WiP: feat(xo-server-icinga2): template filter

Work-around to avoid generating too many logs

.eslintrc.js

@@ -21,7 +21,7 @@ module.exports = {
 
   overrides: [
     {
-      files: ['cli.js', '*-cli.js', 'packages/*cli*/**/*.js'],
+      files: ['cli.js', '*-cli.js', '**/*cli*/**/*.js'],
       rules: {
         'no-console': 'off',
       },
@@ -38,6 +38,15 @@ module.exports = {
     // disabled because XAPI objects are using camel case
     camelcase: ['off'],
 
+    'react/jsx-handler-names': 'off',
+
+    // disabled because not always relevant, we might reconsider in the future
+    //
+    // enabled by https://github.com/standard/eslint-config-standard/commit/319b177750899d4525eb1210686f6aca96190b2f
+    //
+    // example: https://github.com/vatesfr/xen-orchestra/blob/31ed3767c67044ca445658eb6b560718972402f2/packages/xen-api/src/index.js#L156-L157
+    'lines-between-class-members': 'off',
+
     'no-console': ['error', { allow: ['warn', 'error'] }],
     'no-var': 'error',
     'node/no-extraneous-import': 'error',

.prettierrc.js

@@ -1,6 +1,6 @@
 module.exports = {
+  arrowParens: 'avoid',
   jsxSingleQuote: true,
   semi: false,
   singleQuote: true,
-  trailingComma: 'es5',
 }

.travis.yml

@@ -1,7 +1,6 @@
 language: node_js
 node_js:
-  #- stable # disable for now due to an issue of indirect dep upath with Node 9
-  - 8
+  - 12
 
 # Use containers.
 # http://docs.travis-ci.com/user/workers/container-based-infrastructure/

@vates/coalesce-calls/README.md

@@ -0,0 +1,46 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/coalesce-calls
+
+[![Package Version](https://badgen.net/npm/v/@vates/coalesce-calls)](https://npmjs.org/package/@vates/coalesce-calls) ![License](https://badgen.net/npm/license/@vates/coalesce-calls) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/coalesce-calls)](https://bundlephobia.com/result?p=@vates/coalesce-calls) [![Node compatibility](https://badgen.net/npm/node/@vates/coalesce-calls)](https://npmjs.org/package/@vates/coalesce-calls)
+
+> Wraps an async function so that concurrent calls will be coalesced
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/coalesce-calls):
+
+```
+> npm install --save @vates/coalesce-calls
+```
+
+## Usage
+
+```js
+import { coalesceCalls } from 'coalesce-calls'
+
+const connect = coalesceCalls(async function () {
+  // async operation
+})
+
+connect()
+
+// the previous promise result will be returned if the operation is not
+// complete yet
+connect()
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@vates/coalesce-calls/USAGE.md

@@ -0,0 +1,13 @@
+```js
+import { coalesceCalls } from '@vates/coalesce-calls'
+
+const connect = coalesceCalls(async function () {
+  // async operation
+})
+
+connect()
+
+// the previous promise result will be returned if the operation is not
+// complete yet
+connect()
+```

@vates/coalesce-calls/index.js

@@ -0,0 +1,14 @@
+exports.coalesceCalls = function (fn) {
+  let promise
+  const clean = () => {
+    promise = undefined
+  }
+  return function () {
+    if (promise !== undefined) {
+      return promise
+    }
+    promise = fn.apply(this, arguments)
+    promise.then(clean, clean)
+    return promise
+  }
+}

@vates/coalesce-calls/index.spec.js

@@ -0,0 +1,33 @@
+/* eslint-env jest */
+
+const { coalesceCalls } = require('./')
+
+const pDefer = () => {
+  const r = {}
+  r.promise = new Promise((resolve, reject) => {
+    r.reject = reject
+    r.resolve = resolve
+  })
+  return r
+}
+
+describe('coalesceCalls', () => {
+  it('decorates an async function', async () => {
+    const fn = coalesceCalls(promise => promise)
+
+    const defer1 = pDefer()
+    const promise1 = fn(defer1.promise)
+    const defer2 = pDefer()
+    const promise2 = fn(defer2.promise)
+
+    defer1.resolve('foo')
+    expect(await promise1).toBe('foo')
+    expect(await promise2).toBe('foo')
+
+    const defer3 = pDefer()
+    const promise3 = fn(defer3.promise)
+
+    defer3.resolve('bar')
+    expect(await promise3).toBe('bar')
+  })
+})

@vates/coalesce-calls/package.json

@@ -0,0 +1,38 @@
+{
+  "private": false,
+  "name": "@vates/coalesce-calls",
+  "description": "Wraps an async function so that concurrent calls will be coalesced",
+  "keywords": [
+    "async",
+    "calls",
+    "coalesce",
+    "decorate",
+    "decorator",
+    "merge",
+    "promise",
+    "wrap",
+    "wrapper"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/coalesce-calls",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/coalesce-calls",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "files": [
+    "index.js"
+  ],
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  },
+  "license": "ISC",
+  "version": "0.1.0",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  }
+}

@vates/decorate-with/README.md

@@ -0,0 +1,45 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/decorate-with
+
+[![Package Version](https://badgen.net/npm/v/@vates/decorate-with)](https://npmjs.org/package/@vates/decorate-with) ![License](https://badgen.net/npm/license/@vates/decorate-with) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/decorate-with)](https://bundlephobia.com/result?p=@vates/decorate-with) [![Node compatibility](https://badgen.net/npm/node/@vates/decorate-with)](https://npmjs.org/package/@vates/decorate-with)
+
+> Creates a decorator from a function wrapper
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/decorate-with):
+
+```
+> npm install --save @vates/decorate-with
+```
+
+## Usage
+
+For instance, allows using Lodash's functions as decorators:
+
+```js
+import { decorateWith } from '@vates/decorate-with'
+
+class Foo {
+  @decorateWith(lodash.debounce, 150)
+  bar() {
+    // body
+  }
+}
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@vates/decorate-with/USAGE.md

@@ -0,0 +1,12 @@
+For instance, allows using Lodash's functions as decorators:
+
+```js
+import { decorateWith } from '@vates/decorate-with'
+
+class Foo {
+  @decorateWith(lodash.debounce, 150)
+  bar() {
+    // body
+  }
+}
+```

@vates/decorate-with/index.js

@@ -0,0 +1,4 @@
+exports.decorateWith = (fn, ...args) => (target, name, descriptor) => ({
+  ...descriptor,
+  value: fn(descriptor.value, ...args),
+})

@vates/decorate-with/package.json

@@ -0,0 +1,30 @@
+{
+  "private": false,
+  "name": "@vates/decorate-with",
+  "description": "Creates a decorator from a function wrapper",
+  "keywords": [
+    "apply",
+    "decorator",
+    "factory",
+    "wrapper"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/decorate-with",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/decorate-with",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  },
+  "license": "ISC",
+  "version": "0.0.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  }
+}

@vates/parse-duration/README.md

@@ -0,0 +1,47 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/parse-duration
+
+[![Package Version](https://badgen.net/npm/v/@vates/parse-duration)](https://npmjs.org/package/@vates/parse-duration) ![License](https://badgen.net/npm/license/@vates/parse-duration) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/parse-duration)](https://bundlephobia.com/result?p=@vates/parse-duration) [![Node compatibility](https://badgen.net/npm/node/@vates/parse-duration)](https://npmjs.org/package/@vates/parse-duration)
+
+> Small wrapper around ms to parse a duration
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/parse-duration):
+
+```
+> npm install --save @vates/parse-duration
+```
+
+## Usage
+
+`ms` without magic: always parse a duration and throws if invalid.
+
+```js
+import { parseDuration } from '@vates/parse-duration'
+
+parseDuration('2 days')
+// 172800000
+
+parseDuration(172800000)
+// 172800000
+
+parseDuration(undefined)
+// throws TypeError('not a valid duration: undefined')
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@vates/parse-duration/USAGE.md

@@ -0,0 +1,14 @@
+`ms` without magic: always parse a duration and throws if invalid.
+
+```js
+import { parseDuration } from '@vates/parse-duration'
+
+parseDuration('2 days')
+// 172800000
+
+parseDuration(172800000)
+// 172800000
+
+parseDuration(undefined)
+// throws TypeError('not a valid duration: undefined')
+```

@vates/parse-duration/index.js

@@ -1,6 +1,6 @@
-import ms from 'ms'
+const ms = require('ms')
 
-export default value => {
+exports.parseDuration = value => {
   if (typeof value === 'number') {
     return value
   }

@vates/parse-duration/package.json

@@ -0,0 +1,32 @@
+{
+  "private": false,
+  "name": "@vates/parse-duration",
+  "description": "Small wrapper around ms to parse a duration",
+  "keywords": [
+    "duration",
+    "ms",
+    "parse"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/parse-duration",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/parse-duration",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  },
+  "license": "AGPL-3.0-or-later",
+  "version": "0.1.0",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "dependencies": {
+    "ms": "^2.1.2"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  }
+}

@vates/read-chunk/README.md

@@ -0,0 +1,46 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/read-chunk
+
+[![Package Version](https://badgen.net/npm/v/@vates/read-chunk)](https://npmjs.org/package/@vates/read-chunk) ![License](https://badgen.net/npm/license/@vates/read-chunk) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/read-chunk)](https://bundlephobia.com/result?p=@vates/read-chunk) [![Node compatibility](https://badgen.net/npm/node/@vates/read-chunk)](https://npmjs.org/package/@vates/read-chunk)
+
+> Read a chunk of a Node stream
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/read-chunk):
+
+```
+> npm install --save @vates/read-chunk
+```
+
+## Usage
+
+- returns the next available chunk of data
+- like `stream.read()`, a number of bytes can be specified
+- returns `null` if the stream has ended
+
+```js
+import { readChunk } from '@vates/read-chunk'
+;(async () => {
+  let chunk
+  while ((chunk = await readChunk(stream, 1024)) !== null) {
+    // do something with chunk
+  }
+})()
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@vates/read-chunk/USAGE.md

@@ -0,0 +1,13 @@
+- returns the next available chunk of data
+- like `stream.read()`, a number of bytes can be specified
+- returns `null` if the stream has ended
+
+```js
+import { readChunk } from '@vates/read-chunk'
+;(async () => {
+  let chunk
+  while ((chunk = await readChunk(stream, 1024)) !== null) {
+    // do something with chunk
+  }
+})()
+```

@vates/read-chunk/index.js

@@ -0,0 +1,27 @@
+exports.readChunk = (stream, size) =>
+  new Promise((resolve, reject) => {
+    function onEnd() {
+      resolve(null)
+      removeListeners()
+    }
+    function onError(error) {
+      reject(error)
+      removeListeners()
+    }
+    function onReadable() {
+      const data = stream.read(size)
+      if (data !== null) {
+        resolve(data)
+        removeListeners()
+      }
+    }
+    function removeListeners() {
+      stream.removeListener('end', onEnd)
+      stream.removeListener('error', onError)
+      stream.removeListener('readable', onReadable)
+    }
+    stream.on('end', onEnd)
+    stream.on('error', onError)
+    stream.on('readable', onReadable)
+    onReadable()
+  })

@vates/read-chunk/package.json

@@ -0,0 +1,33 @@
+{
+  "private": false,
+  "name": "@vates/read-chunk",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/read-chunk",
+  "description": "Read a chunk of a Node stream",
+  "license": "ISC",
+  "keywords": [
+    "async",
+    "chunk",
+    "data",
+    "node",
+    "promise",
+    "read",
+    "stream"
+  ],
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/read-chunk",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/async-map/README.md

