
+
+  Object.keys(config.mounts).forEach(url => {
+    const paths = config.mounts[url]
+    ;(Array.isArray(paths) ? paths : [paths]).forEach(path => {
+      debug('Setting up %s → %s', url, path)
+
+      express.use(url, serveStatic(path))
+    })
+  })
+
+  return express
+}
+
+function setUpApi (config, httpServer, xo) {
+  const webSocketServer = new WebSocket.Server({
+    noServer: true,
+  })
+  xo.on('stop', () => fromCallback(cb => webSocketServer.close(cb)))
+
+  const onConnection = (socket, upgradeReq) => {
+    const { remoteAddress } = upgradeReq.socket
+
+    debug('+ WebSocket connection (%s)', remoteAddress)
+
+    // Create the abstract XO object for this connection.
+    const connection = xo.createUserConnection()
+    connection.once('close', () => {
+      socket.close()
+    })
+
+    // Create the JSON-RPC server for this connection.
+    const jsonRpc = new JsonRpcPeer(message => {
+      if (message.type === 'request') {
+        return xo.callApiMethod(connection, message.method, message.params)
+      }
+    })
+    connection.notify = jsonRpc.notify.bind(jsonRpc)
+
+    // Close the XO connection with this WebSocket.
+    socket.once('close', () => {
+      debug('- WebSocket connection (%s)', remoteAddress)
+
+      connection.close()
+    })
+
+    // Connect the WebSocket to the JSON-RPC server.
+    socket.on('message', message => {
+      jsonRpc.write(message)
+    })
+
+    const onSend = error => {
+      if (error) {
+        warn('WebSocket send:', error.stack)
+      }
+    }
+    jsonRpc.on('data', data => {
+      // The socket may have been closed during the API method
+      // execution.
+      if (socket.readyState === WebSocket.OPEN) {
+        socket.send(data, onSend)
+      }
+    })
+  }
+  httpServer.on('upgrade', (req, socket, head) => {
+    if (req.url === '/api/') {
+      webSocketServer.handleUpgrade(req, socket, head, ws =>
+        onConnection(ws, req)
+      )
+    }
+  })
+}
+
+function setUpConsoleProxy (httpServer, xo) {
+  const webSocketServer = new WebSocket.Server({
+    noServer: true,
+  })
+
+  const CONSOLE_PROXY_PATH_RE = /^\/api\/consoles\/(.*)$/
+  httpServer.on('upgrade', async (req, socket, head) => {
+    const matches = CONSOLE_PROXY_PATH_RE.exec(req.url)
+    if (!matches) {
+      return
+    }
+
+    const [, id] = matches
+    try {
+      // TODO: factorize permissions checking in an Express middleware.
+      {
+        const { token } = parseCookies(req.headers.cookie)
+
+        const user = await xo.authenticateUser({ token })
+        if (!await xo.hasPermissions(user.id, [[id, 'operate']])) {
+          throw invalidCredentials()
+        }
+
+        const { remoteAddress } = socket
+        debug('+ Console proxy (%s - %s)', user.name, remoteAddress)
+        socket.on('close', () => {
+          debug('- Console proxy (%s - %s)', user.name, remoteAddress)
+        })
+      }
+
+      const xapi = xo.getXapi(id, ['VM', 'VM-controller'])
+      const vmConsole = xapi.getVmConsole(id)
+
+      // FIXME: lost connection due to VM restart is not detected.
+      webSocketServer.handleUpgrade(req, socket, head, connection => {
+        proxyConsole(connection, vmConsole, xapi.sessionId)
+      })
+    } catch (error) {
+      console.error((error && error.stack) || error)
+    }
+  })
+}
+
+async function setUpPassport (express, xo) {
+  // necessary for connect-flash
+  express.use(require('cookie-parser')())
+  express.use(
+    require('express-session')({
+      resave: false,
+      saveUninitialized: false,
+
+      // TODO: should be in the config file.
+      secret: 'CLWguhRZAZIXZcbrMzHCYmefxgweItKnS',
+    })
+  )
+
+  // necessary for Passport to display error messages
+  express.use(require('connect-flash')())
+
+  // necessary for Passport to access the username and password from the sign
+  // in form
+  express.use(require('body-parser').urlencoded({ extended: false }))
+
+  express.use(Passport.initialize())
+
+  const strategies = { __proto__: null }
+  xo.registerPassportStrategy = strategy => {
+    Passport.use(strategy)
+
+    const { name } = strategy
+    if (name !== 'local') {
+      strategies[name] = strategy.label || name
+    }
+  }
+
+  // Registers the sign in form.
+  const signInPage = compilePug(
+    await fromCallback(cb => readFile(`${__dirname}/../signin.pug`, cb))
+  )
+  express.get('/signin', (req, res, next) => {
+    res.send(
+      signInPage({
+        error: req.flash('error')[0],
+        strategies,
+      })
+    )
+  })
+
+  express.get('/signout', (req, res) => {
+    res.clearCookie('token')
+    res.redirect('/')
+  })
+
+  const SIGNIN_STRATEGY_RE = /^\/signin\/([^/]+)(\/callback)?(:?\?.*)?$/
+  express.use(async (req, res, next) => {
+    const { url } = req
+    const matches = url.match(SIGNIN_STRATEGY_RE)
+
+    if (matches !== null) {
+      return Passport.authenticate(matches[1], async (err, user, info) => {
+        if (err) {
+          return next(err)
+        }
+
+        if (!user) {
+          req.flash('error', info ? info.message : 'Invalid credentials')
+          return res.redirect('/signin')
+        }
+
+        // The cookie will be set in via the next request because some
+        // browsers do not save cookies on redirect.
+        req.flash(
+          'token',
+          (await xo.createAuthenticationToken({ userId: user.id })).id
+        )
+
+        // The session is only persistent for internal provider and if 'Remember me' box is checked
+        req.flash(
+          'session-is-persistent',
+          matches[1] === 'local' && req.body['remember-me'] === 'on'
+        )
+
+        res.redirect(req.flash('return-url')[0] || '/')
+      })(req, res, next)
+    }
+
+    const token = req.flash('token')[0]
+
+    if (token) {
+      const isPersistent = req.flash('session-is-persistent')[0]
+
+      if (isPersistent) {
+        // Persistent cookie ? => 1 year
+        res.cookie('token', token, { maxAge: 1000 * 60 * 60 * 24 * 365 })
+      } else {
+        // Non-persistent : external provider as Github, Twitter...
+        res.cookie('token', token)
+      }
+
+      next()
+    } else if (req.cookies.token) {
+      next()
+    } else if (
+      /favicon|fontawesome|images|styles|\.(?:css|jpg|png)$/.test(url)
+    ) {
+      next()
+    } else {
+      req.flash('return-url', url)
+      return res.redirect('/signin')
+    }
+  })
+
+  // Install the local strategy.
+  xo.registerPassportStrategy(
+    new LocalStrategy(async (username, password, done) => {
+      try {
+        const user = await xo.authenticateUser({ username, password })
+        done(null, user)
+      } catch (error) {
+        done(null, false, { message: error.message })
+      }
+    })
+  )
+}
+
+function setUpProxies ({ http: { proxies } }, httpServer, express, xo) {
+  if (proxies === undefined) {
+    return
+  }
+
+  const proxy = createProxyServer({
+    ignorePath: true,
+  }).on('error', error => console.error(error))
+
+  const prefixes = Object.keys(proxies).sort((a, b) => a.length - b.length)
+  const n = prefixes.length
+
+  // HTTP request proxy.
+  express.use((req, res, next) => {
+    const { url } = req
+
+    for (let i = 0; i < n; ++i) {
+      const prefix = prefixes[i]
+      if (url.startsWith(prefix)) {
+        const target = proxies[prefix]
+
+        proxy.web(req, res, {
+          target: target + url.slice(prefix.length),
+        })
+
+        return
+      }
+    }
+
+    next()
+  })
+
+  // WebSocket proxy.
+  const webSocketServer = new WebSocket.Server({
+    noServer: true,
+  })
+  xo.on('stop', () => fromCallback(cb => webSocketServer.close(cb)))
+
+  httpServer.on('upgrade', (req, socket, head) => {
+    const { url } = req
+
+    for (let i = 0; i < n; ++i) {
+      const prefix = prefixes[i]
+      if (url.startsWith(prefix)) {
+        const target = proxies[prefix]
+
+        proxy.ws(req, socket, head, {
+          target: target + url.slice(prefix.length),
+        })
+
+        return
+      }
+    }
+  })
+}
+
+export default async function main ({ config, httpServer, safeMode }) {
+  const express = createExpressApp(config, httpServer)
+
+  setUpProxies(config, httpServer, express, xo)
+
+  setUpApi(config, httpServer, xo)
+
+  // must be set up before the API
+  setUpConsoleProxy(httpServer, xo)
+
+  await setUpPassport(express, xo)
+
+  // TODO: express.use(xo._handleHttpRequest.bind(xo))
+}

