feat(xo-web/home): remove the needless condition when editing backup filter

Introduced by b138438036
Schedule ID is used by [xo-server-test](c1d588264c/packages/xo-server-test/src/_xoConnection.js (L216))

.eslintrc.js

@@ -21,7 +21,7 @@ module.exports = {
 
   overrides: [
     {
-      files: ['cli.js', '*-cli.js', 'packages/*cli*/**/*.js'],
+      files: ['cli.js', '*-cli.js', '**/*cli*/**/*.js'],
       rules: {
         'no-console': 'off',
       },
@@ -38,6 +38,15 @@ module.exports = {
     // disabled because XAPI objects are using camel case
     camelcase: ['off'],
 
+    'react/jsx-handler-names': 'off',
+
+    // disabled because not always relevant, we might reconsider in the future
+    //
+    // enabled by https://github.com/standard/eslint-config-standard/commit/319b177750899d4525eb1210686f6aca96190b2f
+    //
+    // example: https://github.com/vatesfr/xen-orchestra/blob/31ed3767c67044ca445658eb6b560718972402f2/packages/xen-api/src/index.js#L156-L157
+    'lines-between-class-members': 'off',
+
     'no-console': ['error', { allow: ['warn', 'error'] }],
     'no-var': 'error',
     'node/no-extraneous-import': 'error',

.prettierrc.js

@@ -1,6 +1,6 @@
 module.exports = {
+  arrowParens: 'avoid',
   jsxSingleQuote: true,
   semi: false,
   singleQuote: true,
-  trailingComma: 'es5',
 }

@vates/decorate-with/README.md

@@ -0,0 +1,45 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/decorate-with
+
+[![Package Version](https://badgen.net/npm/v/@vates/decorate-with)](https://npmjs.org/package/@vates/decorate-with) ![License](https://badgen.net/npm/license/@vates/decorate-with) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/decorate-with)](https://bundlephobia.com/result?p=@vates/decorate-with) [![Node compatibility](https://badgen.net/npm/node/@vates/decorate-with)](https://npmjs.org/package/@vates/decorate-with)
+
+> Creates a decorator from a function wrapper
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/decorate-with):
+
+```
+> npm install --save @vates/decorate-with
+```
+
+## Usage
+
+For instance, allows using Lodash's functions as decorators:
+
+```js
+import { decorateWith } from '@vates/decorate-with'
+
+class Foo {
+  @decorateWith(lodash.debounce, 150)
+  bar() {
+    // body
+  }
+}
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@vates/decorate-with/USAGE.md

@@ -0,0 +1,12 @@
+For instance, allows using Lodash's functions as decorators:
+
+```js
+import { decorateWith } from '@vates/decorate-with'
+
+class Foo {
+  @decorateWith(lodash.debounce, 150)
+  bar() {
+    // body
+  }
+}
+```

@vates/decorate-with/index.js

@@ -0,0 +1,4 @@
+exports.decorateWith = (fn, ...args) => (target, name, descriptor) => ({
+  ...descriptor,
+  value: fn(descriptor.value, ...args),
+})

@vates/decorate-with/package.json

@@ -0,0 +1,30 @@
+{
+  "private": false,
+  "name": "@vates/decorate-with",
+  "description": "Creates a decorator from a function wrapper",
+  "keywords": [
+    "apply",
+    "decorator",
+    "factory",
+    "wrapper"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/decorate-with",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/decorate-with",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  },
+  "license": "ISC",
+  "version": "0.0.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  }
+}

@vates/parse-duration/README.md

@@ -0,0 +1,47 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/parse-duration
+
+[![Package Version](https://badgen.net/npm/v/@vates/parse-duration)](https://npmjs.org/package/@vates/parse-duration) ![License](https://badgen.net/npm/license/@vates/parse-duration) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/parse-duration)](https://bundlephobia.com/result?p=@vates/parse-duration) [![Node compatibility](https://badgen.net/npm/node/@vates/parse-duration)](https://npmjs.org/package/@vates/parse-duration)
+
+> Small wrapper around ms to parse a duration
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/parse-duration):
+
+```
+> npm install --save @vates/parse-duration
+```
+
+## Usage
+
+`ms` without magic: always parse a duration and throws if invalid.
+
+```js
+import { parseDuration } from '@vates/parse-duration'
+
+parseDuration('2 days')
+// 172800000
+
+parseDuration(172800000)
+// 172800000
+
+parseDuration(undefined)
+// throws TypeError('not a valid duration: undefined')
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@vates/parse-duration/USAGE.md

