listMissingPatchesFailed

See #4546

.eslintrc.js

@@ -21,7 +21,7 @@ module.exports = {
 
   overrides: [
     {
-      files: ['cli.js', '*-cli.js', 'packages/*cli*/**/*.js'],
+      files: ['cli.js', '*-cli.js', '**/*cli*/**/*.js'],
       rules: {
         'no-console': 'off',
       },
@@ -38,6 +38,15 @@ module.exports = {
     // disabled because XAPI objects are using camel case
     camelcase: ['off'],
 
+    'react/jsx-handler-names': 'off',
+
+    // disabled because not always relevant, we might reconsider in the future
+    //
+    // enabled by https://github.com/standard/eslint-config-standard/commit/319b177750899d4525eb1210686f6aca96190b2f
+    //
+    // example: https://github.com/vatesfr/xen-orchestra/blob/31ed3767c67044ca445658eb6b560718972402f2/packages/xen-api/src/index.js#L156-L157
+    'lines-between-class-members': 'off',
+
     'no-console': ['error', { allow: ['warn', 'error'] }],
     'no-var': 'error',
     'node/no-extraneous-import': 'error',

@xen-orchestra/async-map/package.json

@@ -36,8 +36,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/backups-cli/index.js

@@ -0,0 +1,378 @@
+#!/usr/bin/env node
+
+const args = process.argv.slice(2)
+
+if (
+  args.length === 0 ||
+  /^(?:-h|--help)$/.test(args[0]) ||
+  args[0] !== 'clean-vms'
+) {
+  console.log('Usage: xo-backups clean-vms [--force] xo-vm-backups/*')
+  // eslint-disable-next-line no-process-exit
+  return process.exit(1)
+}
+
+// remove `clean-vms` arg which is the only available command ATM
+args.splice(0, 1)
+
+// only act (ie delete files) if `--force` is present
+const force = args[0] === '--force'
+if (force) {
+  args.splice(0, 1)
+}
+
+// -----------------------------------------------------------------------------
+
+const assert = require('assert')
+const lockfile = require('proper-lockfile')
+const { default: Vhd } = require('vhd-lib')
+const { curryRight, flatten } = require('lodash')
+const { dirname, resolve } = require('path')
+const { DISK_TYPE_DIFFERENCING } = require('vhd-lib/dist/_constants')
+const { pipe, promisifyAll } = require('promise-toolbox')
+
+const fs = promisifyAll(require('fs'))
+const handler = require('@xen-orchestra/fs').getHandler({ url: 'file://' })
+
+// -----------------------------------------------------------------------------
+
+const asyncMap = curryRight((iterable, fn) =>
+  Promise.all(
+    Array.isArray(iterable) ? iterable.map(fn) : Array.from(iterable, fn)
+  )
+)
+
+const filter = (...args) => thisArg => thisArg.filter(...args)
+
+// TODO: better check?
+
+// our heuristic is not good enough, there has been some false positives
+// (detected as invalid by us but valid by `tar` and imported with success),
+// either:
+// - these files were normal but the check is incorrect
+// - these files were invalid but without data loss
+// - these files were invalid but with silent data loss
+//
+// FIXME: the heuristic does not work if the XVA is compressed, we need to
+// implement a specific test for it
+//
+// maybe reading the end of the file looking for a file named
+// /^Ref:\d+/\d+\.checksum$/ and then validating the tar structure from it
+//
+// https://github.com/npm/node-tar/issues/234#issuecomment-538190295
+const isValidTar = async path => {
+  try {
+    const fd = await fs.open(path, 'r')
+    try {
+      const { size } = await fs.fstat(fd)
+      if (size <= 1024 || size % 512 !== 0) {
+        return false
+      }
+
+      const buf = Buffer.allocUnsafe(1024)
+      assert.strictEqual(
+        await fs.read(fd, buf, 0, buf.length, size - buf.length),
+        buf.length
+      )
+      return buf.every(_ => _ === 0)
+    } finally {
+      fs.close(fd).catch(noop)
+    }
+  } catch (error) {
+    // never throw, log and report as valid to avoid side effects
+    console.error('isValidTar', path, error)
+    return true
+  }
+}
+
+const noop = Function.prototype
+
+const readDir = path =>
+  fs.readdir(path).then(
+    entries => {
+      entries.forEach((entry, i) => {
+        entries[i] = `${path}/${entry}`
+      })
+
+      return entries
+    },
+    error => {
+      // a missing dir is by definition empty
+      if (error != null && error.code === 'ENOENT') {
+        return []
+      }
+      throw error
+    }
+  )
+
+// -----------------------------------------------------------------------------
+
+// chain is an array of VHDs from child to parent
+//
+// the whole chain will be merged into parent, parent will be renamed to child
+// and all the others will deleted
+async function mergeVhdChain(chain) {
+  assert(chain.length >= 2)
+
+  const child = chain[0]
+  const parent = chain[chain.length - 1]
+  const children = chain.slice(0, -1).reverse()
+
+  console.warn('Unused parents of VHD', child)
+  chain
+    .slice(1)
+    .reverse()
+    .forEach(parent => {
+      console.warn('  ', parent)
+    })
+  force && console.warn('  merging…')
+  console.warn('')
+  if (force) {
+    // `mergeVhd` does not work with a stream, either
+    // - make it accept a stream
+    // - or create synthetic VHD which is not a stream
+    return console.warn('TODO: implement merge')
+    // await mergeVhd(
+    //   handler,
+    //   parent,
+    //   handler,
+    //   children.length === 1
+    //     ? child
+    //     : await createSyntheticStream(handler, children)
+    // )
+  }
+
+  await Promise.all([
+    force && fs.rename(parent, child),
+    asyncMap(children.slice(0, -1), child => {
+      console.warn('Unused VHD', child)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(child)
+    }),
+  ])
+}
+
+const listVhds = pipe([
+  vmDir => vmDir + '/vdis',
+  readDir,
+  asyncMap(readDir),
+  flatten,
+  asyncMap(readDir),
+  flatten,
+  filter(_ => _.endsWith('.vhd')),
+])
+
+async function handleVm(vmDir) {
+  const vhds = new Set()
+  const vhdParents = { __proto__: null }
+  const vhdChildren = { __proto__: null }
+
+  // remove broken VHDs
+  await asyncMap(await listVhds(vmDir), async path => {
+    try {
+      const vhd = new Vhd(handler, path)
+      await vhd.readHeaderAndFooter()
+      vhds.add(path)
+      if (vhd.footer.diskType === DISK_TYPE_DIFFERENCING) {
+        const parent = resolve(dirname(path), vhd.header.parentUnicodeName)
+        vhdParents[path] = parent
+        if (parent in vhdChildren) {
+          const error = new Error(
+            'this script does not support multiple VHD children'
+          )
+          error.parent = parent
+          error.child1 = vhdChildren[parent]
+          error.child2 = path
+          throw error // should we throw?
+        }
+        vhdChildren[parent] = path
+      }
+    } catch (error) {
+      console.warn('Error while checking VHD', path)
+      console.warn('  ', error)
+      if (error != null && error.code === 'ERR_ASSERTION') {
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(path))
+      }
+    }
+  })
+
+  // remove VHDs with missing ancestors
+  {
+    const deletions = []
+
+    // return true if the VHD has been deleted or is missing
+    const deleteIfOrphan = vhd => {
+      const parent = vhdParents[vhd]
+      if (parent === undefined) {
+        return
+      }
+
+      // no longer needs to be checked
+      delete vhdParents[vhd]
+
+      deleteIfOrphan(parent)
+
+      if (!vhds.has(parent)) {
+        vhds.delete(vhd)
+
+        console.warn('Error while checking VHD', vhd)
+        console.warn('  missing parent', parent)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && deletions.push(handler.unlink(vhd))
+      }
+    }
+
+    // > A property that is deleted before it has been visited will not be
+    // > visited later.
+    // >
+    // > -- https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Statements/for...in#Deleted_added_or_modified_properties
+    for (const child in vhdParents) {
+      deleteIfOrphan(child)
+    }
+
+    await Promise.all(deletions)
+  }
+
+  const [jsons, xvas] = await readDir(vmDir).then(entries => [
+    entries.filter(_ => _.endsWith('.json')),
+    new Set(entries.filter(_ => _.endsWith('.xva'))),
+  ])
+
+  await asyncMap(xvas, async path => {
+    // check is not good enough to delete the file, the best we can do is report
+    // it
+    if (!(await isValidTar(path))) {
+      console.warn('Potential broken XVA', path)
+      console.warn('')
+    }
+  })
+
+  const unusedVhds = new Set(vhds)
+  const unusedXvas = new Set(xvas)
+
+  // compile the list of unused XVAs and VHDs, and remove backup metadata which
+  // reference a missing XVA/VHD
+  await asyncMap(jsons, async json => {
+    const metadata = JSON.parse(await fs.readFile(json))
+    const { mode } = metadata
+    if (mode === 'full') {
+      const linkedXva = resolve(vmDir, metadata.xva)
+
+      if (xvas.has(linkedXva)) {
+        unusedXvas.delete(linkedXva)
+      } else {
+        console.warn('Error while checking backup', json)
+        console.warn('  missing file', linkedXva)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    } else if (mode === 'delta') {
+      const linkedVhds = (() => {
+        const { vhds } = metadata
+        return Object.keys(vhds).map(key => resolve(vmDir, vhds[key]))
+      })()
+
+      // FIXME: find better approach by keeping as much of the backup as
+      // possible (existing disks) even if one disk is missing
+      if (linkedVhds.every(_ => vhds.has(_))) {
+        linkedVhds.forEach(_ => unusedVhds.delete(_))
+      } else {
+        console.warn('Error while checking backup', json)
+        const missingVhds = linkedVhds.filter(_ => !vhds.has(_))
+        console.warn(
+          '  %i/%i missing VHDs',
+          missingVhds.length,
+          linkedVhds.length
+        )
+        missingVhds.forEach(vhd => {
+          console.warn('  ', vhd)
+        })
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    }
+  })
+
+  // TODO: parallelize by vm/job/vdi
+  const unusedVhdsDeletion = []
+  {
+    // VHD chains (as list from child to ancestor) to merge indexed by last
+    // ancestor
+    const vhdChainsToMerge = { __proto__: null }
+
+    const toCheck = new Set(unusedVhds)
+
+    const getUsedChildChainOrDelete = vhd => {
+      if (vhd in vhdChainsToMerge) {
+        const chain = vhdChainsToMerge[vhd]
+        delete vhdChainsToMerge[vhd]
+        return chain
+      }
+
+      if (!unusedVhds.has(vhd)) {
+        return [vhd]
+      }
+
+      // no longer needs to be checked
+      toCheck.delete(vhd)
+
+      const child = vhdChildren[vhd]
+      if (child !== undefined) {
+        const chain = getUsedChildChainOrDelete(child)
+        if (chain !== undefined) {
+          chain.push(vhd)
+          return chain
+        }
+      }
+
+      console.warn('Unused VHD', vhd)
+      force && console.warn('  deleting…')
+      console.warn('')
+      force && unusedVhdsDeletion.push(handler.unlink(vhd))
+    }
+
+    toCheck.forEach(vhd => {
+      vhdChainsToMerge[vhd] = getUsedChildChainOrDelete(vhd)
+    })
+
+    Object.keys(vhdChainsToMerge).forEach(key => {
+      const chain = vhdChainsToMerge[key]
+      if (chain !== undefined) {
+        unusedVhdsDeletion.push(mergeVhdChain(chain))
+      }
+    })
+  }
+
+  await Promise.all([
+    unusedVhdsDeletion,
+    asyncMap(unusedXvas, path => {
+      console.warn('Unused XVA', path)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(path)
+    }),
+  ])
+}
+
+// -----------------------------------------------------------------------------
+
+asyncMap(args, async vmDir => {
+  vmDir = resolve(vmDir)
+
+  // TODO: implement this in `xo-server`, not easy because not compatible with
+  // `@xen-orchestra/fs`.
+  const release = await lockfile.lock(vmDir)
+  try {
+    await handleVm(vmDir)
+  } catch (error) {
+    console.error('handleVm', vmDir, error)
+  } finally {
+    await release()
+  }
+}).catch(error => console.error('main', error))

@xen-orchestra/backups-cli/package.json

@@ -0,0 +1,27 @@
+{
+  "bin": {
+    "xo-backups": "index.js"
+  },
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "dependencies": {
+    "@xen-orchestra/fs": "^0.10.1",
+    "lodash": "^4.17.15",
+    "promise-toolbox": "^0.14.0",
+    "proper-lockfile": "^4.1.1",
+    "vhd-lib": "^0.7.0"
+  },
+  "engines": {
+    "node": ">=8.16.1"
+  },
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/backups-cli",
+  "name": "@xen-orchestra/backups-cli",
+  "repository": {
+    "directory": "@xen-orchestra/backups-cli",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "version": "0.0.0"
+}

@xen-orchestra/cr-seed-cli/package.json

@@ -16,7 +16,7 @@
   },
   "dependencies": {
     "golike-defer": "^0.4.1",
-    "xen-api": "^0.27.1"
+    "xen-api": "^0.27.2"
   },
   "scripts": {
     "postversion": "npm publish"

@xen-orchestra/cron/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@xen-orchestra/cron",
-  "version": "1.0.3",
+  "version": "1.0.4",
   "license": "ISC",
   "description": "Focused, well maintained, cron parser/scheduler",
   "keywords": [
@@ -46,8 +46,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/cron/src/index.js

@@ -5,9 +5,16 @@ import parse from './parse'
 
 const MAX_DELAY = 2 ** 31 - 1
 
+function nextDelay(schedule) {
+  const now = schedule._createDate()
+  return next(schedule._schedule, now) - now
+}
+
 class Job {
   constructor(schedule, fn) {
     const wrapper = () => {
+      this._isRunning = true
+
       let result
       try {
         result = fn()
@@ -22,23 +29,34 @@ class Job {
       }
     }
     const scheduleNext = () => {
-      const delay = schedule._nextDelay()
-      this._timeout =
-        delay < MAX_DELAY
-          ? setTimeout(wrapper, delay)
-          : setTimeout(scheduleNext, MAX_DELAY)
+      this._isRunning = false
+
+      if (this._isEnabled) {
+        const delay = nextDelay(schedule)
+        this._timeout =
+          delay < MAX_DELAY
+            ? setTimeout(wrapper, delay)
+            : setTimeout(scheduleNext, MAX_DELAY)
+      }
     }
 
+    this._isEnabled = false
+    this._isRunning = false
     this._scheduleNext = scheduleNext
     this._timeout = undefined
   }
 
   start() {
     this.stop()
-    this._scheduleNext()
+
+    this._isEnabled = true
+    if (!this._isRunning) {
+      this._scheduleNext()
+    }
   }
 
   stop() {
+    this._isEnabled = false
     clearTimeout(this._timeout)
   }
 }
@@ -68,11 +86,6 @@ class Schedule {
     return dates
   }
 
-  _nextDelay() {
-    const now = this._createDate()
-    return next(this._schedule, now) - now
-  }
-
   startJob(fn) {
     const job = this.createJob(fn)
     job.start()

@xen-orchestra/cron/src/index.spec.js

@@ -0,0 +1,62 @@
+/* eslint-env jest */
+
+import { createSchedule } from './'
+
+describe('issues', () => {
+  test('stop during async execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const job = createSchedule('* * * * *').createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+
+    resolve()
+    await promise
+
+    jest.runAllTimers()
+    expect(nCalls).toBe(1)
+  })
+
+  test('stop then start during async job execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const job = createSchedule('* * * * *').createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+    job.start()
+
+    resolve()
+    await promise
+
+    jest.runAllTimers()
+    expect(nCalls).toBe(2)
+  })
+})

@xen-orchestra/defined/package.json

@@ -34,8 +34,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/emit-async/package.json

@@ -33,8 +33,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/fs/package.json

@@ -30,7 +30,7 @@
     "get-stream": "^4.0.0",
     "limit-concurrency-decorator": "^0.4.0",
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "readable-stream": "^3.0.6",
     "through2": "^3.0.0",
     "tmp": "^0.1.0",
@@ -46,10 +46,10 @@
     "@babel/preset-flow": "^7.0.0",
     "async-iterator-to-stream": "^1.1.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "dotenv": "^8.0.0",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/log/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@xen-orchestra/log",
-  "version": "0.1.4",
+  "version": "0.2.0",
   "license": "ISC",
   "description": "",
   "keywords": [],
@@ -31,16 +31,16 @@
   },
   "dependencies": {
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0"
+    "promise-toolbox": "^0.14.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/log/src/configure.js

@@ -19,7 +19,8 @@ const createTransport = config => {
     }
   }
 
-  let { filter, transport } = config
+  let { filter } = config
+  let transport = createTransport(config.transport)
   const level = resolve(config.level)
 
   if (filter !== undefined) {
@@ -51,11 +52,12 @@ const symbol =
     ? Symbol.for('@xen-orchestra/log')
     : '@@@xen-orchestra/log'
 
+const { env } = process
 global[symbol] = createTransport({
   // display warnings or above, and all that are enabled via DEBUG or
   // NODE_DEBUG env
-  filter: process.env.DEBUG || process.env.NODE_DEBUG,
-  level: LEVELS.INFO,
+  filter: [env.DEBUG, env.NODE_DEBUG].filter(Boolean).join(','),
+  level: resolve(env.LOG_LEVEL, LEVELS.INFO),
 
   transport: createConsoleTransport(),
 })

@xen-orchestra/log/src/index.js

@@ -1,5 +1,5 @@
 import createTransport from './transports/console'
-import LEVELS from './levels'
+import LEVELS, { resolve } from './levels'
 
 const symbol =
   typeof Symbol !== 'undefined'
@@ -9,7 +9,8 @@ if (!(symbol in global)) {
   // the default behavior, without requiring `configure` is to avoid
   // logging anything unless it's a real error
   const transport = createTransport()
-  global[symbol] = log => log.level > LEVELS.WARN && transport(log)
+  const level = resolve(process.env.LOG_LEVEL, LEVELS.WARN)
+  global[symbol] = log => log.level >= level && transport(log)
 }
 
 // -------------------------------------------------------------------
@@ -72,5 +73,5 @@ prototype.wrap = function(message, fn) {
   }
 }
 
-const createLogger = namespace => new Logger(namespace)
+export const createLogger = namespace => new Logger(namespace)
 export { createLogger as default }

@xen-orchestra/log/src/levels.js

@@ -13,11 +13,22 @@ for (const name in LEVELS) {
   NAMES[LEVELS[name]] = name
 }
 
-export const resolve = level => {
-  if (typeof level === 'string') {
-    level = LEVELS[level.toUpperCase()]
+// resolves to the number representation of a level
+//
+// returns `defaultLevel` if invalid
+export const resolve = (level, defaultLevel) => {
+  const type = typeof level
+  if (type === 'number') {
+    if (level in NAMES) {
+      return level
+    }
+  } else if (type === 'string') {
+    const nLevel = LEVELS[level.toUpperCase()]
+    if (nLevel !== undefined) {
+      return nLevel
+    }
   }
-  return level
+  return defaultLevel
 }
 
 Object.freeze(LEVELS)

@xen-orchestra/log/src/transports/console.js

@@ -1,26 +1,23 @@
 import LEVELS, { NAMES } from '../levels'
 
-// Bind console methods (necessary for browsers)
-/* eslint-disable no-console */
-const debugConsole = console.log.bind(console)
-const infoConsole = console.info.bind(console)
-const warnConsole = console.warn.bind(console)
-const errorConsole = console.error.bind(console)
-/* eslint-enable no-console */
-
 const { ERROR, INFO, WARN } = LEVELS
 
 const consoleTransport = ({ data, level, namespace, message, time }) => {
   const fn =
+    /* eslint-disable no-console */
     level < INFO
-      ? debugConsole
+      ? console.log
       : level < WARN
-      ? infoConsole
+      ? console.info
       : level < ERROR
-      ? warnConsole
-      : errorConsole
+      ? console.warn
+      : console.error
+  /* eslint-enable no-console */
 
-  fn('%s - %s - [%s] %s', time.toISOString(), namespace, NAMES[level], message)
-  data != null && fn(data)
+  const args = [time.toISOString(), namespace, NAMES[level], message]
+  if (data != null) {
+    args.push(data)
+  }
+  fn.apply(console, args)
 }
 export default () => consoleTransport