packages/xo-server/src/index.js

@@ -1,656 +0,0 @@
-import appConf from 'app-conf'
-import bind from 'lodash/bind'
-import blocked from 'blocked'
-import createExpress from 'express'
-import createLogger from 'debug'
-import has from 'lodash/has'
-import helmet from 'helmet'
-import includes from 'lodash/includes'
-import proxyConsole from './proxy-console'
-import serveStatic from 'serve-static'
-import startsWith from 'lodash/startsWith'
-import stoppable from 'stoppable'
-import WebSocket from 'ws'
-import { compile as compilePug } from 'pug'
-import { createServer as createProxyServer } from 'http-proxy'
-import { fromEvent } from 'promise-toolbox'
-import { join as joinPath } from 'path'
-
-import JsonRpcPeer from 'json-rpc-peer'
-import { invalidCredentials } from 'xo-common/api-errors'
-import { ensureDir, readdir, readFile } from 'fs-extra'
-
-import WebServer from 'http-server-plus'
-import Xo from './xo'
-import {
-  forEach,
-  isArray,
-  isFunction,
-  mapToArray,
-  pFromCallback,
-} from './utils'
-
-import bodyParser from 'body-parser'
-import connectFlash from 'connect-flash'
-import cookieParser from 'cookie-parser'
-import expressSession from 'express-session'
-import passport from 'passport'
-import { parse as parseCookies } from 'cookie'
-import { Strategy as LocalStrategy } from 'passport-local'
-
-// ===================================================================
-
-const debug = createLogger('xo:main')
-
-const warn = (...args) => {
-  console.warn('[Warn]', ...args)
-}
-
-// ===================================================================
-
-const DEPRECATED_ENTRIES = ['users', 'servers']
-
-async function loadConfiguration () {
-  const config = await appConf.load('xo-server', {
-    appDir: joinPath(__dirname, '..'),
-    ignoreUnknownFormats: true,
-  })
-
-  debug('Configuration loaded.')
-
-  // Print a message if deprecated entries are specified.
-  forEach(DEPRECATED_ENTRIES, entry => {
-    if (has(config, entry)) {
-      warn(`${entry} configuration is deprecated.`)
-    }
-  })
-
-  return config
-}
-
-// ===================================================================
-
-function createExpressApp () {
-  const app = createExpress()
-
-  app.use(helmet())
-
-  // Registers the cookie-parser and express-session middlewares,
-  // necessary for connect-flash.
-  app.use(cookieParser())
-  app.use(
-    expressSession({
-      resave: false,
-      saveUninitialized: false,
-
-      // TODO: should be in the config file.
-      secret: 'CLWguhRZAZIXZcbrMzHCYmefxgweItKnS',
-    })
-  )
-
-  // Registers the connect-flash middleware, necessary for Passport to
-  // display error messages.
-  app.use(connectFlash())
-
-  // Registers the body-parser middleware, necessary for Passport to
-  // access the username and password from the sign in form.
-  app.use(bodyParser.urlencoded({ extended: false }))
-
-  // Registers Passport's middlewares.
-  app.use(passport.initialize())
-
-  return app
-}
-
-async function setUpPassport (express, xo) {
-  const strategies = { __proto__: null }
-  xo.registerPassportStrategy = strategy => {
-    passport.use(strategy)
-
-    const { name } = strategy
-    if (name !== 'local') {
-      strategies[name] = strategy.label || name
-    }
-  }
-
-  // Registers the sign in form.
-  const signInPage = compilePug(
-    await readFile(joinPath(__dirname, '..', 'signin.pug'))
-  )
-  express.get('/signin', (req, res, next) => {
-    res.send(
-      signInPage({
-        error: req.flash('error')[0],
-        strategies,
-      })
-    )
-  })
-
-  express.get('/signout', (req, res) => {
-    res.clearCookie('token')
-    res.redirect('/')
-  })
-
-  const SIGNIN_STRATEGY_RE = /^\/signin\/([^/]+)(\/callback)?(:?\?.*)?$/
-  express.use(async (req, res, next) => {
-    const { url } = req
-    const matches = url.match(SIGNIN_STRATEGY_RE)
-
-    if (matches) {
-      return passport.authenticate(matches[1], async (err, user, info) => {
-        if (err) {
-          return next(err)
-        }
-
-        if (!user) {
-          req.flash('error', info ? info.message : 'Invalid credentials')
-          return res.redirect('/signin')
-        }
-
-        // The cookie will be set in via the next request because some
-        // browsers do not save cookies on redirect.
-        req.flash(
-          'token',
-          (await xo.createAuthenticationToken({ userId: user.id })).id
-        )
-
-        // The session is only persistent for internal provider and if 'Remember me' box is checked
-        req.flash(
-          'session-is-persistent',
-          matches[1] === 'local' && req.body['remember-me'] === 'on'
-        )
-
-        res.redirect(req.flash('return-url')[0] || '/')
-      })(req, res, next)
-    }
-
-    const token = req.flash('token')[0]
-
-    if (token) {
-      const isPersistent = req.flash('session-is-persistent')[0]
-
-      if (isPersistent) {
-        // Persistent cookie ? => 1 year
-        res.cookie('token', token, { maxAge: 1000 * 60 * 60 * 24 * 365 })
-      } else {
-        // Non-persistent : external provider as Github, Twitter...
-        res.cookie('token', token)
-      }
-
-      next()
-    } else if (req.cookies.token) {
-      next()
-    } else if (
-      /favicon|fontawesome|images|styles|\.(?:css|jpg|png)$/.test(url)
-    ) {
-      next()
-    } else {
-      req.flash('return-url', url)
-      return res.redirect('/signin')
-    }
-  })
-
-  // Install the local strategy.
-  xo.registerPassportStrategy(
-    new LocalStrategy(async (username, password, done) => {
-      try {
-        const user = await xo.authenticateUser({ username, password })
-        done(null, user)
-      } catch (error) {
-        done(null, false, { message: error.message })
-      }
-    })
-  )
-}
-
-// ===================================================================
-
-async function registerPlugin (pluginPath, pluginName) {
-  const plugin = require(pluginPath)
-  const { description, version = 'unknown' } = (() => {
-    try {
-      return require(pluginPath + '/package.json')
-    } catch (_) {
-      return {}
-    }
-  })()
-
-  // Supports both “normal” CommonJS and Babel's ES2015 modules.
-  const {
-    default: factory = plugin,
-    configurationSchema,
-    configurationPresets,
-    testSchema,
-  } = plugin
-
-  // The default export can be either a factory or directly a plugin
-  // instance.
-  const instance = isFunction(factory)
-    ? factory({
-      xo: this,
-      getDataDir: () => {
-        const dir = `${this._config.datadir}/${pluginName}`
-        return ensureDir(dir).then(() => dir)
-      },
-    })
-    : factory
-
-  await this.registerPlugin(
-    pluginName,
-    instance,
-    configurationSchema,
-    configurationPresets,
-    description,
-    testSchema,
-    version
-  )
-}
-
-const debugPlugin = createLogger('xo:plugin')
-
-function registerPluginWrapper (pluginPath, pluginName) {
-  debugPlugin('register %s', pluginName)
-
-  return registerPlugin.call(this, pluginPath, pluginName).then(
-    () => {
-      debugPlugin(`successfully register ${pluginName}`)
-    },
-    error => {
-      debugPlugin(`failed register ${pluginName}`)
-      debugPlugin(error)
-    }
-  )
-}
-
-const PLUGIN_PREFIX = 'xo-server-'
-const PLUGIN_PREFIX_LENGTH = PLUGIN_PREFIX.length
-
-async function registerPluginsInPath (path) {
-  const files = await readdir(path).catch(error => {
-    if (error.code === 'ENOENT') {
-      return []
-    }
-    throw error
-  })
-
-  await Promise.all(
-    mapToArray(files, name => {
-      if (startsWith(name, PLUGIN_PREFIX)) {
-        return registerPluginWrapper.call(
-          this,
-          `${path}/${name}`,
-          name.slice(PLUGIN_PREFIX_LENGTH)
-        )
-      }
-    })
-  )
-}
-
-async function registerPlugins (xo) {
-  await Promise.all(
-    mapToArray(
-      [`${__dirname}/../node_modules/`, '/usr/local/lib/node_modules/'],
-      xo::registerPluginsInPath
-    )
-  )
-}
-
-// ===================================================================
-
-async function makeWebServerListen (
-  webServer,
-  {
-    certificate,
-
-    // The properties was called `certificate` before.
-    cert = certificate,
-
-    key,
-    ...opts
-  }
-) {
-  if (cert && key) {
-    ;[opts.cert, opts.key] = await Promise.all([readFile(cert), readFile(key)])
-  }
-  try {
-    const niceAddress = await webServer.listen(opts)
-    debug(`Web server listening on ${niceAddress}`)
-  } catch (error) {
-    if (error.niceAddress) {
-      warn(`Web server could not listen on ${error.niceAddress}`)
-
-      const { code } = error
-      if (code === 'EACCES') {
-        warn('  Access denied.')
-        warn('  Ports < 1024 are often reserved to privileges users.')
-      } else if (code === 'EADDRINUSE') {
-        warn('  Address already in use.')
-      }
-    } else {
-      warn('Web server could not listen:', error.message)
-    }
-  }
-}
-
-async function createWebServer ({ listen, listenOptions }) {
-  const webServer = stoppable(new WebServer())
-
-  await Promise.all(
-    mapToArray(listen, opts =>
-      makeWebServerListen(webServer, { ...listenOptions, ...opts })
-    )
-  )
-
-  return webServer
-}
-
-// ===================================================================
-
-const setUpProxies = (express, opts, xo) => {
-  if (!opts) {
-    return
-  }
-
-  const proxy = createProxyServer({
-    ignorePath: true,
-  }).on('error', error => console.error(error))
-
-  // TODO: sort proxies by descending prefix length.
-
-  // HTTP request proxy.
-  express.use((req, res, next) => {
-    const { url } = req
-
-    for (const prefix in opts) {
-      if (startsWith(url, prefix)) {
-        const target = opts[prefix]
-
-        proxy.web(req, res, {
-          target: target + url.slice(prefix.length),
-        })
-
-        return
-      }
-    }
-
-    next()
-  })
-
-  // WebSocket proxy.
-  const webSocketServer = new WebSocket.Server({
-    noServer: true,
-  })
-  xo.on('stop', () => pFromCallback(cb => webSocketServer.close(cb)))
-
-  express.on('upgrade', (req, socket, head) => {
-    const { url } = req
-
-    for (const prefix in opts) {
-      if (startsWith(url, prefix)) {
-        const target = opts[prefix]
-
-        proxy.ws(req, socket, head, {
-          target: target + url.slice(prefix.length),
-        })
-
-        return
-      }
-    }
-  })
-}
-
-// ===================================================================
-
-const setUpStaticFiles = (express, opts) => {
-  forEach(opts, (paths, url) => {
-    if (!isArray(paths)) {
-      paths = [paths]
-    }
-
-    forEach(paths, path => {
-      debug('Setting up %s → %s', url, path)
-
-      express.use(url, serveStatic(path))
-    })
-  })
-}
-
-// ===================================================================
-
-const setUpApi = (webServer, xo, verboseLogsOnErrors) => {
-  const webSocketServer = new WebSocket.Server({
-    noServer: true,
-  })
-  xo.on('stop', () => pFromCallback(cb => webSocketServer.close(cb)))
-
-  const onConnection = (socket, upgradeReq) => {
-    const { remoteAddress } = upgradeReq.socket
-
-    debug('+ WebSocket connection (%s)', remoteAddress)
-
-    // Create the abstract XO object for this connection.
-    const connection = xo.createUserConnection()
-    connection.once('close', () => {
-      socket.close()
-    })
-
-    // Create the JSON-RPC server for this connection.
-    const jsonRpc = new JsonRpcPeer(message => {
-      if (message.type === 'request') {
-        return xo.callApiMethod(connection, message.method, message.params)
-      }
-    })
-    connection.notify = bind(jsonRpc.notify, jsonRpc)
-
-    // Close the XO connection with this WebSocket.
-    socket.once('close', () => {
-      debug('- WebSocket connection (%s)', remoteAddress)
-
-      connection.close()
-    })
-
-    // Connect the WebSocket to the JSON-RPC server.
-    socket.on('message', message => {
-      jsonRpc.write(message)
-    })
-
-    const onSend = error => {
-      if (error) {
-        warn('WebSocket send:', error.stack)
-      }
-    }
-    jsonRpc.on('data', data => {
-      // The socket may have been closed during the API method
-      // execution.
-      if (socket.readyState === WebSocket.OPEN) {
-        socket.send(data, onSend)
-      }
-    })
-  }
-  webServer.on('upgrade', (req, socket, head) => {
-    if (req.url === '/api/') {
-      webSocketServer.handleUpgrade(req, socket, head, ws =>
-        onConnection(ws, req)
-      )
-    }
-  })
-}
-
-// ===================================================================
-
-const CONSOLE_PROXY_PATH_RE = /^\/api\/consoles\/(.*)$/
-
-const setUpConsoleProxy = (webServer, xo) => {
-  const webSocketServer = new WebSocket.Server({
-    noServer: true,
-  })
-  xo.on('stop', () => pFromCallback(cb => webSocketServer.close(cb)))
-
-  webServer.on('upgrade', async (req, socket, head) => {
-    const matches = CONSOLE_PROXY_PATH_RE.exec(req.url)
-    if (!matches) {
-      return
-    }
-
-    const [, id] = matches
-    try {
-      // TODO: factorize permissions checking in an Express middleware.
-      {
-        const { token } = parseCookies(req.headers.cookie)
-
-        const user = await xo.authenticateUser({ token })
-        if (!await xo.hasPermissions(user.id, [[id, 'operate']])) {
-          throw invalidCredentials()
-        }
-
-        const { remoteAddress } = socket
-        debug('+ Console proxy (%s - %s)', user.name, remoteAddress)
-        socket.on('close', () => {
-          debug('- Console proxy (%s - %s)', user.name, remoteAddress)
-        })
-      }
-
-      const xapi = xo.getXapi(id, ['VM', 'VM-controller'])
-      const vmConsole = xapi.getVmConsole(id)
-
-      // FIXME: lost connection due to VM restart is not detected.
-      webSocketServer.handleUpgrade(req, socket, head, connection => {
-        proxyConsole(connection, vmConsole, xapi.sessionId)
-      })
-    } catch (error) {
-      console.error((error && error.stack) || error)
-    }
-  })
-}
-
-// ===================================================================
-
-const USAGE = (({ name, version }) => `Usage: ${name} [--safe-mode]
-
-${name} v${version}`)(require('../package.json'))
-
-// ===================================================================
-
-export default async function main (args) {
-  if (includes(args, '--help') || includes(args, '-h')) {
-    return USAGE
-  }
-
-  {
-    const debug = createLogger('xo:perf')
-    blocked(
-      ms => {
-        debug('blocked for %sms', ms | 0)
-      },
-      {
-        threshold: 50,
-      }
-    )
-  }
-
-  const config = await loadConfiguration()
-
-  const webServer = await createWebServer(config.http)
-
-  // Now the web server is listening, drop privileges.
-  try {
-    const { user, group } = config
-    if (group) {
-      process.setgid(group)
-      debug('Group changed to', group)
-    }
-    if (user) {
-      process.setuid(user)
-      debug('User changed to', user)
-    }
-  } catch (error) {
-    warn('Failed to change user/group:', error)
-  }
-
-  // Creates main object.
-  const xo = new Xo(config)
-
-  // Register web server close on XO stop.
-  xo.on('stop', () => pFromCallback(cb => webServer.stop(cb)))
-
-  // Connects to all registered servers.
-  await xo.start()
-
-  // Trigger a clean job.
-  await xo.clean()
-
-  // Express is used to manage non WebSocket connections.
-  const express = createExpressApp()
-
-  if (config.http.redirectToHttps) {
-    let port
-    forEach(config.http.listen, listen => {
-      if (listen.port && (listen.cert || listen.certificate)) {
-        port = listen.port
-        return false
-      }
-    })
-
-    if (port === undefined) {
-      warn('Could not setup HTTPs redirection: no HTTPs port found')
-    } else {
-      express.use((req, res, next) => {
-        if (req.secure) {
-          return next()
-        }
-
-        res.redirect(`https://${req.hostname}:${port}${req.originalUrl}`)
-      })
-    }
-  }
-
-  // Must be set up before the API.
-  setUpConsoleProxy(webServer, xo)
-
-  // Must be set up before the API.
-  express.use(bind(xo._handleHttpRequest, xo))
-
-  // Everything above is not protected by the sign in, allowing xo-cli
-  // to work properly.
-  await setUpPassport(express, xo)
-
-  // Attaches express to the web server.
-  webServer.on('request', express)
-  webServer.on('upgrade', (req, socket, head) => {
-    express.emit('upgrade', req, socket, head)
-  })
-
-  // Must be set up before the static files.
-  setUpApi(webServer, xo, config.verboseApiLogsOnErrors)
-
-  setUpProxies(express, config.http.proxies, xo)
-
-  setUpStaticFiles(express, config.http.mounts)
-
-  if (!includes(args, '--safe-mode')) {
-    await registerPlugins(xo)
-  }
-
-  // Gracefully shutdown on signals.
-  //
-  // TODO: implements a timeout? (or maybe it is the services launcher
-  // responsibility?)
-  forEach(['SIGINT', 'SIGTERM'], signal => {
-    let alreadyCalled = false
-
-    process.on(signal, () => {
-      if (alreadyCalled) {
-        warn('forced exit')
-        process.exit(1)
-      }
-      alreadyCalled = true
-
-      debug('%s caught, closing…', signal)
-      xo.stop()
-    })
-  })
-
-  await fromEvent(xo, 'stopped')
-
-  debug('bye :-)')
-}

packages/xo-server/src/lvm.js

@@ -1,16 +1,15 @@
 import execa from 'execa'
 import splitLines from 'split-lines'
 import { createParser } from 'parse-pairs'
-import { isArray, map } from 'lodash'
 
 // ===================================================================
 
 const parse = createParser({
   keyTransform: key => key.slice(5).toLowerCase(),
 })
-const makeFunction = command => (fields, ...args) =>
-  execa
-    .stdout(command, [
+const makeFunction = command => async (fields, ...args) => {
+  return splitLines(
+    await execa.stdout(command, [
       '--noheading',
       '--nosuffix',
       '--nameprefixes',
@@ -21,17 +20,8 @@ const makeFunction = command => (fields, ...args) =>
       String(fields),
       ...args,
     ])
-    .then(stdout =>
-      map(
-        splitLines(stdout),
-        isArray(fields)
-          ? parse
-          : line => {
-            const data = parse(line)
-            return data[fields]
-          }
-      )
-    )
+  ).map(Array.isArray(fields) ? parse : line => parse(line)[fields])
+}
 
 export const lvs = makeFunction('lvs')
 export const pvs = makeFunction('pvs')

packages/xo-server/src/schemas/log/jobStart.js

@@ -16,6 +16,11 @@ export default {
     key: {
       type: 'string',
     },
+    type: {
+      default: 'call',
+      enum: ['backup', 'call'],
+    },
+    data: {},
   },
-  required: ['event', 'userId', 'jobId', 'key'],
+  required: ['event', 'userId', 'jobId'],
 }

packages/xo-server/src/schemas/log/taskEnd.js

@@ -0,0 +1,18 @@
+export default {
+  $schema: 'http://json-schema.org/draft-04/schema#',
+  type: 'object',
+  properties: {
+    event: {
+      enum: ['task.end'],
+    },
+    taskId: {
+      type: 'string',
+      description: 'identifier of this task',
+    },
+    status: {
+      enum: ['canceled', 'failure', 'success'],
+    },
+    result: {},
+  },
+  required: ['event', 'taskId', 'status'],
+}

packages/xo-server/src/schemas/log/taskStart.js

@@ -0,0 +1,15 @@
+export default {
+  $schema: 'http://json-schema.org/draft-04/schema#',
+  type: 'object',
+  properties: {
+    event: {
+      enum: ['task.start'],
+    },
+    parentId: {
+      type: 'string',
+      description: 'identifier of the parent task or job',
+    },
+    data: {},
+  },
+  required: ['event'],
+}

packages/xo-server/src/stream-to-new-buffer.js

@@ -1,28 +0,0 @@
-const streamToNewBuffer = stream =>
-  new Promise((resolve, reject) => {
-    const chunks = []
-    let length = 0
-
-    const onData = chunk => {
-      chunks.push(chunk)
-      length += chunk.length
-    }
-    stream.on('data', onData)
-
-    const clean = () => {
-      stream.removeListener('data', onData)
-      stream.removeListener('end', onEnd)
-      stream.removeListener('error', onError)
-    }
-    const onEnd = () => {
-      resolve(Buffer.concat(chunks, length))
-      clean()
-    }
-    stream.on('end', onEnd)
-    const onError = error => {
-      reject(error)
-      clean()
-    }
-    stream.on('error', onError)
-  })
-export { streamToNewBuffer as default }

packages/xo-server/src/utils.js

@@ -55,10 +55,6 @@ export const asyncMap = (collection, iteratee) => {
 
 // -------------------------------------------------------------------
 
-export streamToBuffer from './stream-to-new-buffer'
-
-// -------------------------------------------------------------------
-
 export function camelToSnakeCase (string) {
   return string.replace(
     /([a-z0-9])([A-Z])/g,