@@ -1,6 +1,10 @@
-# @xen-orchestra/async-map [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/async-map
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/async-map)](https://npmjs.org/package/@xen-orchestra/async-map) ![License](https://badgen.net/npm/license/@xen-orchestra/async-map) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/async-map)](https://bundlephobia.com/result?p=@xen-orchestra/async-map) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/async-map)](https://npmjs.org/package/@xen-orchestra/async-map)
+
+> Similar to Promise.all + lodash.map but wait for all promises to be settled
 
 ## Install
 
@@ -12,30 +16,15 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/async
 
 ## Usage
 
-**TODO**
+```js
+import asyncMap from '@xen-orchestra/async-map'
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+const array = await asyncMap(collection, iteratee)
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
@@ -46,4 +35,4 @@ You may:
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/async-map/USAGE.md

@@ -0,0 +1,5 @@
+```js
+import asyncMap from '@xen-orchestra/async-map'
+
+const array = await asyncMap(collection, iteratee)
+```

@xen-orchestra/async-map/package.json

@@ -1,8 +1,9 @@
 {
+  "private": false,
   "name": "@xen-orchestra/async-map",
   "version": "0.0.0",
   "license": "ISC",
-  "description": "",
+  "description": "Similar to Promise.all + lodash.map but wait for all promises to be settled",
   "keywords": [],
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/async-map",
   "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@isonoe.net"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -36,8 +37,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/audit-core/.npmignore

@@ -0,0 +1,24 @@
+/benchmark/
+/benchmarks/
+*.bench.js
+*.bench.js.map
+
+/examples/
+example.js
+example.js.map
+*.example.js
+*.example.js.map
+
+/fixture/
+/fixtures/
+*.fixture.js
+*.fixture.js.map
+*.fixtures.js
+*.fixtures.js.map
+
+/test/
+/tests/
+*.spec.js
+*.spec.js.map
+
+__snapshots__/

@xen-orchestra/audit-core/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/audit-core
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/audit-core)](https://npmjs.org/package/@xen-orchestra/audit-core) ![License](https://badgen.net/npm/license/@xen-orchestra/audit-core) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/audit-core)](https://bundlephobia.com/result?p=@xen-orchestra/audit-core) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/audit-core)](https://npmjs.org/package/@xen-orchestra/audit-core)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/audit-core):
+
+```
+> npm install --save @xen-orchestra/audit-core
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/audit-core/package.json

@@ -0,0 +1,44 @@
+{
+  "name": "@xen-orchestra/audit-core",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/audit-core",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/audit-core",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "main": "dist/",
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "postversion": "npm publish --access public",
+    "prebuild": "rimraf dist/",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.7.4",
+    "@babel/core": "^7.7.4",
+    "@babel/plugin-proposal-decorators": "^7.8.0",
+    "@babel/plugin-proposal-nullish-coalescing-operator": "^7.8.0",
+    "@babel/preset-env": "^7.7.4",
+    "cross": "^1.0.0",
+    "rimraf": "^3.0.0"
+  },
+  "dependencies": {
+    "core-js": "^3.6.4",
+    "golike-defer": "^0.4.1",
+    "lodash": "^4.17.15",
+    "object-hash": "^2.0.1"
+  },
+  "private": false,
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/audit-core/src/index.js

@@ -0,0 +1,142 @@
+// see https://github.com/babel/babel/issues/8450
+import 'core-js/features/symbol/async-iterator'
+
+import assert from 'assert'
+import defer from 'golike-defer'
+import hash from 'object-hash'
+
+export class Storage {
+  constructor() {
+    this._lock = Promise.resolve()
+  }
+
+  async acquireLock() {
+    const lock = this._lock
+    let releaseLock
+    this._lock = new Promise(resolve => {
+      releaseLock = resolve
+    })
+    await lock
+    return releaseLock
+  }
+}
+
+// Format: $<algorithm>$<salt>$<encrypted>
+//
+// http://man7.org/linux/man-pages/man3/crypt.3.html#NOTES
+const ID_TO_ALGORITHM = {
+  '5': 'sha256',
+}
+
+export class AlteredRecordError extends Error {
+  constructor(id, nValid, record) {
+    super('altered record')
+
+    this.id = id
+    this.nValid = nValid
+    this.record = record
+  }
+}
+
+export class MissingRecordError extends Error {
+  constructor(id, nValid) {
+    super('missing record')
+
+    this.id = id
+    this.nValid = nValid
+  }
+}
+
+export const NULL_ID = 'nullId'
+
+const HASH_ALGORITHM_ID = '5'
+const createHash = (data, algorithmId = HASH_ALGORITHM_ID) =>
+  `$${algorithmId}$$${hash(data, {
+    algorithm: ID_TO_ALGORITHM[algorithmId],
+    excludeKeys: key => key === 'id',
+  })}`
+
+export class AuditCore {
+  constructor(storage) {
+    assert.notStrictEqual(storage, undefined)
+    this._storage = storage
+  }
+
+  @defer
+  async add($defer, subject, event, data) {
+    const time = Date.now()
+    const storage = this._storage
+    $defer(await storage.acquireLock())
+
+    // delete "undefined" properties and normalize data with JSON.stringify
+    const record = JSON.parse(
+      JSON.stringify({
+        data,
+        event,
+        previousId: (await storage.getLastId()) ?? NULL_ID,
+        subject,
+        time,
+      })
+    )
+    record.id = createHash(record)
+    await storage.put(record)
+    await storage.setLastId(record.id)
+    return record
+  }
+
+  async checkIntegrity(oldest, newest) {
+    const storage = this._storage
+
+    // handle separated chains case
+    if (newest !== (await storage.getLastId())) {
+      let isNewestAccessible = false
+      for await (const { id } of this.getFrom()) {
+        if (id === newest) {
+          isNewestAccessible = true
+          break
+        }
+      }
+      if (!isNewestAccessible) {
+        throw new MissingRecordError(newest, 0)
+      }
+    }
+
+    let nValid = 0
+    while (newest !== oldest) {
+      const record = await storage.get(newest)
+      if (record === undefined) {
+        throw new MissingRecordError(newest, nValid)
+      }
+      if (
+        newest !== createHash(record, newest.slice(1, newest.indexOf('$', 1)))
+      ) {
+        throw new AlteredRecordError(newest, nValid, record)
+      }
+      newest = record.previousId
+      nValid++
+    }
+    return nValid
+  }
+
+  async *getFrom(newest) {
+    const storage = this._storage
+
+    let id = newest ?? (await storage.getLastId())
+    if (id === undefined) {
+      return
+    }
+
+    let record
+    while ((record = await storage.get(id)) !== undefined) {
+      yield record
+      id = record.previousId
+    }
+  }
+
+  async deleteFrom(newest) {
+    assert.notStrictEqual(newest, undefined)
+    for await (const { id } of this.getFrom(newest)) {
+      await this._storage.del(id)
+    }
+  }
+}

@xen-orchestra/audit-core/src/index.spec.js

@@ -0,0 +1,126 @@
+/* eslint-env jest */
+
+import {
+  AlteredRecordError,
+  AuditCore,
+  MissingRecordError,
+  NULL_ID,
+  Storage,
+} from '.'
+
+const asyncIteratorToArray = async asyncIterator => {
+  const array = []
+  for await (const entry of asyncIterator) {
+    array.push(entry)
+  }
+  return array
+}
+
+class DB extends Storage {
+  constructor() {
+    super()
+
+    this._db = new Map()
+    this._lastId = undefined
+  }
+
+  async put(record) {
+    this._db.set(record.id, record)
+  }
+
+  async setLastId(id) {
+    this._lastId = id
+  }
+
+  async getLastId() {
+    return this._lastId
+  }
+
+  async del(id) {
+    this._db.delete(id)
+  }
+
+  async get(id) {
+    return this._db.get(id)
+  }
+
+  _clear() {
+    return this._db.clear()
+  }
+}
+
+const DATA = [
+  [
+    {
+      name: 'subject0',
+    },
+    'event0',
+    {},
+  ],
+  [
+    {
+      name: 'subject1',
+    },
+    'event1',
+    {},
+  ],
+  [
+    {
+      name: 'subject2',
+    },
+    'event2',
+    {},
+  ],
+]
+
+const db = new DB()
+const auditCore = new AuditCore(db)
+const storeAuditRecords = async () => {
+  await Promise.all(DATA.map(data => auditCore.add(...data)))
+  const records = await asyncIteratorToArray(auditCore.getFrom())
+  expect(records.length).toBe(DATA.length)
+  return records
+}
+
+describe('auditCore', () => {
+  afterEach(() => db._clear())
+
+  it('detects that a record is missing', async () => {
+    const [newestRecord, deletedRecord] = await storeAuditRecords()
+
+    const nValidRecords = await auditCore.checkIntegrity(
+      NULL_ID,
+      newestRecord.id
+    )
+    expect(nValidRecords).toBe(DATA.length)
+
+    await db.del(deletedRecord.id)
+    await expect(
+      auditCore.checkIntegrity(NULL_ID, newestRecord.id)
+    ).rejects.toEqual(new MissingRecordError(deletedRecord.id, 1))
+  })
+
+  it('detects that a record has been altered', async () => {
+    const [newestRecord, alteredRecord] = await storeAuditRecords()
+
+    alteredRecord.event = ''
+    await db.put(alteredRecord)
+
+    await expect(
+      auditCore.checkIntegrity(NULL_ID, newestRecord.id)
+    ).rejects.toEqual(
+      new AlteredRecordError(alteredRecord.id, 1, alteredRecord)
+    )
+  })
+
+  it('confirms interval integrity after deletion of records outside of the interval', async () => {
+    const [thirdRecord, secondRecord, firstRecord] = await storeAuditRecords()
+
+    await auditCore.deleteFrom(secondRecord.id)
+
+    expect(await db.get(firstRecord.id)).toBe(undefined)
+    expect(await db.get(secondRecord.id)).toBe(undefined)
+
+    await auditCore.checkIntegrity(secondRecord.id, thirdRecord.id)
+  })
+})

@xen-orchestra/audit-core/src/specification.ts

@@ -0,0 +1,25 @@
+class Storage {
+  acquire: () => Promise<() => undefined>
+  del: (id: string) => Promise<void>
+  get: (id: string) => Promise<Record | void>
+  getLastId: () => Promise<string | void>
+  put: (record: Record) => Promise<void>
+  setLastId: (id: string) => Promise<void>
+}
+
+interface Record {
+  data: object
+  event: string
+  id: string
+  previousId: string
+  subject: object
+  time: number
+}
+
+export class AuditCore {
+  constructor(storage: Storage) {}
+  public add(subject: any, event: string, data: any): Promise<Record> {}
+  public checkIntegrity(oldest: string, newest: string): Promise<number> {}
+  public getFrom(newest?: string): AsyncIterator {}
+  public deleteFrom(newest: string): Promise<void> {}
+}

@xen-orchestra/babel-config/README.md

@@ -0,0 +1,18 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/babel-config
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/babel-config/index.js

@@ -32,7 +32,6 @@ const configs = {
         }
         return { browsers: pkg.browserslist, node }
       })(),
-      useBuiltIns: '@babel/polyfill' in (pkg.dependencies || {}) && 'usage',
     }
   },
 }
@@ -52,7 +51,7 @@ const pluginsOrder = [
   '@babel/plugin-proposal-class-properties',
 ]
 
-module.exports = function(pkg, plugins, presets) {
+module.exports = function (pkg, plugins, presets) {
   plugins === undefined && (plugins = {})
   presets === undefined && (presets = {})
 