@xen-orchestra/mixin/package.json

@@ -36,8 +36,8 @@
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-dev": "^1.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/template/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/template/README.md

@@ -0,0 +1,62 @@
+# @xen-orchestra/template [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/template):
+
+```
+> npm install --save @xen-orchestra/template
+```
+
+## Usage
+
+Create a string replacer based on a pattern and a list of rules.
+
+```js
+const myReplacer = compileTemplate('{name}_COPY_\{name}_{id}_%\%', {
+  '{name}': vm => vm.name_label,
+  '{id}': vm => vm.id,
+  '%': (_, i) => i
+})
+
+const newString = myReplacer({
+  name_label: 'foo',
+  id: 42,
+}, 32)
+
+newString === 'foo_COPY_{name}_42_32%' // true
+```
+
+## Development
+
+```
+# Install dependencies
+> yarn
+
+# Run the tests
+> yarn test
+
+# Continuously compile
+> yarn dev
+
+# Continuously run the tests
+> yarn dev-test
+
+# Build for production (automatically called by npm install)
+> yarn build
+```
+
+## Contributions
+
+Contributions are *very* welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+ISC © [Vates SAS](https://vates.fr)

@xen-orchestra/template/package.json

@@ -0,0 +1,46 @@
+{
+  "name": "@xen-orchestra/template",
+  "version": "0.1.0",
+  "license": "ISC",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/template",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/template",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Julien Fontanet",
+    "email": "julien.fontanet@vates.fr"
+  },
+  "preferGlobal": false,
+  "main": "dist/",
+  "files": [
+    "dist/"
+  ],
+  "browserslist": [
+    ">2%"
+  ],
+  "engines": {
+    "node": ">=6"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.0.0",
+    "@babel/core": "^7.0.0",
+    "@babel/preset-env": "^7.0.0",
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "clean": "rimraf dist/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "yarn run clean",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build",
+    "postversion": "npm publish --access public"
+  },
+  "dependencies": {
+    "lodash": "^4.17.15"
+  }
+}

@xen-orchestra/template/src/index.js

@@ -0,0 +1,19 @@
+import escapeRegExp from 'lodash/escapeRegExp'
+
+const compareLengthDesc = (a, b) => b.length - a.length
+
+export function compileTemplate(pattern, rules) {
+  const matches = Object.keys(rules)
+    .sort(compareLengthDesc)
+    .map(escapeRegExp)
+    .join('|')
+  const regExp = new RegExp(`\\\\(?:\\\\|${matches})|${matches}`, 'g')
+  return (...params) =>
+    pattern.replace(regExp, match => {
+      if (match[0] === '\\') {
+        return match.slice(1)
+      }
+      const rule = rules[match]
+      return typeof rule === 'function' ? rule(...params) : rule
+    })
+}

@xen-orchestra/template/src/index.spec.js

@@ -0,0 +1,14 @@
+/* eslint-env jest */
+import { compileTemplate } from '.'
+
+it("correctly replaces the template's variables", () => {
+  const replacer = compileTemplate(
+    '{property}_\\{property}_\\\\{property}_{constant}_%_FOO',
+    {
+      '{property}': obj => obj.name,
+      '{constant}': 1235,
+      '%': (_, i) => i,
+    }
+  )
+  expect(replacer({ name: 'bar' }, 5)).toBe('bar_{property}_\\bar_1235_5_FOO')
+})

CHANGELOG.md

@@ -4,12 +4,95 @@
 
 ### Enhancements
 
+### Bug fixes
+
+### Released packages
+
+
+## **5.39.1** (2019-10-11)
+
+![Channel: latest](https://badgen.net/badge/channel/latest/yellow)
+
+### Enhancements
+
+- [Support] Ability to check the XOA on the user interface [#4513](https://github.com/vatesfr/xen-orchestra/issues/4513) (PR [#4574](https://github.com/vatesfr/xen-orchestra/pull/4574))
+
+### Bug fixes
+
+- [VM/new-vm] Fix template selection on creating new VM for resource sets [#4565](https://github.com/vatesfr/xen-orchestra/issues/4565) (PR [#4568](https://github.com/vatesfr/xen-orchestra/pull/4568))
+- [VM] Clearer invalid cores per socket error [#4120](https://github.com/vatesfr/xen-orchestra/issues/4120) (PR [#4187](https://github.com/vatesfr/xen-orchestra/pull/4187))
+
+### Released packages
+
+- xo-web v5.50.3
+
+
+## **5.39.0** (2019-09-30)
+
+### Highlights
+
+- [VM/console] Add a button to connect to the VM via the local SSH client (PR [#4415](https://github.com/vatesfr/xen-orchestra/pull/4415))
+- [SDN Controller] Add possibility to encrypt private networks (PR [#4441](https://github.com/vatesfr/xen-orchestra/pull/4441))
+- [Backups] Improve performance by caching VM backups listing (PR [#4509](https://github.com/vatesfr/xen-orchestra/pull/4509))
+- [HUB] VM template store [#1918](https://github.com/vatesfr/xen-orchestra/issues/1918) (PR [#4442](https://github.com/vatesfr/xen-orchestra/pull/4442))
+
+### Enhancements
+
+- [SR/new] Clarify address formats [#4450](https://github.com/vatesfr/xen-orchestra/issues/4450) (PR [#4460](https://github.com/vatesfr/xen-orchestra/pull/4460))
+- [Backup NG/New] Show warning if zstd compression is not supported on a VM [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PRs [#4411](https://github.com/vatesfr/xen-orchestra/pull/4411))
+- [VM/disks] Don't hide disks that are attached to the same VM twice [#4400](https://github.com/vatesfr/xen-orchestra/issues/4400) (PR [#4414](https://github.com/vatesfr/xen-orchestra/pull/4414))
+- [SDN Controller] Ability to configure MTU for private networks (PR [#4491](https://github.com/vatesfr/xen-orchestra/pull/4491))
+- [VM Export] Filenames are now prefixed with datetime [#4503](https://github.com/vatesfr/xen-orchestra/issues/4503)
+- [Settings/Logs] Differenciate XS/XCP-ng errors from XO errors [#4101](https://github.com/vatesfr/xen-orchestra/issues/4101) (PR [#4385](https://github.com/vatesfr/xen-orchestra/pull/4385))
+- [Backups] Improve performance by caching logs consolidation (PR [#4541](https://github.com/vatesfr/xen-orchestra/pull/4541))
+- [New VM] Cloud Init available for all plans (PR [#4543](https://github.com/vatesfr/xen-orchestra/pull/4543))
+- [Servers] IPv6 addresses can be used [#4520](https://github.com/vatesfr/xen-orchestra/issues/4520) (PR [#4521](https://github.com/vatesfr/xen-orchestra/pull/4521)) \
+  Note: They must enclosed in brackets to differentiate with the port, e.g.: `[2001:db8::7334]` or `[ 2001:db8::7334]:4343`
+
+### Bug fixes
+
+- [PBD] Obfuscate cifs password from device config [#4384](https://github.com/vatesfr/xen-orchestra/issues/4384) (PR [#4401](https://github.com/vatesfr/xen-orchestra/pull/4401))
+- [XOSAN] Fix "invalid parameters" error on creating a SR (PR [#4478](https://github.com/vatesfr/xen-orchestra/pull/4478))
+- [Patching] Avoid overloading XCP-ng by reducing the frequency of yum update checks [#4358](https://github.com/vatesfr/xen-orchestra/issues/4358) (PR [#4477](https://github.com/vatesfr/xen-orchestra/pull/4477))
+- [Network] Fix inability to create a bonded network (PR [#4489](https://github.com/vatesfr/xen-orchestra/pull/4489))
+- [Backup restore & Replication] Don't copy `sm_config` to new VDIs which might leads to useless coalesces [#4482](https://github.com/vatesfr/xen-orchestra/issues/4482) (PR [#4484](https://github.com/vatesfr/xen-orchestra/pull/4484))
+- [Home] Fix intermediary "no results" display showed on filtering items [#4420](https://github.com/vatesfr/xen-orchestra/issues/4420) (PR [#4456](https://github.com/vatesfr/xen-orchestra/pull/4456)
+- [Backup NG/New schedule] Properly show user errors in the form [#3831](https://github.com/vatesfr/xen-orchestra/issues/3831) (PR [#4131](https://github.com/vatesfr/xen-orchestra/pull/4131))
+- [VM/Advanced] Fix `"vm.set_domain_type" is not a function` error on switching virtualization mode (PV/HVM) [#4348](https://github.com/vatesfr/xen-orchestra/issues/4348) (PR [#4504](https://github.com/vatesfr/xen-orchestra/pull/4504))
+- [Backup NG/logs] Show warning when zstd compression is selected but not supported [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PR [#4375](https://github.com/vatesfr/xen-orchestra/pull/4375)
+- [Patches] Fix patches installation for CH 8.0 (PR [#4511](https://github.com/vatesfr/xen-orchestra/pull/4511))
+- [Network] Fix inability to set a network name [#4514](https://github.com/vatesfr/xen-orchestra/issues/4514) (PR [4510](https://github.com/vatesfr/xen-orchestra/pull/4510))
+- [Backup NG] Fix race conditions that could lead to disabled jobs still running (PR [4510](https://github.com/vatesfr/xen-orchestra/pull/4510))
+- [XOA] Remove "Updates" and "Licenses" tabs for non admin users (PR [#4526](https://github.com/vatesfr/xen-orchestra/pull/4526))
+- [New VM] Ability to escape [cloud config template](https://xen-orchestra.com/blog/xen-orchestra-5-21/#cloudconfigtemplates) variables [#4486](https://github.com/vatesfr/xen-orchestra/issues/4486) (PR [#4501](https://github.com/vatesfr/xen-orchestra/pull/4501))
+- [Backup NG] Properly log and report if job is already running [#4497](https://github.com/vatesfr/xen-orchestra/issues/4497) (PR [4534](https://github.com/vatesfr/xen-orchestra/pull/4534))
+- [Host] Fix an issue where host was wrongly reporting time inconsistency (PR [#4540](https://github.com/vatesfr/xen-orchestra/pull/4540))
+
+
+### Released packages
+
+- xen-api v0.27.2
+- xo-server-cloud v0.3.0
+- @xen-orchestra/cron v1.0.4
+- xo-server-sdn-controller v0.3.0
+- @xen-orchestra/template v0.1.0
+- xo-server v5.50.1
+- xo-web v5.50.2
+
+
+## **5.38.0** (2019-08-29)
+
+![Channel: stable](https://badgen.net/badge/channel/stable/green)
+
+### Enhancements
+
 - [VM/Attach disk] Display confirmation modal when VDI is already attached [#3381](https://github.com/vatesfr/xen-orchestra/issues/3381) (PR [#4366](https://github.com/vatesfr/xen-orchestra/pull/4366))
 - [Zstd]
   - [VM/copy, VM/export] Only show zstd option when it's supported [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PRs [#4326](https://github.com/vatesfr/xen-orchestra/pull/4326) [#4368](https://github.com/vatesfr/xen-orchestra/pull/4368))
   - [VM/Bulk copy] Show warning if zstd compression is not supported on a VM [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PR [#4346](https://github.com/vatesfr/xen-orchestra/pull/4346))
 - [VM import & Continuous Replication] Enable `guessVhdSizeOnImport` by default, this fix some `VDI_IO_ERROR` with XenServer 7.1 and XCP-ng 8.0 (PR [#4436](https://github.com/vatesfr/xen-orchestra/pull/4436))
 - [SDN Controller] Add possibility to create multiple GRE networks and VxLAN networks within a same pool (PR [#4435](https://github.com/vatesfr/xen-orchestra/pull/4435))
+- [SDN Controller] Add possibility to create cross-pool private networks (PR [#4405](https://github.com/vatesfr/xen-orchestra/pull/4405))
 
 ### Bug fixes
 
@@ -20,15 +103,13 @@
 
 ### Released packages
 
-- xo-server-sdn-controller v0.1.3
+- xo-server-sdn-controller v0.2.0
 - xo-server-usage-report v0.7.3
 - xo-server v5.48.0
-- xo-web v5.48.0
+- xo-web v5.48.1
 
 ## **5.37.1** (2019-08-06)
 
-![Channel: latest](https://badgen.net/badge/channel/latest/yellow)
-
 ### Enhancements
 
 - [SDN Controller] Let the user choose on which PIF to create a private network (PR [#4379](https://github.com/vatesfr/xen-orchestra/pull/4379))
@@ -84,8 +165,6 @@
 
 ## **5.36.0** (2019-06-27)
 
-![Channel: stable](https://badgen.net/badge/channel/stable/green)
-
 ### Highlights
 
 - [SR/new] Create ZFS storage [#4260](https://github.com/vatesfr/xen-orchestra/issues/4260) (PR [#4266](https://github.com/vatesfr/xen-orchestra/pull/4266))

CHANGELOG.unreleased.md

@@ -3,18 +3,22 @@
 > Keep in mind the changelog is addressed to **users** and should be
 > understandable by them.
 
+### Breaking changes
+
+- `xo-server` requires Node 8.
+
 ### Enhancements
 
 > Users must be able to say: “Nice enhancement, I'm eager to test it”
 
-- [SDN Controller] Add possibility to create cross-pool private networks (PR [#4405](https://github.com/vatesfr/xen-orchestra/pull/4405))
 
 ### Bug fixes
 
-- [PBD] Obfuscate cifs password from device config [#4384](https://github.com/vatesfr/xen-orchestra/issues/4384) (PR [#4401](https://github.com/vatesfr/xen-orchestra/pull/4401))
-
 > Users must be able to say: “I had this issue, happy to know it's fixed”
 
+- [SR] Fix `[object HTMLInputElement]` name after re-attaching a SR [#4546](https://github.com/vatesfr/xen-orchestra/issues/4546) (PR [#4550](https://github.com/vatesfr/xen-orchestra/pull/4550))
+- [Patches] Better error handling when fetching missing patches (PR [#4519](https://github.com/vatesfr/xen-orchestra/pull/4519))
+
 ### Released packages
 
 > Packages will be released in the order they are here, therefore, they should
@@ -22,6 +26,5 @@
 >
 > Rule of thumb: add packages on top.
 
-- xo-server-sdn-controller v0.2.0
-- xo-server v5.49.0
-- xo-web v5.49.0
+- xo-server v5.51.0
+- xo-web v5.51.0

PULL_REQUEST_TEMPLATE.md

@@ -1,15 +1,19 @@
 ### Check list
 
-> Check items when done or if not relevant
+> Check if done.
+>
+> Strikethrough if not relevant: ~~example~~ ([doc](https://help.github.com/en/articles/basic-writing-and-formatting-syntax)).
 
-- [ ] PR reference the relevant issue (e.g. `Fixes #007`)
+- [ ] PR reference the relevant issue (e.g. `Fixes #007` or `See xoa-support#42`)
 - [ ] if UI changes, a screenshot has been added to the PR
-- [ ] if `xo-server` API changes, the corresponding test has been added to/updated on [`xo-server-test`](https://github.com/vatesfr/xen-orchestra/tree/master/packages/xo-server-test)
-- [ ] `CHANGELOG.unreleased.md`:
-   - enhancement/bug fix entry added
-   - list of packages to release updated (`${name} v${new version}`)
 - [ ] documentation updated
-- [ ] **I have tested added/updated features** (and impacted code)
+- `CHANGELOG.unreleased.md`:
+  - [ ] enhancement/bug fix entry added
+  - [ ] list of packages to release updated (`${name} v${new version}`)
+- **I have tested added/updated features** (and impacted code)
+  - [ ] unit tests (e.g. [`cron/parse.spec.js`](https://github.com/vatesfr/xen-orchestra/blob/b24400b21de1ebafa1099c56bac1de5c988d9202/%40xen-orchestra/cron/src/parse.spec.js))
+  - [ ] if `xo-server` API changes, the corresponding test has been added to/updated on [`xo-server-test`](https://github.com/vatesfr/xen-orchestra/tree/master/packages/xo-server-test)
+  - [ ] at least manual testing
 
 ### Process
 
@@ -17,3 +21,10 @@
 1. mark it as `WiP:` (Work in Progress) if not ready to be merged
 1. when you want a review, add a reviewer (and only one)
 1. if necessary, update your PR, and re- add a reviewer
+
+From [_the Four Agreements_](https://en.wikipedia.org/wiki/Don_Miguel_Ruiz#The_Four_Agreements):
+
+1. Be impeccable with your word.
+1. Don't take anything personally.
+1. Don't make assumptions.
+1. Always do your best.

docs/README.md

@@ -13,11 +13,11 @@ It aims to be easy to use on any device supporting modern web technologies (HTML
 
 ## XOA quick deploy
 
-SSH to your XenServer, and execute the following:
+Log in to your account and use the deploy form available on [this page](https://xen-orchestra.com/#!/xoa)
 
-```
-bash -c "$(curl -s http://xoa.io/deploy)"
-```
+> **Note:** no data will be sent to our servers, it's running only between your browser and your host!
+
+[![](./assets/deploy_form.png)](https://xen-orchestra.com/#!/xoa)
 
 ### XOA credentials
 

docs/SUMMARY.md

@@ -55,6 +55,7 @@
    * [Emergency Shutdown](emergency_shutdown.md)
    * [Auto scalability](auto_scalability.md)
    * [Forecaster](forecaster.md)
+   * [SDN Controller](sdn_controller.md)
 * [Recipes](recipes.md)
    * [Reverse proxy](reverse_proxy.md)
 * [How to contribute?](contributing.md)

docs/features.md

@@ -15,5 +15,6 @@ We've made multiple categories to help you to find what you need:
 * [Job Manager](scheduler.html)
 * [Alerts](alerts.html)
 * [Load balancing](load_balancing.html)
+* [SDN Controller](sdn_controller.html)
 
 ![](./assets/xo5tablet.jpg)

docs/installation.md

@@ -1,14 +1,10 @@
 
 # Installation
 
-SSH to your XenServer/XCP-ng host and execute the following:
+Log in to your account and use the deploy form available on [this page](https://xen-orchestra.com/#!/xoa)
 
-```
-bash -c "$(curl -s http://xoa.io/deploy)"
-```
+![](./assets/deploy_form.png)
 
-This will automatically download/import/start the XOA appliance. Nothing is changed on your host itself, it's 100% safe.
-
-## [More on XOA](xoa.md)
+## [More on XOA and alternate deploy](xoa.md)
 
 ![](https://xen-orchestra.com/assets/xoa1.png)

docs/sdn_controller.md

@@ -0,0 +1,60 @@
+# SDN Controller
+
+> SDN Controller is available in XOA 5.44 and higher
+
+The SDN Controller enables a user to **create pool-wide and cross-pool** (since XOA 5.48.1) **private networks**.
+
+![](./assets/sdn-controller.png)
+
+## How does it work?
+
+Please read the [dedicated devblog on the SDN Controller](https://xen-orchestra.com/blog/xo-sdn-controller/) and its [extension for cross-pool private networks](https://xen-orchestra.com/blog/devblog-3-extending-the-sdn-controller/).
+
+## Usage
+
+### Network creation
+
+In the network creation view:
+- Select a `pool`
+- Select `Private network`
+- Select an interface on which to create the network's tunnels
+- Select the encapsulation: a choice is offered between `GRE` and `VxLAN`, if `VxLAN` is chosen, then port 4789 must be open for UDP traffic on all the network's hosts (see [the requirements](#vxlan))
+- Choose if the network should be encrypted or not (see [the requirements](#encryption) to use encryption)
+- Select other `pool`s to add them to the network if desired
+  - For each added `pool`: select an interface on which to create the tunnels
+- Create the network
+- Have fun! ☺
+
+***NB:***
+- All hosts in a private network must be able to reach the other hosts' management interface.
+> The term ‘management interface’ is used to indicate the IP-enabled NIC that carries the management traffic.
+- Only 1 encrypted GRE network and 1 encrypted VxLAN network per pool can exist at a time due to Open vSwitch limitation.
+
+### Configuration
+
+Like all other xo-server plugins, it can be configured directly via
+the web interface, see [the plugin documentation](https://xen-orchestra.com/docs/plugins.html).
+
+The plugin's configuration contains:
+- `cert-dir`: The path where the plugin will look for the certificates to create SSL connections with the hosts.
+If none is provided, the plugin will create its own self-signed certificates.
+- `override-certs`: Enable to uninstall the existing SDN controller CA certificate in order to replace it with the plugin's one.
+
+## Requirements
+
+### VxLAN
+
+- On XCP-ng prior to 7.6:
+  - To be able to use `VxLAN`, the following line needs to be added, if not already present, in `/etc/sysconfig/iptables` of all the hosts where `VxLAN` is wanted: `-A xapi-INPUT -p udp -m conntrack --ctstate NEW -m udp --dport 4789 -j ACCEPT`
+
+### Encryption
+
+> Encryption is not available prior to 8.0.
+
+- On XCP-ng 8.0:
+  - To be able to encrypt the networks, `openvswitch-ipsec` package must be installed on all the hosts:
+    - `yum install openvswitch-ipsec --enablerepo=xcp-ng-testing`
+    - `systemctl enable ipsec`
+    - `systemctl enable openvswitch-ipsec`
+    - `systemctl start ipsec`
+    - `systemctl start openvswitch-ipsec`

docs/updater.md

@@ -41,6 +41,20 @@ However, if you want to start a manual check, you can do it by clicking on the "
 
 ![](./assets/xo5updatebutton.png)
 
+#### Release channel
+In Xen Orchestra, you can make a choice between two different release channels.
+
+##### Stable
+The stable channel is intended to be a version of Xen Orchestra that is already **one month old** (and therefore will benefit from one month of community feedback and various fixes). This way, users more concerned with the stability of their appliance will have the option to stay on a slightly older (and tested) version of XO (still supported by our pro support).
+
+##### Latest
+
+The latest channel will include all the latest improvements available in Xen Orchestra. The version available in latest has already been QA'd by our team, but issues may still occur once deployed in vastly varying environments, such as our user base has.
+
+> To select the release channel of your choice, go to the XOA > Updates view.
+
+![](./assets/release-channels.png)
+
 #### Upgrade
 
 If a new version is found, you'll have an upgrade button and its tooltip displayed:

docs/xoa.md

@@ -26,6 +26,8 @@ The **fastest and most secure way** to install Xen Orchestra is to use our web d
 
 > **Note:** no data will be sent to our servers, it's running only between your browser and your host!
 