@@ -0,0 +1,14 @@
+`ms` without magic: always parse a duration and throws if invalid.
+
+```js
+import { parseDuration } from '@vates/parse-duration'
+
+parseDuration('2 days')
+// 172800000
+
+parseDuration(172800000)
+// 172800000
+
+parseDuration(undefined)
+// throws TypeError('not a valid duration: undefined')
+```

@vates/parse-duration/index.js

@@ -1,6 +1,6 @@
-import ms from 'ms'
+const ms = require('ms')
 
-export default value => {
+exports.parseDuration = value => {
   if (typeof value === 'number') {
     return value
   }

@vates/parse-duration/package.json

@@ -0,0 +1,32 @@
+{
+  "private": false,
+  "name": "@vates/parse-duration",
+  "description": "Small wrapper around ms to parse a duration",
+  "keywords": [
+    "duration",
+    "ms",
+    "parse"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/parse-duration",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/parse-duration",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  },
+  "license": "AGPL-3.0-or-later",
+  "version": "0.1.0",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "dependencies": {
+    "ms": "^2.1.2"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  }
+}

@vates/read-chunk/README.md

@@ -0,0 +1,46 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @vates/read-chunk
+
+[![Package Version](https://badgen.net/npm/v/@vates/read-chunk)](https://npmjs.org/package/@vates/read-chunk) ![License](https://badgen.net/npm/license/@vates/read-chunk) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@vates/read-chunk)](https://bundlephobia.com/result?p=@vates/read-chunk) [![Node compatibility](https://badgen.net/npm/node/@vates/read-chunk)](https://npmjs.org/package/@vates/read-chunk)
+
+> Read a chunk of a Node stream
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@vates/read-chunk):
+
+```
+> npm install --save @vates/read-chunk
+```
+
+## Usage
+
+- returns the next available chunk of data
+- like `stream.read()`, a number of bytes can be specified
+- returns `null` if the stream has ended
+
+```js
+import { readChunk } from '@vates/read-chunk'
+;(async () => {
+  let chunk
+  while ((chunk = await readChunk(stream, 1024)) !== null) {
+    // do something with chunk
+  }
+})()
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@vates/read-chunk/USAGE.md

@@ -0,0 +1,13 @@
+- returns the next available chunk of data
+- like `stream.read()`, a number of bytes can be specified
+- returns `null` if the stream has ended
+
+```js
+import { readChunk } from '@vates/read-chunk'
+;(async () => {
+  let chunk
+  while ((chunk = await readChunk(stream, 1024)) !== null) {
+    // do something with chunk
+  }
+})()
+```

@vates/read-chunk/index.js

@@ -0,0 +1,27 @@
+exports.readChunk = (stream, size) =>
+  new Promise((resolve, reject) => {
+    function onEnd() {
+      resolve(null)
+      removeListeners()
+    }
+    function onError(error) {
+      reject(error)
+      removeListeners()
+    }
+    function onReadable() {
+      const data = stream.read(size)
+      if (data !== null) {
+        resolve(data)
+        removeListeners()
+      }
+    }
+    function removeListeners() {
+      stream.removeListener('end', onEnd)
+      stream.removeListener('error', onError)
+      stream.removeListener('readable', onReadable)
+    }
+    stream.on('end', onEnd)
+    stream.on('error', onError)
+    stream.on('readable', onReadable)
+    onReadable()
+  })

@vates/read-chunk/package.json

@@ -0,0 +1,33 @@
+{
+  "private": false,
+  "name": "@vates/read-chunk",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@vates/read-chunk",
+  "description": "Read a chunk of a Node stream",
+  "license": "ISC",
+  "keywords": [
+    "async",
+    "chunk",
+    "data",
+    "node",
+    "promise",
+    "read",
+    "stream"
+  ],
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@vates/read-chunk",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/async-map/README.md