@xen-orchestra/babel-config/package.json

@@ -8,5 +8,13 @@
     "directory": "@xen-orchestra/babel-config",
     "type": "git",
     "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "engines": {
+    "node": ">=6"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/backups-cli/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/backups-cli
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/backups-cli)](https://npmjs.org/package/@xen-orchestra/backups-cli) ![License](https://badgen.net/npm/license/@xen-orchestra/backups-cli) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/backups-cli)](https://bundlephobia.com/result?p=@xen-orchestra/backups-cli) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/backups-cli)](https://npmjs.org/package/@xen-orchestra/backups-cli)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/backups-cli):
+
+```
+> npm install --global @xen-orchestra/backups-cli
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/backups-cli/_asyncMap.js

@@ -0,0 +1,7 @@
+const curryRight = require('lodash/curryRight')
+
+module.exports = curryRight((iterable, fn) =>
+  Promise.all(
+    Array.isArray(iterable) ? iterable.map(fn) : Array.from(iterable, fn)
+  )
+)

@xen-orchestra/backups-cli/_composeCommands.js

@@ -0,0 +1,32 @@
+const getopts = require('getopts')
+
+const { version } = require('./package.json')
+
+module.exports = commands =>
+  async function (args, prefix) {
+    const opts = getopts(args, {
+      alias: {
+        help: 'h',
+      },
+      boolean: ['help'],
+      stopEarly: true,
+    })
+
+    const commandName = opts.help || args.length === 0 ? 'help' : args[0]
+    const command = commands[commandName]
+    if (command === undefined) {
+      process.stdout.write(`Usage:
+
+${Object.keys(commands)
+  .filter(command => command !== 'help')
+  .map(command => `    ${prefix} ${command} ${commands[command].usage || ''}`)
+  .join('\n\n')}
+
+xo-backups v${version}
+`)
+      process.exitCode = commandName === 'help' ? 0 : 1
+      return
+    }
+
+    return command.main(args.slice(1), prefix + ' ' + commandName)
+  }

@xen-orchestra/backups-cli/_fs.js

@@ -0,0 +1,58 @@
+const { dirname } = require('path')
+
+const fs = require('promise-toolbox/promisifyAll')(require('fs'))
+module.exports = fs
+
+fs.mktree = async function mkdirp(path) {
+  try {
+    await fs.mkdir(path)
+  } catch (error) {
+    const { code } = error
+    if (code === 'EEXIST') {
+      await fs.readdir(path)
+      return
+    }
+    if (code === 'ENOENT') {
+      await mkdirp(dirname(path))
+      return mkdirp(path)
+    }
+    throw error
+  }
+}
+
+// - easier:
+//   - single param for direct use in `Array#map`
+//   - files are prefixed with directory path
+// - safer: returns empty array if path is missing or not a directory
+fs.readdir2 = path =>
+  fs.readdir(path).then(
+    entries => {
+      entries.forEach((entry, i) => {
+        entries[i] = `${path}/${entry}`
+      })
+
+      return entries
+    },
+    error => {
+      const { code } = error
+      if (code === 'ENOENT') {
+        // do nothing
+      } else if (code === 'ENOTDIR') {
+        console.warn('WARN: readdir(%s)', path, error)
+      } else {
+        throw error
+      }
+      return []
+    }
+  )
+
+fs.symlink2 = async (target, path) => {
+  try {
+    await fs.symlink(target, path)
+  } catch (error) {
+    if (error.code === 'EEXIST' && (await fs.readlink(path)) === target) {
+      return
+    }
+    throw error
+  }
+}

@xen-orchestra/backups-cli/commands/clean-vms.js

@@ -0,0 +1,318 @@
+#!/usr/bin/env node
+
+// assigned when options are parsed by the main function
+let force
+
+// -----------------------------------------------------------------------------
+
+const assert = require('assert')
+const flatten = require('lodash/flatten')
+const getopts = require('getopts')
+const lockfile = require('proper-lockfile')
+const pipe = require('promise-toolbox/pipe')
+const { default: Vhd } = require('vhd-lib')
+const { dirname, resolve } = require('path')
+const { DISK_TYPE_DIFFERENCING } = require('vhd-lib/dist/_constants')
+const { isValidXva } = require('@xen-orchestra/backups/isValidXva')
+
+const asyncMap = require('../_asyncMap')
+const fs = require('../_fs')
+
+const handler = require('@xen-orchestra/fs').getHandler({ url: 'file://' })
+
+// -----------------------------------------------------------------------------
+
+// chain is an array of VHDs from child to parent
+//
+// the whole chain will be merged into parent, parent will be renamed to child
+// and all the others will deleted
+async function mergeVhdChain(chain) {
+  assert(chain.length >= 2)
+
+  const child = chain[0]
+  const parent = chain[chain.length - 1]
+  const children = chain.slice(0, -1).reverse()
+
+  console.warn('Unused parents of VHD', child)
+  chain
+    .slice(1)
+    .reverse()
+    .forEach(parent => {
+      console.warn('  ', parent)
+    })
+  force && console.warn('  merging…')
+  console.warn('')
+  if (force) {
+    // `mergeVhd` does not work with a stream, either
+    // - make it accept a stream
+    // - or create synthetic VHD which is not a stream
+    return console.warn('TODO: implement merge')
+    // await mergeVhd(
+    //   handler,
+    //   parent,
+    //   handler,
+    //   children.length === 1
+    //     ? child
+    //     : await createSyntheticStream(handler, children)
+    // )
+  }
+
+  await Promise.all([
+    force && fs.rename(parent, child),
+    asyncMap(children.slice(0, -1), child => {
+      console.warn('Unused VHD', child)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(child)
+    }),
+  ])
+}
+
+const listVhds = pipe([
+  vmDir => vmDir + '/vdis',
+  fs.readdir2,
+  asyncMap(fs.readdir2),
+  flatten,
+  asyncMap(fs.readdir2),
+  flatten,
+  _ => _.filter(_ => _.endsWith('.vhd')),
+])
+
+async function handleVm(vmDir) {
+  const vhds = new Set()
+  const vhdParents = { __proto__: null }
+  const vhdChildren = { __proto__: null }
+
+  // remove broken VHDs
+  await asyncMap(await listVhds(vmDir), async path => {
+    try {
+      const vhd = new Vhd(handler, path)
+      await vhd.readHeaderAndFooter()
+      vhds.add(path)
+      if (vhd.footer.diskType === DISK_TYPE_DIFFERENCING) {
+        const parent = resolve(dirname(path), vhd.header.parentUnicodeName)
+        vhdParents[path] = parent
+        if (parent in vhdChildren) {
+          const error = new Error(
+            'this script does not support multiple VHD children'
+          )
+          error.parent = parent
+          error.child1 = vhdChildren[parent]
+          error.child2 = path
+          throw error // should we throw?
+        }
+        vhdChildren[parent] = path
+      }
+    } catch (error) {
+      console.warn('Error while checking VHD', path)
+      console.warn('  ', error)
+      if (error != null && error.code === 'ERR_ASSERTION') {
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(path))
+      }
+    }
+  })
+
+  // remove VHDs with missing ancestors
+  {
+    const deletions = []
+
+    // return true if the VHD has been deleted or is missing
+    const deleteIfOrphan = vhd => {
+      const parent = vhdParents[vhd]
+      if (parent === undefined) {
+        return
+      }
+
+      // no longer needs to be checked
+      delete vhdParents[vhd]
+
+      deleteIfOrphan(parent)
+
+      if (!vhds.has(parent)) {
+        vhds.delete(vhd)
+
+        console.warn('Error while checking VHD', vhd)
+        console.warn('  missing parent', parent)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && deletions.push(handler.unlink(vhd))
+      }
+    }
+
+    // > A property that is deleted before it has been visited will not be
+    // > visited later.
+    // >
+    // > -- https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Statements/for...in#Deleted_added_or_modified_properties
+    for (const child in vhdParents) {
+      deleteIfOrphan(child)
+    }
+
+    await Promise.all(deletions)
+  }
+
+  const [jsons, xvas, xvaSums] = await fs
+    .readdir2(vmDir)
+    .then(entries => [
+      entries.filter(_ => _.endsWith('.json')),
+      new Set(entries.filter(_ => _.endsWith('.xva'))),
+      entries.filter(_ => _.endsWith('.xva.cheksum')),
+    ])
+
+  await asyncMap(xvas, async path => {
+    // check is not good enough to delete the file, the best we can do is report
+    // it
+    if (!(await isValidXva(path))) {
+      console.warn('Potential broken XVA', path)
+      console.warn('')
+    }
+  })
+
+  const unusedVhds = new Set(vhds)
+  const unusedXvas = new Set(xvas)
+
+  // compile the list of unused XVAs and VHDs, and remove backup metadata which
+  // reference a missing XVA/VHD
+  await asyncMap(jsons, async json => {
+    const metadata = JSON.parse(await fs.readFile(json))
+    const { mode } = metadata
+    if (mode === 'full') {
+      const linkedXva = resolve(vmDir, metadata.xva)
+
+      if (xvas.has(linkedXva)) {
+        unusedXvas.delete(linkedXva)
+      } else {
+        console.warn('Error while checking backup', json)
+        console.warn('  missing file', linkedXva)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    } else if (mode === 'delta') {
+      const linkedVhds = (() => {
+        const { vhds } = metadata
+        return Object.keys(vhds).map(key => resolve(vmDir, vhds[key]))
+      })()
+
+      // FIXME: find better approach by keeping as much of the backup as
+      // possible (existing disks) even if one disk is missing
+      if (linkedVhds.every(_ => vhds.has(_))) {
+        linkedVhds.forEach(_ => unusedVhds.delete(_))
+      } else {
+        console.warn('Error while checking backup', json)
+        const missingVhds = linkedVhds.filter(_ => !vhds.has(_))
+        console.warn(
+          '  %i/%i missing VHDs',
+          missingVhds.length,
+          linkedVhds.length
+        )
+        missingVhds.forEach(vhd => {
+          console.warn('  ', vhd)
+        })
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    }
+  })
+
+  // TODO: parallelize by vm/job/vdi
+  const unusedVhdsDeletion = []
+  {
+    // VHD chains (as list from child to ancestor) to merge indexed by last
+    // ancestor
+    const vhdChainsToMerge = { __proto__: null }
+
+    const toCheck = new Set(unusedVhds)
+
+    const getUsedChildChainOrDelete = vhd => {
+      if (vhd in vhdChainsToMerge) {
+        const chain = vhdChainsToMerge[vhd]
+        delete vhdChainsToMerge[vhd]
+        return chain
+      }
+
+      if (!unusedVhds.has(vhd)) {
+        return [vhd]
+      }
+
+      // no longer needs to be checked
+      toCheck.delete(vhd)
+
+      const child = vhdChildren[vhd]
+      if (child !== undefined) {
+        const chain = getUsedChildChainOrDelete(child)
+        if (chain !== undefined) {
+          chain.push(vhd)
+          return chain
+        }
+      }
+
+      console.warn('Unused VHD', vhd)
+      force && console.warn('  deleting…')
+      console.warn('')
+      force && unusedVhdsDeletion.push(handler.unlink(vhd))
+    }
+
+    toCheck.forEach(vhd => {
+      vhdChainsToMerge[vhd] = getUsedChildChainOrDelete(vhd)
+    })
+
+    Object.keys(vhdChainsToMerge).forEach(key => {
+      const chain = vhdChainsToMerge[key]
+      if (chain !== undefined) {
+        unusedVhdsDeletion.push(mergeVhdChain(chain))
+      }
+    })
+  }
+
+  await Promise.all([
+    unusedVhdsDeletion,
+    asyncMap(unusedXvas, path => {
+      console.warn('Unused XVA', path)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(path)
+    }),
+    asyncMap(xvaSums, path => {
+      // no need to handle checksums for XVAs deleted by the script, they will be handled by `unlink()`
+      if (!xvas.has(path.slice(0, -'.checksum'.length))) {
+        console.warn('Unused XVA checksum', path)
+        force && console.warn('  deleting…')
+        console.warn('')
+        return force && handler.unlink(path)
+      }
+    }),
+  ])
+}
+
+// -----------------------------------------------------------------------------
+
+module.exports = async function main(args) {
+  const opts = getopts(args, {
+    alias: {
+      force: 'f',
+    },
+    boolean: ['force'],
+    default: {
+      force: false,
+    },
+  })
+
+  ;({ force } = opts)
+  await asyncMap(opts._, async vmDir => {
+    vmDir = resolve(vmDir)
+
+    // TODO: implement this in `xo-server`, not easy because not compatible with
+    // `@xen-orchestra/fs`.
+    const release = await lockfile.lock(vmDir)
+    try {
+      await handleVm(vmDir)
+    } catch (error) {
+      console.error('handleVm', vmDir, error)
+    } finally {
+      await release()
+    }
+  })
+}