+![](./assets/deploy_form.png)
+
 ### Via a bash script
 
 Alternatively, you can deploy it by connecting to your XenServer host and executing the following:

package.json

@@ -8,22 +8,22 @@
     "benchmark": "^2.1.4",
     "eslint": "^6.0.1",
     "eslint-config-prettier": "^6.0.0",
-    "eslint-config-standard": "12.0.0",
-    "eslint-config-standard-jsx": "^6.0.2",
+    "eslint-config-standard": "14.1.0",
+    "eslint-config-standard-jsx": "^8.1.0",
     "eslint-plugin-eslint-comments": "^3.1.1",
     "eslint-plugin-import": "^2.8.0",
-    "eslint-plugin-node": "^9.0.1",
+    "eslint-plugin-node": "^10.0.0",
     "eslint-plugin-promise": "^4.0.0",
     "eslint-plugin-react": "^7.6.1",
     "eslint-plugin-standard": "^4.0.0",
     "exec-promise": "^0.7.0",
-    "flow-bin": "^0.102.0",
+    "flow-bin": "^0.109.0",
     "globby": "^10.0.0",
     "husky": "^3.0.0",
     "jest": "^24.1.0",
     "lodash": "^4.17.4",
     "prettier": "^1.10.2",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "sorted-object": "^2.0.1"
   },
   "engines": {
@@ -46,6 +46,7 @@
       "/xo-web/"
     ],
     "testRegex": "\\.spec\\.js$",
+    "timers": "fake",
     "transform": {
       "\\.jsx?$": "babel-jest"
     }

packages/complex-matcher/package.json

@@ -35,8 +35,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.1",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/value-matcher/package.json

@@ -33,8 +33,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/vhd-cli/package.json

@@ -28,7 +28,7 @@
   },
   "dependencies": {
     "@xen-orchestra/fs": "^0.10.1",
-    "cli-progress": "^2.0.0",
+    "cli-progress": "^3.1.0",
     "exec-promise": "^0.7.0",
     "getopts": "^2.2.3",
     "struct-fu": "^1.2.0",
@@ -39,11 +39,11 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "execa": "^2.0.2",
     "index-modules": "^0.3.0",
-    "promise-toolbox": "^0.13.0",
-    "rimraf": "^2.6.1",
+    "promise-toolbox": "^0.14.0",
+    "rimraf": "^3.0.0",
     "tmp": "^0.1.0"
   },
   "scripts": {

packages/vhd-lib/package.json

@@ -26,7 +26,7 @@
     "from2": "^2.3.0",
     "fs-extra": "^8.0.1",
     "limit-concurrency-decorator": "^0.4.0",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "struct-fu": "^1.2.0",
     "uuid": "^3.0.1"
   },
@@ -37,13 +37,13 @@
     "@babel/preset-flow": "^7.0.0",
     "@xen-orchestra/fs": "^0.10.1",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "execa": "^2.0.2",
     "fs-promise": "^2.0.0",
     "get-stream": "^5.1.0",
     "index-modules": "^0.3.0",
     "readable-stream": "^3.0.6",
-    "rimraf": "^2.6.2",
+    "rimraf": "^3.0.0",
     "tmp": "^0.1.0"
   },
   "scripts": {

packages/vhd-lib/src/createSyntheticStream.js

@@ -13,7 +13,7 @@ import {
 import { fuFooter, fuHeader, checksumStruct } from './_structs'
 import { test as mapTestBit } from './_bitmap'
 
-export default async function createSyntheticStream(handler, path) {
+export default async function createSyntheticStream(handler, paths) {
   const fds = []
   const cleanup = () => {
     for (let i = 0, n = fds.length; i < n; ++i) {
@@ -24,7 +24,7 @@ export default async function createSyntheticStream(handler, path) {
   }
   try {
     const vhds = []
-    while (true) {
+    const open = async path => {
       const fd = await handler.openFile(path, 'r')
       fds.push(fd)
       const vhd = new Vhd(handler, fd)
@@ -32,11 +32,18 @@ export default async function createSyntheticStream(handler, path) {
       await vhd.readHeaderAndFooter()
       await vhd.readBlockAllocationTable()
 
-      if (vhd.footer.diskType === DISK_TYPE_DYNAMIC) {
-        break
+      return vhd
+    }
+    if (typeof paths === 'string') {
+      let path = paths
+      let vhd
+      while ((vhd = await open(path)).footer.diskType !== DISK_TYPE_DYNAMIC) {
+        path = resolveRelativeFromFile(path, vhd.header.parentUnicodeName)
+      }
+    } else {
+      for (const path of paths) {
+        await open(path)
       }
-
-      path = resolveRelativeFromFile(path, vhd.header.parentUnicodeName)
     }
     const nVhds = vhds.length
 

packages/xapi-explore-sr/package.json

@@ -41,15 +41,15 @@
     "human-format": "^0.10.0",
     "lodash": "^4.17.4",
     "pw": "^0.0.4",
-    "xen-api": "^0.27.1"
+    "xen-api": "^0.27.2"
   },
   "devDependencies": {
     "@babel/cli": "^7.1.5",
     "@babel/core": "^7.1.5",
     "@babel/preset-env": "^7.1.5",
     "babel-plugin-lodash": "^3.2.11",
-    "cross-env": "^5.1.4",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xen-api/examples/package-lock.json

@@ -0,0 +1,189 @@
+{
+  "requires": true,
+  "lockfileVersion": 1,
+  "dependencies": {
+    "core-util-is": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
+      "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac="
+    },
+    "debug": {
+      "version": "2.6.9",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+      "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+      "requires": {
+        "ms": "2.0.0"
+      }
+    },
+    "event-loop-delay": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/event-loop-delay/-/event-loop-delay-1.0.0.tgz",
+      "integrity": "sha512-8YtyeIWHXrvTqlAhv+fmtaGGARmgStbvocERYzrZ3pwhnQULe5PuvMUTjIWw/emxssoaftfHZsJtkeY8xjiXCg==",
+      "requires": {
+        "napi-macros": "^1.8.2",
+        "node-gyp-build": "^3.7.0"
+      }
+    },
+    "getopts": {
+      "version": "2.2.5",
+      "resolved": "https://registry.npmjs.org/getopts/-/getopts-2.2.5.tgz",
+      "integrity": "sha512-9jb7AW5p3in+IiJWhQiZmmwkpLaR/ccTWdWQCtZM66HJcHHLegowh4q4tSD7gouUyeNvFWRavfK9GXosQHDpFA=="
+    },
+    "golike-defer": {
+      "version": "0.4.1",
+      "resolved": "https://registry.npmjs.org/golike-defer/-/golike-defer-0.4.1.tgz",
+      "integrity": "sha512-x8cq/Fvu32T8cnco3CBDRF+/M2LFmfSIysKfecX09uIK3cFdHcEKBTPlPnEO6lwrdxfjkOIU6dIw3EIlEJeS1A=="
+    },
+    "human-format": {
+      "version": "0.10.1",
+      "resolved": "https://registry.npmjs.org/human-format/-/human-format-0.10.1.tgz",
+      "integrity": "sha512-UzCHToSw3HI9MxH9tYzMr1JbHJbgzr6o0hZCun7sruv59S1leps21bmgpBkkwEvQon5n/2OWKH1iU7BEko02cg=="
+    },
+    "inherits": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+      "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
+    },
+    "isarray": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
+      "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE="
+    },
+    "make-error": {
+      "version": "1.3.5",
+      "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.5.tgz",
+      "integrity": "sha512-c3sIjNUow0+8swNwVpqoH4YCShKNFkMaw6oH1mNS2haDZQqkeZFlHS3dhoeEbKKmJB4vXpJucU6oH75aDYeE9g=="
+    },
+    "ms": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+      "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g="
+    },
+    "napi-macros": {
+      "version": "1.8.2",
+      "resolved": "https://registry.npmjs.org/napi-macros/-/napi-macros-1.8.2.tgz",
+      "integrity": "sha512-Tr0DNY4RzTaBG2W2m3l7ZtFuJChTH6VZhXVhkGGjF/4cZTt+i8GcM9ozD+30Lmr4mDoZ5Xx34t2o4GJqYWDGcg=="
+    },
+    "node-gyp-build": {
+      "version": "3.9.0",
+      "resolved": "https://registry.npmjs.org/node-gyp-build/-/node-gyp-build-3.9.0.tgz",
+      "integrity": "sha512-zLcTg6P4AbcHPq465ZMFNXx7XpKKJh+7kkN699NiQWisR2uWYOWNWqRHAmbnmKiL4e9aLSlmy5U7rEMUXV59+A=="
+    },
+    "prettier-bytes": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/prettier-bytes/-/prettier-bytes-1.0.4.tgz",
+      "integrity": "sha1-mUsCqkb2mcULYle1+qp/4lV+YtY="
+    },
+    "process-nextick-args": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
+      "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag=="
+    },
+    "process-top": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/process-top/-/process-top-1.0.0.tgz",
+      "integrity": "sha512-er8iSmBMslOt5cgIHg9m6zilTPsuUqpEb1yfQ4bDmO80zr/e/5hNn+Tay3CJM/FOBnJo8Bt3fFiDDH6GvIgeAg==",
+      "requires": {
+        "event-loop-delay": "^1.0.0",
+        "prettier-bytes": "^1.0.4"
+      }
+    },
+    "progress-stream": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/progress-stream/-/progress-stream-2.0.0.tgz",
+      "integrity": "sha1-+sY6Cz0R3qy7CWmrzJOyFLzhntU=",
+      "requires": {
+        "speedometer": "~1.0.0",
+        "through2": "~2.0.3"
+      }
+    },
+    "promise-toolbox": {
+      "version": "0.13.0",
+      "resolved": "https://registry.npmjs.org/promise-toolbox/-/promise-toolbox-0.13.0.tgz",
+      "integrity": "sha512-Z6u7EL9/QyY1zZqeqpEiKS7ygKwZyl0JL0ouno/en6vMliZZc4AmM0aFCrDAVxEyKqj2f3SpkW0lXEfAZsNWiQ==",
+      "requires": {
+        "make-error": "^1.3.2"
+      }
+    },
+    "readable-stream": {
+      "version": "3.4.0",
+      "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.4.0.tgz",
+      "integrity": "sha512-jItXPLmrSR8jmTRmRWJXCnGJsfy85mB3Wd/uINMXA65yrnFo0cPClFIUWzo2najVNSl+mx7/4W8ttlLWJe99pQ==",
+      "requires": {
+        "inherits": "^2.0.3",
+        "string_decoder": "^1.1.1",
+        "util-deprecate": "^1.0.1"
+      }
+    },
+    "safe-buffer": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+      "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g=="
+    },
+    "speedometer": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/speedometer/-/speedometer-1.0.0.tgz",
+      "integrity": "sha1-zWccsGdSwivKM3Di8zREC+T8YuI="
+    },
+    "stream-parser": {
+      "version": "0.3.1",
+      "resolved": "https://registry.npmjs.org/stream-parser/-/stream-parser-0.3.1.tgz",
+      "integrity": "sha1-FhhUhpRCACGhGC/wrxkRwSl2F3M=",
+      "requires": {
+        "debug": "2"
+      }
+    },
+    "string_decoder": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
+      "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
+      "requires": {
+        "safe-buffer": "~5.1.0"
+      }
+    },
+    "throttle": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/throttle/-/throttle-1.0.3.tgz",
+      "integrity": "sha1-ijLkoV8XY9mXlIMXxevjrYpB5Lc=",
+      "requires": {
+        "readable-stream": ">= 0.3.0",
+        "stream-parser": ">= 0.0.2"
+      }
+    },
+    "through2": {
+      "version": "2.0.5",
+      "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz",
+      "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==",
+      "requires": {
+        "readable-stream": "~2.3.6",
+        "xtend": "~4.0.1"
+      },
+      "dependencies": {
+        "readable-stream": {
+          "version": "2.3.6",
+          "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz",
+          "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==",
+          "requires": {
+            "core-util-is": "~1.0.0",
+            "inherits": "~2.0.3",
+            "isarray": "~1.0.0",
+            "process-nextick-args": "~2.0.0",
+            "safe-buffer": "~5.1.1",
+            "string_decoder": "~1.1.1",
+            "util-deprecate": "~1.0.1"
+          }
+        }
+      }
+    },
+    "util-deprecate": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+      "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8="
+    },
+    "xtend": {
+      "version": "4.0.2",
+      "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz",
+      "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ=="
+    }
+  }
+}

packages/xen-api/examples/package.json

@@ -5,7 +5,7 @@
     "human-format": "^0.10.1",
     "process-top": "^1.0.0",
     "progress-stream": "^2.0.0",
-    "promise-toolbox": "^0.11.0",
+    "promise-toolbox": "^0.13.0",
     "readable-stream": "^3.1.1",
     "throttle": "^1.0.3"
   }

packages/xen-api/examples/yarn.lock

@@ -1,179 +0,0 @@
-# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
-# yarn lockfile v1
-
-
-core-util-is@~1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
-  integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=
-
-debug@2:
-  version "2.6.9"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
-  integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==
-  dependencies:
-    ms "2.0.0"
-
-event-loop-delay@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/event-loop-delay/-/event-loop-delay-1.0.0.tgz#5af6282549494fd0d868c499cbdd33e027978b8c"
-  integrity sha512-8YtyeIWHXrvTqlAhv+fmtaGGARmgStbvocERYzrZ3pwhnQULe5PuvMUTjIWw/emxssoaftfHZsJtkeY8xjiXCg==
-  dependencies:
-    napi-macros "^1.8.2"
-    node-gyp-build "^3.7.0"
-
-getopts@^2.2.3:
-  version "2.2.3"
-  resolved "https://registry.yarnpkg.com/getopts/-/getopts-2.2.3.tgz#11d229775e2ec2067ed8be6fcc39d9b4bf39cf7d"
-  integrity sha512-viEcb8TpgeG05+Nqo5EzZ8QR0hxdyrYDp6ZSTZqe2M/h53Bk036NmqG38Vhf5RGirC/Of9Xql+v66B2gp256SQ==
-
-golike-defer@^0.4.1:
-  version "0.4.1"
-  resolved "https://registry.yarnpkg.com/golike-defer/-/golike-defer-0.4.1.tgz#7a1cd435d61e461305805d980b133a0f3db4e1cc"
-
-human-format@^0.10.1:
-  version "0.10.1"
-  resolved "https://registry.yarnpkg.com/human-format/-/human-format-0.10.1.tgz#107793f355912e256148d5b5dcf66a0230187ee9"
-  integrity sha512-UzCHToSw3HI9MxH9tYzMr1JbHJbgzr6o0hZCun7sruv59S1leps21bmgpBkkwEvQon5n/2OWKH1iU7BEko02cg==
-
-inherits@^2.0.3, inherits@~2.0.3:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
-  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
-
-isarray@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
-  integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=
-
-make-error@^1.3.2:
-  version "1.3.5"
-  resolved "https://registry.yarnpkg.com/make-error/-/make-error-1.3.5.tgz#efe4e81f6db28cadd605c70f29c831b58ef776c8"
-  integrity sha512-c3sIjNUow0+8swNwVpqoH4YCShKNFkMaw6oH1mNS2haDZQqkeZFlHS3dhoeEbKKmJB4vXpJucU6oH75aDYeE9g==
-
-ms@2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
-  integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=
-
-napi-macros@^1.8.2:
-  version "1.8.2"
-  resolved "https://registry.yarnpkg.com/napi-macros/-/napi-macros-1.8.2.tgz#299265c1d8aa401351ad0675107d751228c03eda"
-  integrity sha512-Tr0DNY4RzTaBG2W2m3l7ZtFuJChTH6VZhXVhkGGjF/4cZTt+i8GcM9ozD+30Lmr4mDoZ5Xx34t2o4GJqYWDGcg==
-
-node-gyp-build@^3.7.0:
-  version "3.7.0"
-  resolved "https://registry.yarnpkg.com/node-gyp-build/-/node-gyp-build-3.7.0.tgz#daa77a4f547b9aed3e2aac779eaf151afd60ec8d"
-  integrity sha512-L/Eg02Epx6Si2NXmedx+Okg+4UHqmaf3TNcxd50SF9NQGcJaON3AtU++kax69XV7YWz4tUspqZSAsVofhFKG2w==
-
-prettier-bytes@^1.0.4:
-  version "1.0.4"
-  resolved "https://registry.yarnpkg.com/prettier-bytes/-/prettier-bytes-1.0.4.tgz#994b02aa46f699c50b6257b5faaa7fe2557e62d6"
-  integrity sha1-mUsCqkb2mcULYle1+qp/4lV+YtY=
-
-process-nextick-args@~2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa"
-  integrity sha512-MtEC1TqN0EU5nephaJ4rAtThHtC86dNN9qCuEhtshvpVBkAW5ZO7BASN9REnF9eoXGcRub+pFuKEpOHE+HbEMw==
-
-process-top@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/process-top/-/process-top-1.0.0.tgz#52892bedb581c5abf0df2d0aa5c429e34275cc7e"
-  integrity sha512-er8iSmBMslOt5cgIHg9m6zilTPsuUqpEb1yfQ4bDmO80zr/e/5hNn+Tay3CJM/FOBnJo8Bt3fFiDDH6GvIgeAg==
-  dependencies:
-    event-loop-delay "^1.0.0"
-    prettier-bytes "^1.0.4"
-
-progress-stream@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/progress-stream/-/progress-stream-2.0.0.tgz#fac63a0b3d11deacbb0969abcc93b214bce19ed5"
-  integrity sha1-+sY6Cz0R3qy7CWmrzJOyFLzhntU=
-  dependencies:
-    speedometer "~1.0.0"
-    through2 "~2.0.3"
-
-promise-toolbox@^0.11.0:
-  version "0.11.0"
-  resolved "https://registry.yarnpkg.com/promise-toolbox/-/promise-toolbox-0.11.0.tgz#9ed928355355395072dace3f879879504e07d1bc"
-  integrity sha512-bjHk0kq+Ke3J3zbkbbJH6kXCyQZbFHwOTrE/Et7vS0uS0tluoV+PLqU/kEyxl8aARM7v04y2wFoDo/wWAEPvjA==
-  dependencies:
-    make-error "^1.3.2"
-
-"readable-stream@>= 0.3.0", readable-stream@^3.1.1:
-  version "3.1.1"
-  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-3.1.1.tgz#ed6bbc6c5ba58b090039ff18ce670515795aeb06"
-  integrity sha512-DkN66hPyqDhnIQ6Jcsvx9bFjhw214O4poMBcIMgPVpQvNy9a0e0Uhg5SqySyDKAmUlwt8LonTBz1ezOnM8pUdA==
-  dependencies:
-    inherits "^2.0.3"
-    string_decoder "^1.1.1"
-    util-deprecate "^1.0.1"
-
-readable-stream@~2.3.6:
-  version "2.3.6"
-  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.6.tgz#b11c27d88b8ff1fbe070643cf94b0c79ae1b0aaf"
-  integrity sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==
-  dependencies:
-    core-util-is "~1.0.0"
-    inherits "~2.0.3"
-    isarray "~1.0.0"
-    process-nextick-args "~2.0.0"
-    safe-buffer "~5.1.1"
-    string_decoder "~1.1.1"
-    util-deprecate "~1.0.1"
-
-safe-buffer@~5.1.0, safe-buffer@~5.1.1:
-  version "5.1.2"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
-  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
-
-speedometer@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/speedometer/-/speedometer-1.0.0.tgz#cd671cb06752c22bca3370e2f334440be4fc62e2"
-  integrity sha1-zWccsGdSwivKM3Di8zREC+T8YuI=
-
-"stream-parser@>= 0.0.2":
-  version "0.3.1"
-  resolved "https://registry.yarnpkg.com/stream-parser/-/stream-parser-0.3.1.tgz#1618548694420021a1182ff0af1911c129761773"
-  integrity sha1-FhhUhpRCACGhGC/wrxkRwSl2F3M=
-  dependencies:
-    debug "2"
-
-string_decoder@^1.1.1:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.2.0.tgz#fe86e738b19544afe70469243b2a1ee9240eae8d"
-  integrity sha512-6YqyX6ZWEYguAxgZzHGL7SsCeGx3V2TtOTqZz1xSTSWnqsbWwbptafNyvf/ACquZUXV3DANr5BDIwNYe1mN42w==
-  dependencies:
-    safe-buffer "~5.1.0"
-
-string_decoder@~1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
-  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
-  dependencies:
-    safe-buffer "~5.1.0"
-
-throttle@^1.0.3:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/throttle/-/throttle-1.0.3.tgz#8a32e4a15f1763d997948317c5ebe3ad8a41e4b7"
-  integrity sha1-ijLkoV8XY9mXlIMXxevjrYpB5Lc=
-  dependencies:
-    readable-stream ">= 0.3.0"
-    stream-parser ">= 0.0.2"
-
-through2@~2.0.3:
-  version "2.0.5"
-  resolved "https://registry.yarnpkg.com/through2/-/through2-2.0.5.tgz#01c1e39eb31d07cb7d03a96a70823260b23132cd"
-  integrity sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==
-  dependencies:
-    readable-stream "~2.3.6"
-    xtend "~4.0.1"
-
-util-deprecate@^1.0.1, util-deprecate@~1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
-  integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=
-
-xtend@~4.0.1:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af"
-  integrity sha1-pcbVMr5lbiPbgg77lDofBJmNY68=