@@ -1,6 +1,10 @@
-# @xen-orchestra/async-map [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/async-map
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/async-map)](https://npmjs.org/package/@xen-orchestra/async-map) ![License](https://badgen.net/npm/license/@xen-orchestra/async-map) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/async-map)](https://bundlephobia.com/result?p=@xen-orchestra/async-map) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/async-map)](https://npmjs.org/package/@xen-orchestra/async-map)
+
+> Similar to Promise.all + lodash.map but wait for all promises to be settled
 
 ## Install
 
@@ -12,30 +16,15 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/async
 
 ## Usage
 
-**TODO**
+```js
+import asyncMap from '@xen-orchestra/async-map'
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+const array = await asyncMap(collection, iteratee)
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
@@ -46,4 +35,4 @@ You may:
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/async-map/USAGE.md

@@ -0,0 +1,5 @@
+```js
+import asyncMap from '@xen-orchestra/async-map'
+
+const array = await asyncMap(collection, iteratee)
+```

@xen-orchestra/async-map/package.json

@@ -1,8 +1,9 @@
 {
+  "private": false,
   "name": "@xen-orchestra/async-map",
   "version": "0.0.0",
   "license": "ISC",
-  "description": "",
+  "description": "Similar to Promise.all + lodash.map but wait for all promises to be settled",
   "keywords": [],
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/async-map",
   "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@isonoe.net"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -36,8 +37,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/audit-core/.npmignore

@@ -0,0 +1,24 @@
+/benchmark/
+/benchmarks/
+*.bench.js
+*.bench.js.map
+
+/examples/
+example.js
+example.js.map
+*.example.js
+*.example.js.map
+
+/fixture/
+/fixtures/
+*.fixture.js
+*.fixture.js.map
+*.fixtures.js
+*.fixtures.js.map
+
+/test/
+/tests/
+*.spec.js
+*.spec.js.map
+
+__snapshots__/

@xen-orchestra/audit-core/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/audit-core
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/audit-core)](https://npmjs.org/package/@xen-orchestra/audit-core) ![License](https://badgen.net/npm/license/@xen-orchestra/audit-core) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/audit-core)](https://bundlephobia.com/result?p=@xen-orchestra/audit-core) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/audit-core)](https://npmjs.org/package/@xen-orchestra/audit-core)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/audit-core):
+
+```
+> npm install --save @xen-orchestra/audit-core
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/audit-core/package.json

@@ -0,0 +1,44 @@
+{
+  "name": "@xen-orchestra/audit-core",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/audit-core",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/audit-core",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "main": "dist/",
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "postversion": "npm publish --access public",
+    "prebuild": "rimraf dist/",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.7.4",
+    "@babel/core": "^7.7.4",
+    "@babel/plugin-proposal-decorators": "^7.8.0",
+    "@babel/plugin-proposal-nullish-coalescing-operator": "^7.8.0",
+    "@babel/preset-env": "^7.7.4",
+    "cross": "^1.0.0",
+    "rimraf": "^3.0.0"
+  },
+  "dependencies": {
+    "core-js": "^3.6.4",
+    "golike-defer": "^0.4.1",
+    "lodash": "^4.17.15",
+    "object-hash": "^2.0.1"
+  },
+  "private": false,
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/audit-core/src/index.js