packages/xo-server/src/vhd-test.js

@@ -1,72 +0,0 @@
-import execa from 'execa'
-import vhdMerge, { chainVhd, Vhd } from './vhd-merge'
-import LocalHandler from './remote-handlers/local.js'
-
-async function testVhdMerge () {
-  console.log('before merge')
-  const moOfRandom = 4
-  await execa('bash', [
-    '-c',
-    `head -c ${moOfRandom}M < /dev/urandom >randomfile`,
-  ])
-  await execa('bash', [
-    '-c',
-    `head -c ${moOfRandom / 2}M < /dev/urandom >small_randomfile`,
-  ])
-  await execa('qemu-img', [
-    'convert',
-    '-f',
-    'raw',
-    '-Ovpc',
-    'randomfile',
-    'randomfile.vhd',
-  ])
-  await execa('vhd-util', ['check', '-t', '-n', 'randomfile.vhd'])
-  await execa('vhd-util', ['create', '-s', moOfRandom, '-n', 'empty.vhd'])
-  // await execa('vhd-util', ['snapshot', '-n', 'randomfile_delta.vhd', '-p', 'randomfile.vhd'])
-
-  const handler = new LocalHandler({ url: 'file://' + process.cwd() })
-  const originalSize = await handler._getSize('randomfile')
-  await chainVhd(handler, 'empty.vhd', handler, 'randomfile.vhd')
-  const childVhd = new Vhd(handler, 'randomfile.vhd')
-  console.log('changing type')
-  await childVhd.readHeaderAndFooter()
-  console.log('child vhd', childVhd.footer.currentSize, originalSize)
-  await childVhd.readBlockTable()
-  childVhd.footer.diskType = 4 // Delta backup.
-  await childVhd.writeFooter()
-  console.log('chained')
-  await vhdMerge(handler, 'empty.vhd', handler, 'randomfile.vhd')
-  console.log('merged')
-  const parentVhd = new Vhd(handler, 'empty.vhd')
-  await parentVhd.readHeaderAndFooter()
-  console.log('parent vhd', parentVhd.footer.currentSize)
-
-  await execa('qemu-img', [
-    'convert',
-    '-f',
-    'vpc',
-    '-Oraw',
-    'empty.vhd',
-    'recovered',
-  ])
-  await execa('truncate', ['-s', originalSize, 'recovered'])
-  console.log('ls', (await execa('ls', ['-lt'])).stdout)
-  console.log(
-    'diff',
-    (await execa('diff', ['-q', 'randomfile', 'recovered'])).stdout
-  )
-
-  /* const vhd = new Vhd(handler, 'randomfile_delta.vhd')
-  await vhd.readHeaderAndFooter()
-  await vhd.readBlockTable()
-  console.log('vhd.header.maxTableEntries', vhd.header.maxTableEntries)
-  await vhd.ensureBatSize(300)
-
-  console.log('vhd.header.maxTableEntries', vhd.header.maxTableEntries)
-    */
-  console.log(await handler.list())
-  console.log('lol')
-}
-
-export { testVhdMerge as default }

packages/xo-server/src/worker-wrapper.js

@@ -0,0 +1,3 @@
+process.on('message', ([action, ...args]) => {
+  console.log(action, args)
+})

packages/xo-server/src/worker.js

@@ -0,0 +1,143 @@
+import blocked from 'blocked'
+import { createLogger } from '@xen-orchestra/log'
+import { fromEvent } from 'promise-toolbox'
+
+import { ensureDir, readdir } from 'fs-extra'
+
+import Xo from './xo'
+
+// ===================================================================
+
+const { debug } = createLogger('xo:main')
+
+// ===================================================================
+
+async function registerPlugin (pluginPath, pluginName) {
+  const plugin = require(pluginPath)
+  const { description, version = 'unknown' } = (() => {
+    try {
+      return require(pluginPath + '/package.json')
+    } catch (_) {
+      return {}
+    }
+  })()
+
+  // Supports both “normal” CommonJS and Babel's ES2015 modules.
+  const {
+    default: factory = plugin,
+    configurationSchema,
+    configurationPresets,
+    testSchema,
+  } = plugin
+
+  // The default export can be either a factory or directly a plugin
+  // instance.
+  const instance =
+    typeof factory === 'function'
+      ? factory({
+        xo: this,
+        getDataDir: () => {
+          const dir = `${this._config.datadir}/${pluginName}`
+          return ensureDir(dir).then(() => dir)
+        },
+      })
+      : factory
+
+  await this.registerPlugin(
+    pluginName,
+    instance,
+    configurationSchema,
+    configurationPresets,
+    description,
+    testSchema,
+    version
+  )
+}
+
+const debugPlugin = createLogger('xo:plugin')
+
+function registerPluginWrapper (pluginPath, pluginName) {
+  debugPlugin('register %s', pluginName)
+
+  return registerPlugin.call(this, pluginPath, pluginName).then(
+    () => {
+      debugPlugin(`successfully register ${pluginName}`)
+    },
+    error => {
+      debugPlugin(`failed register ${pluginName}`)
+      debugPlugin(error)
+    }
+  )
+}
+
+const PLUGIN_PREFIX = 'xo-server-'
+const PLUGIN_PREFIX_LENGTH = PLUGIN_PREFIX.length
+
+async function registerPluginsInPath (path) {
+  const files = await readdir(path).catch(error => {
+    if (error.code === 'ENOENT') {
+      return []
+    }
+    throw error
+  })
+
+  await Promise.all(
+    files.map(name => {
+      if (name.startsWith(PLUGIN_PREFIX)) {
+        return registerPluginWrapper.call(
+          this,
+          `${path}/${name}`,
+          name.slice(PLUGIN_PREFIX_LENGTH)
+        )
+      }
+    })
+  )
+}
+
+async function registerPlugins (xo) {
+  await Promise.all(
+    [`${__dirname}/../node_modules/`, '/usr/local/lib/node_modules/'].map(
+      xo::registerPluginsInPath
+    )
+  )
+}
+
+// ===================================================================
+
+async function main ({ config, safeMode }) {
+  {
+    const debug = createLogger('xo:perf')
+    blocked(ms => {
+      debug('blocked for %sms', ms | 0)
+    })
+  }
+
+  // Creates main object.
+  const xo = new Xo(config)
+
+  // Connects to all registered servers.
+  await xo.start()
+
+  // Trigger a clean job.
+  await xo.clean()
+
+  if (!safeMode) {
+    await registerPlugins(xo)
+  }
+
+  await new Promise(resolve => {
+    const onMessage = message => {
+      if (message[0] === 'STOP') {
+        process.removeListener('message', onMessage)
+        resolve()
+      }
+    }
+    process.on('message', onMessage)
+  })
+
+  await fromEvent(xo, 'stopped')
+}
+main().then(
+  () => process.send(['STOPPED']),
+  error => process.send(['STOPPED_WITH_ERROR', error])
+)

packages/xo-server/src/xapi/index.js

@@ -1314,7 +1314,7 @@ export default class Xapi extends XapiBase {
   async _importOvaVm (
     $defer,
     stream,
-    { descriptionLabel, disks, memory, nameLabel, networks, nCpus },
+    { descriptionLabel, disks, memory, nameLabel, networks, nCpus, tables },
     sr
   ) {
     // 1. Create VM.
@@ -1387,8 +1387,9 @@ export default class Xapi extends XapiBase {
           return
         }
 
-        const vhdStream = await vmdkToVhd(stream)
-        await this._importVdiContent(vdi, vhdStream, VDI_FORMAT_RAW)
+        const table = tables[entry.name]
+        const vhdStream = await vmdkToVhd(stream, table)
+        await this._importVdiContent(vdi, vhdStream, VDI_FORMAT_VHD)
 
         // See: https://github.com/mafintosh/tar-stream#extracting
         // No import parallelization.

packages/xo-server/src/xapi/index.js.flow

@@ -37,6 +37,8 @@ declare class XapiObject {
 type Id = string | XapiObject
 declare export class Vm extends XapiObject {
   $snapshots: Vm[];
+  is_a_snapshot: boolean;
+  is_a_template: boolean;
   name_label: string;
   other_config: $Dict<string>;
   snapshot_time: number;
@@ -56,7 +58,7 @@ declare export class Xapi {
   _updateObjectMapProperty(
     object: XapiObject,
     property: string,
-    entries: $Dict<string>
+    entries: $Dict<null | string>
   ): Promise<void>;
   _setObjectProperties(
     object: XapiObject,

packages/xo-server/src/xapi/mixins/patching.js

@@ -1,9 +1,9 @@
 import deferrable from 'golike-defer'
 import every from 'lodash/every'
 import find from 'lodash/find'
-import filter from 'lodash/filter'
 import includes from 'lodash/includes'
 import isObject from 'lodash/isObject'
+import pickBy from 'lodash/pickBy'
 import some from 'lodash/some'
 import sortBy from 'lodash/sortBy'
 import assign from 'lodash/assign'
@@ -445,10 +445,10 @@ export default {
     const installableByUuid =
       host.license_params.sku_type !== 'free'
         ? await this._listMissingPoolPatchesOnHost(host)
-        : filter(await this._listMissingPoolPatchesOnHost(host), {
-          paid: false,
-          upgrade: false,
-        })
+        : pickBy(await this._listMissingPoolPatchesOnHost(host), {
+            paid: false,
+            upgrade: false,
+          })
 
     // List of all installable patches sorted from the newest to the
     // oldest.
@@ -488,7 +488,7 @@ export default {
               patches =>
                 host.license_params.sku_type !== 'free'
                   ? patches
-                  : filter(patches, { paid: false, upgrade: false })
+                  : pickBy(patches, { paid: false, upgrade: false })
             )
           }
         })

packages/xo-server/src/xo-mixins/backups-ng/index.js

@@ -1,17 +1,29 @@
 // @flow
 
 // $FlowFixMe
+import type RemoteHandler from '@xen-orchestra/fs'
 import defer from 'golike-defer'
 import { type Pattern, createPredicate } from 'value-matcher'
 import { type Readable, PassThrough } from 'stream'
 import { basename, dirname } from 'path'
-import { isEmpty, last, mapValues, noop, values } from 'lodash'
+import {
+  forEach,
+  groupBy,
+  isEmpty,
+  last,
+  mapValues,
+  noop,
+  values,
+} from 'lodash'
 import { timeout as pTimeout } from 'promise-toolbox'
+import Vhd, {
+  chainVhd,
+  createSyntheticStream as createVhdReadStream,
+} from 'vhd-lib'
 
 import { type CallJob, type Executor, type Job } from '../jobs'
 import { type Schedule } from '../scheduling'
 
-import type RemoteHandler from '../../remote-handlers/abstract'
 import createSizeStream from '../../size-stream'
 import {
   type DeltaVmExport,
@@ -25,19 +37,16 @@ import {
   safeDateFormat,
   serializeError,
 } from '../../utils'
-import {
-  chainVhd,
-  createReadStream as createVhdReadStream,
-  readVhdMetadata,
-} from '../../vhd-merge'
 
 import { translateLegacyJob } from './migration'
 
 type Mode = 'full' | 'delta'
+type ReportWhen = 'always' | 'failure' | 'never'
 
 type Settings = {|
   deleteFirst?: boolean,
   exportRetention?: number,
+  reportWhen?: ReportWhen,
   snapshotRetention?: number,
   vmTimeout?: number,
 |}
@@ -57,13 +66,6 @@ export type BackupJob = {|
   vms: Pattern,
 |}
 
-type BackupResult = {|
-  mergeDuration: number,
-  mergeSize: number,
-  transferDuration: number,
-  transferSize: number,
-|}
-
 type MetadataBase = {|
   _filename?: string,
   jobId: string,
@@ -88,6 +90,33 @@ type MetadataFull = {|
 |}
 type Metadata = MetadataDelta | MetadataFull
 
+type ConsolidatedJob = {|
+  duration?: number,
+  end?: number,
+  error?: Object,
+  id: string,
+  jobId: string,
+  mode: Mode,
+  start: number,
+  type: 'backup' | 'call',
+  userId: string,
+|}
+type ConsolidatedTask = {|
+  data?: Object,
+  duration?: number,
+  end?: number,
+  parentId: string,
+  message: string,
+  result?: Object,
+  start: number,
+  status: 'canceled' | 'failure' | 'success',
+  taskId: string,
+|}
+type ConsolidatedBackupNgLog = {
+  roots: Array<ConsolidatedJob>,
+  [parentId: string]: Array<ConsolidatedTask>,
+}
+
 const compareSnapshotTime = (a: Vm, b: Vm): number =>
   a.snapshot_time < b.snapshot_time ? -1 : 1
 
@@ -106,6 +135,7 @@ const getOldEntries = <T>(retention: number, entries?: T[]): T[] =>
 const defaultSettings: Settings = {
   deleteFirst: false,
   exportRetention: 0,
+  reportWhen: 'failure',
   snapshotRetention: 0,
   vmTimeout: 0,
 }
@@ -145,6 +175,8 @@ const listReplicatedVms = (
     const oc = object.other_config
     if (
       object.$type === 'vm' &&
+      !object.is_a_snapshot &&
+      !object.is_a_template &&
       'start' in object.blocked_operations &&
       oc['xo:backup:schedule'] === scheduleId &&
       oc['xo:backup:sr'] === srId &&
@@ -282,6 +314,77 @@ const writeStream = async (
   }
 }
 