packages/xen-api/package.json

@@ -1,6 +1,6 @@
 {
   "name": "xen-api",
-  "version": "0.27.1",
+  "version": "0.27.2",
   "license": "ISC",
   "description": "Connector to the Xen API",
   "keywords": [
@@ -46,7 +46,7 @@
     "make-error": "^1.3.0",
     "minimist": "^1.2.0",
     "ms": "^2.1.1",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "pw": "0.0.4",
     "xmlrpc": "^1.3.2",
     "xo-collection": "^0.4.1"
@@ -60,8 +60,8 @@
     "@babel/plugin-proposal-optional-chaining": "^7.2.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xen-api/src/_parseUrl.js

@@ -1,4 +1,4 @@
-const URL_RE = /^(?:(https?:)\/*)?(?:([^:]+):([^@]+)@)?([^/]+?)(?::([0-9]+))?\/?$/
+const URL_RE = /^(?:(https?:)\/*)?(?:([^:]+):([^@]+)@)?(?:\[([^\]]+)\]|([^:/]+))(?::([0-9]+))?\/?$/
 
 export default url => {
   const matches = URL_RE.exec(url)
@@ -6,7 +6,15 @@ export default url => {
     throw new Error('invalid URL: ' + url)
   }
 
-  const [, protocol = 'https:', username, password, hostname, port] = matches
+  const [
+    ,
+    protocol = 'https:',
+    username,
+    password,
+    ipv6,
+    hostname = ipv6,
+    port,
+  ] = matches
   const parsedUrl = { protocol, hostname, port }
   if (username !== undefined) {
     parsedUrl.username = decodeURIComponent(username)

packages/xen-api/src/cli.js

@@ -8,7 +8,7 @@ import execPromise from 'exec-promise'
 import minimist from 'minimist'
 import pw from 'pw'
 import { asCallback, fromCallback } from 'promise-toolbox'
-import { filter, find, isArray } from 'lodash'
+import { filter, find } from 'lodash'
 import { getBoundPropertyDescriptor } from 'bind-property-descriptor'
 import { start as createRepl } from 'repl'
 
@@ -110,7 +110,7 @@ const main = async args => {
     asCallback.call(
       fromCallback(cb => {
         evaluate.call(repl, cmd, context, filename, cb)
-      }).then(value => (isArray(value) ? Promise.all(value) : value)),
+      }).then(value => (Array.isArray(value) ? Promise.all(value) : value)),
       cb
     )
   })(repl.eval)

packages/xen-api/src/index.js

@@ -4,7 +4,7 @@ import kindOf from 'kindof'
 import ms from 'ms'
 import httpRequest from 'http-request-plus'
 import { EventEmitter } from 'events'
-import { isArray, map, noop, omit } from 'lodash'
+import { map, noop, omit } from 'lodash'
 import {
   cancelable,
   defer,
@@ -113,7 +113,7 @@ export class Xapi extends EventEmitter {
     this._watchedTypes = undefined
     const { watchEvents } = opts
     if (watchEvents !== false) {
-      if (isArray(watchEvents)) {
+      if (Array.isArray(watchEvents)) {
         this._watchedTypes = watchEvents
       }
       this.watchEvents()
@@ -1075,7 +1075,7 @@ export class Xapi extends EventEmitter {
         const $field = (field in RESERVED_FIELDS ? '$$' : '$') + field
 
         const value = data[field]
-        if (isArray(value)) {
+        if (Array.isArray(value)) {
           if (value.length === 0 || isOpaqueRef(value[0])) {
             getters[$field] = function() {
               const value = this[field]

packages/xo-cli/package.json

@@ -38,16 +38,16 @@
     "human-format": "^0.10.0",
     "l33teral": "^3.0.3",
     "lodash": "^4.17.4",
-    "micromatch": "^3.1.3",
+    "micromatch": "^4.0.2",
     "mkdirp": "^0.5.1",
     "nice-pipe": "0.0.0",
-    "pretty-ms": "^4.0.0",
+    "pretty-ms": "^5.0.0",
     "progress-stream": "^2.0.0",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "pump": "^3.0.0",
     "pw": "^0.0.4",
-    "strip-indent": "^2.0.0",
-    "xdg-basedir": "^3.0.0",
+    "strip-indent": "^3.0.0",
+    "xdg-basedir": "^4.0.0",
     "xo-lib": "^0.9.0"
   },
   "devDependencies": {
@@ -56,8 +56,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-cli/src/config.js

@@ -7,7 +7,6 @@ const promisify = require('bluebird').promisify
 const readFile = promisify(require('fs').readFile)
 const writeFile = promisify(require('fs').writeFile)
 
-const assign = require('lodash/assign')
 const l33t = require('l33teral')
 const mkdirp = promisify(require('mkdirp'))
 const xdgBasedir = require('xdg-basedir')
@@ -41,7 +40,7 @@ const save = (exports.save = function(config) {
 
 exports.set = function(data) {
   return load().then(function(config) {
-    return save(assign(config, data))
+    return save(Object.assign(config, data))
   })
 }
 

packages/xo-cli/src/index.js

@@ -17,7 +17,6 @@ const getKeys = require('lodash/keys')
 const hrp = require('http-request-plus').default
 const humanFormat = require('human-format')
 const identity = require('lodash/identity')
-const isArray = require('lodash/isArray')
 const isObject = require('lodash/isObject')
 const micromatch = require('micromatch')
 const nicePipe = require('nice-pipe')
@@ -199,7 +198,18 @@ function main(args) {
     return exports[fnName](args.slice(1))
   }
 
-  return exports.call(args)
+  return exports.call(args).catch(error => {
+    if (!(error != null && error.code === 10 && 'errors' in error.data)) {
+      throw error
+    }
+
+    const lines = [error.message]
+    const { errors } = error.data
+    errors.forEach(error => {
+      lines.push(`  property ${error.property}: ${error.message}`)
+    })
+    throw lines.join('\n')
+  })
 }
 exports = module.exports = main
 
@@ -287,7 +297,11 @@ async function listCommands(args) {
       str.push(
         name,
         '=<',
-        type == null ? 'unknown type' : isArray(type) ? type.join('|') : type,
+        type == null
+          ? 'unknown type'
+          : Array.isArray(type)
+          ? type.join('|')
+          : type,
         '>'
       )
 

packages/xo-collection/package.json

@@ -34,9 +34,9 @@
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "event-to-promise": "^0.8.0",
-    "rimraf": "^2.6.1"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-common/package.json

@@ -36,8 +36,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-common/src/api-errors.js

@@ -1,5 +1,5 @@
 import { BaseError } from 'make-error'
-import { isArray, iteratee } from 'lodash'
+import { iteratee } from 'lodash'
 
 class XoError extends BaseError {
   constructor({ code, message, data }) {
@@ -77,7 +77,7 @@ export const serverUnreachable = create(9, objectId => ({
 }))
 
 export const invalidParameters = create(10, (message, errors) => {
-  if (isArray(message)) {
+  if (Array.isArray(message)) {
     errors = message
     message = undefined
   }
@@ -172,3 +172,11 @@ export const patchPrecheckFailed = create(20, ({ errorType, patch }) => ({
   },
   message: `patch precheck failed: ${errorType}`,
 }))
+
+export const listMissingPatchesFailed = create(21, ({ host, reason }) => ({
+  data: {
+    host,
+    reason,
+  },
+  message: 'could not fetch missing patches',
+}))

packages/xo-lib/package.json

@@ -41,8 +41,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-remote-parser/package.json

@@ -32,9 +32,9 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "deep-freeze": "^0.0.1",
-    "rimraf": "^2.6.1"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-auth-google/package.json

@@ -40,8 +40,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-auth-ldap/package.json

@@ -36,18 +36,18 @@
   "dependencies": {
     "event-to-promise": "^0.8.0",
     "exec-promise": "^0.7.0",
-    "inquirer": "^6.0.0",
+    "inquirer": "^7.0.0",
     "ldapjs": "^1.0.1",
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0"
+    "promise-toolbox": "^0.14.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-auth-saml/package.json

@@ -40,8 +40,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-preset-env": "^1.6.1",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-backup-reports/package.json

@@ -36,7 +36,7 @@
     "node": ">=6"
   },
   "dependencies": {
-    "@xen-orchestra/log": "^0.1.4",
+    "@xen-orchestra/log": "^0.2.0",
     "human-format": "^0.10.0",
     "lodash": "^4.13.1",
     "moment-timezone": "^0.5.13"
@@ -48,8 +48,8 @@
     "@babel/plugin-proposal-optional-chaining": "^7.2.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-cloud/package.json

@@ -1,6 +1,6 @@
 {
   "name": "xo-server-cloud",
-  "version": "0.2.4",
+  "version": "0.3.0",
   "license": "ISC",
   "description": "",
   "keywords": [
@@ -39,8 +39,8 @@
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.5.4"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-cloud/src/index.js

@@ -20,9 +20,13 @@ class XoServerCloud {
   }
 
   async load() {
-    const getResourceCatalog = () => this._getCatalog()
-    getResourceCatalog.description = 'Get the list of all available resources'
+    const getResourceCatalog = this._getCatalog.bind(this)
+    getResourceCatalog.description =
+      "Get the list of user's available resources"
     getResourceCatalog.permission = 'admin'
+    getResourceCatalog.params = {
+      filters: { type: 'object', optional: true },
+    }
 
     const registerResource = ({ namespace }) =>
       this._registerResource(namespace)
@@ -34,8 +38,29 @@ class XoServerCloud {
     }
     registerResource.permission = 'admin'
 
+    const downloadAndInstallResource = this._downloadAndInstallResource.bind(
+      this
+    )
+
+    downloadAndInstallResource.description =
+      'Download and install a resource via cloud plugin'
+
+    downloadAndInstallResource.params = {
+      id: { type: 'string' },
+      namespace: { type: 'string' },
+      version: { type: 'string' },
+      sr: { type: 'string' },
+    }
+
+    downloadAndInstallResource.resolve = {
+      sr: ['sr', 'SR', 'administrate'],
+    }
+
+    downloadAndInstallResource.permission = 'admin'
+
     this._unsetApiMethods = this._xo.addApiMethods({
       cloud: {
+        downloadAndInstallResource,
         getResourceCatalog,
         registerResource,
       },
@@ -66,8 +91,8 @@ class XoServerCloud {
 
   // ----------------------------------------------------------------
 
-  async _getCatalog() {
-    const catalog = await this._updater.call('getResourceCatalog')
+  async _getCatalog({ filters } = {}) {
+    const catalog = await this._updater.call('getResourceCatalog', { filters })
 
     if (!catalog) {
       throw new Error('cannot get catalog')
@@ -90,6 +115,26 @@ class XoServerCloud {
 
   // ----------------------------------------------------------------
 
+  async _downloadAndInstallResource({ id, namespace, sr, version }) {
+    const stream = await this._requestResource({
+      hub: true,
+      id,
+      namespace,
+      version,
+    })
+    const vm = await this._xo.getXapi(sr.$poolId).importVm(stream, {
+      srId: sr.id,
+      type: 'xva',
+    })
+    await vm.update_other_config({
+      'xo:resource:namespace': namespace,
+      'xo:resource:xva:version': version,
+      'xo:resource:xva:id': id,
+    })
+  }
+
+  // ----------------------------------------------------------------
+
   async _registerResource(namespace) {
     const _namespace = (await this._getNamespaces())[namespace]
 
@@ -106,8 +151,10 @@ class XoServerCloud {
 
   // ----------------------------------------------------------------
 
-  async _getNamespaceCatalog(namespace) {
-    const namespaceCatalog = (await this._getCatalog())[namespace]
+  async _getNamespaceCatalog({ hub, namespace }) {
+    const namespaceCatalog = (await this._getCatalog({ filters: { hub } }))[
+      namespace
+    ]
 
     if (!namespaceCatalog) {
       throw new Error(`cannot get catalog: ${namespace} not registered`)
@@ -118,14 +165,17 @@ class XoServerCloud {
 
   // ----------------------------------------------------------------
 
-  async _requestResource(namespace, id, version) {
+  async _requestResource({ hub = false, id, namespace, version }) {
     const _namespace = (await this._getNamespaces())[namespace]
 
-    if (!_namespace || !_namespace.registered) {
+    if (!hub && (!_namespace || !_namespace.registered)) {
       throw new Error(`cannot get resource: ${namespace} not registered`)
     }
 
-    const { _token: token } = await this._getNamespaceCatalog(namespace)
+    const { _token: token } = await this._getNamespaceCatalog({
+      hub,
+      namespace,
+    })
 
     // 2018-03-20 Extra check: getResourceDownloadToken seems to be called without a token in some cases
     if (token === undefined) {

packages/xo-server-load-balancer/package.json

@@ -31,7 +31,7 @@
     "node": ">=6"
   },
   "dependencies": {
-    "@xen-orchestra/cron": "^1.0.3",
+    "@xen-orchestra/cron": "^1.0.4",
     "lodash": "^4.16.2"
   },
   "devDependencies": {

packages/xo-server-perf-alert/package.json

@@ -21,7 +21,7 @@
     "node": ">=6"
   },
   "dependencies": {
-    "@xen-orchestra/cron": "^1.0.3",
+    "@xen-orchestra/cron": "^1.0.4",
     "d3-time-format": "^2.1.1",
     "json5": "^2.0.1",
     "lodash": "^4.17.4"
@@ -32,8 +32,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-perf-alert/src/index.js

@@ -1,6 +1,6 @@
 import JSON5 from 'json5'
 import { createSchedule } from '@xen-orchestra/cron'
-import { assign, forOwn, map, mean } from 'lodash'
+import { forOwn, map, mean } from 'lodash'
 import { utcParse } from 'd3-time-format'
 
 const COMPARATOR_FN = {
@@ -483,7 +483,7 @@ ${monitorBodies.join('\n')}`
                 result.rrd = await this.getRrd(result.object, observationPeriod)
                 if (result.rrd !== null) {
                   const data = parseData(result.rrd, result.object.uuid)
-                  assign(result, {
+                  Object.assign(result, {
                     data,
                     value: data.getDisplayableValue(),
                     shouldAlarm: data.shouldAlarm(),
@@ -496,7 +496,7 @@ ${monitorBodies.join('\n')}`
                   definition.alarmTriggerLevel
                 )
                 const data = getter(result.object)
-                assign(result, {
+                Object.assign(result, {
                   value: data.getDisplayableValue(),
                   shouldAlarm: data.shouldAlarm(),
                 })
@@ -680,7 +680,7 @@ ${entry.listItem}
       },
     }
     if (xapiObject.$type === 'VM') {
-      payload['vm_uuid'] = xapiObject.uuid
+      payload.vm_uuid = xapiObject.uuid
     }
     // JSON is not well formed, can't use the default node parser
     return JSON5.parse(

packages/xo-server-sdn-controller/README.md

@@ -6,29 +6,9 @@ XO Server plugin that allows the creation of pool-wide and cross-pool private ne
 
 For installing XO and the plugins from the sources, please take a look at [the documentation](https://xen-orchestra.com/docs/from_the_sources.html).
 
-## Usage
+## Documentation
 
-### Network creation
-
-In the network creation view:
-- Select a `pool` and `Private network`
-- Select on which interface to create the network's tunnels
-- Select other pools to add them to the network if wanted
-- Create the network
-
-Choice is offer between `GRE` and `VxLAN`, if `VxLAN` is chosen, then the port 4789 must be open for UDP traffic.
-The following line needs to be added, if not already present, in `/etc/sysconfig/iptables` of all the hosts where `VxLAN` is wanted:
-`-A xapi-INPUT -p udp -m conntrack --ctstate NEW -m udp --dport 4789 -j ACCEPT`
-
-### Configuration
-
-Like all other xo-server plugins, it can be configured directly via
-the web interface, see [the plugin documentation](https://xen-orchestra.com/docs/plugins.html).
-
-The plugin's configuration contains:
-- `cert-dir`: A path where to find the certificates to create SSL connections with the hosts.
-If none is provided, the plugin will create its own self-signed certificates.
-- `override-certs`: Whether or not to uninstall an already existing SDN controller CA certificate in order to replace it by the plugin's one.
+Please see the plugin's [official documentation](https://xen-orchestra.com/docs/sdn_controller.html).
 