@xen-orchestra/backups-cli/commands/create-symlink-index.js

@@ -0,0 +1,28 @@
+const filenamify = require('filenamify')
+const get = require('lodash/get')
+const { dirname, join, relative } = require('path')
+
+const asyncMap = require('../_asyncMap')
+const { mktree, readdir2, readFile, symlink2 } = require('../_fs')
+
+module.exports = async function createSymlinkIndex([backupDir, fieldPath]) {
+  const indexDir = join(backupDir, 'indexes', filenamify(fieldPath))
+  await mktree(indexDir)
+
+  await asyncMap(await readdir2(backupDir), async vmDir =>
+    asyncMap(
+      (await readdir2(vmDir)).filter(_ => _.endsWith('.json')),
+      async json => {
+        const metadata = JSON.parse(await readFile(json))
+        const value = get(metadata, fieldPath)
+        if (value !== undefined) {
+          const target = relative(indexDir, dirname(json))
+          const path = join(indexDir, filenamify(String(value)))
+          await symlink2(target, path).catch(error => {
+            console.warn('symlink(%s, %s)', target, path, error)
+          })
+        }
+      }
+    )
+  )
+}

@xen-orchestra/backups-cli/index.js

@@ -0,0 +1,19 @@
+#!/usr/bin/env node
+
+require('./_composeCommands')({
+  'clean-vms': {
+    get main() {
+      return require('./commands/clean-vms')
+    },
+    usage: '[--force] xo-vm-backups/*',
+  },
+  'create-symlink-index': {
+    get main() {
+      return require('./commands/create-symlink-index')
+    },
+    usage: 'xo-vm-backups <field path>',
+  },
+})(process.argv.slice(2), 'xo-backups').catch(error => {
+  console.error('main', error)
+  process.exitCode = 1
+})

@xen-orchestra/backups-cli/package.json

@@ -0,0 +1,41 @@
+{
+  "private": false,
+  "bin": {
+    "xo-backups": "index.js"
+  },
+  "preferGlobal": true,
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "dependencies": {
+    "@xen-orchestra/backups": "^0.1.1",
+    "@xen-orchestra/fs": "^0.10.4",
+    "filenamify": "^4.1.0",
+    "getopts": "^2.2.5",
+    "lodash": "^4.17.15",
+    "promise-toolbox": "^0.15.0",
+    "proper-lockfile": "^4.1.1",
+    "vhd-lib": "^0.7.2"
+  },
+  "engines": {
+    "node": ">=7.10.1"
+  },
+  "files": [
+    "commands",
+    "*.js"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/backups-cli",
+  "name": "@xen-orchestra/backups-cli",
+  "repository": {
+    "directory": "@xen-orchestra/backups-cli",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "version": "0.0.0",
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/backups/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/backups
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/backups)](https://npmjs.org/package/@xen-orchestra/backups) ![License](https://badgen.net/npm/license/@xen-orchestra/backups) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/backups)](https://bundlephobia.com/result?p=@xen-orchestra/backups) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/backups)](https://npmjs.org/package/@xen-orchestra/backups)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/backups):
+
+```
+> npm install --save @xen-orchestra/backups
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/backups/extractIdsFromSimplePattern.js

@@ -0,0 +1,30 @@
+function extractIdsFromSimplePattern(pattern) {
+  if (pattern === undefined) {
+    return []
+  }
+
+  if (pattern !== null && typeof pattern === 'object') {
+    let keys = Object.keys(pattern)
+
+    if (keys.length === 1 && keys[0] === 'id') {
+      pattern = pattern.id
+      if (typeof pattern === 'string') {
+        return [pattern]
+      }
+      if (pattern !== null && typeof pattern === 'object') {
+        keys = Object.keys(pattern)
+        if (
+          keys.length === 1 &&
+          keys[0] === '__or' &&
+          Array.isArray((pattern = pattern.__or)) &&
+          pattern.every(_ => typeof _ === 'string')
+        ) {
+          return pattern
+        }
+      }
+    }
+  }
+
+  throw new Error('invalid pattern')
+}
+exports.extractIdsFromSimplePattern = extractIdsFromSimplePattern

@xen-orchestra/backups/filenameDate.js

@@ -0,0 +1,6 @@
+const { utcFormat, utcParse } = require('d3-time-format')
+
+// Format a date in ISO 8601 in a safe way to be used in filenames
+// (even on Windows).
+exports.formatFilenameDate = utcFormat('%Y%m%dT%H%M%SZ')
+exports.parseFilenameDate = utcParse('%Y%m%dT%H%M%SZ')

@xen-orchestra/backups/getOldEntries.js

@@ -0,0 +1,7 @@
+// returns all entries but the last retention-th
+exports.getOldEntries = (retention, entries) =>
+  entries === undefined
+    ? []
+    : retention > 0
+    ? entries.slice(0, -retention)
+    : entries

@xen-orchestra/backups/isValidXva.js

@@ -0,0 +1,65 @@
+const assert = require('assert')
+const fs = require('fs-extra')
+
+const isGzipFile = async fd => {
+  // https://tools.ietf.org/html/rfc1952.html#page-5
+  const magicNumber = Buffer.allocUnsafe(2)
+  assert.strictEqual(
+    (await fs.read(fd, magicNumber, 0, magicNumber.length, 0)).bytesRead,
+    magicNumber.length
+  )
+  return magicNumber[0] === 31 && magicNumber[1] === 139
+}
+
+// TODO: better check?
+//
+// our heuristic is not good enough, there has been some false positives
+// (detected as invalid by us but valid by `tar` and imported with success),
+// either THOUGH THEY MAY HAVE BEEN COMPRESSED FILES:
+// - these files were normal but the check is incorrect
+// - these files were invalid but without data loss
+// - these files were invalid but with silent data loss
+//
+// maybe reading the end of the file looking for a file named
+// /^Ref:\d+/\d+\.checksum$/ and then validating the tar structure from it
+//
+// https://github.com/npm/node-tar/issues/234#issuecomment-538190295
+const isValidTar = async (size, fd) => {
+  if (size <= 1024 || size % 512 !== 0) {
+    return false
+  }
+
+  const buf = Buffer.allocUnsafe(1024)
+  assert.strictEqual(
+    (await fs.read(fd, buf, 0, buf.length, size - buf.length)).bytesRead,
+    buf.length
+  )
+  return buf.every(_ => _ === 0)
+}
+
+// TODO: find an heuristic for compressed files
+const isValidXva = async path => {
+  try {
+    const fd = await fs.open(path, 'r')
+    try {
+      const { size } = await fs.fstat(fd)
+      if (size < 20) {
+        // neither a valid gzip not tar
+        return false
+      }
+
+      return (await isGzipFile(fd))
+        ? true // gzip files cannot be validated at this time
+        : await isValidTar(size, fd)
+    } finally {
+      fs.close(fd).catch(noop)
+    }
+  } catch (error) {
+    // never throw, log and report as valid to avoid side effects
+    console.error('isValidXva', path, error)
+    return true
+  }
+}
+exports.isValidXva = isValidXva
+
+const noop = Function.prototype

@xen-orchestra/backups/package.json

@@ -0,0 +1,27 @@
+{
+  "private": false,
+  "name": "@xen-orchestra/backups",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/backups",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/backups",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "dependencies": {
+    "d3-time-format": "^2.2.3",
+    "fs-extra": "^9.0.0"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/backups/watchStreamSize.js

@@ -0,0 +1,11 @@
+exports.watchStreamSize = stream => {
+  const container = { size: 0 }
+  const isPaused = stream.isPaused()
+  stream.on('data', data => {
+    container.size += data.length
+  })
+  if (isPaused) {
+    stream.pause()
+  }
+  return container
+}

@xen-orchestra/cr-seed-cli/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/cr-seed-cli
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/cr-seed-cli)](https://npmjs.org/package/@xen-orchestra/cr-seed-cli) ![License](https://badgen.net/npm/license/@xen-orchestra/cr-seed-cli) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/cr-seed-cli)](https://bundlephobia.com/result?p=@xen-orchestra/cr-seed-cli) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/cr-seed-cli)](https://npmjs.org/package/@xen-orchestra/cr-seed-cli)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/cr-seed-cli):
+
+```
+> npm install --global @xen-orchestra/cr-seed-cli
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/cr-seed-cli/index.js

@@ -5,7 +5,7 @@ const { NULL_REF, Xapi } = require('xen-api')
 
 const pkg = require('./package.json')
 
-Xapi.prototype.getVmDisks = async function(vm) {
+Xapi.prototype.getVmDisks = async function (vm) {
   const disks = { __proto__: null }
   await Promise.all([
     ...vm.VBDs.map(async vbdRef => {

@xen-orchestra/cr-seed-cli/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/cr-seed-cli",
   "version": "0.2.0",
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/cr-seed-cli",
@@ -14,11 +15,17 @@
   "bin": {
     "xo-cr-seed": "./index.js"
   },
+  "preferGlobal": true,
   "dependencies": {
     "golike-defer": "^0.4.1",
-    "xen-api": "^0.27.1"
+    "xen-api": "^0.29.0"
   },
   "scripts": {
     "postversion": "npm publish"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/cron/README.md

@@ -1,4 +1,8 @@
-# @xen-orchestra/cron [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/cron
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/cron)](https://npmjs.org/package/@xen-orchestra/cron) ![License](https://badgen.net/npm/license/@xen-orchestra/cron) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/cron)](https://bundlephobia.com/result?p=@xen-orchestra/cron) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/cron)](https://npmjs.org/package/@xen-orchestra/cron)
 
 > Focused, well maintained, cron parser/scheduler
 
@@ -10,13 +14,14 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/cron)
 > npm install --save @xen-orchestra/cron
 ```
 
+## Usage
+
 ### Pattern syntax
 