+const wrapTask = async <T>(opts: any, task: Promise<T>): Promise<T> => {
+  const { data, logger, message, parentId, result } = opts
+
+  const taskId = logger.notice(message, {
+    event: 'task.start',
+    parentId,
+    data,
+  })
+
+  return task.then(
+    value => {
+      logger.notice(message, {
+        event: 'task.end',
+        result:
+          result === undefined
+            ? value
+            : typeof result === 'function' ? result(value) : result,
+        status: 'success',
+        taskId,
+      })
+      return task
+    },
+    result => {
+      logger.error(message, {
+        event: 'task.end',
+        result: serializeError(result),
+        status: 'failure',
+        taskId,
+      })
+      return task
+    }
+  )
+}
+
+const wrapTaskFn = <T>(
+  opts: any,
+  task: (...any) => Promise<T>
+): ((taskId: string, ...any) => Promise<T>) =>
+  async function () {
+    const { data, logger, message, parentId, result } =
+      typeof opts === 'function' ? opts.apply(this, arguments) : opts
+
+    const taskId = logger.notice(message, {
+      event: 'task.start',
+      parentId,
+      data,
+    })
+
+    try {
+      const value = await task.apply(this, [taskId, ...arguments])
+      logger.notice(message, {
+        event: 'task.end',
+        result:
+          result === undefined
+            ? value
+            : typeof result === 'function' ? result(value) : result,
+        status: 'success',
+        taskId,
+      })
+      return value
+    } catch (result) {
+      logger.error(message, {
+        event: 'task.end',
+        result: serializeError(result),
+        status: 'failure',
+        taskId,
+      })
+      throw result
+    }
+  }
+
 // File structure on remotes:
 //
 // <remote>
@@ -315,6 +418,7 @@ export default class BackupNg {
     getXapi: (id: string) => Xapi,
     getJob: ((id: string, 'backup') => Promise<BackupJob>) &
       ((id: string, 'call') => Promise<CallJob>),
+    getLogs: (namespace: string) => Promise<{ [id: string]: Object }>,
     updateJob: (($Shape<BackupJob>, ?boolean) => Promise<BackupJob>) &
       (($Shape<CallJob>, ?boolean) => Promise<CallJob>),
     removeJob: (id: string) => Promise<void>,
@@ -348,82 +452,59 @@ export default class BackupNg {
         }
         const jobId = job.id
         const scheduleId = schedule.id
-        const status: Object = {
-          calls: {},
-          runJobId,
-          start: Date.now(),
-          timezone: schedule.timezone,
-        }
-        const { calls } = status
         await asyncMap(vms, async vm => {
-          const { uuid } = vm
-          const method = 'backup-ng'
-          const params = {
-            id: uuid,
-            tag: job.name,
-          }
-
-          const name = vm.name_label
-          const runCallId = logger.notice(
+          const { name_label: name, uuid } = vm
+          const taskId: string = logger.notice(
             `Starting backup of ${name}. (${jobId})`,
             {
-              event: 'jobCall.start',
-              method,
-              params,
-              runJobId,
+              event: 'task.start',
+              parentId: runJobId,
+              data: {
+                type: 'VM',
+                id: uuid,
+              },
             }
           )
-          const call: Object = (calls[runCallId] = {
-            method,
-            params,
-            start: Date.now(),
-          })
           const vmCancel = cancelToken.fork()
           try {
             // $FlowFixMe injected $defer param
-            let p = this._backupVm(vmCancel.token, uuid, job, schedule)
+            let p = this._backupVm(
+              vmCancel.token,
+              uuid,
+              job,
+              schedule,
+              logger,
+              taskId
+            )
             const vmTimeout: number = getSetting(
               job.settings,
               'vmTimeout',
               uuid,
-              scheduleId
+              scheduleId,
+              logger,
+              taskId
             )
             if (vmTimeout !== 0) {
               p = pTimeout.call(p, vmTimeout)
             }
-            const returnedValue = await p
-            logger.notice(
-              `Backuping ${name} (${runCallId}) is a success. (${jobId})`,
-              {
-                event: 'jobCall.end',
-                runJobId,
-                runCallId,
-                returnedValue,
-              }
-            )
-
-            call.returnedValue = returnedValue
-            call.end = Date.now()
+            await p
+            logger.notice(`Backuping ${name} is a success. (${jobId})`, {
+              event: 'task.end',
+              taskId,
+              status: 'success',
+            })
           } catch (error) {
             vmCancel.cancel()
-            logger.notice(
-              `Backuping ${name} (${runCallId}) has failed. (${jobId})`,
-              {
-                event: 'jobCall.end',
-                runJobId,
-                runCallId,
-                error: Array.isArray(error)
-                  ? error.map(serializeError)
-                  : serializeError(error),
-              }
-            )
-
-            call.error = error
-            call.end = Date.now()
+            logger.error(`Backuping ${name} has failed. (${jobId})`, {
+              event: 'task.end',
+              taskId,
+              status: 'failure',
+              result: Array.isArray(error)
+                ? error.map(serializeError)
+                : serializeError(error),
+            })
           }
         })
-        status.end = Date.now()
-        return status
       }
       app.registerJobExecutor('backup', executor)
     })
@@ -539,6 +620,19 @@ export default class BackupNg {
             // inject an id usable by importVmBackupNg()
             backups.forEach(backup => {
               backup.id = `${remoteId}/${backup._filename}`
+
+              const { vdis, vhds } = backup
+              backup.disks =
+                vhds === undefined
+                  ? []
+                  : Object.keys(vhds).map(vdiId => {
+                      const vdi = vdis[vdiId]
+                      return {
+                        id: `${dirname(backup._filename)}/${vhds[vdiId]}`,
+                        name: vdi.name_label,
+                        uuid: vdi.uuid,
+                      }
+                    })
             })
 
             backupsByVm[vmUuid] = backups
@@ -604,12 +698,24 @@ export default class BackupNg {
     $cancelToken: any,
     vmUuid: string,
     job: BackupJob,
-    schedule: Schedule
-  ): Promise<BackupResult> {
+    schedule: Schedule,
+    logger: any,
+    taskId: string
+  ): Promise<void> {
     const app = this._app
     const xapi = app.getXapi(vmUuid)
     const vm: Vm = (xapi.getObject(vmUuid): any)
 
+    // ensure the VM itself does not have any backup metadata which would be
+    // copied on manual snapshots and interfere with the backup jobs
+    if ('xo:backup:job' in vm.other_config) {
+      await xapi._updateObjectMapProperty(vm, 'other_config', {
+        'xo:backup:job': null,
+        'xo:backup:schedule': null,
+        'xo:backup:vm': null,
+      })
+    }
+
     const { id: jobId, settings } = job
     const { id: scheduleId } = schedule
 
@@ -636,10 +742,18 @@ export default class BackupNg {
 
     await xapi._assertHealthyVdiChains(vm)
 
-    let snapshot: Vm = (await xapi._snapshotVm(
-      $cancelToken,
-      vm,
-      `[XO Backup ${job.name}] ${vm.name_label}`
+    let snapshot: Vm = (await wrapTask(
+      {
+        parentId: taskId,
+        logger,
+        message: 'snapshot',
+        result: _ => _.uuid,
+      },
+      xapi._snapshotVm(
+        $cancelToken,
+        vm,
+        `[XO Backup ${job.name}] ${vm.name_label}`
+      )
     ): any)
     await xapi._updateObjectMapProperty(snapshot, 'other_config', {
       'xo:backup:job': jobId,
@@ -662,12 +776,7 @@ export default class BackupNg {
     snapshot = ((await xapi.barrier(snapshot.$ref): any): Vm)
 
     if (exportRetention === 0) {
-      return {
-        mergeDuration: 0,
-        mergeSize: 0,
-        transferDuration: 0,
-        transferSize: 0,
-      }
+      return
     }
 
     const remotes = unboxIds(job.remotes)
@@ -722,93 +831,123 @@ export default class BackupNg {
 
       const jsonMetadata = JSON.stringify(metadata)
 
-      const errors = []
       await waitAll(
         [
-          ...remotes.map(async remoteId => {
-            const fork = forkExport()
-
-            const handler = await app.getRemoteHandler(remoteId)
-
-            const oldBackups: MetadataFull[] = (getOldEntries(
-              exportRetention,
-              await this._listVmBackups(
-                handler,
-                vm,
-                _ => _.mode === 'full' && _.scheduleId === scheduleId
-              )
-            ): any)
-
-            const deleteFirst = getSetting(settings, 'deleteFirst', remoteId)
-            if (deleteFirst) {
-              await this._deleteFullVmBackups(handler, oldBackups)
-            }
-
-            await writeStream(fork, handler, dataFilename)
-
-            await handler.outputFile(metadataFilename, jsonMetadata)
-
-            if (!deleteFirst) {
-              await this._deleteFullVmBackups(handler, oldBackups)
-            }
-          }),
-          ...srs.map(async srId => {
-            const fork = forkExport()
-
-            const xapi = app.getXapi(srId)
-            const sr = xapi.getObject(srId)
-
-            const oldVms = getOldEntries(
-              exportRetention,
-              listReplicatedVms(xapi, scheduleId, srId, vmUuid)
-            )
-
-            const deleteFirst = getSetting(settings, 'deleteFirst', srId)
-            if (deleteFirst) {
-              await this._deleteVms(xapi, oldVms)
-            }
-
-            const vm = await xapi.barrier(
-              await xapi._importVm($cancelToken, fork, sr, vm =>
-                xapi._setObjectProperties(vm, {
-                  nameLabel: `${metadata.vm.name_label} (${safeDateFormat(
-                    metadata.timestamp
-                  )})`,
-                })
-              )
-            )
-
-            await Promise.all([
-              xapi.addTag(vm.$ref, 'Disaster Recovery'),
-              xapi._updateObjectMapProperty(vm, 'blocked_operations', {
-                start:
-                  'Start operation for this vm is blocked, clone it if you want to use it.',
+          ...remotes.map(
+            wrapTaskFn(
+              id => ({
+                data: { id, type: 'remote' },
+                logger,
+                message: 'export',
+                parentId: taskId,
               }),
-              xapi._updateObjectMapProperty(vm, 'other_config', {
-                'xo:backup:sr': srId,
-              }),
-            ])
+              async (taskId, remoteId) => {
+                const fork = forkExport()
 
-            if (!deleteFirst) {
-              await this._deleteVms(xapi, oldVms)
-            }
-          }),
+                const handler = await app.getRemoteHandler(remoteId)
+
+                const oldBackups: MetadataFull[] = (getOldEntries(
+                  exportRetention,
+                  await this._listVmBackups(
+                    handler,
+                    vm,
+                    _ => _.mode === 'full' && _.scheduleId === scheduleId
+                  )
+                ): any)
+
+                const deleteFirst = getSetting(
+                  settings,
+                  'deleteFirst',
+                  remoteId
+                )
+                if (deleteFirst) {
+                  await this._deleteFullVmBackups(handler, oldBackups)
+                }
+
+                await wrapTask(
+                  {
+                    logger,
+                    message: 'transfer',
+                    parentId: taskId,
+                    result: {
+                      size: 0,
+                    },
+                  },
+                  writeStream(fork, handler, dataFilename)
+                )
+
+                await handler.outputFile(metadataFilename, jsonMetadata)
+
+                if (!deleteFirst) {
+                  await this._deleteFullVmBackups(handler, oldBackups)
+                }
+              }
+            )
+          ),
+          ...srs.map(
+            wrapTaskFn(
+              id => ({
+                data: { id, type: 'SR' },
+                logger,
+                message: 'export',
+                parentId: taskId,
+              }),
+              async (taskId, srId) => {
+                const fork = forkExport()
+
+                const xapi = app.getXapi(srId)
+                const sr = xapi.getObject(srId)
+
+                const oldVms = getOldEntries(
+                  exportRetention,
+                  listReplicatedVms(xapi, scheduleId, srId, vmUuid)
+                )
+
+                const deleteFirst = getSetting(settings, 'deleteFirst', srId)
+                if (deleteFirst) {
+                  await this._deleteVms(xapi, oldVms)
+                }
+
+                const vm = await xapi.barrier(
+                  await wrapTask(
+                    {
+                      logger,
+                      message: 'transfer',
+                      parentId: taskId,
+                      result: {
+                        size: 0,
+                      },
+                    },
+                    xapi._importVm($cancelToken, fork, sr, vm =>
+                      xapi._setObjectProperties(vm, {
+                        nameLabel: `${metadata.vm.name_label} (${safeDateFormat(
+                          metadata.timestamp
+                        )})`,
+                      })
+                    )
+                  )
+                )
+
+                await Promise.all([
+                  xapi.addTag(vm.$ref, 'Disaster Recovery'),
+                  xapi._updateObjectMapProperty(vm, 'blocked_operations', {
+                    start:
+                      'Start operation for this vm is blocked, clone it if you want to use it.',
+                  }),
+                  xapi._updateObjectMapProperty(vm, 'other_config', {
+                    'xo:backup:sr': srId,
+                  }),
+                ])
+
+                if (!deleteFirst) {
+                  await this._deleteVms(xapi, oldVms)
+                }
+              }
+            )
+          ),
         ],
-        error => {
-          console.warn(error)
-          errors.push(error)
-        }
+        noop // errors are handled in logs
       )
-      if (errors.length !== 0) {
-        throw errors
-      }
-
-      return {
-        mergeDuration: 0,
-        mergeSize: 0,
-        transferDuration: Date.now() - now,
-        transferSize: xva.size,
-      }
     } else if (job.mode === 'delta') {
       if (snapshotRetention === 0) {
         // only keep the snapshot in case of success
@@ -880,126 +1019,164 @@ export default class BackupNg {
               }
             })()
 
-      const mergeStart = 0
-      const mergeEnd = 0
-      let transferStart = 0
-      let transferEnd = 0
-      const errors = []
       await waitAll(
         [
-          ...remotes.map(async remoteId => {
-            const fork = forkExport()
+          ...remotes.map(
+            wrapTaskFn(
+              id => ({
+                data: { id, type: 'remote' },
+                logger,
+                message: 'export',
+                parentId: taskId,
+              }),
+              async (taskId, remoteId) => {
+                const fork = forkExport()
 
-            const handler = await app.getRemoteHandler(remoteId)
+                const handler = await app.getRemoteHandler(remoteId)
 
-            const oldBackups: MetadataDelta[] = (getOldEntries(
-              exportRetention,
-              await this._listVmBackups(
-                handler,
-                vm,
-                _ => _.mode === 'delta' && _.scheduleId === scheduleId
-              )
-            ): any)
+                const oldBackups: MetadataDelta[] = (getOldEntries(
+                  exportRetention,
+                  await this._listVmBackups(
+                    handler,
+                    vm,
+                    _ => _.mode === 'delta' && _.scheduleId === scheduleId
+                  )
+                ): any)
+                const deleteOldBackups = () =>
+                  wrapTask(
+                    {
+                      logger,
+                      message: 'merge',
+                      parentId: taskId,
+                      result: {
+                        size: 0,
+                      },
+                    },
+                    this._deleteDeltaVmBackups(handler, oldBackups)
+                  )
 
-            const deleteFirst = getSetting(settings, 'deleteFirst', remoteId)
-            if (deleteFirst) {
-              this._deleteDeltaVmBackups(handler, oldBackups)
-            }
-
-            await asyncMap(
-              fork.vdis,
-              defer(async ($defer, vdi, id) => {
-                const path = `${vmDir}/${metadata.vhds[id]}`
-
-                const isDelta = vdi.other_config['xo:base_delta'] !== undefined
-                let parentPath
-                if (isDelta) {
-                  const vdiDir = dirname(path)
-                  const parent = (await handler.list(vdiDir))
-                    .filter(isVhd)
-                    .sort()
-                    .pop()
-                  parentPath = `${vdiDir}/${parent}`
+                const deleteFirst =
+                  exportRetention > 1 &&
+                  getSetting(settings, 'deleteFirst', remoteId)
+                if (deleteFirst) {
+                  await deleteOldBackups()
                 }
 
-                await writeStream(fork.streams[`${id}.vhd`](), handler, path, {
-                  // no checksum for VHDs, because they will be invalidated by
-                  // merges and chainings
-                  checksum: false,
-                })
-                $defer.onFailure.call(handler, 'unlink', path)
+                await wrapTask(
+                  {
+                    logger,
+                    message: 'transfer',
+                    parentId: taskId,
+                    result: {
+                      size: 0,
+                    },
+                  },
+                  asyncMap(
+                    fork.vdis,
+                    defer(async ($defer, vdi, id) => {
+                      const path = `${vmDir}/${metadata.vhds[id]}`
 
-                if (isDelta) {
-                  await chainVhd(handler, parentPath, handler, path)
+                      const isDelta =
+                        vdi.other_config['xo:base_delta'] !== undefined
+                      let parentPath
+                      if (isDelta) {
+                        const vdiDir = dirname(path)
+                        const parent = (await handler.list(vdiDir))
+                          .filter(isVhd)
+                          .sort()
+                          .pop()
+                        parentPath = `${vdiDir}/${parent}`
+                      }
+
+                      await writeStream(
+                        fork.streams[`${id}.vhd`](),
+                        handler,
+                        path,
+                        {
+                          // no checksum for VHDs, because they will be invalidated by
+                          // merges and chainings
+                          checksum: false,
+                        }
+                      )
+                      $defer.onFailure.call(handler, 'unlink', path)
+
+                      if (isDelta) {
+                        await chainVhd(handler, parentPath, handler, path)
+                      }
+                    })
+                  )
+                )
+
+                await handler.outputFile(metadataFilename, jsonMetadata)
+
+                if (!deleteFirst) {
+                  await deleteOldBackups()
                 }
-              })
+              }
             )
+          ),
+          ...srs.map(
+            wrapTaskFn(
+              id => ({
+                data: { id, type: 'SR' },
+                logger,
+                message: 'export',
+                parentId: taskId,
+              }),
+              async (taskId, srId) => {
+                const fork = forkExport()
 
-            await handler.outputFile(metadataFilename, jsonMetadata)
+                const xapi = app.getXapi(srId)
+                const sr = xapi.getObject(srId)
 