 ## Contributions
 

packages/xo-server-sdn-controller/package.json

@@ -15,22 +15,23 @@
     "predev": "yarn run prebuild",
     "prepublishOnly": "yarn run build"
   },
-  "version": "0.2.0",
+  "version": "0.3.0",
   "engines": {
     "node": ">=6"
   },
   "devDependencies": {
     "@babel/cli": "^7.4.4",
     "@babel/core": "^7.4.4",
+    "@babel/plugin-proposal-nullish-coalescing-operator": "^7.4.4",
     "@babel/plugin-proposal-optional-chaining": "^7.2.0",
     "@babel/preset-env": "^7.4.4",
-    "cross-env": "^5.2.0"
+    "cross-env": "^6.0.3"
   },
   "dependencies": {
-    "@xen-orchestra/log": "^0.1.4",
+    "@xen-orchestra/log": "^0.2.0",
     "lodash": "^4.17.11",
-    "node-openssl-cert": "^0.0.84",
-    "promise-toolbox": "^0.13.0",
+    "node-openssl-cert": "^0.0.98",
+    "promise-toolbox": "^0.14.0",
     "uuid": "^3.3.2"
   },
   "private": true

packages/xo-server-sdn-controller/src/index.js

@@ -4,8 +4,8 @@ import NodeOpenssl from 'node-openssl-cert'
 import uuidv4 from 'uuid/v4'
 import { access, constants, readFile, writeFile } from 'fs'
 import { EventEmitter } from 'events'
-import { filter, find, forEach, forOwn, map, omitBy } from 'lodash'
-import { fromCallback, fromEvent } from 'promise-toolbox'
+import { filter, find, forOwn, map, omitBy, sample } from 'lodash'
+import { fromCallback, promisify } from 'promise-toolbox'
 import { join } from 'path'
 
 import { OvsdbClient } from './ovsdb-client'
@@ -47,20 +47,13 @@ export const configurationSchema = {
 
 // =============================================================================
 
-async function fileWrite(path, data) {
-  await fromCallback(writeFile, path, data)
-}
-
-async function fileRead(path) {
-  const result = await fromCallback(readFile, path)
-  return result
-}
-
+const fileWrite = promisify(writeFile)
+const fileRead = promisify(readFile)
 async function fileExists(path) {
   try {
     await fromCallback(access, path, constants.F_OK)
   } catch (error) {
-    if (error.code === 'ENOENT') {
+    if (error?.code === 'ENOENT') {
       return false
     }
 
@@ -70,9 +63,160 @@ async function fileExists(path) {
   return true
 }
 
+// -----------------------------------------------------------------------------
+
+// 2019-09-03
+// Compatibility code, to be removed in 1 year.
+const updateNetworkOtherConfig = network =>
+  Promise.all(
+    map(
+      {
+        'cross-pool-network-uuid': 'cross_pool_network_uuid',
+        encapsulation: 'encapsulation',
+        'pif-device': 'pif_device',
+        'private-pool-wide': 'private_pool_wide',
+        vni: 'vni',
+      },
+      (oldKey, newKey) => {
+        const namespacedKey = `xo:sdn-controller:${newKey}`
+        if (network.other_config[namespacedKey] !== undefined) {
+          // Nothing to do the update has been done already
+          return
+        }
+
+        const value = network.other_config[oldKey]
+        if (value !== undefined) {
+          return network.update_other_config({
+            [oldKey]: null,
+            [namespacedKey]: value,
+          })
+        }
+      }
+    )
+  )
+
+// -----------------------------------------------------------------------------
+
+const CHARS = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789?!'
+const createPassword = () =>
+  Array.from({ length: 16 }, _ => sample(CHARS)).join('')
+
+// -----------------------------------------------------------------------------
+
+async function generateCertificatesAndKey(dataDir) {
+  const openssl = new NodeOpenssl()
+  const rsaKeyOptions = {
+    rsa_keygen_bits: 4096,
+    format: 'PKCS8',
+  }
+  const subject = {
+    countryName: 'XX',
+    localityName: 'Default City',
+    organizationName: 'Default Company LTD',
+  }
+  const csrOptions = {
+    hash: 'sha256',
+    startdate: new Date('1984-02-04 00:00:00'),
+    enddate: new Date('2143-06-04 04:16:23'),
+    subject: subject,
+  }
+  const caCsrOptions = {
+    hash: 'sha256',
+    days: NB_DAYS,
+    subject: subject,
+  }
+
+  let operation
+  try {
+    // CA Cert
+    operation = 'Generating CA private key'
+    const caKey = await fromCallback.call(
+      openssl,
+      'generateRSAPrivateKey',
+      rsaKeyOptions
+    )
+
+    operation = 'Generating CA certificate'
+    const caCsr = await fromCallback.call(
+      openssl,
+      'generateCSR',
+      caCsrOptions,
+      caKey,
+      null
+    )
+
+    operation = 'Signing CA certificate'
+    const caCrt = await fromCallback.call(
+      openssl,
+      'selfSignCSR',
+      caCsr,
+      caCsrOptions,
+      caKey,
+      null
+    )
+    await fileWrite(join(dataDir, CA_CERT), caCrt)
+
+    // Cert
+    operation = 'Generating private key'
+    const key = await fromCallback.call(
+      openssl,
+      'generateRSAPrivateKey',
+      rsaKeyOptions
+    )
+    await fileWrite(join(dataDir, CLIENT_KEY), key)
+
+    operation = 'Generating certificate'
+    const csr = await fromCallback.call(
+      openssl,
+      'generateCSR',
+      csrOptions,
+      key,
+      null
+    )
+
+    operation = 'Signing certificate'
+    const crt = await fromCallback.call(
+      openssl,
+      'CASignCSR',
+      csr,
+      caCsrOptions,
+      false,
+      caCrt,
+      caKey,
+      null
+    )
+    await fileWrite(join(dataDir, CLIENT_CERT), crt)
+  } catch (error) {
+    log.error('Error while generating certificates and keys', {
+      operation,
+      error,
+    })
+    throw error
+  }
+
+  log.debug('All certificates have been successfully written')
+}
+
 // =============================================================================
 
 class SDNController extends EventEmitter {
+  /*
+  Attributes on created networks:
+  - `other_config`:
+    - `xo:sdn-controller:encapsulation`    : encapsulation protocol used for tunneling (either `gre` or `vxlan`)
+    - `xo:sdn-controller:encrypted`        : `true` if the network is encrypted
+    - `xo:sdn-controller:pif-device`       : PIF device on which the tunnels are created, must be physical and have an IP configuration
+    - `xo:sdn-controller:private-pool-wide`: `true` if the network is created (and so must be managed) by a SDN Controller
+    - `xo:sdn-controller:vni`              : VxLAN Network Identifier,
+        it is used by OpenVSwitch to route traffic of different networks in a single tunnel
+        See: https://tools.ietf.org/html/rfc7348
+
+  Attributes on created tunnels: See: https://xapi-project.github.io/xapi/design/tunnelling.html
+  - `status`:
+    - `active`: `true` if the corresponding OpenVSwitch bridge is correctly configured and working
+    - `key`   : Corresponding OpenVSwitch bridge name (missing if `active` is `false`)
+  */
+
   constructor({ xo, getDataDir }) {
     super()
 
@@ -94,9 +238,6 @@ class SDNController extends EventEmitter {
 
     this._overrideCerts = false
 
-    // VNI: VxLAN Network Identifier, it is used by OpenVSwitch
-    // to route traffic of different networks in a single tunnel.
-    // See: https://tools.ietf.org/html/rfc7348
     this._prevVni = 0
   }
 
@@ -122,7 +263,7 @@ class SDNController extends EventEmitter {
         )
 
         log.debug(`No default self-signed certificates exists, creating them`)
-        await this._generateCertificatesAndKey(certDirectory)
+        await generateCertificatesAndKey(certDirectory)
       }
     }
     // TODO: verify certificates and create new certificates if needed
@@ -150,7 +291,14 @@ class SDNController extends EventEmitter {
 
   async load() {
     // Expose method to create pool-wide private network
-    const createPrivateNetwork = this._createPrivateNetwork.bind(this)
+    const createPrivateNetwork = params =>
+      this._createPrivateNetwork({
+        encrypted: false,
+        mtu: 0,
+        ...params,
+        vni: ++this._prevVni,
+      })
+
     createPrivateNetwork.description =
       'Creates a pool-wide private network on a selected pool'
     createPrivateNetwork.params = {
@@ -159,6 +307,8 @@ class SDNController extends EventEmitter {
       networkDescription: { type: 'string' },
       encapsulation: { type: 'string' },
       pifId: { type: 'string' },
+      encrypted: { type: 'boolean', optional: true },
+      mtu: { type: 'integer', optional: true },
     }
     createPrivateNetwork.resolve = {
       xoPool: ['poolId', 'pool', ''],
@@ -166,9 +316,13 @@ class SDNController extends EventEmitter {
     }
 
     // Expose method to create cross-pool private network
-    const createCrossPoolPrivateNetwork = this._createCrossPoolPrivateNetwork.bind(
-      this
-    )
+    const createCrossPoolPrivateNetwork = params =>
+      this._createCrossPoolPrivateNetwork({
+        encrypted: false,
+        mtu: 0,
+        ...params,
+      })
+
     createCrossPoolPrivateNetwork.description =
       'Creates a cross-pool private network on selected pools'
     createCrossPoolPrivateNetwork.params = {
@@ -187,6 +341,8 @@ class SDNController extends EventEmitter {
           type: 'string',
         },
       },
+      encrypted: { type: 'boolean', optional: true },
+      mtu: { type: 'integer', optional: true },
     }
 
     this._unsetApiMethods = this._xo.addApiMethods({
@@ -217,11 +373,17 @@ class SDNController extends EventEmitter {
         const noVniNetworks = []
         await Promise.all(
           map(networks, async network => {
-            if (network.other_config.private_pool_wide !== 'true') {
+            // 2019-09-03
+            // Compatibility code, to be removed in 1 year.
+            await updateNetworkOtherConfig(network)
+            network = await network.$xapi.barrier(network.$ref)
+
+            const otherConfig = network.other_config
+            if (otherConfig['xo:sdn-controller:private-pool-wide'] !== 'true') {
               return
             }
 
-            const { vni } = network.other_config
+            const vni = otherConfig['xo:sdn-controller:vni']
             if (vni === undefined) {
               noVniNetworks.push(network)
             } else {
@@ -239,10 +401,13 @@ class SDNController extends EventEmitter {
             // 2019-08-22
             // This is used to add the pif_device to networks created before this version. (v0.1.2)
             // This will be removed in 1 year.
-            if (network.other_config.pif_device === undefined) {
+            if (otherConfig['xo:sdn-controller:pif-device'] === undefined) {
               const tunnel = this._getHostTunnelForNetwork(center, network.$ref)
               const pif = xapi.getObjectByRef(tunnel.transport_PIF)
-              await network.update_other_config('pif_device', pif.device)
+              await network.update_other_config(
+                'xo:sdn-controller:pif-device',
+                pif.device
+              )
             }
 
             this._poolNetworks.push({
@@ -256,7 +421,7 @@ class SDNController extends EventEmitter {
             }
 
             const crossPoolNetworkUuid =
-              network.other_config.cross_pool_network_uuid
+              otherConfig['xo:sdn-controller:cross-pool-network-uuid']
             if (crossPoolNetworkUuid !== undefined) {
               let crossPoolNetwork = this._crossPoolNetworks[
                 crossPoolNetworkUuid
@@ -291,7 +456,10 @@ class SDNController extends EventEmitter {
         // This will be removed in 1 year.
         await Promise.all(
           map(noVniNetworks, async network => {
-            await network.update_other_config('vni', String(++this._prevVni))
+            await network.update_other_config(
+              'xo:sdn-controller:vni',
+              String(++this._prevVni)
+            )
 
             // Re-elect a center to apply the VNI
             const center = await this._electNewCenter(network, true)
@@ -333,6 +501,9 @@ class SDNController extends EventEmitter {
     networkDescription,
     encapsulation,
     xoPif,
+    vni,
+    encrypted,
+    mtu,
   }) {
     const pool = this._xo.getXapiObject(xoPool)
     await this._setPoolControllerIfNeeded(pool)
@@ -343,13 +514,16 @@ class SDNController extends EventEmitter {
     const privateNetworkRef = await pool.$xapi.call('network.create', {
       name_label: networkName,
       name_description: networkDescription,
-      MTU: 0,
+      MTU: mtu,
       other_config: {
+        // Set `automatic` to false so XenCenter does not get confused
+        // See: https://citrix.github.io/xenserver-sdk/#network
         automatic: 'false',
-        private_pool_wide: 'true',
-        encapsulation: encapsulation,
-        pif_device: pif.device,
-        vni: String(++this._prevVni),
+        'xo:sdn-controller:encapsulation': encapsulation,
+        'xo:sdn-controller:encrypted': encrypted ? 'true' : undefined,
+        'xo:sdn-controller:pif-device': pif.device,
+        'xo:sdn-controller:private-pool-wide': 'true',
+        'xo:sdn-controller:vni': String(vni),
       },
     })
 
@@ -390,6 +564,8 @@ class SDNController extends EventEmitter {
     networkDescription,
     encapsulation,
     xoPifIds,
+    encrypted,
+    mtu,
   }) {
     const uuid = uuidv4()
     const crossPoolNetwork = {
@@ -400,6 +576,7 @@ class SDNController extends EventEmitter {
 
     log.debug('New cross-pool network created', { uuid })
 
+    const vni = ++this._prevVni
     for (const xoPoolId of xoPoolIds) {
       const xoPool = this._xo.getObject(xoPoolId, 'pool')
       const pool = this._xo.getXapiObject(xoPool)
@@ -416,10 +593,16 @@ class SDNController extends EventEmitter {
         networkDescription,
         encapsulation,
         xoPif,
+        vni,
+        encrypted,
+        mtu,
       })
 
       const network = pool.$xapi.getObjectByRef(poolNetwork.network)
-      await network.update_other_config('cross_pool_network_uuid', uuid)
+      await network.update_other_config(
+        'xo:sdn-controller:cross-pool-network-uuid',
+        uuid
+      )
 
       crossPoolNetwork.pools.push(poolNetwork.pool)
       crossPoolNetwork.networks.push(poolNetwork.network)
@@ -454,7 +637,7 @@ class SDNController extends EventEmitter {
   }
 
   _objectsAdded(objects) {
-    forEach(objects, object => {
+    forOwn(objects, object => {
       const { $type } = object
 
       if ($type === 'host') {
@@ -472,26 +655,28 @@ class SDNController extends EventEmitter {
   }
 
   _objectsUpdated(objects) {
-    return Promise.all(
-      map(objects, object => {
+    forOwn(objects, async object => {
+      try {
         const { $type } = object
-
         if ($type === 'PIF') {
-          return this._pifUpdated(object)
+          await this._pifUpdated(object)
+        } else if ($type === 'host') {
+          await this._hostUpdated(object)
+        } else if ($type === 'host_metrics') {
+          await this._hostMetricsUpdated(object)
         }
-        if ($type === 'host') {
-          return this._hostUpdated(object)
-        }
-        if ($type === 'host_metrics') {
-          return this._hostMetricsUpdated(object)
-        }
-      })
-    )
+      } catch (error) {
+        log.error('Error in _objectsUpdated', {
+          error,
+          object,
+        })
+      }
+    })
   }
 
   _objectsRemoved(xapi, objects) {
-    return Promise.all(
-      map(objects, async (object, id) => {
+    forOwn(objects, async (object, id) => {
+      try {
         this._ovsdbClients = this._ovsdbClients.filter(
           client => client.host.$id !== id
         )
@@ -533,8 +718,13 @@ class SDNController extends EventEmitter {
             crossPoolNetwork => crossPoolNetwork.networks.length === 0
           )
         }
-      })
-    )
+      } catch (error) {
+        log.error('Error in _objectsRemoved', {
+          error,
+          object,
+        })
+      }
+    })
   }
 
   async _pifUpdated(pif) {
@@ -666,11 +856,12 @@ class SDNController extends EventEmitter {
           }
 
           const network = host.$xapi.getObjectByRef(poolNetwork.network)
-          const pifDevice = network.other_config.pif_device || 'eth0'
-          this._createTunnel(host, network, pifDevice)
+          const pifDevice =
+            network.other_config['xo:sdn-controller:pif-device'] ?? 'eth0'
+          await this._createTunnel(host, network, pifDevice)
         }
 
-        this._addHostToPoolNetworks(host)
+        await this._addHostToPoolNetworks(host)
       }
     }
   }
@@ -1054,7 +1245,15 @@ class SDNController extends EventEmitter {
     const network = client.host.$xapi.getObjectByRef(poolNetwork.network)
 
     // Use centerNetwork VNI by convention
-    const { encapsulation = 'gre', vni = '0' } = centerNetwork.other_config
+    const otherConfig = centerNetwork.other_config
+    const encapsulation =
+      otherConfig['xo:sdn-controller:encapsulation'] ?? 'gre'
+    const vni = otherConfig['xo:sdn-controller:vni'] ?? '0'
+    const password =
+      otherConfig['xo:sdn-controller:encrypted'] === 'true'
+        ? createPassword()
+        : undefined
+
     try {
       await Promise.all([
         client.addInterfaceAndPort(
@@ -1063,6 +1262,7 @@ class SDNController extends EventEmitter {
           centerClient.host.address,
           encapsulation,
           vni,
+          password,
           centerNetwork.uuid
         ),
         centerClient.addInterfaceAndPort(
@@ -1071,6 +1271,7 @@ class SDNController extends EventEmitter {
           client.host.address,
           encapsulation,
           vni,
+          password,
           network.uuid
         ),
       ])
@@ -1105,6 +1306,15 @@ class SDNController extends EventEmitter {
     }
 
     const tunnel = this._getHostTunnelForNetwork(host, network.$ref)
+    if (tunnel === undefined) {
+      log.info('Unable to add host to network: no tunnel available', {
+        network: network.name_label,
+        host: host.name_label,
+        pool: host.$pool.name_label,
+      })
+      return
+    }
+
     const starCenterTunnel = this._getHostTunnelForNetwork(
       starCenter,
       network.$ref
@@ -1135,7 +1345,16 @@ class SDNController extends EventEmitter {
       return
     }
 
-    const { encapsulation = 'gre', vni = '0' } = network.other_config
+    const otherConfig = network.other_config
+    const encapsulation =
+      otherConfig['xo:sdn-controller:encapsulation'] ?? 'gre'
+    const vni = otherConfig['xo:sdn-controller:vni'] ?? '0'
+
+    const password =
+      otherConfig['xo:sdn-controller:encrypted'] === 'true'
+        ? createPassword()
+        : undefined
+
     let bridgeName
     try {
       ;[bridgeName] = await Promise.all([
@@ -1144,14 +1363,16 @@ class SDNController extends EventEmitter {
           network.name_label,
           starCenterClient.host.address,
           encapsulation,
-          vni
+          vni,
+          password
         ),
         starCenterClient.addInterfaceAndPort(
           network.uuid,
           network.name_label,
           hostClient.host.address,
           encapsulation,
-          vni
+          vni,
+          password
         ),
       ])
     } catch (error) {
@@ -1161,6 +1382,7 @@ class SDNController extends EventEmitter {
         host: host.name_label,
         pool: host.$pool.name_label,
       })
+      return
     }
 
     if (bridgeName !== undefined) {
@@ -1298,119 +1520,6 @@ class SDNController extends EventEmitter {
     this._ovsdbClients.push(client)
     return client
   }
-
-  // ---------------------------------------------------------------------------
-
-  async _generateCertificatesAndKey(dataDir) {
-    const openssl = new NodeOpenssl()
-
-    const rsakeyoptions = {
-      rsa_keygen_bits: 4096,
-      format: 'PKCS8',
-    }
-    const subject = {
-      countryName: 'XX',
-      localityName: 'Default City',
-      organizationName: 'Default Company LTD',
-    }
-    const csroptions = {
-      hash: 'sha256',
-      startdate: new Date('1984-02-04 00:00:00'),
-      enddate: new Date('2143-06-04 04:16:23'),
-      subject: subject,
-    }
-    const cacsroptions = {
-      hash: 'sha256',
-      days: NB_DAYS,
-      subject: subject,
-    }
-
-    // In all the following callbacks, `error` is:
-    // - either an error object if there was an error
-    // - or a boolean set to `false` if no error occurred
-    openssl.generateRSAPrivateKey(rsakeyoptions, (error, cakey, cmd) => {
-      if (error !== false) {
-        log.error('Error while generating CA private key', {
-          error,
-        })
-        return
-      }
-
-      openssl.generateCSR(cacsroptions, cakey, null, (error, csr, cmd) => {
-        if (error !== false) {
-          log.error('Error while generating CA certificate', {
-            error,
-          })
-          return
-        }
-
-        openssl.selfSignCSR(
-          csr,
-          cacsroptions,
-          cakey,
-          null,
-          async (error, cacrt, cmd) => {
-            if (error !== false) {
-              log.error('Error while signing CA certificate', {
-                error,
-              })
-              return
-            }
-
-            await fileWrite(join(dataDir, CA_CERT), cacrt)
-            openssl.generateRSAPrivateKey(
-              rsakeyoptions,
-              async (error, key, cmd) => {
-                if (error !== false) {
-                  log.error('Error while generating private key', {
-                    error,
-                  })
-                  return
-                }
-
-                await fileWrite(join(dataDir, CLIENT_KEY), key)
-                openssl.generateCSR(
-                  csroptions,
-                  key,
-                  null,
-                  (error, csr, cmd) => {
-                    if (error !== false) {
-                      log.error('Error while generating certificate', {
-                        error,
-                      })
-                      return
-                    }
-                    openssl.CASignCSR(
-                      csr,
-                      cacsroptions,
-                      false,
-                      cacrt,
-                      cakey,
-                      null,
-                      async (error, crt, cmd) => {
-                        if (error !== false) {
-                          log.error('Error while signing certificate', {
-                            error,
-                          })
-                          return
-                        }
-
-                        await fileWrite(join(dataDir, CLIENT_CERT), crt)
-                        this.emit('certWritten')
-                      }
-                    )
-                  }
-                )
-              }
-            )
-          }
-        )
-      })
-    })
-
-    await fromEvent(this, 'certWritten', {})
-    log.debug('All certificates have been successfully written')
-  }
 }
 
 export default opts => new SDNController(opts)

packages/xo-server-sdn-controller/src/ovsdb-client.js

@@ -1,8 +1,8 @@
 import assert from 'assert'
 import createLogger from '@xen-orchestra/log'
-import forOwn from 'lodash/forOwn'
 import fromEvent from 'promise-toolbox/fromEvent'
 import { connect } from 'tls'
+import { forOwn, toPairs } from 'lodash'
 
 const log = createLogger('xo:xo-server:sdn-controller:ovsdb-client')
 