 ```
 <minute> <hour> <day of month> <month> <day of week>
 ```
 
-
 Each entry can be:
 
 - a single value
@@ -29,12 +34,12 @@ A wildcard (`*`) can be used as a shortcut for the whole range
 Step values can be used in conjunctions with ranges. For instance,
 `1-7/2` is the same as `1,3,5,7`.
 
-| Field            | Allowed values |
-|------------------|----------------|
-| minute           | 0-59           |
-| hour             | 0-23           |
-| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …) |
-| month            | 0-11           |
+| Field            | Allowed values                                                     |
+| ---------------- | ------------------------------------------------------------------ |
+| minute           | 0-59                                                               |
+| hour             | 0-23                                                               |
+| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …)                           |
+| month            | 0-11                                                               |
 | day of week      | 0-7 (0 and 7 both mean Sunday) or 3-letter names (`mon`, `tue`, …) |
 
 > Note: the month range is 0-11 to be compatible with
@@ -110,28 +115,9 @@ job.start()
 job.stop()
 ```
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
-```
-
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
@@ -142,4 +128,4 @@ You may:
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/cron/USAGE.md

@@ -0,0 +1,98 @@
+### Pattern syntax
+
+```
+<minute> <hour> <day of month> <month> <day of week>
+```
+
+Each entry can be:
+
+- a single value
+- a range (`0-23` or `*/2`)
+- a list of values/ranges (`1,8-12`)
+
+A wildcard (`*`) can be used as a shortcut for the whole range
+(`first-last`).
+
+Step values can be used in conjunctions with ranges. For instance,
+`1-7/2` is the same as `1,3,5,7`.
+
+| Field            | Allowed values                                                     |
+| ---------------- | ------------------------------------------------------------------ |
+| minute           | 0-59                                                               |
+| hour             | 0-23                                                               |
+| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …)                           |
+| month            | 0-11                                                               |
+| day of week      | 0-7 (0 and 7 both mean Sunday) or 3-letter names (`mon`, `tue`, …) |
+
+> Note: the month range is 0-11 to be compatible with
+> [cron](https://github.com/kelektiv/node-cron), it does not appear to
+> be very standard though.
+
+### API
+
+`createSchedule(pattern: string, zone: string = 'utc'): Schedule`
+
+> Create a new schedule.
+
+- `pattern`: the pattern to use, see [the syntax](#pattern-syntax)
+- `zone`: the timezone to use, use `'local'` for the local timezone
+
+```js
+import { createSchedule } from '@xen-orchestra/cron'
+
+const schedule = createSchedule('0 0 * * sun', 'America/New_York')
+```
+
+`Schedule#createJob(fn: Function): Job`
+
+> Create a new job from this schedule.
+
+- `fn`: function to execute, if it returns a promise, it will be
+  awaited before scheduling the next run.
+
+```js
+const job = schedule.createJob(() => {
+  console.log(new Date())
+})
+```
+
+`Schedule#next(n: number): Array<Date>`
+
+> Returns the next dates matching this schedule.
+
+- `n`: number of dates to return
+
+```js
+schedule.next(2)
+// [ 2018-02-11T05:00:00.000Z, 2018-02-18T05:00:00.000Z ]
+```
+
+`Schedule#startJob(fn: Function): () => void`
+
+> Start a new job from this schedule and return a function to stop it.
+
+- `fn`: function to execute, if it returns a promise, it will be
+  awaited before scheduling the next run.
+
+```js
+const stopJob = schedule.startJob(() => {
+  console.log(new Date())
+})
+stopJob()
+```
+
+`Job#start(): void`
+
+> Start this job.
+
+```js
+job.start()
+```
+
+`Job#stop(): void`
+
+> Stop this job.
+
+```js
+job.stop()
+```

@xen-orchestra/cron/package.json

@@ -1,6 +1,7 @@
 {
+  "private": false,
   "name": "@xen-orchestra/cron",
-  "version": "1.0.3",
+  "version": "1.0.6",
   "license": "ISC",
   "description": "Focused, well maintained, cron parser/scheduler",
   "keywords": [
@@ -22,8 +23,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@isonoe.net"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -46,8 +47,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/cron/src/index.js

@@ -7,7 +7,21 @@ const MAX_DELAY = 2 ** 31 - 1
 
 class Job {
   constructor(schedule, fn) {
+    let scheduledDate
     const wrapper = () => {
+      const now = Date.now()
+      if (scheduledDate > now) {
+        // we're early, delay
+        //
+        // no need to check _isEnabled, we're just delaying the existing timeout
+        //
+        // see https://github.com/vatesfr/xen-orchestra/issues/4625
+        this._timeout = setTimeout(wrapper, scheduledDate - now)
+        return
+      }
+
+      this._isRunning = true
+
       let result
       try {
         result = fn()
@@ -22,23 +36,36 @@ class Job {
       }
     }
     const scheduleNext = () => {
-      const delay = schedule._nextDelay()
-      this._timeout =
-        delay < MAX_DELAY
-          ? setTimeout(wrapper, delay)
-          : setTimeout(scheduleNext, MAX_DELAY)
+      this._isRunning = false
+
+      if (this._isEnabled) {
+        const now = schedule._createDate()
+        scheduledDate = +next(schedule._schedule, now)
+        const delay = scheduledDate - now
+        this._timeout =
+          delay < MAX_DELAY
+            ? setTimeout(wrapper, delay)
+            : setTimeout(scheduleNext, MAX_DELAY)
+      }
     }
 
+    this._isEnabled = false
+    this._isRunning = false
     this._scheduleNext = scheduleNext
     this._timeout = undefined
   }
 
   start() {
     this.stop()
-    this._scheduleNext()
+
+    this._isEnabled = true
+    if (!this._isRunning) {
+      this._scheduleNext()
+    }
   }
 
   stop() {
+    this._isEnabled = false
     clearTimeout(this._timeout)
   }
 }
@@ -68,11 +95,6 @@ class Schedule {
     return dates
   }
 
-  _nextDelay() {
-    const now = this._createDate()
-    return next(this._schedule, now) - now
-  }
-
   startJob(fn) {
     const job = this.createJob(fn)
     job.start()

@xen-orchestra/cron/src/index.spec.js

@@ -0,0 +1,78 @@
+/* eslint-env jest */
+
+import { createSchedule } from './'
+
+const wrap = value => () => value
+
+describe('issues', () => {
+  let originalDateNow
+  beforeAll(() => {
+    originalDateNow = Date.now
+  })
+  afterAll(() => {
+    Date.now = originalDateNow
+    originalDateNow = undefined
+  })
+
+  test('stop during async execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const schedule = createSchedule('* * * * *')
+    const job = schedule.createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+
+    resolve()
+    await promise
+
+    jest.runAllTimers()
+    expect(nCalls).toBe(1)
+  })
+
+  test('stop then start during async job execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const schedule = createSchedule('* * * * *')
+    const job = schedule.createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+    job.start()
+
+    resolve()
+    await promise
+
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+    expect(nCalls).toBe(2)
+  })
+})

@xen-orchestra/defined/README.md

@@ -1,49 +1,28 @@
-# ${pkg.name} [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/defined
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/defined)](https://npmjs.org/package/@xen-orchestra/defined) ![License](https://badgen.net/npm/license/@xen-orchestra/defined) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/defined)](https://bundlephobia.com/result?p=@xen-orchestra/defined) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/defined)](https://npmjs.org/package/@xen-orchestra/defined)
 