-            if (!deleteFirst) {
-              this._deleteDeltaVmBackups(handler, oldBackups)
-            }
-          }),
-          ...srs.map(async srId => {
-            const fork = forkExport()
+                const oldVms = getOldEntries(
+                  exportRetention,
+                  listReplicatedVms(xapi, scheduleId, srId, vmUuid)
+                )
 
-            const xapi = app.getXapi(srId)
-            const sr = xapi.getObject(srId)
+                const deleteFirst = getSetting(settings, 'deleteFirst', srId)
+                if (deleteFirst) {
+                  await this._deleteVms(xapi, oldVms)
+                }
 
-            const oldVms = getOldEntries(
-              exportRetention,
-              listReplicatedVms(xapi, scheduleId, srId, vmUuid)
+                const { vm } = await wrapTask(
+                  {
+                    logger,
+                    message: 'transfer',
+                    parentId: taskId,
+                    result: {
+                      size: 0,
+                    },
+                  },
+                  xapi.importDeltaVm(fork, {
+                    disableStartAfterImport: false, // we'll take care of that
+                    name_label: `${metadata.vm.name_label} (${safeDateFormat(
+                      metadata.timestamp
+                    )})`,
+                    srId: sr.$id,
+                  })
+                )
+
+                await Promise.all([
+                  xapi.addTag(vm.$ref, 'Continuous Replication'),
+                  xapi._updateObjectMapProperty(vm, 'blocked_operations', {
+                    start:
+                      'Start operation for this vm is blocked, clone it if you want to use it.',
+                  }),
+                  xapi._updateObjectMapProperty(vm, 'other_config', {
+                    'xo:backup:sr': srId,
+                  }),
+                ])
+
+                if (!deleteFirst) {
+                  await this._deleteVms(xapi, oldVms)
+                }
+              }
             )
-
-            const deleteFirst = getSetting(settings, 'deleteFirst', srId)
-            if (deleteFirst) {
-              await this._deleteVms(xapi, oldVms)
-            }
-
-            transferStart = Math.min(transferStart, Date.now())
-
-            const { vm } = await xapi.importDeltaVm(fork, {
-              disableStartAfterImport: false, // we'll take care of that
-              name_label: `${metadata.vm.name_label} (${safeDateFormat(
-                metadata.timestamp
-              )})`,
-              srId: sr.$id,
-            })
-
-            transferEnd = Math.max(transferEnd, Date.now())
-
-            await Promise.all([
-              xapi.addTag(vm.$ref, 'Continuous Replication'),
-              xapi._updateObjectMapProperty(vm, 'blocked_operations', {
-                start:
-                  'Start operation for this vm is blocked, clone it if you want to use it.',
-              }),
-              xapi._updateObjectMapProperty(vm, 'other_config', {
-                'xo:backup:sr': srId,
-              }),
-            ])
-
-            if (!deleteFirst) {
-              await this._deleteVms(xapi, oldVms)
-            }
-          }),
+          ),
         ],
-        error => {
-          console.warn(error)
-          errors.push(error)
-        }
+        noop // errors are handled in logs
       )
-      if (errors.length !== 0) {
-        throw errors
-      }
-
-      return {
-        mergeDuration: mergeEnd - mergeStart,
-        mergeSize: 0,
-        transferDuration: transferEnd - transferStart,
-        transferSize: 0,
-      }
     } else {
       throw new Error(`no exporter for backup mode ${job.mode}`)
     }
@@ -1042,9 +1219,13 @@ export default class BackupNg {
     const vhds = await asyncMap(
       await handler.list(dirname(path), { filter: isVhd, prependDir: true }),
       async path => {
-        const metadata = await readVhdMetadata(handler, path)
-        metadata.path = path
-        return metadata
+        const vhd = new Vhd(handler, path)
+        await vhd.readHeaderAndFooter()
+        return {
+          footer: vhd.footer,
+          header: vhd.header,
+          path,
+        }
       }
     )
     const base = basename(path)
@@ -1096,11 +1277,65 @@ export default class BackupNg {
         })
       )
     } catch (error) {
-      if (error == null || error.code !== 'ENOENT') {
+      let code
+      if (
+        error == null ||
+        ((code = error.code) !== 'ENOENT' && code !== 'ENOTDIR')
+      ) {
         throw error
       }
     }
 
     return backups.sort(compareTimestamp)
   }
+
+  async getBackupNgLogs (runId?: string): Promise<ConsolidatedBackupNgLog> {
+    const rawLogs = await this._app.getLogs('jobs')
+
+    const logs: $Dict<ConsolidatedJob & ConsolidatedTask> = {}
+    forEach(rawLogs, (log, id) => {
+      const { data, time, message } = log
+      const { event } = data
+      delete data.event
+
+      switch (event) {
+        case 'job.start':
+          if (data.type === 'backup' && (runId === undefined || runId === id)) {
+            logs[id] = {
+              ...data,
+              id,
+              start: time,
+            }
+          }
+          break
+        case 'job.end':
+          const job = logs[data.runJobId]
+          if (job !== undefined) {
+            job.end = time
+            job.duration = time - job.start
+            job.error = data.error
+          }
+          break
+        case 'task.start':
+          if (logs[data.parentId] !== undefined) {
+            logs[id] = {
+              ...data,
+              start: time,
+              message,
+            }
+          }
+          break
+        case 'task.end':
+          const task = logs[data.taskId]
+          if (task !== undefined) {
+            task.status = data.status
+            task.taskId = data.taskId
+            task.result = data.result
+            task.end = time
+            task.duration = time - task.start
+          }
+      }
+    })
+    return groupBy(logs, log => log.parentId || 'roots')
+  }
 }

packages/xo-server/src/xo-mixins/backups.js

@@ -19,12 +19,13 @@ import {
   startsWith,
   trim,
 } from 'lodash'
+import {
+  chainVhd,
+  createSyntheticStream as createVhdReadStream,
+  mergeVhd,
+} from 'vhd-lib'
 
 import createSizeStream from '../size-stream'
-import vhdMerge, {
-  chainVhd,
-  createReadStream as createVhdReadStream,
-} from '../vhd-merge'
 import xapiObjectToXo from '../xapi-object-to-xo'
 import { lvs, pvs } from '../lvm'
 import {
@@ -553,7 +554,7 @@ export default class {
       const backup = `${dir}/${backups[j]}`
 
       try {
-        mergedDataSize += await vhdMerge(handler, parent, handler, backup)
+        mergedDataSize += await mergeVhd(handler, parent, handler, backup)
       } catch (e) {
         console.error('Unable to use vhd-util.', e)
         throw e
@@ -815,10 +816,17 @@ export default class {
 
       await Promise.all(
         mapToArray(delta.vdis, async (vdi, id) => {
-          streams[`${id}.vhd`] = await createVhdReadStream(
-            handler,
-            `${basePath}/${vdi.xoPath}`
-          )
+          let path = `${basePath}/${vdi.xoPath}`
+          try {
+            await handler.getSize(path)
+          } catch (error) {
+            if (error == null || error.code !== 'ENOENT') {
+              throw error
+            }
+
+            path = path.replace(/_delta\.vhd$/, '_full.vhd')
+          }
+          streams[`${id}.vhd`] = await createVhdReadStream(handler, path)
         })
       )
 

packages/xo-server/src/xo-mixins/file-restore-ng.js

@@ -0,0 +1,332 @@
+import defer from 'golike-defer'
+import execa from 'execa'
+import splitLines from 'split-lines'
+import { createParser as createPairsParser } from 'parse-pairs'
+import { normalize } from 'path'
+import { readdir, rmdir, stat } from 'fs-extra'
+import { ZipFile } from 'yazl'
+
+import { lvs, pvs } from '../lvm'
+import { resolveSubpath, tmpDir } from '../utils'
+
+const IGNORED_PARTITION_TYPES = {
+  // https://github.com/jhermsmeier/node-mbr/blob/master/lib/partition.js#L38
+  0x05: true,
+  0x0f: true,
+  0x15: true,
+  0x5e: true,
+  0x5f: true,
+  0x85: true,
+  0x91: true,
+  0x9b: true,
+  0xc5: true,
+  0xcf: true,
+  0xd5: true,
+
+  0x82: true, // swap
+}
+
+const PARTITION_TYPE_NAMES = {
+  0x07: 'NTFS',
+  0x0c: 'FAT',
+  0x83: 'linux',
+}
+
+const RE_VHDI = /^vhdi(\d+)$/
+
+const parsePartxLine = createPairsParser({
+  keyTransform: key => (key === 'UUID' ? 'id' : key.toLowerCase()),
+  valueTransform: (value, key) =>
+    key === 'start' || key === 'size'
+      ? +value
+      : key === 'type' ? PARTITION_TYPE_NAMES[+value] || value : value,
+})
+
+const listLvmLogicalVolumes = defer(
+  async ($defer, devicePath, partition, results = []) => {
+    const pv = await mountLvmPhysicalVolume(devicePath, partition)
+    $defer(pv.unmount)
+
+    const lvs = await pvs(['lv_name', 'lv_path', 'lv_size', 'vg_name'], pv.path)
+    const partitionId = partition !== undefined ? partition.id : ''
+    lvs.forEach((lv, i) => {
+      const name = lv.lv_name
+      if (name !== '') {
+        results.push({
+          id: `${partitionId}/${lv.vg_name}/${name}`,
+          name,
+          size: lv.lv_size,
+        })
+      }
+    })
+    return results
+  }
+)
+
+async function mountLvmPhysicalVolume (devicePath, partition) {
+  const args = []
+  if (partition !== undefined) {
+    args.push('-o', partition.start * 512)
+  }
+  args.push('--show', '-f', devicePath)
+  const path = (await execa.stdout('losetup', args)).trim()
+  await execa('pvscan', ['--cache', path])
+
+  return {
+    path,
+    unmount: async () => {
+      try {
+        const vgNames = await pvs('vg_name', path)
+        await execa('vgchange', ['-an', ...vgNames])
+      } finally {
+        await execa('losetup', ['-d', path])
+      }
+    },
+  }
+}
+
+const mountPartition = defer(async ($defer, devicePath, partition) => {
+  const options = ['loop', 'ro']
+
+  if (partition !== undefined) {
+    const { start } = partition
+    if (start !== undefined) {
+      options.push(`offset=${start * 512}`)
+    }
+  }
+
+  const path = await tmpDir()
+  $defer.onFailure(rmdir, path)
+
+  const mount = options =>
+    execa('mount', [
+      `--options=${options.join(',')}`,
+      `--source=${devicePath}`,
+      `--target=${path}`,
+    ])
+
+  // `norecovery` option is used for ext3/ext4/xfs, if it fails it might be
+  // another fs, try without
+  try {
+    await mount([...options, 'norecovery'])
+  } catch (error) {
+    await mount(options)
+  }
+  const unmount = async () => {
+    await execa('umount', ['--lazy', path])
+    return rmdir(path)
+  }
+  $defer.onFailure(unmount)
+
+  return { path, unmount }
+})
+
+// - [x] list partitions
+// - [x] list files in a partition
+// - [x] list files in a bare partition
+// - [x] list LVM partitions
+//
+// - [ ] partitions with unmount debounce
+// - [ ] handle directory restore
+// - [ ] handle multiple entries restore (both dirs and files)
+//       - [ ] by default use common path as root
+// - [ ] handle LVM partitions on multiple disks
+// - [ ] find mounted disks/partitions on start (in case of interruptions)
+//
+// - [ ] manual mount/unmount (of disk) for advance file restore
+//       - could it stay mounted during the backup process?
+//       - [ ] mountDisk (VHD)
+//       - [ ] unmountDisk (only for manual mount)
+//       - [ ] getMountedDisks
+//       - [ ] mountPartition (optional)
+//       - [ ] getMountedPartitions
+//       - [ ] unmountPartition
+export default class BackupNgFileRestore {
+  constructor (app) {
+    this._app = app
+    this._mounts = { __proto__: null }
+  }
+
+  @defer
+  async fetchBackupNgPartitionFiles (
+    $defer,
+    remoteId,
+    diskId,
+    partitionId,
+    paths
+  ) {
+    const disk = await this._mountDisk(remoteId, diskId)
+    $defer.onFailure(disk.unmount)
+
+    const partition = await this._mountPartition(disk.path, partitionId)
+    $defer.onFailure(partition.unmount)
+
+    const zip = new ZipFile()
+    paths.forEach(file => {
+      zip.addFile(resolveSubpath(partition.path, file), normalize('./' + file))
+    })
+    zip.end()
+    return zip.outputStream.on('end', () =>
+      partition.unmount().then(disk.unmount)
+    )
+  }
+
+  @defer
+  async listBackupNgDiskPartitions ($defer, remoteId, diskId) {
+    const disk = await this._mountDisk(remoteId, diskId)
+    $defer(disk.unmount)
+    return this._listPartitions(disk.path)
+  }
+
+  @defer
+  async listBackupNgPartitionFiles (
+    $defer,
+    remoteId,
+    diskId,
+    partitionId,
+    path
+  ) {
+    const disk = await this._mountDisk(remoteId, diskId)
+    $defer(disk.unmount)
+
+    const partition = await this._mountPartition(disk.path, partitionId)
+    $defer(partition.unmount)
+
+    path = resolveSubpath(partition.path, path)
+
+    const entriesMap = {}
+    await Promise.all(
+      (await readdir(path)).map(async name => {
+        try {
+          const stats = await stat(`${path}/${name}`)
+          entriesMap[stats.isDirectory() ? `${name}/` : name] = {}
+        } catch (error) {
+          if (error == null || error.code !== 'ENOENT') {
+            throw error
+          }
+        }
+      })
+    )
+    return entriesMap
+  }
+
+  async _findPartition (devicePath, partitionId) {
+    const partitions = await this._listPartitions(devicePath, false)
+    const partition = partitions.find(_ => _.id === partitionId)
+    if (partition === undefined) {
+      throw new Error(`partition ${partitionId} not found`)
+    }
+    return partition
+  }
+
+  async _listPartitions (devicePath, inspectLvmPv = true) {
+    const stdout = await execa.stdout('partx', [
+      '--bytes',
+      '--output=NR,START,SIZE,NAME,UUID,TYPE',
+      '--pairs',
+      devicePath,
+    ])
+
+    const promises = []
+    const partitions = []
+    splitLines(stdout).forEach(line => {
+      const partition = parsePartxLine(line)
+      let { type } = partition
+      if (type == null || (type = +type) in IGNORED_PARTITION_TYPES) {
+        return
+      }
+
+      if (inspectLvmPv && type === 0x8e) {
+        promises.push(listLvmLogicalVolumes(devicePath, partition, partitions))
+        return
+      }
+
+      partitions.push(partition)
+    })
+
+    await Promise.all(promises)
+
+    return partitions
+  }
+
+  @defer
+  async _mountDisk ($defer, remoteId, diskId) {
+    const handler = await this._app.getRemoteHandler(remoteId)
+    if (handler._getFilePath === undefined) {
+      throw new Error(`this remote is not supported`)
+    }
+
+    const diskPath = handler._getFilePath(diskId)
+    const mountDir = await tmpDir()
+    $defer.onFailure(rmdir, mountDir)
+
+    await execa('vhdimount', [diskPath, mountDir])
+    const unmount = async () => {
+      await execa('fusermount', ['-uz', mountDir])
+      return rmdir(mountDir)
+    }
+    $defer.onFailure(unmount)
+
+    let max = 0
+    let maxEntry
+    const entries = await readdir(mountDir)
+    entries.forEach(entry => {
+      const matches = RE_VHDI.exec(entry)
+      if (matches !== null) {
+        const value = +matches[1]
+        if (value > max) {
+          max = value
+          maxEntry = entry
+        }
+      }
+    })
+    if (max === 0) {
+      throw new Error('no disks found')
+    }
+
+    return {
+      path: `${mountDir}/${maxEntry}`,
+      unmount,
+    }
+  }
+
+  @defer
+  async _mountPartition ($defer, devicePath, partitionId) {
+    if (partitionId === undefined) {
+      return mountPartition(devicePath)
+    }
+
+    if (partitionId.includes('/')) {
+      const [pvId, vgName, lvName] = partitionId.split('/')
+      const lvmPartition =
+        pvId !== '' ? await this._findPartition(devicePath, pvId) : undefined
+
+      const pv = await mountLvmPhysicalVolume(devicePath, lvmPartition)
+
+      const unmountQueue = [pv.unmount]
+      const unmount = async () => {
+        let fn
+        while ((fn = unmountQueue.pop()) !== undefined) {
+          await fn()
+        }
+      }
+      $defer.onFailure(unmount)
+
+      await execa('vgchange', ['-ay', vgName])
+      unmountQueue.push(() => execa('vgchange', ['-an', vgName]))
+
+      const partition = await mountPartition(
+        (await lvs(['lv_name', 'lv_path'], vgName)).find(
+          _ => _.lv_name === lvName
+        ).lv_path
+      )
+      unmountQueue.push(partition.unmount)
+      return { ...partition, unmount }
+    }
+
+    return mountPartition(
+      devicePath,
+      await this._findPartition(devicePath, partitionId)
+    )
+  }
+}

packages/xo-server/src/xo-mixins/jobs/index.js

@@ -209,28 +209,43 @@ export default class Jobs {
       throw new Error(`job ${id} is already running`)
     }
 