@@ -10,7 +10,33 @@ const OVSDB_PORT = 6640
 
 // =============================================================================
 
+function toMap(object) {
+  return ['map', toPairs(object)]
+}
+
+// =============================================================================
+
 export class OvsdbClient {
+  /*
+  Create an SSL connection to an XCP-ng host.
+  Interact with the host's OpenVSwitch (OVS) daemon to create and manage the virtual bridges
+  corresponding to the private networks with OVSDB (OpenVSwitch DataBase) Protocol.
+  See:
+  - OVSDB Protocol: https://tools.ietf.org/html/rfc7047
+  - OVS Tunneling : http://docs.openvswitch.org/en/latest/howto/tunneling/
+  - OVS IPSEC     : http://docs.openvswitch.org/en/latest/howto/ipsec/
+
+  Attributes on created OVS ports (corresponds to a XAPI `PIF` or `VIF`):
+  - `other_config`:
+    - `xo:sdn-controller:cross-pool`       : UUID of the remote network connected by the tunnel
+    - `xo:sdn-controller:private-pool-wide`: `true` if created (and managed) by a SDN Controller
+
+  Attributes on created OVS interfaces:
+  - `options`:
+    - `key`      : Network's VNI
+    - `remote_ip`: Remote IP of the tunnel
+  */
+
   constructor(host, clientKey, clientCert, caCert) {
     this._numberOfPortAndInterface = 0
     this._requestId = 0
@@ -46,6 +72,7 @@ export class OvsdbClient {
     remoteAddress,
     encapsulation,
     key,
+    password,
     remoteNetwork
   ) {
     if (
@@ -91,33 +118,36 @@ export class OvsdbClient {
     const portName = bridgeName + '_port' + index
 
     // Add interface and port to the bridge
-    const options = ['map', [['remote_ip', remoteAddress], ['key', key]]]
-    const otherConfig =
-      remoteNetwork !== undefined
-        ? ['map', [['cross_pool', remoteNetwork]]]
-        : ['map', [['private_pool_wide', 'true']]]
-
+    const options = { remote_ip: remoteAddress, key: key }
+    if (password !== undefined) {
+      options.psk = password
+    }
     const addInterfaceOperation = {
       op: 'insert',
       table: 'Interface',
       row: {
         type: encapsulation,
-        options: options,
+        options: toMap(options),
         name: interfaceName,
-        other_config: otherConfig,
       },
       'uuid-name': 'new_iface',
     }
+
     const addPortOperation = {
       op: 'insert',
       table: 'Port',
       row: {
         name: portName,
         interfaces: ['set', [['named-uuid', 'new_iface']]],
-        other_config: otherConfig,
+        other_config: toMap(
+          remoteNetwork !== undefined
+            ? { 'xo:sdn-controller:cross-pool': remoteNetwork }
+            : { 'xo:sdn-controller:private-pool-wide': 'true' }
+        ),
       },
       'uuid-name': 'new_port',
     }
+
     const mutateBridgeOperation = {
       op: 'mutate',
       table: 'Bridge',
@@ -217,12 +247,20 @@ export class OvsdbClient {
       }
 
       forOwn(selectResult.other_config[1], config => {
-        const shouldDelete =
+        // 2019-09-03
+        // Compatibility code, to be removed in 1 year.
+        const oldShouldDelete =
           (config[0] === 'private_pool_wide' && !crossPoolOnly) ||
           (config[0] === 'cross_pool' &&
             (remoteNetwork === undefined || remoteNetwork === config[1]))
 
-        if (shouldDelete) {
+        const shouldDelete =
+          (config[0] === 'xo:sdn-controller:private-pool-wide' &&
+            !crossPoolOnly) ||
+          (config[0] === 'xo:sdn-controller:cross-pool' &&
+            (remoteNetwork === undefined || remoteNetwork === config[1]))
+
+        if (shouldDelete || oldShouldDelete) {
           portsToDelete.push(['uuid', portUuid])
         }
       })
@@ -299,11 +337,7 @@ export class OvsdbClient {
 
   async _getBridgeUuidForNetwork(networkUuid, networkName, socket) {
     const where = [
-      [
-        'external_ids',
-        'includes',
-        ['map', [['xs-network-uuids', networkUuid]]],
-      ],
+      ['external_ids', 'includes', toMap({ 'xs-network-uuids': networkUuid })],
     ]
     const selectResult = await this._select(
       'Bridge',

packages/xo-server-test/README.md

@@ -15,15 +15,20 @@ src
 |   |     └─ index.spec.js.snap
 |   └─ index.spec.js
 ├─ job
+|   └─ index.spec.js
+├─ issues
 ¦   └─ index.spec.js
 ¦
-¦
 ├─ _xoConnection.js
 └─ util.js
 ```
 
-The tests can describe xo methods or scenarios:
-```javascript
+The tests can describe:
+
+  - XO methods or scenarios:
+
+`src/user/index.js`
+```js
 import xo from "../_xoConnection";
 
 describe("user", () => {
@@ -46,6 +51,16 @@ describe("user", () => {
   });
 
 });
+```
+  - issues
+
+`src/issues/index.js`
+```js
+ describe("issue", () => {
+  test("5454", () => {
+    /* some tests */
+  })
+})
 ```
 
 ### Best practices

packages/xo-server-test/package.json

@@ -36,7 +36,7 @@
     "golike-defer": "^0.4.1",
     "jest": "^24.8.0",
     "lodash": "^4.17.11",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "xo-collection": "^0.4.1",
     "xo-common": "^0.2.0",
     "xo-lib": "^0.9.0"

packages/xo-server-test/sample.config.toml

@@ -3,6 +3,9 @@
   email = ''
   password = ''
 
+[pools]
+  default = ''
+
 [servers]
   [servers.default]
     username = ''

packages/xo-server-test/src/_defaultValues.js

@@ -0,0 +1,6 @@
+export const getDefaultName = () => `xo-server-test ${new Date().toISOString()}`
+
+export const getDefaultSchedule = () => ({
+  name: getDefaultName(),
+  cron: '0 * * * * *',
+})

packages/xo-server-test/src/_xoConnection.js

@@ -2,15 +2,11 @@
 import defer from 'golike-defer'
 import Xo from 'xo-lib'
 import XoCollection from 'xo-collection'
-import { find, forOwn } from 'lodash'
+import { defaultsDeep, find, forOwn, pick } from 'lodash'
 import { fromEvent } from 'promise-toolbox'
 
 import config from './_config'
-
-const getDefaultCredentials = () => {
-  const { email, password } = config.xoConnection
-  return { email, password }
-}
+import { getDefaultName } from './_defaultValues'
 
 class XoConnection extends Xo {
   constructor(opts) {
@@ -72,7 +68,10 @@ class XoConnection extends Xo {
   }
 
   @defer
-  async connect($defer, credentials = getDefaultCredentials()) {
+  async connect(
+    $defer,
+    credentials = pick(config.xoConnection, 'email', 'password')
+  ) {
     await this.open()
     $defer.onFailure(() => this.close())
 
@@ -87,7 +86,7 @@ class XoConnection extends Xo {
     while (true) {
       try {
         await predicate(obj)
-        return
+        return obj
       } catch (_) {}
       // If failed, wait for next object state/update and retry.
       obj = await this.waitObject(id)
@@ -111,18 +110,48 @@ class XoConnection extends Xo {
   }
 
   async createTempBackupNgJob(params) {
-    const job = await this.call('backupNg.createJob', params)
-    this._tempResourceDisposers.push('backupNg.deleteJob', { id: job.id })
-    return job
+    // mutate and inject default values
+    defaultsDeep(params, {
+      mode: 'full',
+      name: getDefaultName(),
+      settings: {
+        '': {
+          // it must be enabled because the XAPI might be not able to coalesce VDIs
+          // as fast as the tests run
+          //
+          // see https://xen-orchestra.com/docs/backup_troubleshooting.html#vdi-chain-protection
+          bypassVdiChainsCheck: true,
+
+          // it must be 'never' to avoid race conditions with the plugin `backup-reports`
+          reportWhen: 'never',
+        },
+      },
+    })
+    const id = await this.call('backupNg.createJob', params)
+    this._tempResourceDisposers.push('backupNg.deleteJob', { id })
+    return this.call('backupNg.getJob', { id })
+  }
+
+  async createTempNetwork(params) {
+    const id = await this.call('network.create', {
+      name: 'XO Test',
+      pool: config.pools.default,
+      ...params,
+    })
+    this._tempResourceDisposers.push('network.delete', { id })
+    return this.getOrWaitObject(id)
   }
 
   async createTempVm(params) {
-    const id = await this.call('vm.create', params)
+    const id = await this.call('vm.create', {
+      name_label: getDefaultName(),
+      template: config.templates.templateWithoutDisks,
+      ...params,
+    })
     this._tempResourceDisposers.push('vm.delete', { id })
-    await this.waitObjectState(id, vm => {
+    return this.waitObjectState(id, vm => {
       if (vm.type !== 'VM') throw new Error('retry')
     })
-    return id
   }
 
   async createTempRemote(params) {
@@ -197,6 +226,10 @@ class XoConnection extends Xo {
     return backups
   }
 
+  getBackupLogs(filter) {
+    return this.call('backupNg.getLogs', { _forceRefresh: true, ...filter })
+  }
+
   async _cleanDisposers(disposers) {
     for (let n = disposers.length - 1; n > 0; ) {
       const params = disposers[n--]

packages/xo-server-test/src/backupNg/__snapshots__/backupNg.spec.js.snap

@@ -1,61 +1,6 @@
 // Jest Snapshot v1, https://goo.gl/fbAQLP
 
-exports[`backupNg .createJob() : creates a new backup job with schedules 1`] = `
-Object {
-  "id": Any<String>,
-  "mode": "full",
-  "name": "default-backupNg",
-  "settings": Any<Object>,
-  "type": "backup",
-  "userId": Any<String>,
-  "vms": Any<Object>,
-}
-`;
-
-exports[`backupNg .createJob() : creates a new backup job with schedules 2`] = `
-Object {
-  "cron": "0 * * * * *",
-  "enabled": false,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "name": "scheduleTest",
-}
-`;
-
-exports[`backupNg .createJob() : creates a new backup job without schedules 1`] = `
-Object {
-  "id": Any<String>,
-  "mode": "full",
-  "name": "default-backupNg",
-  "settings": Object {
-    "": Object {
-      "reportWhen": "never",
-    },
-  },
-  "type": "backup",
-  "userId": Any<String>,
-  "vms": Any<Object>,
-}
-`;
-
 exports[`backupNg .runJob() : fails trying to run a backup job with a VM without disks 1`] = `
-Object {
-  "data": Object {
-    "mode": "full",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "jobName": "default-backupNg",
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "skipped",
-}
-`;
-
-exports[`backupNg .runJob() : fails trying to run a backup job with a VM without disks 2`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -92,23 +37,6 @@ Array [
 exports[`backupNg .runJob() : fails trying to run a backup job without schedule 1`] = `[JsonRpcError: invalid parameters]`;
 
 exports[`backupNg .runJob() : fails trying to run backup job without retentions 1`] = `
-Object {
-  "data": Object {
-    "mode": "full",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "jobName": "default-backupNg",
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "failure",
-}
-`;
-
-exports[`backupNg .runJob() : fails trying to run backup job without retentions 2`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -128,22 +56,6 @@ Object {
 `;
 
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 1`] = `
-Object {
-  "data": Object {
-    "mode": "delta",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 2`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -157,7 +69,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 3`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 2`] = `
 Object {
   "end": Any<Number>,
   "id": Any<String>,
@@ -168,7 +80,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 4`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 3`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -183,6 +95,19 @@ Object {
 }
 `;
 
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 4`] = `
+Object {
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 5`] = `
 Object {
   "end": Any<Number>,
@@ -197,19 +122,6 @@ Object {
 `;
 
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 6`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 7`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -224,6 +136,19 @@ Object {
 }
 `;
 
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 7`] = `
+Object {
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 8`] = `
 Object {
   "end": Any<Number>,
@@ -238,35 +163,6 @@ Object {
 `;
 
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 9`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 10`] = `
-Object {
-  "data": Object {
-    "mode": "delta",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 11`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -280,7 +176,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 12`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 10`] = `
 Object {
   "end": Any<Number>,
   "id": Any<String>,
@@ -291,7 +187,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 13`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 11`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -306,7 +202,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 14`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 12`] = `
 Object {
   "end": Any<Number>,
   "id": Any<String>,
@@ -319,6 +215,34 @@ Object {
 }
 `;
 
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 13`] = `
+Object {
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 14`] = `
+Object {
+  "data": Object {
+    "id": Any<String>,
+    "isFull": false,
+    "type": "remote",
+  },
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 15`] = `
 Object {
   "end": Any<Number>,
@@ -334,62 +258,18 @@ Object {
 
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 16`] = `
 Object {
-  "data": Object {
-    "id": Any<String>,
-    "isFull": false,
-    "type": "remote",
-  },
   "end": Any<Number>,
   "id": Any<String>,
   "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
   "start": Any<Number>,
   "status": "success",
 }
 `;
 
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 17`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 18`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 19`] = `
-Object {
-  "data": Object {
-    "mode": "delta",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 20`] = `
 Object {
   "data": Object {
     "id": Any<String>,
@@ -403,7 +283,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 21`] = `
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 18`] = `
 Object {
   "end": Any<Number>,
   "id": Any<String>,
@@ -414,6 +294,47 @@ Object {
 }
 `;
 
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 19`] = `
+Object {
+  "data": Object {
+    "id": Any<String>,
+    "isFull": true,
+    "type": "remote",
+  },
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 20`] = `
+Object {
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
+exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 21`] = `
+Object {
+  "end": Any<Number>,
+  "id": Any<String>,
+  "message": Any<String>,
+  "result": Object {
+    "size": Any<Number>,
+  },
+  "start": Any<Number>,
+  "status": "success",
+}
+`;
+
 exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 22`] = `
 Object {
   "data": Object {
@@ -455,65 +376,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 25`] = `
-Object {
-  "data": Object {
-    "id": Any<String>,
-    "isFull": true,
-    "type": "remote",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 26`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval 27`] = `
-Object {
-  "end": Any<Number>,
-  "id": Any<String>,
-  "message": Any<String>,
-  "result": Object {
-    "size": Any<Number>,
-  },
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
 exports[`backupNg execute three times a rolling snapshot with 2 as retention & revert to an old state 1`] = `
-Object {
-  "data": Object {
-    "mode": "full",
-    "reportWhen": "never",
-  },
-  "end": Any<Number>,
-  "id": Any<String>,
-  "jobId": Any<String>,
-  "jobName": "default-backupNg",
-  "message": "backup",
-  "scheduleId": Any<String>,
-  "start": Any<Number>,
-  "status": "success",
-}
-`;
-
-exports[`backupNg execute three times a rolling snapshot with 2 as retention & revert to an old state 2`] = `
 Object {
   "end": Any<Number>,
   "id": Any<String>,
@@ -524,7 +387,7 @@ Object {
 }
 `;
 
-exports[`backupNg execute three times a rolling snapshot with 2 as retention & revert to an old state 3`] = `
+exports[`backupNg execute three times a rolling snapshot with 2 as retention & revert to an old state 2`] = `
 Object {
   "data": Object {
     "id": Any<String>,

packages/xo-server-test/src/backupNg/backupNg.spec.js

@@ -6,20 +6,44 @@ import { noSuchObject } from 'xo-common/api-errors'
 import config from '../_config'
 import randomId from '../_randomId'
 import xo from '../_xoConnection'
+import { getDefaultName, getDefaultSchedule } from '../_defaultValues'
 
-const DEFAULT_SCHEDULE = {
-  name: 'scheduleTest',
-  cron: '0 * * * * *',
+const validateBackupJob = (jobInput, jobOutput, createdSchedule) => {
+  const expectedObj = {
+    id: expect.any(String),
+    mode: jobInput.mode,
+    name: jobInput.name,
+    type: 'backup',
+    settings: {
+      '': jobInput.settings[''],
+    },
+    userId: xo._user.id,
+    vms: jobInput.vms,
+  }
+
+  const schedules = jobInput.schedules
+  if (schedules !== undefined) {
+    const scheduleTmpId = Object.keys(schedules)[0]
+    expect(createdSchedule).toEqual({
+      ...schedules[scheduleTmpId],
+      enabled: false,
+      id: expect.any(String),
+      jobId: jobOutput.id,
+    })
+
+    expectedObj.settings[createdSchedule.id] = jobInput.settings[scheduleTmpId]
+  }
+
+  expect(jobOutput).toEqual(expectedObj)
 }
 