@@ -0,0 +1,142 @@
+// see https://github.com/babel/babel/issues/8450
+import 'core-js/features/symbol/async-iterator'
+
+import assert from 'assert'
+import defer from 'golike-defer'
+import hash from 'object-hash'
+
+export class Storage {
+  constructor() {
+    this._lock = Promise.resolve()
+  }
+
+  async acquireLock() {
+    const lock = this._lock
+    let releaseLock
+    this._lock = new Promise(resolve => {
+      releaseLock = resolve
+    })
+    await lock
+    return releaseLock
+  }
+}
+
+// Format: $<algorithm>$<salt>$<encrypted>
+//
+// http://man7.org/linux/man-pages/man3/crypt.3.html#NOTES
+const ID_TO_ALGORITHM = {
+  '5': 'sha256',
+}
+
+export class AlteredRecordError extends Error {
+  constructor(id, nValid, record) {
+    super('altered record')
+
+    this.id = id
+    this.nValid = nValid
+    this.record = record
+  }
+}
+
+export class MissingRecordError extends Error {
+  constructor(id, nValid) {
+    super('missing record')
+
+    this.id = id
+    this.nValid = nValid
+  }
+}
+
+export const NULL_ID = 'nullId'
+
+const HASH_ALGORITHM_ID = '5'
+const createHash = (data, algorithmId = HASH_ALGORITHM_ID) =>
+  `$${algorithmId}$$${hash(data, {
+    algorithm: ID_TO_ALGORITHM[algorithmId],
+    excludeKeys: key => key === 'id',
+  })}`
+
+export class AuditCore {
+  constructor(storage) {
+    assert.notStrictEqual(storage, undefined)
+    this._storage = storage
+  }
+
+  @defer
+  async add($defer, subject, event, data) {
+    const time = Date.now()
+    const storage = this._storage
+    $defer(await storage.acquireLock())
+
+    // delete "undefined" properties and normalize data with JSON.stringify
+    const record = JSON.parse(
+      JSON.stringify({
+        data,
+        event,
+        previousId: (await storage.getLastId()) ?? NULL_ID,
+        subject,
+        time,
+      })
+    )
+    record.id = createHash(record)
+    await storage.put(record)
+    await storage.setLastId(record.id)
+    return record
+  }
+
+  async checkIntegrity(oldest, newest) {
+    const storage = this._storage
+
+    // handle separated chains case
+    if (newest !== (await storage.getLastId())) {
+      let isNewestAccessible = false
+      for await (const { id } of this.getFrom()) {
+        if (id === newest) {
+          isNewestAccessible = true
+          break
+        }
+      }
+      if (!isNewestAccessible) {
+        throw new MissingRecordError(newest, 0)
+      }
+    }
+
+    let nValid = 0
+    while (newest !== oldest) {
+      const record = await storage.get(newest)
+      if (record === undefined) {
+        throw new MissingRecordError(newest, nValid)
+      }
+      if (
+        newest !== createHash(record, newest.slice(1, newest.indexOf('$', 1)))
+      ) {
+        throw new AlteredRecordError(newest, nValid, record)
+      }
+      newest = record.previousId
+      nValid++
+    }
+    return nValid
+  }
+
+  async *getFrom(newest) {
+    const storage = this._storage
+
+    let id = newest ?? (await storage.getLastId())
+    if (id === undefined) {
+      return
+    }
+
+    let record
+    while ((record = await storage.get(id)) !== undefined) {
+      yield record
+      id = record.previousId
+    }
+  }
+
+  async deleteFrom(newest) {
+    assert.notStrictEqual(newest, undefined)
+    for await (const { id } of this.getFrom(newest)) {
+      await this._storage.del(id)
+    }
+  }
+}