-    const executor = this._executors[job.type]
+    const { type } = job
+    const executor = this._executors[type]
     if (executor === undefined) {
-      throw new Error(`cannot run job ${id}: no executor for type ${job.type}`)
+      throw new Error(`cannot run job ${id}: no executor for type ${type}`)
+    }
+
+    let data
+    if (type === 'backup') {
+      // $FlowFixMe only defined for BackupJob
+      const settings = job.settings['']
+      data = {
+        // $FlowFixMe only defined for BackupJob
+        mode: job.mode,
+        reportWhen: (settings && settings.reportWhen) || 'failure',
+      }
     }
 
     const logger = this._logger
     const runJobId = logger.notice(`Starting execution of ${id}.`, {
+      data,
       event: 'job.start',
       userId: job.userId,
       jobId: id,
       // $FlowFixMe only defined for CallJob
       key: job.key,
+      type,
     })
 
     runningJobs[id] = runJobId
 
+    let session
     try {
       const app = this._app
-      const session = app.createUserConnection()
+      session = app.createUserConnection()
       session.set('user_id', job.userId)
 
-      const status = await executor({
+      await executor({
         app,
         cancelToken,
         job,
@@ -244,8 +259,7 @@ export default class Jobs {
         runJobId,
       })
 
-      session.close()
-      app.emit('job:terminated', status)
+      app.emit('job:terminated', runJobId, job, schedule)
     } catch (error) {
       logger.error(`The execution of ${id} has failed.`, {
         event: 'job.end',
@@ -255,6 +269,9 @@ export default class Jobs {
       throw error
     } finally {
       delete runningJobs[id]
+      if (session !== undefined) {
+        session.close()
+      }
     }
   }
 

packages/xo-server/src/xo-mixins/logs/index.js

@@ -32,11 +32,11 @@ export default class Logs {
     const onData =
       keep !== 0
         ? () => {
-          if (--keep === 0) {
-            stream.on('data', deleteEntry)
-            stream.removeListener('data', onData)
+            if (--keep === 0) {
+              stream.on('data', deleteEntry)
+              stream.removeListener('data', onData)
+            }
           }
-        }
         : deleteEntry
     stream.on('data', onData)
 
@@ -51,4 +51,22 @@ export default class Logs {
       .getStore('logs')
       .then(store => new LevelDbLogger(store, namespace))
   }
+
+  async getLogs (namespace) {
+    const logger = await this.getLogger(namespace)
+
+    return new Promise((resolve, reject) => {
+      const logs = {}
+
+      logger
+        .createReadStream()
+        .on('data', data => {
+          logs[data.key] = data.value
+        })
+        .on('end', () => {
+          resolve(logs)
+        })
+        .on('error', reject)
+    })
+  }
 }

packages/xo-server/src/xo-mixins/remotes.js

@@ -1,7 +1,7 @@
+import { getHandler } from '@xen-orchestra/fs'
 import { noSuchObject } from 'xo-common/api-errors'
 
 import { forEach, mapToArray } from '../utils'
-import { getHandler } from '../remote-handlers'
 import { Remotes } from '../models/remote'
 
 // ===================================================================

packages/xo-server/src/xo-mixins/workers/worker.js

@@ -1,7 +1,7 @@
 // @flow
 
-import mergeVhd_ from '../../vhd-merge'
-import { type Remote, getHandler } from '../../remote-handlers'
+import { type Remote, getHandler } from '@xen-orchestra/fs'
+import { mergeVhd as mergeVhd_ } from 'vhd-lib'
 
 export function mergeVhd (
   parentRemote: Remote,

packages/xo-server/src/xo.js

@@ -140,7 +140,11 @@ export default class Xo extends EventEmitter {
     }).then(
       result => {
         if (result != null) {
-          res.end(JSON.stringify(result))
+          if (typeof result.pipe === 'function') {
+            result.pipe(res)
+          } else {
+            res.end(JSON.stringify(result))
+          }
         }
       },
       error => {

packages/xo-vmdk-to-vhd/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

packages/xo-vmdk-to-vhd/package.json

@@ -1,6 +1,6 @@
 {
   "name": "xo-vmdk-to-vhd",
-  "version": "0.0.12",
+  "version": "0.1.0",
   "license": "AGPL-3.0",
   "description": "JS lib streaming a vmdk file to a vhd",
   "keywords": [
@@ -23,44 +23,34 @@
     "node": ">=4"
   },
   "dependencies": {
-    "babel-runtime": "^6.18.0",
+    "@babel/runtime": "^7.0.0-beta.44",
     "child-process-promise": "^2.0.3",
-    "deflate-js": "^0.2.3",
     "fs-promise": "^2.0.0",
-    "pipette": "^0.9.3"
+    "pipette": "^0.9.3",
+    "promise-toolbox": "^0.9.5",
+    "tmp": "^0.0.33",
+    "vhd-lib": "^0.0.0"
   },
   "devDependencies": {
-    "babel-cli": "^6.18.0",
-    "babel-plugin-transform-runtime": "^6.15.0",
-    "babel-preset-env": "^1.0.0",
+    "@babel/cli": "7.0.0-beta.44",
+    "@babel/core": "7.0.0-beta.44",
+    "@babel/plugin-transform-runtime": "^7.0.0-beta.44",
+    "@babel/preset-env": "7.0.0-beta.44",
+    "babel-plugin-lodash": "^3.3.2",
     "cross-env": "^5.1.3",
-    "mocha": "^4.0.1",
-    "must": "^0.13.2",
-    "rimraf": "^2.5.4"
+    "event-to-promise": "^0.8.0",
+    "execa": "^0.10.0",
+    "fs-extra": "^5.0.0",
+    "get-stream": "^3.0.0",
+    "index-modules": "^0.3.0",
+    "rimraf": "^2.6.2"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
     "clean": "rimraf dist/",
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
-    "dev-test": "mocha --watch --reporter=min \"dist/**/*.spec.js\"",
     "prebuild": "yarn run clean",
-    "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build",
-    "test-disabled": "mocha \"dist/**/*.spec.js\""
-  },
-  "babel": {
-    "plugins": [
-      "transform-runtime"
-    ],
-    "presets": [
-      [
-        "env",
-        {
-          "targets": {
-            "node": 4
-          }
-        }
-      ]
-    ]
+    "predev": "yarn run clean",
+    "prepare": "yarn run build"
   }
 }

packages/xo-vmdk-to-vhd/src/index.js

@@ -1 +1,16 @@
-export { convertFromVMDK as default } from './vhd-write'
+import { createReadableSparseStream } from 'vhd-lib'
+
+import { VMDKDirectParser, readVmdkGrainTable } from './vmdk-read'
+
+async function convertFromVMDK (vmdkReadStream, table) {
+  const parser = new VMDKDirectParser(vmdkReadStream)
+  const header = await parser.readHeader()
+  return createReadableSparseStream(
+    header.capacitySectors * 512,
+    header.grainSizeSectors * 512,
+    table,
+    parser.blockIterator()
+  )
+}
+
+export { convertFromVMDK as default, readVmdkGrainTable }

packages/xo-vmdk-to-vhd/src/vhd-write.js

@@ -1,340 +0,0 @@
-'use strict'
-import { open, write } from 'fs-promise'
-import stream from 'stream'
-import { VMDKDirectParser } from './vmdk-read'
-
-const footerCookie = 'conectix'
-const creatorApp = 'xo  '
-// it looks like everybody is using Wi2k
-const osString = 'Wi2k'
-const headerCookie = 'cxsparse'
-const fixedHardDiskType = 2
-const dynamicHardDiskType = 3
-
-const sectorSize = 512
-
-export function computeChecksum (buffer) {
-  let sum = 0
-  for (let i = 0; i < buffer.length; i++) {
-    sum += buffer[i]
-  }
-  // http://stackoverflow.com/a/1908655/72637 the >>> prevents the number from going negative
-  return ~sum >>> 0
-}
-
-class Block {
-  constructor (blockSize) {
-    const bitmapSize = blockSize / sectorSize / 8
-    const bufferSize =
-      Math.ceil((blockSize + bitmapSize) / sectorSize) * sectorSize
-    this.buffer = Buffer.alloc(bufferSize)
-    this.bitmapBuffer = this.buffer.slice(0, bitmapSize)
-    this.dataBuffer = this.buffer.slice(bitmapSize)
-    this.bitmapBuffer.fill(0xff)
-  }
-
-  writeData (buffer, offset = 0) {
-    buffer.copy(this.dataBuffer, offset)
-  }
-
-  async writeOnFile (file) {
-    await write(file, this.buffer, 0, this.buffer.length)
-  }
-}
-
-class SparseExtent {
-  constructor (dataSize, blockSize, startOffset) {
-    this.table = createEmptyTable(dataSize, blockSize)
-    this.blockSize = blockSize
-    this.startOffset = (startOffset + this.table.buffer.length) / sectorSize
-  }
-
-  get entryCount () {
-    return this.table.entryCount
-  }
-
-  _writeBlock (blockBuffer, tableIndex, offset) {
-    if (blockBuffer.length + offset > this.blockSize) {
-      throw new Error('invalid block geometry')
-    }
-    let entry = this.table.entries[tableIndex]
-    if (entry === undefined) {
-      entry = new Block(this.blockSize)
-      this.table.entries[tableIndex] = entry
-    }
-    entry.writeData(blockBuffer, offset)
-  }
-
-  writeBuffer (buffer, offset = 0) {
-    const startBlock = Math.floor(offset / this.blockSize)
-    const endBlock = Math.ceil((offset + buffer.length) / this.blockSize)
-    for (let i = startBlock; i < endBlock; i++) {
-      const blockDelta = offset - i * this.blockSize
-      let blockBuffer, blockOffset
-      if (blockDelta > 0) {
-        blockBuffer = buffer.slice(0, (i + 1) * this.blockSize - offset)
-        blockOffset = blockDelta
-      } else {
-        blockBuffer = buffer.slice(
-          -blockDelta,
-          (i + 1) * this.blockSize - offset
-        )
-        blockOffset = 0
-      }
-      this._writeBlock(blockBuffer, i, blockOffset)
-    }
-  }
-
-  async writeOnFile (file) {
-    let currentOffset = this.startOffset
-    for (let i = 0; i < this.table.entryCount; i++) {
-      const block = this.table.entries[i]
-      if (block !== undefined) {
-        this.table.buffer.writeUInt32BE(currentOffset, i * 4)
-        currentOffset += block.buffer.length / sectorSize
-      }
-    }
-    await write(file, this.table.buffer, 0, this.table.buffer.length)
-    for (let i = 0; i < this.table.entryCount; i++) {
-      const block = this.table.entries[i]
-      if (block !== undefined) {
-        await block.writeOnFile(file)
-      }
-    }
-  }
-}
-
-export class VHDFile {
-  constructor (virtualSize, timestamp) {
-    this.geomtry = computeGeometryForSize(virtualSize)
-    this.timestamp = timestamp
-    this.blockSize = 0x00200000
-    this.sparseFile = new SparseExtent(
-      this.geomtry.actualSize,
-      this.blockSize,
-      sectorSize * 3
-    )
-  }
-
-  writeBuffer (buffer, offset = 0) {
-    this.sparseFile.writeBuffer(buffer, offset)
-  }
-
-  async writeFile (fileName) {
-    const fileFooter = createFooter(
-      this.geomtry.actualSize,
-      this.timestamp,
-      this.geomtry,
-      dynamicHardDiskType,
-      512,
-      0
-    )
-    const diskHeader = createDynamicDiskHeader(
-      this.sparseFile.entryCount,
-      this.blockSize
-    )
-    const file = await open(fileName, 'w')
-    await write(file, fileFooter, 0, fileFooter.length)
-    await write(file, diskHeader, 0, diskHeader.length)
-    await this.sparseFile.writeOnFile(file)
-    await write(file, fileFooter, 0, fileFooter.length)
-  }
-}
-
-export function computeGeometryForSize (size) {
-  const totalSectors = Math.ceil(size / 512)
-  let sectorsPerTrack
-  let heads
-  let cylinderTimesHeads
-  if (totalSectors > 65535 * 16 * 255) {
-    throw Error('disk is too big')
-  }
-  // straight copypasta from the file spec appendix on CHS Calculation
-  if (totalSectors >= 65535 * 16 * 63) {
-    sectorsPerTrack = 255
-    heads = 16
-    cylinderTimesHeads = totalSectors / sectorsPerTrack
-  } else {
-    sectorsPerTrack = 17
-    cylinderTimesHeads = totalSectors / sectorsPerTrack
-    heads = Math.floor((cylinderTimesHeads + 1023) / 1024)
-    if (heads < 4) {
-      heads = 4
-    }
-    if (cylinderTimesHeads >= heads * 1024 || heads > 16) {
-      sectorsPerTrack = 31
-      heads = 16
-      cylinderTimesHeads = totalSectors / sectorsPerTrack
-    }
-    if (cylinderTimesHeads >= heads * 1024) {
-      sectorsPerTrack = 63
-      heads = 16
-      cylinderTimesHeads = totalSectors / sectorsPerTrack
-    }
-  }
-  const cylinders = Math.floor(cylinderTimesHeads / heads)
-  const actualSize = cylinders * heads * sectorsPerTrack * sectorSize
-  return { cylinders, heads, sectorsPerTrack, actualSize }
-}
-
-export function createFooter (
-  size,
-  timestamp,
-  geometry,
-  diskType,
-  dataOffsetLow = 0xffffffff,
-  dataOffsetHigh = 0xffffffff
-) {
-  const footer = Buffer.alloc(512)
-  Buffer.from(footerCookie, 'ascii').copy(footer)
-  footer.writeUInt32BE(2, 8)
-  footer.writeUInt32BE(0x00010000, 12)
-  footer.writeUInt32BE(dataOffsetHigh, 16)
-  footer.writeUInt32BE(dataOffsetLow, 20)
-  footer.writeUInt32BE(timestamp, 24)
-  Buffer.from(creatorApp, 'ascii').copy(footer, 28)
-  Buffer.from(osString, 'ascii').copy(footer, 36)
-  // do not use & 0xFFFFFFFF to extract lower bits, that would propagate a negative sign if the 2^31 bit is one
-  const sizeHigh = Math.floor(size / Math.pow(2, 32)) % Math.pow(2, 32)
-  const sizeLow = size % Math.pow(2, 32)
-  footer.writeUInt32BE(sizeHigh, 40)
-  footer.writeUInt32BE(sizeLow, 44)
-  footer.writeUInt32BE(sizeHigh, 48)
-  footer.writeUInt32BE(sizeLow, 52)
-  footer.writeUInt16BE(geometry['cylinders'], 56)
-  footer.writeUInt8(geometry['heads'], 58)
-  footer.writeUInt8(geometry['sectorsPerTrack'], 59)
-  footer.writeUInt32BE(diskType, 60)
-  const checksum = computeChecksum(footer)
-  footer.writeUInt32BE(checksum, 64)
-  return footer
-}
-
-export function createDynamicDiskHeader (tableEntries, blockSize) {
-  const header = Buffer.alloc(1024)
-  Buffer.from(headerCookie, 'ascii').copy(header)
-  // hard code no next data
-  header.writeUInt32BE(0xffffffff, 8)
-  header.writeUInt32BE(0xffffffff, 12)
-  // hard code table offset
-  header.writeUInt32BE(0, 16)
-  header.writeUInt32BE(sectorSize * 3, 20)
-  header.writeUInt32BE(0x00010000, 24)
-  header.writeUInt32BE(tableEntries, 28)
-  header.writeUInt32BE(blockSize, 32)
-  const checksum = computeChecksum(header)
-  header.writeUInt32BE(checksum, 36)
-  return header
-}
-
-export function createEmptyTable (dataSize, blockSize) {
-  const blockCount = Math.ceil(dataSize / blockSize)
-  const tableSizeSectors = Math.ceil(blockCount * 4 / sectorSize)
-  const buffer = Buffer.alloc(tableSizeSectors * sectorSize, 0xff)
-  return { entryCount: blockCount, buffer: buffer, entries: [] }
-}
-
-export class ReadableRawVHDStream extends stream.Readable {
-  constructor (size, vmdkParser) {
-    super()
-    this.size = size
-    const geometry = computeGeometryForSize(size)
-    this.footer = createFooter(
-      size,
-      Math.floor(Date.now() / 1000),
-      geometry,
-      fixedHardDiskType
-    )
-    this.position = 0
-    this.vmdkParser = vmdkParser
-    this.done = false
-    this.busy = false
-    this.currentFile = []
-  }
-
-  filePadding (paddingLength) {
-    if (paddingLength !== 0) {
-      const chunkSize = 1024 * 1024 // 1Mo
-      const chunkCount = Math.floor(paddingLength / chunkSize)
-      for (let i = 0; i < chunkCount; i++) {
-        this.currentFile.push(() => {
-          const paddingBuffer = Buffer.alloc(chunkSize)
-          return paddingBuffer
-        })
-      }
-      this.currentFile.push(() => {
-        const paddingBuffer = Buffer.alloc(paddingLength % chunkSize)
-        return paddingBuffer
-      })
-    }
-  }
-
-  async pushNextBlock () {
-    const next = await this.vmdkParser.next()
-    if (next === null) {
-      const paddingLength = this.size - this.position
-      this.filePadding(paddingLength)
-      this.currentFile.push(() => this.footer)
-      this.currentFile.push(() => {
-        this.done = true
-        return null
-      })
-    } else {
-      const offset = next.lbaBytes
-      const buffer = next.grain
-      const paddingLength = offset - this.position
-      if (paddingLength < 0) {
-        process.nextTick(() =>
-          this.emit(
-            'error',
-            'This VMDK file does not have its blocks in the correct order'
-          )
-        )
-      }
-      this.filePadding(paddingLength)
-      this.currentFile.push(() => buffer)
-      this.position = offset + buffer.length
-    }
-    return this.pushFileUntilFull()
-  }
-
-  // returns true if the file is empty
-  pushFileUntilFull () {
-    while (true) {
-      if (this.currentFile.length === 0) {
-        break
-      }
-      const result = this.push(this.currentFile.shift()())
-      if (!result) {
-        break
-      }
-    }
-    return this.currentFile.length === 0
-  }
-
-  async pushNextUntilFull () {
-    while (!this.done && (await this.pushNextBlock())) {}
-  }
-
-  _read () {
-    if (this.busy || this.done) {
-      return
-    }
-    if (this.pushFileUntilFull()) {
-      this.busy = true
-      this.pushNextUntilFull()
-        .then(() => {
-          this.busy = false
-        })
-        .catch(error => {
-          process.nextTick(() => this.emit('error', error))
-        })
-    }
-  }
-}
-
-export async function convertFromVMDK (vmdkReadStream) {
-  const parser = new VMDKDirectParser(vmdkReadStream)
-  const header = await parser.readHeader()
-  return new ReadableRawVHDStream(header.capacitySectors * sectorSize, parser)
-}