-const validateRootTask = (log, props) =>
-  expect(log).toMatchSnapshot({
+const validateRootTask = (log, expected) =>
+  expect(log).toEqual({
     end: expect.any(Number),
     id: expect.any(String),
-    jobId: expect.any(String),
-    scheduleId: expect.any(String),
+    message: 'backup',
     start: expect.any(Number),
-    ...props,
+    ...expected,
   })
 
 const validateVmTask = (task, vmId, props) => {
@@ -67,83 +91,54 @@ const validateOperationTask = (task, props) => {
 }
 
 describe('backupNg', () => {
-  let defaultBackupNg
-
-  beforeAll(() => {
-    defaultBackupNg = {
-      name: 'default-backupNg',
-      mode: 'full',
-      vms: {
-        id: config.vms.default,
-      },
-      settings: {
-        '': {
-          reportWhen: 'never',
-        },
-      },
-    }
-  })
-
   describe('.createJob() :', () => {
     it('creates a new backup job without schedules', async () => {
-      const backupNg = await xo.createTempBackupNgJob(defaultBackupNg)
-      expect(backupNg).toMatchSnapshot({
-        id: expect.any(String),
-        userId: expect.any(String),
-        vms: expect.any(Object),
-      })
-      expect(backupNg.vms).toEqual(defaultBackupNg.vms)
-      expect(backupNg.userId).toBe(xo._user.id)
+      const jobInput = {
+        mode: 'full',
+        vms: {
+          id: config.vms.default,
+        },
+      }
+      const jobOutput = await xo.createTempBackupNgJob(jobInput)
+      validateBackupJob(jobInput, jobOutput)
     })
 
     it('creates a new backup job with schedules', async () => {
       const scheduleTempId = randomId()
-      const { id: jobId } = await xo.createTempBackupNgJob({
-        ...defaultBackupNg,
+      const jobInput = {
+        mode: 'full',
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
-          ...defaultBackupNg.settings,
           [scheduleTempId]: { snapshotRetention: 1 },
         },
-      })
-
-      const backupNgJob = await xo.call('backupNg.getJob', { id: jobId })
-
-      expect(backupNgJob).toMatchSnapshot({
-        id: expect.any(String),
-        userId: expect.any(String),
-        settings: expect.any(Object),
-        vms: expect.any(Object),
-      })
-      expect(backupNgJob.vms).toEqual(defaultBackupNg.vms)
-      expect(backupNgJob.userId).toBe(xo._user.id)
-
-      expect(Object.keys(backupNgJob.settings).length).toBe(2)
-      const schedule = await xo.getSchedule({ jobId })
-      expect(typeof schedule).toBe('object')
-      expect(backupNgJob.settings[schedule.id]).toEqual({
-        snapshotRetention: 1,
-      })
-
-      expect(schedule).toMatchSnapshot({
-        id: expect.any(String),
-        jobId: expect.any(String),
-      })
+        vms: {
+          id: config.vms.default,
+        },
+      }
+      const jobOutput = await xo.createTempBackupNgJob(jobInput)
+      validateBackupJob(
+        jobInput,
+        jobOutput,
+        await xo.getSchedule({ jobId: jobOutput.id })
+      )
     })
   })
 
   describe('.delete() :', () => {
     it('deletes a backup job', async () => {
       const scheduleTempId = randomId()
-      const { id: jobId } = await xo.call('backupNg.createJob', {
-        ...defaultBackupNg,
+      const jobId = await xo.call('backupNg.createJob', {
+        mode: 'full',
+        name: getDefaultName(),
+        vms: {
+          id: config.vms.default,
+        },
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
-          ...defaultBackupNg.settings,
           [scheduleTempId]: { snapshotRetention: 1 },
         },
       })
@@ -169,16 +164,19 @@ describe('backupNg', () => {
 
   describe('.runJob() :', () => {
     it('fails trying to run a backup job without schedule', async () => {
-      const { id } = await xo.createTempBackupNgJob(defaultBackupNg)
+      const { id } = await xo.createTempBackupNgJob({
+        vms: {
+          id: config.vms.default,
+        },
+      })
       await expect(xo.call('backupNg.runJob', { id })).rejects.toMatchSnapshot()
     })
 
     it('fails trying to run a backup job with no matching VMs', async () => {
       const scheduleTempId = randomId()
       const { id: jobId } = await xo.createTempBackupNgJob({
-        ...defaultBackupNg,
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
           [scheduleTempId]: { snapshotRetention: 1 },
@@ -201,9 +199,8 @@ describe('backupNg', () => {
       jest.setTimeout(7e3)
       const scheduleTempId = randomId()
       const { id: jobId } = await xo.createTempBackupNgJob({
-        ...defaultBackupNg,
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
           [scheduleTempId]: { snapshotRetention: 1 },
@@ -217,7 +214,7 @@ describe('backupNg', () => {
       expect(typeof schedule).toBe('object')
 
       await xo.call('backupNg.runJob', { id: jobId, schedule: schedule.id })
-      const [log] = await xo.call('backupNg.getLogs', {
+      const [log] = await xo.getBackupLogs({
         scheduleId: schedule.id,
       })
       expect(log.warnings).toMatchSnapshot()
@@ -226,26 +223,24 @@ describe('backupNg', () => {
     it('fails trying to run a backup job with a VM without disks', async () => {
       jest.setTimeout(8e3)
       await xo.createTempServer(config.servers.default)
-      const vmIdWithoutDisks = await xo.createTempVm({
-        name_label: 'XO Test Without Disks',
+      const { id: vmIdWithoutDisks } = await xo.createTempVm({
         name_description: 'Creating a vm without disks',
         template: config.templates.templateWithoutDisks,
       })
 
       const scheduleTempId = randomId()
-      const { id: jobId } = await xo.createTempBackupNgJob({
-        ...defaultBackupNg,
+      const jobInput = {
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
-          ...defaultBackupNg.settings,
           [scheduleTempId]: { snapshotRetention: 1 },
         },
         vms: {
           id: vmIdWithoutDisks,
         },
-      })
+      }
+      const { id: jobId } = await xo.createTempBackupNgJob(jobInput)
 
       const schedule = await xo.getSchedule({ jobId })
       expect(typeof schedule).toBe('object')
@@ -256,16 +251,20 @@ describe('backupNg', () => {
           tasks: [vmTask],
           ...log
         },
-      ] = await xo.call('backupNg.getLogs', {
+      ] = await xo.getBackupLogs({
         jobId,
         scheduleId: schedule.id,
       })
-      expect(log).toMatchSnapshot({
-        end: expect.any(Number),
-        id: expect.any(String),
-        jobId: expect.any(String),
-        scheduleId: expect.any(String),
-        start: expect.any(Number),
+
+      validateRootTask(log, {
+        data: {
+          mode: jobInput.mode,
+          reportWhen: jobInput.settings[''].reportWhen,
+        },
+        jobId,
+        jobName: jobInput.name,
+        scheduleId: schedule.id,
+        status: 'skipped',
       })
 
       expect(vmTask).toMatchSnapshot({
@@ -289,22 +288,24 @@ describe('backupNg', () => {
       const scheduleTempId = randomId()
       await xo.createTempServer(config.servers.default)
       const { id: remoteId } = await xo.createTempRemote(config.remotes.default)
-      const { id: jobId } = await xo.createTempBackupNgJob({
-        ...defaultBackupNg,
+      const jobInput = {
         remotes: {
           id: remoteId,
         },
         schedules: {
-          [scheduleTempId]: DEFAULT_SCHEDULE,
+          [scheduleTempId]: getDefaultSchedule(),
         },
         settings: {
-          ...defaultBackupNg.settings,
           [scheduleTempId]: {},
         },
         srs: {
           id: config.srs.default,
         },
-      })
+        vms: {
+          id: config.vms.default,
+        },
+      }
+      const { id: jobId } = await xo.createTempBackupNgJob(jobInput)
 
       const schedule = await xo.getSchedule({ jobId })
       expect(typeof schedule).toBe('object')
@@ -315,17 +316,20 @@ describe('backupNg', () => {
           tasks: [task],
           ...log
         },
-      ] = await xo.call('backupNg.getLogs', {
+      ] = await xo.getBackupLogs({
         jobId,
         scheduleId: schedule.id,
       })
 
-      expect(log).toMatchSnapshot({
-        end: expect.any(Number),
-        id: expect.any(String),
-        jobId: expect.any(String),
-        scheduleId: expect.any(String),
-        start: expect.any(Number),
+      validateRootTask(log, {
+        data: {
+          mode: jobInput.mode,
+          reportWhen: jobInput.settings[''].reportWhen,
+        },
+        jobId,
+        jobName: jobInput.name,
+        scheduleId: schedule.id,
+        status: 'failure',
       })
 
       expect(task).toMatchSnapshot({
@@ -347,8 +351,7 @@ describe('backupNg', () => {
   test('execute three times a rolling snapshot with 2 as retention & revert to an old state', async () => {
     jest.setTimeout(6e4)
     await xo.createTempServer(config.servers.default)
-    const vmId = await xo.createTempVm({
-      name_label: 'XO Test Temp',
+    let vm = await xo.createTempVm({
       name_description: 'Creating a temporary vm',
       template: config.templates.default,
       VDIs: [
@@ -361,48 +364,45 @@ describe('backupNg', () => {
     })
 
     const scheduleTempId = randomId()
-    const { id: jobId } = await xo.createTempBackupNgJob({
-      ...defaultBackupNg,
+    const jobInput = {
       vms: {
-        id: vmId,
+        id: vm.id,
       },
       schedules: {
-        [scheduleTempId]: DEFAULT_SCHEDULE,
+        [scheduleTempId]: getDefaultSchedule(),
       },
       settings: {
-        ...defaultBackupNg.settings,
         [scheduleTempId]: { snapshotRetention: 2 },
       },
-    })
+    }
+    const { id: jobId } = await xo.createTempBackupNgJob(jobInput)
 
     const schedule = await xo.getSchedule({ jobId })
     expect(typeof schedule).toBe('object')
+
     for (let i = 0; i < 3; i++) {
-      const oldSnapshots = xo.objects.all[vmId].snapshots
       await xo.call('backupNg.runJob', { id: jobId, schedule: schedule.id })
-      await xo.waitObjectState(vmId, ({ snapshots }) => {
+      vm = await xo.waitObjectState(vm.id, ({ snapshots }) => {
         // Test on updating snapshots.
-        expect(snapshots).not.toEqual(oldSnapshots)
+        expect(snapshots).not.toEqual(vm.snapshots)
       })
     }
 
-    const { snapshots, videoram: oldVideoram } = xo.objects.all[vmId]
-
     // Test on the retention, how many snapshots should be saved.
-    expect(snapshots.length).toBe(2)
+    expect(vm.snapshots.length).toBe(2)
 
     const newVideoram = 16
-    await xo.call('vm.set', { id: vmId, videoram: newVideoram })
-    await xo.waitObjectState(vmId, ({ videoram }) => {
+    await xo.call('vm.set', { id: vm.id, videoram: newVideoram })
+    await xo.waitObjectState(vm.id, ({ videoram }) => {
       expect(videoram).toBe(newVideoram.toString())
     })
 
     await xo.call('vm.revert', {
-      snapshot: snapshots[0],
+      snapshot: vm.snapshots[0],
     })
 
-    await xo.waitObjectState(vmId, ({ videoram }) => {
-      expect(videoram).toBe(oldVideoram)
+    await xo.waitObjectState(vm.id, ({ videoram }) => {
+      expect(videoram).toBe(vm.videoram)
     })
 
     const [
@@ -410,17 +410,20 @@ describe('backupNg', () => {
         tasks: [{ tasks: subTasks, ...vmTask }],
         ...log
       },
-    ] = await xo.call('backupNg.getLogs', {
+    ] = await xo.getBackupLogs({
       jobId,
       scheduleId: schedule.id,
     })
 
-    expect(log).toMatchSnapshot({
-      end: expect.any(Number),
-      id: expect.any(String),
-      jobId: expect.any(String),
-      scheduleId: expect.any(String),
-      start: expect.any(Number),
+    validateRootTask(log, {
+      data: {
+        mode: jobInput.mode,
+        reportWhen: jobInput.settings[''].reportWhen,
+      },
+      jobId,
+      jobName: jobInput.name,
+      scheduleId: schedule.id,
+      status: 'success',
     })
 
     const subTaskSnapshot = subTasks.find(
@@ -442,7 +445,7 @@ describe('backupNg', () => {
       message: expect.any(String),
       start: expect.any(Number),
     })
-    expect(vmTask.data.id).toBe(vmId)
+    expect(vmTask.data.id).toBe(vm.id)
   })
 
   test('execute three times a delta backup with 2 remotes, 2 as retention and 2 as fullInterval', async () => {
@@ -465,7 +468,7 @@ describe('backupNg', () => {
     const exportRetention = 2
     const fullInterval = 2
     const scheduleTempId = randomId()
-    const { id: jobId } = await xo.createTempBackupNgJob({
+    const jobInput = {
       mode: 'delta',
       remotes: {
         id: {
@@ -473,11 +476,10 @@ describe('backupNg', () => {
         },
       },
       schedules: {
-        [scheduleTempId]: DEFAULT_SCHEDULE,
+        [scheduleTempId]: getDefaultSchedule(),
       },
       settings: {
         '': {
-          reportWhen: 'never',
           fullInterval,
         },
         [remoteId1]: { deleteFirst: true },
@@ -486,7 +488,8 @@ describe('backupNg', () => {
       vms: {
         id: vmToBackup,
       },
-    })
+    }
+    const { id: jobId } = await xo.createTempBackupNgJob(jobInput)
 
     const schedule = await xo.getSchedule({ jobId })
     expect(typeof schedule).toBe('object')
@@ -500,7 +503,7 @@ describe('backupNg', () => {
       expect(backups.length).toBe(exportRetention)
     )
 
-    const backupLogs = await xo.call('backupNg.getLogs', {
+    const backupLogs = await xo.getBackupLogs({
       jobId,
       scheduleId: schedule.id,
     })
@@ -509,10 +512,12 @@ describe('backupNg', () => {
     backupLogs.forEach(({ tasks = [], ...log }, key) => {
       validateRootTask(log, {
         data: {
-          mode: 'delta',
-          reportWhen: 'never',
+          mode: jobInput.mode,
+          reportWhen: jobInput.settings[''].reportWhen,
         },
-        message: 'backup',
+        jobId,
+        jobName: jobInput.name,
+        scheduleId: schedule.id,
         status: 'success',
       })
 

packages/xo-server-test/src/issues/index.spec.js

@@ -0,0 +1,51 @@
+/* eslint-env jest */
+
+import config from '../_config'
+import xo from '../_xoConnection'
+
+describe('issue', () => {
+  test('4507', async () => {
+    await xo.createTempServer(config.servers.default)
+
+    const props = {
+      coresPerSocket: 1,
+      cpuCap: 1,
+    }
+    const vm = await xo.createTempVm(props)
+    expect(vm).toMatchObject(props)
+
+    await xo.call('vm.set', {
+      coresPerSocket: null,
+      cpuCap: null,
+      id: vm.id,
+    })
+    await xo.waitObjectState(vm.id, vm => {
+      expect(vm.coresPerSocket).toBe(undefined)
+      expect(vm.cpuCap).toBe(undefined)
+    })
+  })
+
+  test('4514', async () => {
+    await xo.createTempServer(config.servers.default)
+
+    const oldName = 'Old XO Test name'
+    const { id, name_label } = await xo.createTempNetwork({ name: oldName })
+    expect(name_label).toBe(oldName)
+
+    const newName = 'New XO Test name'
+    await xo.call('network.set', { id, name_label: newName })
+    await xo.waitObjectState(id, ({ name_label }) => {
+      expect(name_label).toBe(newName)
+    })
+  })
+
+  test('4523', async () => {
+    const id = await xo.call('network.create', {
+      name: 'XO Test',
+      pool: config.pools.default,
+    })
+    expect(typeof id).toBe('string')
+
+    await xo.call('network.delete', { id })
+  })
+})

packages/xo-server-test/src/old-tests/disk.spec.js

@@ -6,7 +6,7 @@ import expect from 'must'
 // ===================================================================
 
 import { getConfig, getMainConnection, getSrId, waitObjectState } from './util'
-import { map, assign } from 'lodash'
+import { map } from 'lodash'
 import eventToPromise from 'event-to-promise'
 
 // ===================================================================
@@ -27,7 +27,7 @@ describe('disk', () => {
     const config = await getConfig()
     serverId = await xo.call(
       'server.add',
-      assign({ autoConnect: false }, config.xenServer1)
+      Object.assign({ autoConnect: false }, config.xenServer1)
     )
     await xo.call('server.connect', { id: serverId })
     await eventToPromise(xo.objects, 'finish')

packages/xo-server-test/src/old-tests/server.spec.js

@@ -1,6 +1,6 @@
 /* eslint-env jest */
 
-import { assign, find, map } from 'lodash'
+import { find, map } from 'lodash'
 
 import { config, rejectionOf, xo } from './util'
 
@@ -151,7 +151,7 @@ describe('server', () => {
 
     it('connects to a Xen server', async () => {
       const serverId = await addServer(
-        assign({ autoConnect: false }, config.xenServer1)
+        Object.assign({ autoConnect: false }, config.xenServer1)
       )
 
       await xo.call('server.connect', {
@@ -184,7 +184,7 @@ describe('server', () => {
     let serverId
     beforeEach(async () => {
       serverId = await addServer(
-        assign({ autoConnect: false }, config.xenServer1)
+        Object.assign({ autoConnect: false }, config.xenServer1)
       )
       await xo.call('server.connect', {
         id: serverId,

packages/xo-server-test/src/old-tests/vbd.spec.js

@@ -12,7 +12,7 @@ import {
   getOneHost,
   waitObjectState,
 } from './util'
-import { assign, map } from 'lodash'
+import { map } from 'lodash'
 import eventToPromise from 'event-to-promise'
 
 // ===================================================================
@@ -33,7 +33,7 @@ describe('vbd', () => {
 
     serverId = await xo.call(
       'server.add',
-      assign({ autoConnect: false }, config.xenServer1)
+      Object.assign({ autoConnect: false }, config.xenServer1)
     )
     await xo.call('server.connect', { id: serverId })
     await eventToPromise(xo.objects, 'finish')

packages/xo-server-transport-email/package.json

@@ -34,15 +34,15 @@
   "dependencies": {
     "nodemailer": "^6.1.0",
     "nodemailer-markdown": "^1.0.1",
-    "promise-toolbox": "^0.13.0"
+    "promise-toolbox": "^0.14.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-transport-nagios/package.json

@@ -39,8 +39,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-preset-env": "^1.5.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-transport-slack/package.json

@@ -33,15 +33,15 @@
     "node": ">=6"
   },
   "dependencies": {
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "slack-node": "^0.1.8"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.5.4"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-transport-xmpp/package.json

@@ -40,8 +40,8 @@
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-usage-report/package.json

@@ -36,21 +36,21 @@
   },
   "dependencies": {
     "@xen-orchestra/async-map": "^0.0.0",
-    "@xen-orchestra/cron": "^1.0.3",
-    "@xen-orchestra/log": "^0.1.4",
+    "@xen-orchestra/cron": "^1.0.4",
+    "@xen-orchestra/log": "^0.2.0",
     "handlebars": "^4.0.6",
     "html-minifier": "^4.0.0",
     "human-format": "^0.10.0",
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0"
+    "promise-toolbox": "^0.14.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.1"
+    "cross-env": "^6.0.3",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server-usage-report/src/index.js

@@ -5,7 +5,6 @@ import humanFormat from 'human-format'
 import { createSchedule } from '@xen-orchestra/cron'
 import { minify } from 'html-minifier'
 import {
-  assign,
   concat,
   differenceBy,
   filter,
@@ -418,7 +417,7 @@ function computeGlobalVmsStats({ haltedVms, vmsStats, xo }) {
     }))
   )
 
-  return assign(
+  return Object.assign(
     computeMeans(vmsStats, [
       'cpu',
       'ram',
@@ -446,7 +445,7 @@ function computeGlobalHostsStats({ haltedHosts, hostsStats, xo }) {
     }))
   )
 