@xen-orchestra/audit-core/src/index.spec.js

@@ -0,0 +1,126 @@
+/* eslint-env jest */
+
+import {
+  AlteredRecordError,
+  AuditCore,
+  MissingRecordError,
+  NULL_ID,
+  Storage,
+} from '.'
+
+const asyncIteratorToArray = async asyncIterator => {
+  const array = []
+  for await (const entry of asyncIterator) {
+    array.push(entry)
+  }
+  return array
+}
+
+class DB extends Storage {
+  constructor() {
+    super()
+
+    this._db = new Map()
+    this._lastId = undefined
+  }
+
+  async put(record) {
+    this._db.set(record.id, record)
+  }
+
+  async setLastId(id) {
+    this._lastId = id
+  }
+
+  async getLastId() {
+    return this._lastId
+  }
+
+  async del(id) {
+    this._db.delete(id)
+  }
+
+  async get(id) {
+    return this._db.get(id)
+  }
+
+  _clear() {
+    return this._db.clear()
+  }
+}
+
+const DATA = [
+  [
+    {
+      name: 'subject0',
+    },
+    'event0',
+    {},
+  ],
+  [
+    {
+      name: 'subject1',
+    },
+    'event1',
+    {},
+  ],
+  [
+    {
+      name: 'subject2',
+    },
+    'event2',
+    {},
+  ],
+]
+
+const db = new DB()
+const auditCore = new AuditCore(db)
+const storeAuditRecords = async () => {
+  await Promise.all(DATA.map(data => auditCore.add(...data)))
+  const records = await asyncIteratorToArray(auditCore.getFrom())
+  expect(records.length).toBe(DATA.length)
+  return records
+}
+
+describe('auditCore', () => {
+  afterEach(() => db._clear())
+
+  it('detects that a record is missing', async () => {
+    const [newestRecord, deletedRecord] = await storeAuditRecords()
+
+    const nValidRecords = await auditCore.checkIntegrity(
+      NULL_ID,
+      newestRecord.id
+    )
+    expect(nValidRecords).toBe(DATA.length)
+
+    await db.del(deletedRecord.id)
+    await expect(
+      auditCore.checkIntegrity(NULL_ID, newestRecord.id)
+    ).rejects.toEqual(new MissingRecordError(deletedRecord.id, 1))
+  })
+
+  it('detects that a record has been altered', async () => {
+    const [newestRecord, alteredRecord] = await storeAuditRecords()
+
+    alteredRecord.event = ''
+    await db.put(alteredRecord)
+
+    await expect(
+      auditCore.checkIntegrity(NULL_ID, newestRecord.id)
+    ).rejects.toEqual(
+      new AlteredRecordError(alteredRecord.id, 1, alteredRecord)
+    )
+  })
+
+  it('confirms interval integrity after deletion of records outside of the interval', async () => {
+    const [thirdRecord, secondRecord, firstRecord] = await storeAuditRecords()
+
+    await auditCore.deleteFrom(secondRecord.id)
+
+    expect(await db.get(firstRecord.id)).toBe(undefined)
+    expect(await db.get(secondRecord.id)).toBe(undefined)
+
+    await auditCore.checkIntegrity(secondRecord.id, thirdRecord.id)
+  })
+})

@xen-orchestra/audit-core/src/specification.ts

@@ -0,0 +1,25 @@
+class Storage {
+  acquire: () => Promise<() => undefined>
+  del: (id: string) => Promise<void>
+  get: (id: string) => Promise<Record | void>
+  getLastId: () => Promise<string | void>
+  put: (record: Record) => Promise<void>
+  setLastId: (id: string) => Promise<void>
+}
+
+interface Record {
+  data: object
+  event: string
+  id: string
+  previousId: string
+  subject: object
+  time: number
+}
+
+export class AuditCore {
+  constructor(storage: Storage) {}
+  public add(subject: any, event: string, data: any): Promise<Record> {}
+  public checkIntegrity(oldest: string, newest: string): Promise<number> {}
+  public getFrom(newest?: string): AsyncIterator {}
+  public deleteFrom(newest: string): Promise<void> {}
+}

@xen-orchestra/babel-config/README.md

@@ -0,0 +1,18 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/babel-config
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/babel-config/index.js

@@ -32,7 +32,6 @@ const configs = {
         }
         return { browsers: pkg.browserslist, node }
       })(),
-      useBuiltIns: '@babel/polyfill' in (pkg.dependencies || {}) && 'usage',
     }
   },
 }
@@ -52,7 +51,7 @@ const pluginsOrder = [
   '@babel/plugin-proposal-class-properties',
 ]
 
-module.exports = function(pkg, plugins, presets) {
+module.exports = function (pkg, plugins, presets) {
   plugins === undefined && (plugins = {})
   presets === undefined && (presets = {})
 