packages/xo-vmdk-to-vhd/src/vhd-write.spec.js

@@ -1,137 +0,0 @@
-'use strict'
-
-import expect from 'must'
-import { createWriteStream } from 'fs'
-import { describe, it } from 'mocha'
-import { exec } from 'child-process-promise'
-import { readFile } from 'fs-promise'
-
-import {
-  computeChecksum,
-  computeGeometryForSize,
-  createDynamicDiskHeader,
-  createFooter,
-  ReadableRawVHDStream,
-  VHDFile,
-} from './vhd-write'
-
-describe('VHD writing', () => {
-  it('computeChecksum() is correct against some reference values', () => {
-    // those values were taken from a file generated by qemu
-    const testValue1 =
-      '636F6E6563746978000000020001000000000000000002001F34DB9F71656D75000500035769326B0000000000019800000000000001980000030411000000030000000033B3A5E17F94433498376740246E5660'
-    const expectedChecksum1 = 0xffffefb2
-    const testValue2 =
-      '6378737061727365FFFFFFFFFFFFFFFF0000000000000600000100000000000100200000'
-    const expectedChecksum2 = 0xfffff476
-    expect(computeChecksum(Buffer.from(testValue1, 'hex'))).to.equal(
-      expectedChecksum1
-    )
-    expect(computeChecksum(Buffer.from(testValue2, 'hex'))).to.equal(
-      expectedChecksum2
-    )
-  })
-
-  it('createFooter() does not crash', () => {
-    createFooter(104448, Math.floor(Date.now() / 1000), {
-      cylinders: 3,
-      heads: 4,
-      sectorsPerTrack: 17,
-    })
-  })
-
-  it('createDynamicDiskHeader() does not crash', () => {
-    createDynamicDiskHeader(1, 0x00200000)
-  })
-
-  it('ReadableRawVHDStream does not crash', () => {
-    const data = [
-      {
-        lbaBytes: 100,
-        grain: Buffer.from('azerzaerazeraze', 'ascii'),
-      },
-      {
-        lbaBytes: 700,
-        grain: Buffer.from('gdfslkdfguer', 'ascii'),
-      },
-    ]
-    let index = 0
-    const mockParser = {
-      next: () => {
-        if (index < data.length) {
-          const result = data[index]
-          index++
-          return result
-        } else {
-          return null
-        }
-      },
-    }
-    const stream = new ReadableRawVHDStream(100000, mockParser)
-    const pipe = stream.pipe(createWriteStream('outputStream'))
-    return new Promise((resolve, reject) => {
-      pipe.on('finish', resolve)
-      pipe.on('error', reject)
-    })
-  })
-
-  it('ReadableRawVHDStream detects when blocks are out of order', () => {
-    const data = [
-      {
-        lbaBytes: 700,
-        grain: Buffer.from('azerzaerazeraze', 'ascii'),
-      },
-      {
-        lbaBytes: 100,
-        grain: Buffer.from('gdfslkdfguer', 'ascii'),
-      },
-    ]
-    let index = 0
-    const mockParser = {
-      next: () => {
-        if (index < data.length) {
-          const result = data[index]
-          index++
-          return result
-        } else {
-          return null
-        }
-      },
-    }
-    return expect(
-      new Promise((resolve, reject) => {
-        const stream = new ReadableRawVHDStream(100000, mockParser)
-        stream.on('error', reject)
-        const pipe = stream.pipe(createWriteStream('outputStream'))
-        pipe.on('finish', resolve)
-        pipe.on('error', reject)
-      })
-    ).to.reject.to.equal(
-      'This VMDK file does not have its blocks in the correct order'
-    )
-  })
-
-  it('writing a known file with VHDFile is successful', async () => {
-    const fileName = 'output.vhd'
-    const rawFilename = 'output.raw'
-    const randomFileName = 'random.raw'
-    const geometry = computeGeometryForSize(1024 * 1024 * 8)
-    const dataSize = geometry.actualSize
-    await exec(
-      'base64 /dev/urandom | head -c ' + dataSize + ' > ' + randomFileName
-    )
-    const buffer = await readFile(randomFileName)
-    const f = new VHDFile(buffer.length, 523557791)
-    const splitPoint = Math.floor(Math.random() * buffer.length)
-    f.writeBuffer(buffer.slice(splitPoint), splitPoint)
-    f.writeBuffer(buffer.slice(0, splitPoint), 0)
-    f.writeBuffer(buffer.slice(splitPoint), splitPoint)
-    await f.writeFile(fileName)
-    await exec('qemu-img convert -fvpc -Oraw ' + fileName + ' ' + rawFilename)
-    const fileContent = await readFile(rawFilename)
-    expect(fileContent.length).to.equal(dataSize)
-    for (let i = 0; i < fileContent.length; i++) {
-      expect(fileContent[i]).to.equal(buffer[i])
-    }
-  })
-})

packages/xo-vmdk-to-vhd/src/virtual-buffer.integ.spec.js

@@ -0,0 +1,35 @@
+/* eslint-env jest */
+
+import { createReadStream, readFile } from 'fs-promise'
+import { exec } from 'child-process-promise'
+import { fromCallback as pFromCallback } from 'promise-toolbox'
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+
+import { VirtualBuffer } from './virtual-buffer'
+
+const initialDir = process.cwd()
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+test('Virtual Buffer can read a file correctly', async () => {
+  const rawFileName = 'random-data'
+  await exec('base64 /dev/urandom | head -c 1048 > ' + rawFileName)
+  const buffer = new VirtualBuffer(createReadStream(rawFileName))
+  const part1 = await buffer.readChunk(10)
+  const part2 = await buffer.readChunk(1038)
+  const original = await readFile(rawFileName)
+  expect(buffer.isDepleted).toBeTruthy()
+  expect(Buffer.concat([part1, part2]).toString('ascii')).toEqual(
+    original.toString('ascii')
+  )
+})

packages/xo-vmdk-to-vhd/src/virtual-buffer.js

@@ -2,8 +2,6 @@
 
 import { Slicer } from 'pipette'
 
-const chunkSize = 1024 * 1024
-
 export class VirtualBuffer {
   constructor (readStream) {
     this.slicer = new Slicer(readStream)
@@ -15,43 +13,23 @@ export class VirtualBuffer {
     return !this.slicer.readable
   }
 
-  // length = -1 means 'until the end'
   async readChunk (length, label) {
     const _this = this
     if (this.promise !== null) {
       throw new Error('pomise already there !!!', this.promise)
     }
-    if (length === -1) {
-      const chunks = []
-      let error = false
-      do {
-        const res = await new Promise((resolve, reject) => {
-          this.slicer.read(chunkSize, (error, length, data, offset) => {
-            if (error !== false && error !== true) {
-              reject(error)
-            } else {
-              resolve({ error, data })
-            }
-          })
-        })
-        error = res.error
-        chunks.push(res.data)
-      } while (error === false)
-      return Buffer.concat(chunks)
-    } else {
-      this.promise = label
-      return new Promise((resolve, reject) => {
-        this.slicer.read(length, (error, actualLength, data, offset) => {
-          if (error !== false && error !== true) {
-            _this.promise = null
-            reject(error)
-          } else {
-            _this.promise = null
-            _this.position += data.length
-            resolve(data)
-          }
-        })
+    this.promise = label
+    return new Promise((resolve, reject) => {
+      this.slicer.read(length, (error, actualLength, data, offset) => {
+        if (error !== false && error !== true) {
+          _this.promise = null
+          reject(error)
+        } else {
+          _this.promise = null
+          _this.position += data.length
+          resolve(data)
+        }
       })
-    }
+    })
   }
 }

packages/xo-vmdk-to-vhd/src/virtual-buffer.spec.js

@@ -1,21 +0,0 @@
-import expect from 'must'
-import { createReadStream, readFile } from 'fs-promise'
-import { describe, it } from 'mocha'
-import { exec } from 'child-process-promise'
-
-import { VirtualBuffer } from './virtual-buffer'
-
-describe('Virtual Buffer', function () {
-  it('can read a file correctly', async () => {
-    const rawFileName = 'random-data'
-    await exec('base64 /dev/urandom | head -c 104448 > ' + rawFileName)
-    const buffer = new VirtualBuffer(createReadStream(rawFileName))
-    const part1 = await buffer.readChunk(10)
-    const part2 = await buffer.readChunk(-1)
-    const original = await readFile(rawFileName)
-    expect(buffer.isDepleted).to.be.true()
-    expect(Buffer.concat([part1, part2]).toString('ascii')).to.equal(
-      original.toString('ascii')
-    )
-  })
-})

packages/xo-vmdk-to-vhd/src/vmdk-read.integ.spec.js

@@ -0,0 +1,48 @@
+/* eslint-env jest */
+
+import { createReadStream } from 'fs-promise'
+import { exec } from 'child-process-promise'
+import { fromCallback as pFromCallback } from 'promise-toolbox'
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+
+import { VMDKDirectParser } from './vmdk-read'
+
+jest.setTimeout(10000)
+
+const initialDir = process.cwd()
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+test('VMDKDirectParser reads OK', async () => {
+  const rawFileName = 'random-data'
+  const fileName = 'random-data.vmdk'
+  await exec('base64 /dev/urandom | head -c 104448 > ' + rawFileName)
+  await exec(
+    'rm -f ' +
+      fileName +
+      '&& python /usr/share/pyshared/VMDKstream.py ' +
+      rawFileName +
+      ' ' +
+      fileName
+  )
+  const parser = new VMDKDirectParser(createReadStream(fileName))
+  const header = await parser.readHeader()
+  const harvested = []
+  for await (const res of parser.blockIterator()) {
+    harvested.push(res)
+  }
+  expect(harvested.length).toEqual(2)
+  expect(harvested[0].offsetBytes).toEqual(0)
+  expect(harvested[0].data.length).toEqual(header['grainSizeSectors'] * 512)
+  expect(harvested[1].offsetBytes).toEqual(header['grainSizeSectors'] * 512)
+})

packages/xo-vmdk-to-vhd/src/vmdk-read.js

@@ -1,6 +1,7 @@
 'use strict'
 
 import zlib from 'zlib'
+
 import { VirtualBuffer } from './virtual-buffer'
 
 const sectorSize = 512
@@ -266,7 +267,7 @@ export class VMDKDirectParser {
     return this.header
   }
 