-  return assign(
+  return Object.assign(
     computeMeans(hostsStats, [
       'cpu',
       'ram',

packages/xo-server/package.json

@@ -1,7 +1,7 @@
 {
   "private": true,
   "name": "xo-server",
-  "version": "5.48.0",
+  "version": "5.50.1",
   "license": "AGPL-3.0",
   "description": "Server part of Xen-Orchestra",
   "keywords": [
@@ -30,22 +30,23 @@
     "bin": "bin"
   },
   "engines": {
-    "node": ">=6"
+    "node": ">=8"
   },
   "dependencies": {
     "@iarna/toml": "^2.2.1",
     "@xen-orchestra/async-map": "^0.0.0",
-    "@xen-orchestra/cron": "^1.0.3",
+    "@xen-orchestra/cron": "^1.0.4",
     "@xen-orchestra/defined": "^0.0.0",
     "@xen-orchestra/emit-async": "^0.0.0",
     "@xen-orchestra/fs": "^0.10.1",
-    "@xen-orchestra/log": "^0.1.4",
+    "@xen-orchestra/log": "^0.2.0",
     "@xen-orchestra/mixin": "^0.0.0",
     "ajv": "^6.1.1",
     "app-conf": "^0.7.0",
     "archiver": "^3.0.0",
     "async-iterator-to-stream": "^1.0.1",
     "base64url": "^3.0.0",
+    "bind-property-descriptor": "^1.0.0",
     "blocked": "^1.2.1",
     "bluebird": "^3.5.1",
     "body-parser": "^1.18.2",
@@ -57,16 +58,15 @@
     "debug": "^4.0.1",
     "decorator-synchronized": "^0.5.0",
     "deptree": "^1.0.0",
-    "escape-string-regexp": "^1.0.5",
     "event-to-promise": "^0.8.0",
     "exec-promise": "^0.7.0",
-    "execa": "^1.0.0",
+    "execa": "^2.0.5",
     "express": "^4.16.2",
     "express-session": "^1.15.6",
     "fatfs": "^0.10.4",
     "from2": "^2.3.0",
     "fs-extra": "^8.0.1",
-    "get-stream": "^4.0.0",
+    "get-stream": "^5.1.0",
     "golike-defer": "^0.4.1",
     "hashy": "^0.7.1",
     "helmet": "^3.9.0",
@@ -90,7 +90,7 @@
     "limit-concurrency-decorator": "^0.4.0",
     "lodash": "^4.17.4",
     "make-error": "^1",
-    "micromatch": "^3.1.4",
+    "micromatch": "^4.0.2",
     "minimist": "^1.2.0",
     "moment-timezone": "^0.5.14",
     "ms": "^2.1.1",
@@ -102,7 +102,7 @@
     "passport": "^0.4.0",
     "passport-local": "^1.0.0",
     "pretty-format": "^24.0.0",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.14.0",
     "proxy-agent": "^3.0.0",
     "pug": "^2.0.0-rc.4",
     "pump": "^3.0.0",
@@ -122,8 +122,8 @@
     "uuid": "^3.0.1",
     "value-matcher": "^0.2.0",
     "vhd-lib": "^0.7.0",
-    "ws": "^6.0.0",
-    "xen-api": "^0.27.1",
+    "ws": "^7.1.2",
+    "xen-api": "^0.27.2",
     "xml2js": "^0.4.19",
     "xo-acl-resolver": "^0.4.1",
     "xo-collection": "^0.4.1",
@@ -147,9 +147,9 @@
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
     "babel-plugin-transform-dev": "^2.0.1",
-    "cross-env": "^5.1.3",
+    "cross-env": "^6.0.3",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

packages/xo-server/src/_MultiKeyMap.spec.js

@@ -0,0 +1,34 @@
+/* eslint-env jest */
+
+import MultiKeyMap from './_MultiKeyMap'
+
+describe('MultiKeyMap', () => {
+  it('works', () => {
+    const map = new MultiKeyMap()
+
+    const keys = [
+      // null key
+      [],
+      // simple key
+      ['foo'],
+      // composite key
+      ['foo', 'bar'],
+      // reverse composite key
+      ['bar', 'foo'],
+    ]
+    const values = keys.map(() => ({}))
+
+    // set all values first to make sure they are all stored and not only the
+    // last one
+    keys.forEach((key, i) => {
+      map.set(key, values[i])
+    })
+
+    keys.forEach((key, i) => {
+      // copy the key to make sure the array itself is not the key
+      expect(map.get(key.slice())).toBe(values[i])
+      map.delete(key.slice())
+      expect(map.get(key.slice())).toBe(undefined)
+    })
+  })
+})

packages/xo-server/src/_pDebounceWithKey.js

@@ -16,13 +16,28 @@ function scheduleRemoveCacheEntry(keys, expires) {
 
 const defaultKeyFn = () => []
 
+const { slice } = Array.prototype
+
+export const REMOVE_CACHE_ENTRY = {}
+
 // debounce an async function so that all subsequent calls in a delay receive
 // the same result
 //
 // similar to `p-debounce` with `leading` set to `true` but with key support
-export default (fn, delay, keyFn = defaultKeyFn) => {
+//
+// - `delay`: number of milliseconds to cache the response, a function can be
+//   passed to use a custom delay for a call based on its parameters
+export const debounceWithKey = (fn, delay, keyFn = defaultKeyFn) => {
   const cache = new MultiKeyMap()
-  return function() {
+  const delayFn = typeof delay === 'number' ? () => delay : delay
+  return function(arg) {
+    if (arg === REMOVE_CACHE_ENTRY) {
+      return removeCacheEntry(
+        cache,
+        ensureArray(keyFn.apply(this, slice.call(arguments, 1)))
+      )
+    }
+
     const keys = ensureArray(keyFn.apply(this, arguments))
     let promise = cache.get(keys)
     if (promise === undefined) {
@@ -30,10 +45,15 @@ export default (fn, delay, keyFn = defaultKeyFn) => {
       const remove = scheduleRemoveCacheEntry.bind(
         cache,
         keys,
-        Date.now() + delay
+        Date.now() + delayFn.apply(this, arguments)
       )
       promise.then(remove, remove)
     }
     return promise
   }
 }
+
+debounceWithKey.decorate = (...params) => (target, name, descriptor) => ({
+  ...descriptor,
+  value: debounceWithKey(descriptor.value, ...params),
+})

packages/xo-server/src/_pDebounceWithKey.spec.js

@@ -0,0 +1,29 @@
+/* eslint-env jest */
+
+import { debounceWithKey, REMOVE_CACHE_ENTRY } from './_pDebounceWithKey'
+
+describe('REMOVE_CACHE_ENTRY', () => {
+  it('clears the cache', async () => {
+    let i = 0
+    const debouncedFn = debounceWithKey(
+      function() {
+        return Promise.resolve(++i)
+      },
+      Infinity,
+      id => id
+    )
+
+    // not cached accross keys
+    expect(await debouncedFn(1)).toBe(1)
+    expect(await debouncedFn(2)).toBe(2)
+
+    // retrieve the already cached values
+    expect(await debouncedFn(1)).toBe(1)
+    expect(await debouncedFn(2)).toBe(2)
+
+    // an entry for a specific key can be removed
+    debouncedFn(REMOVE_CACHE_ENTRY, 1)
+    expect(await debouncedFn(1)).toBe(3)
+    expect(await debouncedFn(2)).toBe(2)
+  })
+})

packages/xo-server/src/api/backup-ng.js

@@ -3,11 +3,12 @@ import { fromCallback } from 'promise-toolbox'
 import { pipeline } from 'readable-stream'
 
 import createNdJsonStream from '../_createNdJsonStream'
+import { REMOVE_CACHE_ENTRY } from '../_pDebounceWithKey'
 import { safeDateFormat } from '../utils'
 
 export function createJob({ schedules, ...job }) {
   job.userId = this.user.id
-  return this.createBackupNgJob(job, schedules)
+  return this.createBackupNgJob(job, schedules).then(({ id }) => id)
 }
 
 createJob.permission = 'admin'
@@ -184,7 +185,20 @@ getAllLogs.params = {
   ndjson: { type: 'boolean', optional: true },
 }
 
-export function getLogs({ after, before, limit, ...filter }) {
+export function getLogs({
+  after,
+  before,
+  limit,
+
+  // TODO: it's a temporary work-around which should be removed
+  // when the consolidated logs will be stored in the DB
+  _forceRefresh = false,
+
+  ...filter
+}) {
+  if (_forceRefresh) {
+    this.getBackupNgLogs(REMOVE_CACHE_ENTRY)
+  }
   return this.getBackupNgLogsSorted({ after, before, limit, filter })
 }
 
@@ -302,7 +316,7 @@ export async function fetchFiles(params) {
   filename += '.zip'
 
   return this.registerHttpRequest(handleFetchFiles, params, {
-    suffix: encodeURI(`/${filename}`),
+    suffix: '/' + encodeURIComponent(filename),
   }).then(url => ({ $getFrom: url }))
 }
 

packages/xo-server/src/api/backup.js

@@ -93,7 +93,7 @@ export async function fetchFiles({ format = 'zip', ...params }) {
     handleFetchFiles,
     { ...params, format },
     {
-      suffix: encodeURI(`/${fileName}`),
+      suffix: '/' + encodeURIComponent(fileName),
     }
   ).then(url => ({ $getFrom: url }))
 }

packages/xo-server/src/api/host.js

@@ -221,12 +221,7 @@ emergencyShutdownHost.resolve = {
 // -------------------------------------------------------------------
 
 export async function isHostServerTimeConsistent({ host }) {
-  try {
-    await this.getXapi(host).assertConsistentHostServerTime(host._xapiRef)
-    return true
-  } catch (e) {
-    return false
-  }
+  return this.getXapi(host).isHostServerTimeConsistent(host._xapiRef)
 }
 
 isHostServerTimeConsistent.params = {

packages/xo-server/src/api/network.js

@@ -1,3 +1,4 @@
+import xapiObjectToXo from '../xapi-object-to-xo'
 import { mapToArray } from '../utils'
 
 export function getBondModes() {
@@ -12,13 +13,15 @@ export async function create({
   mtu = 1500,
   vlan = 0,
 }) {
-  return this.getXapi(pool).createNetwork({
-    name,
-    description,
-    pifId: pif && this.getObject(pif, 'PIF')._xapiId,
-    mtu: +mtu,
-    vlan: +vlan,
-  })
+  return xapiObjectToXo(
+    await this.getXapi(pool).createNetwork({
+      name,
+      description,
+      pifId: pif && this.getObject(pif, 'PIF')._xapiId,
+      mtu: +mtu,
+      vlan: +vlan,
+    })
+  ).id
 }
 
 create.params = {
@@ -116,6 +119,9 @@ set.params = {
     type: 'boolean',
     optional: true,
   },
+  id: {
+    type: 'string',
+  },
   name_description: {
     type: 'string',
     optional: true,

packages/xo-server/src/api/sr.js

@@ -777,7 +777,7 @@ export async function probeIscsiExists({
   )
 
   const srs = []
-  forEach(ensureArray(xml['SRlist'].SR), sr => {
+  forEach(ensureArray(xml.SRlist.SR), sr => {
     // get the UUID of SR connected to this LUN
     srs.push({ uuid: sr.UUID.trim() })
   })
@@ -845,7 +845,7 @@ export async function probeNfsExists({ host, server, serverPath }) {
 
   const srs = []
 
-  forEach(ensureArray(xml['SRlist'].SR), sr => {
+  forEach(ensureArray(xml.SRlist.SR), sr => {
     // get the UUID of SR connected to this LUN
     srs.push({ uuid: sr.UUID.trim() })
   })

packages/xo-server/src/api/vdi.js

@@ -1,7 +1,7 @@
 // FIXME: rename to disk.*
 
 import { invalidParameters } from 'xo-common/api-errors'
-import { isArray, reduce } from 'lodash'
+import { reduce } from 'lodash'
 
 import { parseSize } from '../utils'
 
@@ -85,7 +85,7 @@ export async function set(params) {
       continue
     }
 
-    for (const field of isArray(fields) ? fields : [fields]) {
+    for (const field of Array.isArray(fields) ? fields : [fields]) {
       await xapi.call(`VDI.set_${field}`, ref, `${params[param]}`)
     }
   }

packages/xo-server/src/api/vm.js

@@ -9,7 +9,7 @@ import {
   unauthorized,
 } from 'xo-common/api-errors'
 
-import { forEach, map, mapFilter, parseSize } from '../utils'
+import { forEach, map, mapFilter, parseSize, safeDateFormat } from '../utils'
 
 // ===================================================================
 
@@ -1189,7 +1189,11 @@ async function export_({ vm, compress }) {
 
   return {
     $getFrom: await this.registerHttpRequest(handleExport, data, {
-      suffix: encodeURI(`/${vm.name_label}.xva`),
+      suffix:
+        '/' +
+        encodeURIComponent(
+          `${safeDateFormat(new Date())} - ${vm.name_label}.xva`
+        ),
     }),
   }
 }

packages/xo-server/src/api/xosan.js

@@ -85,7 +85,7 @@ async function rateLimitedRetry(action, shouldRetry, retryCount = 20) {
 function createVolumeInfoTypes() {
   function parseHeal(parsed) {
     const bricks = []
-    parsed['healInfo']['bricks']['brick'].forEach(brick => {
+    parsed.healInfo.bricks.brick.forEach(brick => {
       bricks.push(brick)
       if (brick.file) {
         brick.file = ensureArray(brick.file)
@@ -96,21 +96,21 @@ function createVolumeInfoTypes() {
 
   function parseStatus(parsed) {
     const brickDictByUuid = {}
-    const volume = parsed['volStatus']['volumes']['volume']
-    volume['node'].forEach(node => {
+    const volume = parsed.volStatus.volumes.volume
+    volume.node.forEach(node => {
       brickDictByUuid[node.peerid] = brickDictByUuid[node.peerid] || []
       brickDictByUuid[node.peerid].push(node)
     })
     return {
       commandStatus: true,
-      result: { nodes: brickDictByUuid, tasks: volume['tasks'] },
+      result: { nodes: brickDictByUuid, tasks: volume.tasks },
     }
   }
 
   async function parseInfo(parsed) {
-    const volume = parsed['volInfo']['volumes']['volume']
-    volume['bricks'] = volume['bricks']['brick']
-    volume['options'] = volume['options']['option']
+    const volume = parsed.volInfo.volumes.volume
+    volume.bricks = volume.bricks.brick
+    volume.options = volume.options.option
     return { commandStatus: true, result: volume }
   }
 
@@ -118,23 +118,23 @@ function createVolumeInfoTypes() {
     return async function(sr) {
       const glusterEndpoint = this::_getGlusterEndpoint(sr)
       const cmdShouldRetry = result =>
-        !result['commandStatus'] &&
-        ((result.parsed && result.parsed['cliOutput']['opErrno'] === '30802') ||
+        !result.commandStatus &&
+        ((result.parsed && result.parsed.cliOutput.opErrno === '30802') ||
           result.stderr.match(/Another transaction is in progress/))
       const runCmd = async () =>
         glusterCmd(glusterEndpoint, 'volume ' + command, true)
       const commandResult = await rateLimitedRetry(runCmd, cmdShouldRetry, 30)
-      return commandResult['commandStatus']
-        ? this::handler(commandResult.parsed['cliOutput'], sr)
+      return commandResult.commandStatus
+        ? this::handler(commandResult.parsed.cliOutput, sr)
         : commandResult
     }
   }
 
   async function profileType(sr) {
     async function parseProfile(parsed) {
-      const volume = parsed['volProfile']
-      volume['bricks'] = ensureArray(volume['brick'])
-      delete volume['brick']
+      const volume = parsed.volProfile
+      volume.bricks = ensureArray(volume.brick)
+      delete volume.brick
       return { commandStatus: true, result: volume }
     }
 
@@ -143,9 +143,9 @@ function createVolumeInfoTypes() {
 
   async function profileTopType(sr) {
     async function parseTop(parsed) {
-      const volume = parsed['volTop']
-      volume['bricks'] = ensureArray(volume['brick'])
-      delete volume['brick']
+      const volume = parsed.volTop
+      volume.bricks = ensureArray(volume.brick)
+      delete volume.brick
       return { commandStatus: true, result: volume }
     }
 
@@ -326,7 +326,7 @@ async function remoteSsh(glusterEndpoint, cmd, ignoreError = false) {
       }
       messageArray.push(`${key}: ${result[key]}`)
     }
-    messageArray.push('command: ' + result['command'].join(' '))
+    messageArray.push('command: ' + result.command.join(' '))
     messageKeys.splice(messageKeys.indexOf('command'), 1)
     for (const key of messageKeys) {
       messageArray.push(`${key}: ${JSON.stringify(result[key])}`)
@@ -343,7 +343,7 @@ async function remoteSsh(glusterEndpoint, cmd, ignoreError = false) {
         })
         break
       } catch (exception) {
-        if (exception['code'] !== 'HOST_OFFLINE') {
+        if (exception.code !== 'HOST_OFFLINE') {
           throw exception
         }
       }
@@ -370,19 +370,17 @@ async function remoteSsh(glusterEndpoint, cmd, ignoreError = false) {
 }
 
 function findErrorMessage(commandResut) {
-  if (commandResut['exit'] === 0 && commandResut.parsed) {
-    const cliOut = commandResut.parsed['cliOutput']
-    if (cliOut['opErrstr'] && cliOut['opErrstr'].length) {
-      return cliOut['opErrstr']
+  if (commandResut.exit === 0 && commandResut.parsed) {
+    const cliOut = commandResut.parsed.cliOutput
+    if (cliOut.opErrstr && cliOut.opErrstr.length) {
+      return cliOut.opErrstr
     }
     // "peer probe" returns it's "already in peer" error in cliOutput/output
-    if (cliOut['output'] && cliOut['output'].length) {
-      return cliOut['output']
+    if (cliOut.output && cliOut.output.length) {
+      return cliOut.output
     }
   }
-  return commandResut['stderr'].length
-    ? commandResut['stderr']
-    : commandResut['stdout']
+  return commandResut.stderr.length ? commandResut.stderr : commandResut.stdout
 }
 
 async function glusterCmd(glusterEndpoint, cmd, ignoreError = false) {
@@ -392,15 +390,15 @@ async function glusterCmd(glusterEndpoint, cmd, ignoreError = false) {
     true
   )
   try {
-    result.parsed = parseXml(result['stdout'])
+    result.parsed = parseXml(result.stdout)
   } catch (e) {
     // pass, we never know if a message can be parsed or not, so we just try
   }
-  if (result['exit'] === 0) {
-    const cliOut = result.parsed['cliOutput']
+  if (result.exit === 0) {
+    const cliOut = result.parsed.cliOutput
     // we have found cases where opErrno is !=0 and opRet was 0, albeit the operation was an error.
     result.commandStatus =
-      cliOut['opRet'].trim() === '0' && cliOut['opErrno'].trim() === '0'
+      cliOut.opRet.trim() === '0' && cliOut.opErrno.trim() === '0'
     result.error = findErrorMessage(result)
   } else {
     result.commandStatus = false
@@ -793,7 +791,7 @@ export const createSR = defer(async function(
       host: param.host.$id,
       vm: { id: param.vm.$id, ip: param.address },
       underlyingSr: param.underlyingSr.$id,
-      arbiter: !!param['arbiter'],
+      arbiter: !!param.arbiter,
     }))
     await xapi.xo.setData(xosanSrRef, 'xosan_config', {
       version: 'beta2',
@@ -821,12 +819,14 @@ export const createSR = defer(async function(
 createSR.description = 'create gluster VM'
 createSR.permission = 'admin'
 createSR.params = {
+  brickSize: { type: 'number', optional: true },
   srs: {
     type: 'array',
     items: {
       type: 'string',
     },
   },
+  template: { type: 'object' },
   pif: {
     type: 'string',
   },
@@ -1162,11 +1162,11 @@ async function _prepareGlusterVm(
 }
 
 async function _importGlusterVM(xapi, template, lvmsrId) {
-  const templateStream = await this.requestResource(
-    'xosan',
-    template.id,
-    template.version
-  )
+  const templateStream = await this.requestResource({
+    id: template.id,
+    namespace: 'xosan',
+    version: template.version,
+  })
   const newVM = await xapi.importVm(templateStream, {
     srId: lvmsrId,
     type: 'xva',
@@ -1298,7 +1298,7 @@ export const addBricks = defer(async function(
         underlyingSr: newSr,
       })
     }
-    const arbiterNode = data.nodes.find(n => n['arbiter'])
+    const arbiterNode = data.nodes.find(n => n.arbiter)
     if (arbiterNode) {
       await glusterCmd(
         glusterEndpoint,
@@ -1533,8 +1533,11 @@ export async function downloadAndInstallXosanPack({ id, version, pool }) {
   }
 
   const xapi = this.getXapi(pool.id)
-  const res = await this.requestResource('xosan', id, version)
-
+  const res = await this.requestResource({
+    id,
+    namespace: 'xosan',
+    version,
+  })
   await xapi.installSupplementalPackOnAllHosts(res)
   await xapi.pool.update_other_config(
     'xosan_pack_installation_time',

packages/xo-server/src/collection.js

@@ -1,7 +1,7 @@
 import Model from './model'
 import { BaseError } from 'make-error'
 import { EventEmitter } from 'events'
-import { isArray, isObject, map } from './utils'
+import { isObject, map } from './utils'
 
 // ===================================================================
 
@@ -30,7 +30,7 @@ export default class Collection extends EventEmitter {
   }
 
   async add(models, opts) {
-    const array = isArray(models)
+    const array = Array.isArray(models)
     if (!array) {
       models = [models]
     }
@@ -66,7 +66,7 @@ export default class Collection extends EventEmitter {
   }
 
   async remove(ids) {
-    if (!isArray(ids)) {
+    if (!Array.isArray(ids)) {
       ids = [ids]
     }
 
@@ -77,8 +77,8 @@ export default class Collection extends EventEmitter {
   }
 
   async update(models) {
-    const array = isArray(models)
-    if (!isArray(models)) {
+    const array = Array.isArray(models)
+    if (!array) {
       models = [models]
     }