 ## Install
 
-Installation of the [npm package](https://npmjs.org/package/${pkg.name}):
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/defined):
 
 ```
-> npm install --save ${pkg.name}
-```
-
-## Usage
-
-**TODO**
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+> npm install --save @xen-orchestra/defined
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/defined/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/defined",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -34,8 +35,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/emit-async/README.md

@@ -1,6 +1,8 @@
-# @xen-orchestra/emit-async [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/emit-async
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/emit-async)](https://npmjs.org/package/@xen-orchestra/emit-async) ![License](https://badgen.net/npm/license/@xen-orchestra/emit-async) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/emit-async)](https://bundlephobia.com/result?p=@xen-orchestra/emit-async) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/emit-async)](https://npmjs.org/package/@xen-orchestra/emit-async)
 
 ## Install
 
@@ -29,43 +31,27 @@ await ee.emitAsync('start')
 
 // by default, it will rejects as soon as one listener reject, you can customise
 // error handling though:
-await ee.emitAsync({
-  onError (error) {
-    console.warn(error)
-  }
-}, 'start')
-```
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+await ee.emitAsync(
+  {
+    onError(error) {
+      console.warn(error)
+    },
+  },
+  'start'
+)
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/emit-async/USAGE.md

@@ -0,0 +1,26 @@
+```js
+import EE from 'events'
+import emitAsync from '@xen-orchestra/emit-async'
+
+const ee = new EE()
+ee.emitAsync = emitAsync
+
+ee.on('start', async function () {
+  // whatever
+})
+
+// similar to EventEmmiter#emit() but returns a promise which resolves when all
+// listeners have resolved
+await ee.emitAsync('start')
+
+// by default, it will rejects as soon as one listener reject, you can customise
+// error handling though:
+await ee.emitAsync(
+  {
+    onError(error) {
+      console.warn(error)
+    },
+  },
+  'start'
+)
+```

@xen-orchestra/emit-async/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/emit-async",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -33,8 +34,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/fs/README.md

@@ -0,0 +1,30 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/fs
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/fs)](https://npmjs.org/package/@xen-orchestra/fs) ![License](https://badgen.net/npm/license/@xen-orchestra/fs) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/fs)](https://bundlephobia.com/result?p=@xen-orchestra/fs) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/fs)](https://npmjs.org/package/@xen-orchestra/fs)
+
+> The File System for Xen Orchestra backups.
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/fs):
+
+```
+> npm install --global @xen-orchestra/fs
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/fs/package.json

@@ -1,7 +1,8 @@
 {
+  "private": false,
   "name": "@xen-orchestra/fs",
-  "version": "0.10.1",
-  "license": "AGPL-3.0",
+  "version": "0.10.4",
+  "license": "AGPL-3.0-or-later",
   "description": "The File System for Xen Orchestra backups.",
   "keywords": [],
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/fs",
@@ -18,19 +19,19 @@
     "dist/"
   ],
   "engines": {
-    "node": ">=6"
+    "node": ">=8.10"
   },
   "dependencies": {
-    "@marsaud/smb2": "^0.14.0",
-    "@sindresorhus/df": "^2.1.0",
+    "@marsaud/smb2": "^0.15.0",
+    "@sindresorhus/df": "^3.1.1",
     "@xen-orchestra/async-map": "^0.0.0",
     "decorator-synchronized": "^0.5.0",
-    "execa": "^1.0.0",
-    "fs-extra": "^8.0.1",
-    "get-stream": "^4.0.0",
+    "execa": "^4.0.2",
+    "fs-extra": "^9.0.0",
+    "get-stream": "^5.1.0",
     "limit-concurrency-decorator": "^0.4.0",
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0",
+    "promise-toolbox": "^0.15.0",
     "readable-stream": "^3.0.6",
     "through2": "^3.0.0",
     "tmp": "^0.1.0",
@@ -46,10 +47,10 @@
     "@babel/preset-flow": "^7.0.0",
     "async-iterator-to-stream": "^1.1.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^7.0.2",
     "dotenv": "^8.0.0",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -59,5 +60,9 @@
     "predev": "yarn run clean",
     "prepare": "yarn run build",
     "postversion": "npm publish"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/fs/src/_mount.js

@@ -31,10 +31,7 @@ export default class MountHandler extends LocalHandler {
     }
     this._realPath = join(
       mountsDir,
-      remote.id ||
-        Math.random()
-          .toString(36)
-          .slice(2)
+      remote.id || Math.random().toString(36).slice(2)
     )
   }
 
@@ -75,9 +72,12 @@ export default class MountHandler extends LocalHandler {
 
     try {
       const { type, device, options, env } = this._params
+
+      // Linux mount is more flexible in which order the mount arguments appear.
+      // But FreeBSD requires this order of the arguments.
       await this._execa(
         'mount',
-        ['-t', type, device, realPath, '-o', options],
+        ['-o', options, '-t', type, device, realPath],
         {
           env: {
             LANG: 'C',

@xen-orchestra/fs/src/abstract.js

@@ -118,7 +118,7 @@ export default class RemoteHandlerAbstract {
   }
 
   async closeFile(fd: FileDescriptor): Promise<void> {
-    await timeout.call(this._closeFile(fd.fd), this._timeout)
+    await this.__closeFile(fd)
   }
 
   async createOutputStream(
@@ -283,30 +283,15 @@ export default class RemoteHandlerAbstract {
   }
 
   async mkdir(dir: string): Promise<void> {
-    dir = normalizePath(dir)
-    try {
-      await this._mkdir(dir)
-    } catch (error) {
-      if (error == null || error.code !== 'EEXIST') {
-        throw error
-      }
-
-      // this operation will throw if it's not already a directory
-      await this._list(dir)
-    }
+    await this.__mkdir(normalizePath(dir))
   }
 
   async mktree(dir: string): Promise<void> {
     await this._mktree(normalizePath(dir))
   }
 
-  async openFile(path: string, flags: string): Promise<FileDescriptor> {
-    path = normalizePath(path)
-
-    return {
-      fd: await timeout.call(this._openFile(path, flags), this._timeout),
-      path,
-    }
+  openFile(path: string, flags: string): Promise<FileDescriptor> {
+    return this.__openFile(path, flags)
   }
 
   async outputFile(
@@ -389,7 +374,7 @@ export default class RemoteHandlerAbstract {
   async test(): Promise<Object> {
     const SIZE = 1024 * 1024 * 10
     const testFileName = normalizePath(`${Date.now()}.test`)
-    const data = await fromCallback(cb => randomBytes(SIZE, cb))
+    const data = await fromCallback(randomBytes, SIZE)
     let step = 'write'
     try {
       const writeStart = process.hrtime()
@@ -455,6 +440,34 @@ export default class RemoteHandlerAbstract {
     await this._writeFile(normalizePath(file), data, { flags })
   }
 
+  // Methods that can be called by private methods to avoid parallel limit on public methods
+
+  async __closeFile(fd: FileDescriptor): Promise<void> {
+    await timeout.call(this._closeFile(fd.fd), this._timeout)
+  }
+
+  async __mkdir(dir: string): Promise<void> {
+    try {
+      await this._mkdir(dir)
+    } catch (error) {
+      if (error == null || error.code !== 'EEXIST') {
+        throw error
+      }
+
+      // this operation will throw if it's not already a directory
+      await this._list(dir)
+    }
+  }
+
+  async __openFile(path: string, flags: string): Promise<FileDescriptor> {
+    path = normalizePath(path)
+
+    return {
+      fd: await timeout.call(this._openFile(path, flags), this._timeout),
+      path,
+    }
+  }
+
   // Methods that can be implemented by inheriting classes
 
   async _closeFile(fd: mixed): Promise<void> {
@@ -503,7 +516,7 @@ export default class RemoteHandlerAbstract {
 
   async _mktree(dir: string): Promise<void> {
     try {
-      return await this.mkdir(dir)
+      return await this.__mkdir(dir)
     } catch (error) {
       if (error.code !== 'ENOENT') {
         throw error
@@ -586,13 +599,13 @@ export default class RemoteHandlerAbstract {
   async _write(file: File, buffer: Buffer, position: number): Promise<void> {
     const isPath = typeof file === 'string'
     if (isPath) {
-      file = await this.openFile(file, 'r+')
+      file = await this.__openFile(file, 'r+')
     }
     try {
       return await this._writeFd(file, buffer, position)
     } finally {
       if (isPath) {
-        await this.closeFile(file)
+        await this.__closeFile(file)
       }
     }
   }
@@ -635,7 +648,7 @@ function createPrefixWrapperMethods() {
       return
     }
 
-    descriptor.value = function() {
+    descriptor.value = function () {
       let path
       if (arguments.length !== 0 && typeof (path = arguments[0]) === 'string') {
         arguments[0] = this._resolve(path)

@xen-orchestra/fs/src/fs.spec.js

@@ -28,7 +28,7 @@ const unsecureRandomBytes = n => {
 
 const TEST_DATA_LEN = 1024
 const TEST_DATA = unsecureRandomBytes(TEST_DATA_LEN)
-const createTestDataStream = asyncIteratorToStream(function*() {
+const createTestDataStream = asyncIteratorToStream(function* () {
   yield TEST_DATA
 })
 
@@ -86,7 +86,7 @@ handlers.forEach(url => {
     describe('#createOutputStream()', () => {
       it('creates parent dir if missing', async () => {
         const stream = await handler.createOutputStream('dir/file')
-        await fromCallback(cb => pipeline(createTestDataStream(), stream, cb))
+        await fromCallback(pipeline, createTestDataStream(), stream)
         await expect(await handler.readFile('dir/file')).toEqual(TEST_DATA)
       })
     })
@@ -106,7 +106,7 @@ handlers.forEach(url => {
     describe('#createWriteStream()', () => {
       testWithFileDescriptor('file', 'wx', async ({ file, flags }) => {
         const stream = await handler.createWriteStream(file, { flags })
-        await fromCallback(cb => pipeline(createTestDataStream(), stream, cb))
+        await fromCallback(pipeline, createTestDataStream(), stream)
         await expect(await handler.readFile('file')).toEqual(TEST_DATA)
       })
 
@@ -219,6 +219,12 @@ handlers.forEach(url => {
         const error = await rejectionOf(handler.outputFile('file', ''))
         expect(error.code).toBe('EEXIST')
       })
+
+      it("shouldn't timeout in case of the respect of the parallel execution restriction", async () => {
+        const handler = getHandler({ url }, { maxParallelOperations: 1 })
+        await handler.sync()
+        await handler.outputFile(`xo-fs-tests-${Date.now()}/test`, '')
+      }, 40)
     })
 
     describe('#read()', () => {

@xen-orchestra/fs/src/local.js

@@ -47,8 +47,19 @@ export default class LocalHandler extends RemoteHandlerAbstract {
     })
   }
 
-  _getInfo() {
-    return df.file(this._getFilePath('/'))
+  async _getInfo() {
+    // df.file() resolves with an object with the following properties:
+    // filesystem, type, size, used, available, capacity and mountpoint.
+    // size, used, available and capacity may be `NaN` so we remove any `NaN`
+    // value from the object.
+    const info = await df.file(this._getFilePath('/'))
+    Object.keys(info).forEach(key => {
+      if (Number.isNaN(info[key])) {
+        delete info[key]
+      }
+    })
+
+    return info
   }
 
   async _getSize(file) {

@xen-orchestra/log/README.md

@@ -1,6 +1,8 @@
-# @xen-orchestra/log [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/log
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/log)](https://npmjs.org/package/@xen-orchestra/log) ![License](https://badgen.net/npm/license/@xen-orchestra/log) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/log)](https://bundlephobia.com/result?p=@xen-orchestra/log) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/log)](https://npmjs.org/package/@xen-orchestra/log)
 
 ## Install
 
@@ -15,7 +17,7 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/log):
 Everywhere something should be logged:
 
 ```js
-import createLogger from '@xen-orchestra/log'
+import { createLogger } from '@xen-orchestra/log'
 
 const log = createLogger('my-module')
 
@@ -42,6 +44,7 @@ log.error('could not join server', {
 Then, at application level, configure the logs are handled:
 
 ```js
+import { createLogger } from '@xen-orchestra/log'
 import { configure, catchGlobalErrors } from '@xen-orchestra/log/configure'
 import transportConsole from '@xen-orchestra/log/transports/console'
 import transportEmail from '@xen-orchestra/log/transports/email'
@@ -50,13 +53,10 @@ const transport = transportEmail({
   service: 'gmail',
   auth: {
     user: 'jane.smith@gmail.com',
-    pass: 'H&NbECcpXF|pyXe#%ZEb'
+    pass: 'H&NbECcpXF|pyXe#%ZEb',
   },
   from: 'jane.smith@gmail.com',
-  to: [
-    'jane.smith@gmail.com',
-    'sam.doe@yahoo.com'
-  ]
+  to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
 })
 
 configure([
@@ -66,19 +66,19 @@ configure([
     // matched against the namespace of the logs
     filter: process.env.DEBUG,
 
-    transport: transportConsole()
+    transport: transportConsole(),
   },
   {
     // only levels >= warn
     level: 'warn',
 
-    transport
-  }
+    transport,
+  },
 ])
 
 // send all global errors (uncaught exceptions, warnings, unhandled rejections)
-// to this transport
-catchGlobalErrors(transport)
+// to this logger
+catchGlobalErrors(createLogger('app'))
 ```
 
 ### Transports
@@ -104,18 +104,17 @@ Configuration:
 ```js
 import transportEmail from '@xen-orchestra/log/transports/email'
 
-configure(transportEmail({
-  service: 'gmail',
-  auth: {
-    user: 'jane.smith@gmail.com',
-    pass: 'H&NbECcpXF|pyXe#%ZEb'
-  },
-  from: 'jane.smith@gmail.com',
-  to: [
-    'jane.smith@gmail.com',
-    'sam.doe@yahoo.com'
-  ]
-}))
+configure(
+  transportEmail({
+    service: 'gmail',
+    auth: {
+      user: 'jane.smith@gmail.com',
+      pass: 'H&NbECcpXF|pyXe#%ZEb',
+    },
+    from: 'jane.smith@gmail.com',
+    to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+  })
+)
 ```
 