@xen-orchestra/babel-config/package.json

@@ -8,5 +8,13 @@
     "directory": "@xen-orchestra/babel-config",
     "type": "git",
     "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "engines": {
+    "node": ">=6"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/backups-cli/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/backups-cli
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/backups-cli)](https://npmjs.org/package/@xen-orchestra/backups-cli) ![License](https://badgen.net/npm/license/@xen-orchestra/backups-cli) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/backups-cli)](https://bundlephobia.com/result?p=@xen-orchestra/backups-cli) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/backups-cli)](https://npmjs.org/package/@xen-orchestra/backups-cli)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/backups-cli):
+
+```
+> npm install --global @xen-orchestra/backups-cli
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/backups-cli/_asyncMap.js

@@ -0,0 +1,7 @@
+const curryRight = require('lodash/curryRight')
+
+module.exports = curryRight((iterable, fn) =>
+  Promise.all(
+    Array.isArray(iterable) ? iterable.map(fn) : Array.from(iterable, fn)
+  )
+)

@xen-orchestra/backups-cli/_composeCommands.js

@@ -0,0 +1,32 @@
+const getopts = require('getopts')
+
+const { version } = require('./package.json')
+
+module.exports = commands =>
+  async function (args, prefix) {
+    const opts = getopts(args, {
+      alias: {
+        help: 'h',
+      },
+      boolean: ['help'],
+      stopEarly: true,
+    })
+
+    const commandName = opts.help || args.length === 0 ? 'help' : args[0]
+    const command = commands[commandName]
+    if (command === undefined) {
+      process.stdout.write(`Usage:
+
+${Object.keys(commands)
+  .filter(command => command !== 'help')
+  .map(command => `    ${prefix} ${command} ${commands[command].usage || ''}`)
+  .join('\n\n')}
+
+xo-backups v${version}
+`)
+      process.exitCode = commandName === 'help' ? 0 : 1
+      return
+    }
+
+    return command.main(args.slice(1), prefix + ' ' + commandName)
+  }

@xen-orchestra/backups-cli/_fs.js

@@ -0,0 +1,58 @@
+const { dirname } = require('path')
+
+const fs = require('promise-toolbox/promisifyAll')(require('fs'))
+module.exports = fs
+
+fs.mktree = async function mkdirp(path) {
+  try {
+    await fs.mkdir(path)
+  } catch (error) {
+    const { code } = error
+    if (code === 'EEXIST') {
+      await fs.readdir(path)
+      return
+    }
+    if (code === 'ENOENT') {
+      await mkdirp(dirname(path))
+      return mkdirp(path)
+    }
+    throw error
+  }
+}
+
+// - easier:
+//   - single param for direct use in `Array#map`
+//   - files are prefixed with directory path
+// - safer: returns empty array if path is missing or not a directory
+fs.readdir2 = path =>
+  fs.readdir(path).then(
+    entries => {
+      entries.forEach((entry, i) => {
+        entries[i] = `${path}/${entry}`
+      })
+
+      return entries
+    },
+    error => {
+      const { code } = error
+      if (code === 'ENOENT') {
+        // do nothing
+      } else if (code === 'ENOTDIR') {
+        console.warn('WARN: readdir(%s)', path, error)
+      } else {
+        throw error
+      }
+      return []
+    }
+  )
+
+fs.symlink2 = async (target, path) => {
+  try {
+    await fs.symlink(target, path)
+  } catch (error) {
+    if (error.code === 'EEXIST' && (await fs.readlink(path)) === target) {
+      return
+    }
+    throw error
+  }
+}