-  async next () {
+  async * blockIterator () {
     while (!this.virtualBuffer.isDepleted) {
       const position = this.virtualBuffer.position
       const sector = await this.virtualBuffer.readChunk(
@@ -293,79 +294,73 @@ export class VMDKDirectParser {
           'grain remainder ' + this.virtualBuffer.position
         )
         const grainBuffer = Buffer.concat([sector, remainderOfGrainBuffer])
-        return readGrain(
+        const grain = await readGrain(
           0,
           grainBuffer,
           this.header.compressionMethod === compressionDeflate &&
             this.header.flags.compressedGrains
         )
-      }
-    }
-    return new Promise(resolve => resolve(null))
-  }
-}
-
-export async function readRawContent (readStream) {
-  const virtualBuffer = new VirtualBuffer(readStream)
-  const headerBuffer = await virtualBuffer.readChunk(512, 'header')
-  let header = parseHeader(headerBuffer)
-
-  // I think the multiplications are OK, because the descriptor is always at the beginning of the file
-  const descriptorLength = header.descriptorSizeSectors * sectorSize
-  const descriptorBuffer = await virtualBuffer.readChunk(
-    descriptorLength,
-    'descriptor'
-  )
-  const descriptor = parseDescriptor(descriptorBuffer)
-
-  // TODO: we concat them back for now so that the indices match, we'll have to introduce a bias later
-  const remainingBuffer = await virtualBuffer.readChunk(-1, 'remainder')
-  const buffer = Buffer.concat([
-    headerBuffer,
-    descriptorBuffer,
-    remainingBuffer,
-  ])
-  if (header.grainDirectoryOffsetSectors === -1) {
-    header = parseHeader(buffer.slice(-1024, -1024 + sectorSize))
-  }
-  const rawOutputBuffer = Buffer.alloc(header.capacitySectors * sectorSize)
-  const l1Size = Math.floor(
-    (header.capacitySectors + header.l1EntrySectors - 1) / header.l1EntrySectors
-  )
-  const l2Size = header.numGTEsPerGT
-  const l1 = []
-  for (let i = 0; i < l1Size; i++) {
-    const l1Entry = buffer.readUInt32LE(
-      header.grainDirectoryOffsetSectors * sectorSize + 4 * i
-    )
-    if (l1Entry !== 0) {
-      l1.push(l1Entry)
-      const l2 = []
-      for (let j = 0; j < l2Size; j++) {
-        const l2Entry = buffer.readUInt32LE(l1Entry * sectorSize + 4 * j)
-        if (l2Entry !== 0 && l2Entry !== 1) {
-          const grain = await readGrain(
-            l2Entry,
-            buffer,
-            header['flags']['compressedGrains']
-          )
-          grain.grain.copy(rawOutputBuffer, grain.lba * sectorSize)
-          l2[j] = grain
-        }
+        yield { offsetBytes: grain.lbaBytes, data: grain.grain }
       }
     }
   }
-  const vmdkType = descriptor['descriptor']['createType']
-  if (!vmdkType || vmdkType.toLowerCase() !== 'streamOptimized'.toLowerCase()) {
-    throw new Error(
-      'unsupported VMDK type "' +
-        vmdkType +
-        '", only streamOptimized is supported'
+}
+
+export async function readVmdkGrainTable (fileAccessor) {
+  let headerBuffer = await fileAccessor(0, 512)
+  let grainDirAddr = headerBuffer.slice(56, 56 + 8)
+  if (
+    new Int8Array(grainDirAddr).reduce((acc, val) => acc && val === -1, true)
+  ) {
+    headerBuffer = await fileAccessor(-1024, -1024 + 512)
+    grainDirAddr = new DataView(headerBuffer.slice(56, 56 + 8)).getUint32(
+      0,
+      true
     )
   }
-  return {
-    descriptor: descriptor.descriptor,
-    extents: descriptor.extents,
-    rawFile: rawOutputBuffer,
+  const grainDirPosBytes = grainDirAddr * 512
+  const capacity =
+    new DataView(headerBuffer.slice(12, 12 + 8)).getUint32(0, true) * 512
+  const grainSize =
+    new DataView(headerBuffer.slice(20, 20 + 8)).getUint32(0, true) * 512
+  const grainCount = Math.ceil(capacity / grainSize)
+  const numGTEsPerGT = new DataView(headerBuffer.slice(44, 44 + 8)).getUint32(
+    0,
+    true
+  )
+  const grainTablePhysicalSize = numGTEsPerGT * 4
+  const grainDirectoryEntries = Math.ceil(grainCount / numGTEsPerGT)
+  const grainDirectoryPhysicalSize = grainDirectoryEntries * 4
+  const grainDirBuffer = await fileAccessor(
+    grainDirPosBytes,
+    grainDirPosBytes + grainDirectoryPhysicalSize
+  )
+  const grainDir = new Uint32Array(grainDirBuffer)
+  const cachedGrainTables = []
+  for (let i = 0; i < grainDirectoryEntries; i++) {
+    const grainTableAddr = grainDir[i] * 512
+    if (grainTableAddr !== 0) {
+      cachedGrainTables[i] = new Uint32Array(
+        await fileAccessor(
+          grainTableAddr,
+          grainTableAddr + grainTablePhysicalSize
+        )
+      )
+    }
   }
+  const extractedGrainTable = []
+  for (let i = 0; i < grainCount; i++) {
+    const directoryEntry = Math.floor(i / numGTEsPerGT)
+    const grainTable = cachedGrainTables[directoryEntry]
+    if (grainTable !== undefined) {
+      const grainAddr = grainTable[i % numGTEsPerGT]
+      if (grainAddr !== 0) {
+        extractedGrainTable.push([i, grainAddr])
+      }
+    }
+  }
+  extractedGrainTable.sort(
+    ([i1, grainAddress1], [i2, grainAddress2]) => grainAddress1 - grainAddress2
+  )
+  return extractedGrainTable.map(([index, grainAddress]) => index * grainSize)
 }

packages/xo-vmdk-to-vhd/src/vmdk-read.spec.js

@@ -1,35 +0,0 @@
-import expect from 'must'
-import { createReadStream } from 'fs-promise'
-import { describe, it } from 'mocha'
-import { exec } from 'child-process-promise'
-
-import { VMDKDirectParser } from './vmdk-read'
-
-describe('VMDK reading', () => {
-  it('VMDKDirectParser reads OK', async () => {
-    const rawFileName = 'random-data'
-    const fileName = 'random-data.vmdk'
-    await exec('base64 /dev/urandom | head -c 104448 > ' + rawFileName)
-    await exec(
-      'rm -f ' +
-        fileName +
-        '&& VBoxManage convertfromraw --format VMDK --variant Stream ' +
-        rawFileName +
-        ' ' +
-        fileName
-    )
-    const parser = new VMDKDirectParser(createReadStream(fileName))
-    const header = await parser.readHeader()
-    const harvested = []
-    while (true) {
-      const res = await parser.next()
-      if (res === null) {
-        break
-      }
-      harvested.push(res)
-    }
-    expect(harvested.length).to.equal(2)
-    expect(harvested[0].lba).to.equal(0)
-    expect(harvested[1].lba).to.equal(header['grainSizeSectors'])
-  }).timeout(10000)
-})

packages/xo-vmdk-to-vhd/src/vmdk-to-vhd.integ.spec.js

@@ -0,0 +1,91 @@
+/* eslint-env jest */
+
+import execa from 'execa'
+import eventToPromise from 'event-to-promise'
+import getStream from 'get-stream'
+import rimraf from 'rimraf'
+import tmp from 'tmp'
+
+import { createReadStream, createWriteStream, stat } from 'fs-promise'
+import { fromCallback as pFromCallback } from 'promise-toolbox'
+import convertFromVMDK, { readVmdkGrainTable } from '.'
+
+const initialDir = process.cwd()
+jest.setTimeout(100000)
+
+beforeEach(async () => {
+  const dir = await pFromCallback(cb => tmp.dir(cb))
+  process.chdir(dir)
+})
+
+afterEach(async () => {
+  const tmpDir = process.cwd()
+  process.chdir(initialDir)
+  await pFromCallback(cb => rimraf(tmpDir, cb))
+})
+
+function createFileAccessor (file) {
+  return async (start, end) => {
+    if (start < 0 || end < 0) {
+      const fileLength = (await stat(file)).size
+      start = start < 0 ? fileLength + start : start
+      end = end < 0 ? fileLength + end : end
+    }
+    const result = await getStream.buffer(
+      createReadStream(file, { start, end: end - 1 })
+    )
+    // crazy stuff to get a browser-compatible ArrayBuffer from a node buffer
+    // https://stackoverflow.com/a/31394257/72637
+    return result.buffer.slice(
+      result.byteOffset,
+      result.byteOffset + result.byteLength
+    )
+  }
+}
+
+test('VMDK to VHD can convert a random data file with VMDKDirectParser', async () => {
+  const inputRawFileName = 'random-data.raw'
+  const vmdkFileName = 'random-data.vmdk'
+  const vhdFileName = 'from-vmdk-VMDKDirectParser.vhd'
+  const reconvertedFromVhd = 'from-vhd.raw'
+  const reconvertedFromVmdk = 'from-vhd-by-vbox.raw'
+  const dataSize = 8355840 // this number is an integer head/cylinder/count equation solution
+  try {
+    await execa.shell(
+      'base64 /dev/urandom | head -c ' + dataSize + ' > ' + inputRawFileName
+    )
+    await execa.shell(
+      'python /usr/share/pyshared/VMDKstream.py ' +
+        inputRawFileName +
+        ' ' +
+        vmdkFileName
+    )
+    const result = await readVmdkGrainTable(createFileAccessor(vmdkFileName))
+    const pipe = (await convertFromVMDK(
+      createReadStream(vmdkFileName),
+      result
+    )).pipe(createWriteStream(vhdFileName))
+    await eventToPromise(pipe, 'finish')
+    await execa('vhd-util', ['check', '-p', '-b', '-t', '-n', vhdFileName])
+    await execa('qemu-img', [
+      'convert',
+      '-fvmdk',
+      '-Oraw',
+      vmdkFileName,
+      reconvertedFromVmdk,
+    ])
+    await execa('qemu-img', [
+      'convert',
+      '-fvpc',
+      '-Oraw',
+      vhdFileName,
+      reconvertedFromVhd,
+    ])
+    await execa('qemu-img', ['compare', inputRawFileName, vhdFileName])
+  } catch (error) {
+    console.error(error.stdout)
+    console.error(error.stderr)
+    console.error(error.message)
+    throw error
+  }
+})

packages/xo-vmdk-to-vhd/src/vmdk-to-vhd.spec.js

@@ -1,115 +0,0 @@
-'use strict'
-
-import { describe, it } from 'mocha'
-import { exec } from 'child-process-promise'
-import { createReadStream, createWriteStream } from 'fs-promise'
-
-import { readRawContent } from './vmdk-read'
-import { VHDFile, convertFromVMDK, computeGeometryForSize } from './vhd-write'
-
-describe('VMDK to VHD conversion', () => {
-  it('can convert a random data file with readRawContent()', async () => {
-    const inputRawFileName = 'random-data.raw'
-    const vmdkFileName = 'random-data.vmdk'
-    const vhdFileName = 'from-vmdk-readRawContent.vhd'
-    const reconvertedRawFilemane = 'from-vhd.raw'
-    const dataSize = 5222400
-    await exec(
-      'rm -f ' +
-        [
-          inputRawFileName,
-          vmdkFileName,
-          vhdFileName,
-          reconvertedRawFilemane,
-        ].join(' ')
-    )
-    await exec(
-      'base64 /dev/urandom | head -c ' + dataSize + ' > ' + inputRawFileName
-    )
-    await exec(
-      'VBoxManage convertfromraw --format VMDK --variant Stream ' +
-        inputRawFileName +
-        ' ' +
-        vmdkFileName
-    )
-    const rawContent = (await readRawContent(createReadStream(vmdkFileName)))
-      .rawFile
-    const f = new VHDFile(rawContent.length, 523557791)
-    await f.writeBuffer(rawContent)
-    await f.writeFile(vhdFileName)
-    await exec(
-      'qemu-img convert -fvpc -Oraw ' +
-        vhdFileName +
-        ' ' +
-        reconvertedRawFilemane
-    )
-    return exec('qemu-img compare ' + vmdkFileName + ' ' + vhdFileName).catch(
-      error => {
-        console.error(error.stdout)
-        console.error(error.stderr)
-        console.error(vhdFileName, vmdkFileName, error.message)
-
-        throw error
-      }
-    )
-  })
-
-  it('can convert a random data file with VMDKDirectParser', async () => {
-    const inputRawFileName = 'random-data.raw'
-    const vmdkFileName = 'random-data.vmdk'
-    const vhdFileName = 'from-vmdk-VMDKDirectParser.vhd'
-    const reconvertedRawFilemane = 'from-vhd.raw'
-    const reconvertedByVBoxRawFilemane = 'from-vhd-by-vbox.raw'
-    const dataSize = computeGeometryForSize(8 * 1024 * 1024).actualSize
-    await exec(
-      'rm -f ' +
-        [
-          inputRawFileName,
-          vmdkFileName,
-          vhdFileName,
-          reconvertedRawFilemane,
-          reconvertedByVBoxRawFilemane,
-        ].join(' ')
-    )
-    await exec(
-      'base64 /dev/urandom | head -c ' + dataSize + ' > ' + inputRawFileName
-    )
-    await exec(
-      'VBoxManage convertfromraw --format VMDK --variant Stream ' +
-        inputRawFileName +
-        ' ' +
-        vmdkFileName
-    )
-    const pipe = (await convertFromVMDK(createReadStream(vmdkFileName))).pipe(
-      createWriteStream(vhdFileName)
-    )
-    await new Promise((resolve, reject) => {
-      pipe.on('finish', resolve)
-      pipe.on('error', reject)
-    })
-    await exec(
-      'qemu-img convert -fvmdk -Oraw ' +
-        vmdkFileName +
-        ' ' +
-        reconvertedByVBoxRawFilemane
-    )
-    await exec(
-      'qemu-img convert -fvpc -Oraw ' +
-        vhdFileName +
-        ' ' +
-        reconvertedRawFilemane
-    )
-    return exec(
-      'qemu-img compare ' +
-        reconvertedByVBoxRawFilemane +
-        ' ' +
-        reconvertedRawFilemane
-    ).catch(error => {
-      console.error(error.stdout)
-      console.error(error.stderr)
-      console.error(vhdFileName, vmdkFileName, error.message)
-
-      throw error
-    })
-  })
-})

packages/xo-web/package.json

@@ -1,7 +1,7 @@
 {
   "private": false,
   "name": "xo-web",
-  "version": "5.19.0",
+  "version": "5.19.2",
   "license": "AGPL-3.0",
   "description": "Web interface client for Xen-Orchestra",
   "keywords": [
@@ -33,6 +33,7 @@
     "@julien-f/freactal": "0.1.0",
     "@nraynaud/novnc": "0.6.1",
     "@xen-orchestra/cron": "^1.0.3",
+    "xo-vmdk-to-vhd": "0.1.0",
     "ansi_up": "^3.0.0",
     "asap": "^2.0.6",
     "babel-core": "^6.26.0",
@@ -125,7 +126,6 @@
     "rimraf": "^2.6.2",
     "semver": "^5.4.1",
     "styled-components": "^3.1.5",
-    "tar-stream": "^1.5.5",
     "uglify-es": "^3.3.4",
     "uncontrollable-input": "^0.1.1",
     "url-parse": "^1.2.0",