 #### Syslog
@@ -138,36 +137,17 @@ configure(transportSyslog())
 configure(transportSyslog('tcp://syslog.company.lan'))
 ```
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
-```
-
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](https://github.com/vatesfr/xo-web/issues/)
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/log/USAGE.md

@@ -0,0 +1,122 @@
+Everywhere something should be logged:
+
+```js
+import { createLogger } from '@xen-orchestra/log'
+
+const log = createLogger('my-module')
+
+log.debug('only useful for debugging')
+log.info('this information is relevant to the user')
+log.warn('something went wrong but did not prevent current action')
+log.error('something went wrong')
+log.fatal('service/app is going down')
+
+// you can add contextual info
+log.debug('new API request', {
+  method: 'foo',
+  params: [ 'bar', 'baz' ]
+  user: 'qux'
+})
+
+// by convention, errors go into the `error` field
+log.error('could not join server', {
+  error,
+  server: 'example.org',
+})
+```
+
+Then, at application level, configure the logs are handled:
+
+```js
+import { createLogger } from '@xen-orchestra/log'
+import { configure, catchGlobalErrors } from '@xen-orchestra/log/configure'
+import transportConsole from '@xen-orchestra/log/transports/console'
+import transportEmail from '@xen-orchestra/log/transports/email'
+
+const transport = transportEmail({
+  service: 'gmail',
+  auth: {
+    user: 'jane.smith@gmail.com',
+    pass: 'H&NbECcpXF|pyXe#%ZEb',
+  },
+  from: 'jane.smith@gmail.com',
+  to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+})
+
+configure([
+  {
+    // if filter is a string, then it is pattern
+    // (https://github.com/visionmedia/debug#wildcards) which is
+    // matched against the namespace of the logs
+    filter: process.env.DEBUG,
+
+    transport: transportConsole(),
+  },
+  {
+    // only levels >= warn
+    level: 'warn',
+
+    transport,
+  },
+])
+
+// send all global errors (uncaught exceptions, warnings, unhandled rejections)
+// to this logger
+catchGlobalErrors(createLogger('app'))
+```
+
+### Transports
+
+#### Console
+
+```js
+import transportConsole from '@xen-orchestra/log/transports/console'
+
+configure(transportConsole())
+```
+
+#### Email
+
+Optional dependency:
+
+```
+> yarn add nodemailer pretty-format
+```
+
+Configuration:
+
+```js
+import transportEmail from '@xen-orchestra/log/transports/email'
+
+configure(
+  transportEmail({
+    service: 'gmail',
+    auth: {
+      user: 'jane.smith@gmail.com',
+      pass: 'H&NbECcpXF|pyXe#%ZEb',
+    },
+    from: 'jane.smith@gmail.com',
+    to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+  })
+)
+```
+
+#### Syslog
+
+Optional dependency:
+
+```
+> yarn add split-host syslog-client
+```
+
+Configuration:
+
+```js
+import transportSyslog from '@xen-orchestra/log/transports/syslog'
+
+// By default, log to udp://localhost:514
+configure(transportSyslog())
+
+// But TCP, a different host, or a different port can be used
+configure(transportSyslog('tcp://syslog.company.lan'))
+```

@xen-orchestra/log/package.json

@@ -1,6 +1,7 @@
 {
+  "private": false,
   "name": "@xen-orchestra/log",
-  "version": "0.1.4",
+  "version": "0.2.0",
   "license": "ISC",
   "description": "",
   "keywords": [],
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -31,16 +32,16 @@
   },
   "dependencies": {
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.13.0"
+    "promise-toolbox": "^0.15.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^7.0.2",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -48,7 +49,7 @@
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
     "prebuild": "yarn run clean",
     "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build",
+    "prepare": "yarn run build",
     "postversion": "npm publish"
   }
 }

@xen-orchestra/log/src/configure.js

@@ -12,14 +12,15 @@ const createTransport = config => {
   if (Array.isArray(config)) {
     const transports = config.map(createTransport)
     const { length } = transports
-    return function() {
+    return function () {
       for (let i = 0; i < length; ++i) {
         transports[i].apply(this, arguments)
       }
     }
   }
 
-  let { filter, transport } = config
+  let { filter } = config
+  let transport = createTransport(config.transport)
   const level = resolve(config.level)
 
   if (filter !== undefined) {
@@ -29,14 +30,14 @@ const createTransport = config => {
     }
 
     const orig = transport
-    transport = function(log) {
+    transport = function (log) {
       if ((level !== undefined && log.level >= level) || filter(log)) {
         return orig.apply(this, arguments)
       }
     }
   } else if (level !== undefined) {
     const orig = transport
-    transport = function(log) {
+    transport = function (log) {
       if (log.level >= level) {
         return orig.apply(this, arguments)
       }
@@ -51,11 +52,12 @@ const symbol =
     ? Symbol.for('@xen-orchestra/log')
     : '@@@xen-orchestra/log'
 
+const { env } = process
 global[symbol] = createTransport({
   // display warnings or above, and all that are enabled via DEBUG or
   // NODE_DEBUG env
-  filter: process.env.DEBUG || process.env.NODE_DEBUG,
-  level: LEVELS.INFO,
+  filter: [env.DEBUG, env.NODE_DEBUG].filter(Boolean).join(','),
+  level: resolve(env.LOG_LEVEL, LEVELS.INFO),
 
   transport: createConsoleTransport(),
 })

@xen-orchestra/log/src/index.js

@@ -1,5 +1,5 @@
 import createTransport from './transports/console'
-import LEVELS from './levels'
+import LEVELS, { resolve } from './levels'
 
 const symbol =
   typeof Symbol !== 'undefined'
@@ -9,7 +9,8 @@ if (!(symbol in global)) {
   // the default behavior, without requiring `configure` is to avoid
   // logging anything unless it's a real error
   const transport = createTransport()
-  global[symbol] = log => log.level > LEVELS.WARN && transport(log)
+  const level = resolve(process.env.LOG_LEVEL, LEVELS.WARN)
+  global[symbol] = log => log.level >= level && transport(log)
 }
 
 // -------------------------------------------------------------------
@@ -37,7 +38,7 @@ const { prototype } = Logger
 for (const name in LEVELS) {
   const level = LEVELS[name]
 
-  prototype[name.toLowerCase()] = function(message, data) {
+  prototype[name.toLowerCase()] = function (message, data) {
     if (typeof message !== 'string') {
       if (message instanceof Error) {
         data = { error: message }
@@ -53,13 +54,13 @@ for (const name in LEVELS) {
   }
 }
 
-prototype.wrap = function(message, fn) {
+prototype.wrap = function (message, fn) {
   const logger = this
   const warnAndRethrow = error => {
     logger.warn(message, { error })
     throw error
   }
-  return function() {
+  return function () {
     try {
       const result = fn.apply(this, arguments)
       const then = result != null && result.then
@@ -72,5 +73,5 @@ prototype.wrap = function(message, fn) {
   }
 }
 
-const createLogger = namespace => new Logger(namespace)
+export const createLogger = namespace => new Logger(namespace)
 export { createLogger as default }

@xen-orchestra/log/src/levels.js

@@ -13,11 +13,22 @@ for (const name in LEVELS) {
   NAMES[LEVELS[name]] = name
 }
 
-export const resolve = level => {
-  if (typeof level === 'string') {
-    level = LEVELS[level.toUpperCase()]
+// resolves to the number representation of a level
+//
+// returns `defaultLevel` if invalid
+export const resolve = (level, defaultLevel) => {
+  const type = typeof level
+  if (type === 'number') {
+    if (level in NAMES) {
+      return level
+    }
+  } else if (type === 'string') {
+    const nLevel = LEVELS[level.toUpperCase()]
+    if (nLevel !== undefined) {
+      return nLevel
+    }
   }
-  return level
+  return defaultLevel
 }
 
 Object.freeze(LEVELS)

@xen-orchestra/log/src/transports/console.js

@@ -1,26 +1,107 @@
 import LEVELS, { NAMES } from '../levels'
 
-// Bind console methods (necessary for browsers)
-/* eslint-disable no-console */
-const debugConsole = console.log.bind(console)
-const infoConsole = console.info.bind(console)
-const warnConsole = console.warn.bind(console)
-const errorConsole = console.error.bind(console)
-/* eslint-enable no-console */
+const { DEBUG, ERROR, FATAL, INFO, WARN } = LEVELS
 
-const { ERROR, INFO, WARN } = LEVELS
+let formatLevel, formatNamespace
+if (
+  process.stdout !== undefined &&
+  process.stdout.isTTY &&
+  process.stderr !== undefined &&
+  process.stderr.isTTY
+) {
+  const ansi = (style, str) => `\x1b[${style}m${str}\x1b[0m`
+
+  const LEVEL_STYLES = {
+    [DEBUG]: '2',
+    [ERROR]: '1;31',
+    [FATAL]: '1;31',
+    [INFO]: '1',
+    [WARN]: '1;33',
+  }
+  formatLevel = level => {
+    const style = LEVEL_STYLES[level]
+    const name = NAMES[level]
+    return style === undefined ? name : ansi(style, name)
+  }
+
+  const NAMESPACE_COLORS = [
+    196,
+    202,
+    208,
+    214,
+    220,
+    226,
+    190,
+    154,
+    118,
+    82,
+    46,
+    47,
+    48,
+    49,
+    50,
+    51,
+    45,
+    39,
+    33,
+    27,
+    21,
+    57,
+    93,
+    129,
+    165,
+    201,
+    200,
+    199,
+    198,
+    197,
+  ]
+  formatNamespace = namespace => {
+    // https://werxltd.com/wp/2010/05/13/javascript-implementation-of-javas-string-hashcode-method/
+    let hash = 0
+    for (let i = 0, n = namespace.length; i < n; ++i) {
+      hash = ((hash << 5) - hash + namespace.charCodeAt(i)) | 0
+    }
+    // // select a hue (HSV)
+    // const h = (Math.abs(hash) % 20) * 18
+    // // convert to RGB
+    // const f = (n, k = (n + h / 60) % 6) =>
+    //   Math.round(255 * (1 - Math.max(Math.min(k, 4 - k, 1), 0)))
+    // const r = f(5)
+    // const g = f(3)
+    // const b = f(1)
+    // return ansi(`38;2;${r};${g};${b}`, namespace)
+    return ansi(
+      `1;38;5;${NAMESPACE_COLORS[Math.abs(hash) % NAMESPACE_COLORS.length]}`,
+      namespace
+    )
+  }
+} else {
+  formatLevel = str => NAMES[str]
+  formatNamespace = str => str
+}
 
 const consoleTransport = ({ data, level, namespace, message, time }) => {
   const fn =
+    /* eslint-disable no-console */
     level < INFO
-      ? debugConsole
+      ? console.log
       : level < WARN
-      ? infoConsole
+      ? console.info
       : level < ERROR
-      ? warnConsole
-      : errorConsole
+      ? console.warn
+      : console.error
+  /* eslint-enable no-console */
 
-  fn('%s - %s - [%s] %s', time.toISOString(), namespace, NAMES[level], message)
-  data != null && fn(data)
+  const args = [
+    time.toISOString(),
+    formatNamespace(namespace),
+    formatLevel(level),
+    message,
+  ]
+  if (data != null) {
+    args.push(data)
+  }
+  fn.apply(console, args)
 }
 export default () => consoleTransport

@xen-orchestra/log/src/utils.js

@@ -13,10 +13,7 @@ export const evalTemplate = (tpl, data) => {
 // -------------------------------------------------------------------
 
 const compileGlobPatternFragment = pattern =>
-  pattern
-    .split('*')
-    .map(escapeRegExp)
-    .join('.*')
+  pattern.split('*').map(escapeRegExp).join('.*')
 
 export const compileGlobPattern = pattern => {
   const no = []

@xen-orchestra/mixin/README.md

@@ -1,49 +1,28 @@
-# ${pkg.name} [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/mixin
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/mixin)](https://npmjs.org/package/@xen-orchestra/mixin) ![License](https://badgen.net/npm/license/@xen-orchestra/mixin) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/mixin)](https://bundlephobia.com/result?p=@xen-orchestra/mixin) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/mixin)](https://npmjs.org/package/@xen-orchestra/mixin)
 
 ## Install
 
-Installation of the [npm package](https://npmjs.org/package/${pkg.name}):
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/mixin):
 
 ```
-> npm install --save ${pkg.name}
-```
-
-## Usage
-
-**TODO**
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+> npm install --save @xen-orchestra/mixin
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/mixin/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/mixin",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -36,8 +37,8 @@
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-dev": "^1.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/self-signed/README.md

@@ -0,0 +1,46 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/self-signed
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/self-signed)](https://npmjs.org/package/@xen-orchestra/self-signed) ![License](https://badgen.net/npm/license/@xen-orchestra/self-signed) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/self-signed)](https://bundlephobia.com/result?p=@xen-orchestra/self-signed) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/self-signed)](https://npmjs.org/package/@xen-orchestra/self-signed)
+
+> Minimalist wrapper around openssl to generate a self signed certificate
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/self-signed):
+
+```
+> npm install --save @xen-orchestra/self-signed
+```
+
+## Usage
+
+```js
+import { genSelfSigned } from '@xen-orchestra/self-signed'
+
+console.log(await genSelfSigned())
+// {
+//   cert: '-----BEGIN CERTIFICATE-----\n' +
+//     // content…
+//     '-----END CERTIFICATE-----\n',
+//   key: '-----BEGIN RSA PRIVATE KEY-----\n' +
+//     // content…
+//     '-----END RSA PRIVATE KEY-----\n'
+// }
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/self-signed/USAGE.md

@@ -0,0 +1,13 @@
+```js
+import { genSelfSigned } from '@xen-orchestra/self-signed'
+
+console.log(await genSelfSigned())
+// {
+//   cert: '-----BEGIN CERTIFICATE-----\n' +
+//     // content…
+//     '-----END CERTIFICATE-----\n',
+//   key: '-----BEGIN RSA PRIVATE KEY-----\n' +
+//     // content…
+//     '-----END RSA PRIVATE KEY-----\n'
+// }
+```

@xen-orchestra/self-signed/index.js

@@ -0,0 +1,25 @@
+const { execFile } = require('child_process')
+
+const openssl = (cmd, args, { input, ...opts } = {}) =>
+  new Promise((resolve, reject) => {
+    const child = execFile('openssl', [cmd, ...args], opts, (error, stdout) =>
+      error != null ? reject(error) : resolve(stdout)
+    )
+    if (input !== undefined) {
+      child.stdin.end(input)
+    }
+  })
+
+exports.genSelfSignedCert = async () => {
+  const key = await openssl('genrsa', ['2048'])
+  return {
+    cert: await openssl(
+      'req',
+      ['-batch', '-new', '-key', '-', '-x509', '-days', '360', '-nodes'],
+      {
+        input: key,
+      }
+    ),
+    key,
+  }
+}

@xen-orchestra/self-signed/package.json

@@ -0,0 +1,24 @@
+{
+  "private": false,
+  "name": "@xen-orchestra/self-signed",
+  "description": "Minimalist wrapper around openssl to generate a self signed certificate",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/self-signed",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/self-signed",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.0",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "license": "ISC",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/template/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/template/README.md

@@ -0,0 +1,50 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/template
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/template)](https://npmjs.org/package/@xen-orchestra/template) ![License](https://badgen.net/npm/license/@xen-orchestra/template) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/template)](https://bundlephobia.com/result?p=@xen-orchestra/template) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/template)](https://npmjs.org/package/@xen-orchestra/template)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/template):
+
+```
+> npm install --save @xen-orchestra/template
+```
+
+## Usage
+
+Create a string replacer based on a pattern and a list of rules.
+
+```js
+const myReplacer = compileTemplate('{name}_COPY_{name}_{id}_%%', {
+  '{name}': vm => vm.name_label,
+  '{id}': vm => vm.id,
+  '%': (_, i) => i,
+})
+
+const newString = myReplacer(
+  {
+    name_label: 'foo',
+    id: 42,
+  },
+  32
+)
+
+newString === 'foo_COPY_{name}_42_32%' // true
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/template/USAGE.md

@@ -0,0 +1,19 @@
+Create a string replacer based on a pattern and a list of rules.
+
+```js
+const myReplacer = compileTemplate('{name}_COPY_{name}_{id}_%%', {
+  '{name}': vm => vm.name_label,
+  '{id}': vm => vm.id,
+  '%': (_, i) => i,
+})
+
+const newString = myReplacer(
+  {
+    name_label: 'foo',
+    id: 42,
+  },
+  32
+)
+
+newString === 'foo_COPY_{name}_42_32%' // true
+```

@xen-orchestra/template/package.json

@@ -1,46 +1,36 @@
 {
-  "name": "xo-server-cloud",
-  "version": "0.2.4",
+  "private": false,
+  "name": "@xen-orchestra/template",
+  "version": "0.1.0",
   "license": "ISC",
-  "description": "",
-  "keywords": [
-    "cloud",
-    "orchestra",
-    "plugin",
-    "xen",
-    "xen-orchestra",
-    "xo-server"
-  ],
-  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/packages/xo-server-cloud",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/template",
   "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
   "repository": {
-    "directory": "packages/xo-server-cloud",
+    "directory": "@xen-orchestra/template",
     "type": "git",
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Pierre Donias",
-    "email": "pierre.donias@gmail.com"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
-  "bin": {},
   "files": [
     "dist/"
   ],
+  "browserslist": [
+    ">2%"
+  ],
   "engines": {
     "node": ">=6"
   },
-  "dependencies": {
-    "http-request-plus": "^0.8.0",
-    "jsonrpc-websocket-client": "^0.5.0"
-  },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.5.4"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -48,7 +38,10 @@
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
     "prebuild": "yarn run clean",
     "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build"
+    "prepublishOnly": "yarn run build",
+    "postversion": "npm publish --access public"
   },
-  "private": true
+  "dependencies": {
+    "lodash": "^4.17.15"
+  }
 }

@xen-orchestra/template/src/index.js

@@ -0,0 +1,19 @@
+import escapeRegExp from 'lodash/escapeRegExp'
+
+const compareLengthDesc = (a, b) => b.length - a.length
+
+export function compileTemplate(pattern, rules) {
+  const matches = Object.keys(rules)
+    .sort(compareLengthDesc)
+    .map(escapeRegExp)
+    .join('|')
+  const regExp = new RegExp(`\\\\(?:\\\\|${matches})|${matches}`, 'g')
+  return (...params) =>
+    pattern.replace(regExp, match => {
+      if (match[0] === '\\') {
+        return match.slice(1)
+      }
+      const rule = rules[match]
+      return typeof rule === 'function' ? rule(...params) : rule
+    })
+}

@xen-orchestra/template/src/index.spec.js

@@ -0,0 +1,14 @@
+/* eslint-env jest */
+import { compileTemplate } from '.'
+
+it("correctly replaces the template's variables", () => {
+  const replacer = compileTemplate(
+    '{property}_\\{property}_\\\\{property}_{constant}_%_FOO',
+    {
+      '{property}': obj => obj.name,
+      '{constant}': 1235,
+      '%': (_, i) => i,
+    }
+  )
+  expect(replacer({ name: 'bar' }, 5)).toBe('bar_{property}_\\bar_1235_5_FOO')
+})

@xen-orchestra/upload-ova/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/upload-ova/.npmignore

@@ -0,0 +1,24 @@
+/benchmark/
+/benchmarks/
+*.bench.js
+*.bench.js.map
+
+/examples/
+example.js
+example.js.map
+*.example.js
+*.example.js.map
+
+/fixture/
+/fixtures/
+*.fixture.js
+*.fixture.js.map
+*.fixtures.js
+*.fixtures.js.map
+
+/test/
+/tests/
+*.spec.js
+*.spec.js.map
+
+__snapshots__/

@xen-orchestra/upload-ova/README.md

@@ -0,0 +1,63 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/upload-ova
+
+> Basic CLI to upload ova files to Xen-Orchestra
+
+## Usage
+
+```
+Usage:
+
+  xo-upload-ova --register [--expiresIn duration] <XO-Server URL> <username> [<password>]
+    Registers the XO instance to use.
+
+    --expiresIn duration
+      Can be used to change the validity duration of the
+      authorization token (default: one month).
+
+  xo-upload-ova --unregister
+    Remove stored credentials.
+
+  xo-upload-ova --inspect <file>
+    Displays the data that would be imported from the ova.
+
+  xo-upload-ova --upload <file> <sr> [--override <key>=<value> [<key>=<value>]+]
+    Actually imports the VM contained in <file> to the Storage Repository <sr>.
+    Some parameters can be overridden from the file, consult --inspect to get the list.
+    Note: --override has to come last. By default arguments are string, prefix them with <json:> to type
+    them, ex. " --override nameLabel='new VM'  memory=json:67108864 disks.vmdisk1.capacity=json:134217728"
+
+xo-upload-ova v0.1.0
+
+```
+
+#### Register your XO instance
+
+```
+> xo-upload-ova --register http://xo.my-company.net admin@admin.net admin
+Successfully logged with admin@admin.net
+```
+
+Note: only a token will be saved in the configuration file.
+
+#### Import your .ova file
+
+```
+> xo-upload-ova --upload dsl.ova a7c630bf-b38c-489e-d3c3-e62507948980 --override 'nameLabel=dsl ' descriptionLabel='short desc' memory=json:671088640 disks.vmdisk1.descriptionLabel='disk description' disks.vmdisk1.capacity=json:1342177280
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/upload-ova/USAGE.md

@@ -0,0 +1,40 @@
+```
+Usage:
+
+  xo-upload-ova --register [--expiresIn duration] <XO-Server URL> <username> [<password>]
+    Registers the XO instance to use.
+
+    --expiresIn duration
+      Can be used to change the validity duration of the
+      authorization token (default: one month).
+
+  xo-upload-ova --unregister
+    Remove stored credentials.
+
+  xo-upload-ova --inspect <file>
+    Displays the data that would be imported from the ova.
+
+  xo-upload-ova --upload <file> <sr> [--override <key>=<value> [<key>=<value>]+]
+    Actually imports the VM contained in <file> to the Storage Repository <sr>.
+    Some parameters can be overridden from the file, consult --inspect to get the list.
+    Note: --override has to come last. By default arguments are string, prefix them with <json:> to type
+    them, ex. " --override nameLabel='new VM'  memory=json:67108864 disks.vmdisk1.capacity=json:134217728"
+
+xo-upload-ova v0.1.0
+
+```
+
+#### Register your XO instance
+
+```
+> xo-upload-ova --register http://xo.my-company.net admin@admin.net admin
+Successfully logged with admin@admin.net
+```
+
+Note: only a token will be saved in the configuration file.
+
+#### Import your .ova file
+
+```
+> xo-upload-ova --upload dsl.ova a7c630bf-b38c-489e-d3c3-e62507948980 --override 'nameLabel=dsl ' descriptionLabel='short desc' memory=json:671088640 disks.vmdisk1.descriptionLabel='disk description' disks.vmdisk1.capacity=json:1342177280
+```

@xen-orchestra/upload-ova/package.json

@@ -0,0 +1,75 @@
+{
+  "name": "@xen-orchestra/upload-ova",
+  "version": "0.1.3",
+  "license": "AGPL-3.0-or-later",
+  "description": "Basic CLI to upload ova files to Xen-Orchestra",
+  "keywords": [
+    "import",
+    "orchestra",
+    "ova",
+    "xcp-ng",
+    "xcp",
+    "xen-orchestra",
+    "xen-server",
+    "xen",
+    "xo"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/upload-ova",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/upload-ova",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "preferGlobal": true,
+  "main": "dist/",
+  "bin": {
+    "xo-upload-ova": "dist/index.js"
+  },
+  "files": [
+    "dist/"
+  ],
+  "engines": {
+    "node": ">=8.10"
+  },
+  "dependencies": {
+    "chalk": "^2.2.0",
+    "exec-promise": "^0.7.0",
+    "fs-extra": "^9.0.0",
+    "fs-promise": "^2.0.3",
+    "get-stream": "^4.1.0",
+    "http-request-plus": "^0.8.0",
+    "human-format": "^0.10.0",
+    "l33teral": "^3.0.3",
+    "lodash": "^4.17.4",
+    "nice-pipe": "0.0.0",
+    "pretty-ms": "^4.0.0",
+    "progress-stream": "^2.0.0",
+    "pw": "^0.0.4",
+    "strip-indent": "^2.0.0",
+    "xdg-basedir": "^3.0.0",
+    "xo-lib": "^0.9.0",
+    "xo-vmdk-to-vhd": "^1.2.1"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.0.0",
+    "@babel/core": "^7.0.0",
+    "@babel/preset-env": "^7.0.0",
+    "@babel/preset-flow": "^7.0.0",
+    "babel-plugin-lodash": "^3.3.2",
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "rimraf dist/",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build"
+  },
+  "private": true,
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}