@xen-orchestra/backups-cli/commands/clean-vms.js

@@ -0,0 +1,318 @@
+#!/usr/bin/env node
+
+// assigned when options are parsed by the main function
+let force
+
+// -----------------------------------------------------------------------------
+
+const assert = require('assert')
+const flatten = require('lodash/flatten')
+const getopts = require('getopts')
+const lockfile = require('proper-lockfile')
+const pipe = require('promise-toolbox/pipe')
+const { default: Vhd } = require('vhd-lib')
+const { dirname, resolve } = require('path')
+const { DISK_TYPE_DIFFERENCING } = require('vhd-lib/dist/_constants')
+const { isValidXva } = require('@xen-orchestra/backups/isValidXva')
+
+const asyncMap = require('../_asyncMap')
+const fs = require('../_fs')
+
+const handler = require('@xen-orchestra/fs').getHandler({ url: 'file://' })
+
+// -----------------------------------------------------------------------------
+
+// chain is an array of VHDs from child to parent
+//
+// the whole chain will be merged into parent, parent will be renamed to child
+// and all the others will deleted
+async function mergeVhdChain(chain) {
+  assert(chain.length >= 2)
+
+  const child = chain[0]
+  const parent = chain[chain.length - 1]
+  const children = chain.slice(0, -1).reverse()
+
+  console.warn('Unused parents of VHD', child)
+  chain
+    .slice(1)
+    .reverse()
+    .forEach(parent => {
+      console.warn('  ', parent)
+    })
+  force && console.warn('  merging…')
+  console.warn('')
+  if (force) {
+    // `mergeVhd` does not work with a stream, either
+    // - make it accept a stream
+    // - or create synthetic VHD which is not a stream
+    return console.warn('TODO: implement merge')
+    // await mergeVhd(
+    //   handler,
+    //   parent,
+    //   handler,
+    //   children.length === 1
+    //     ? child
+    //     : await createSyntheticStream(handler, children)
+    // )
+  }
+
+  await Promise.all([
+    force && fs.rename(parent, child),
+    asyncMap(children.slice(0, -1), child => {
+      console.warn('Unused VHD', child)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(child)
+    }),
+  ])
+}
+
+const listVhds = pipe([
+  vmDir => vmDir + '/vdis',
+  fs.readdir2,
+  asyncMap(fs.readdir2),
+  flatten,
+  asyncMap(fs.readdir2),
+  flatten,
+  _ => _.filter(_ => _.endsWith('.vhd')),
+])
+
+async function handleVm(vmDir) {
+  const vhds = new Set()
+  const vhdParents = { __proto__: null }
+  const vhdChildren = { __proto__: null }
+
+  // remove broken VHDs
+  await asyncMap(await listVhds(vmDir), async path => {
+    try {
+      const vhd = new Vhd(handler, path)
+      await vhd.readHeaderAndFooter()
+      vhds.add(path)
+      if (vhd.footer.diskType === DISK_TYPE_DIFFERENCING) {
+        const parent = resolve(dirname(path), vhd.header.parentUnicodeName)
+        vhdParents[path] = parent
+        if (parent in vhdChildren) {
+          const error = new Error(
+            'this script does not support multiple VHD children'
+          )
+          error.parent = parent
+          error.child1 = vhdChildren[parent]
+          error.child2 = path
+          throw error // should we throw?
+        }
+        vhdChildren[parent] = path
+      }
+    } catch (error) {
+      console.warn('Error while checking VHD', path)
+      console.warn('  ', error)
+      if (error != null && error.code === 'ERR_ASSERTION') {
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(path))
+      }
+    }
+  })
+
+  // remove VHDs with missing ancestors
+  {
+    const deletions = []
+
+    // return true if the VHD has been deleted or is missing
+    const deleteIfOrphan = vhd => {
+      const parent = vhdParents[vhd]
+      if (parent === undefined) {
+        return
+      }
+
+      // no longer needs to be checked
+      delete vhdParents[vhd]
+
+      deleteIfOrphan(parent)
+
+      if (!vhds.has(parent)) {
+        vhds.delete(vhd)
+
+        console.warn('Error while checking VHD', vhd)
+        console.warn('  missing parent', parent)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && deletions.push(handler.unlink(vhd))
+      }
+    }
+
+    // > A property that is deleted before it has been visited will not be
+    // > visited later.
+    // >
+    // > -- https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Statements/for...in#Deleted_added_or_modified_properties
+    for (const child in vhdParents) {
+      deleteIfOrphan(child)
+    }
+
+    await Promise.all(deletions)
+  }
+
+  const [jsons, xvas, xvaSums] = await fs
+    .readdir2(vmDir)
+    .then(entries => [
+      entries.filter(_ => _.endsWith('.json')),
+      new Set(entries.filter(_ => _.endsWith('.xva'))),
+      entries.filter(_ => _.endsWith('.xva.cheksum')),
+    ])
+
+  await asyncMap(xvas, async path => {
+    // check is not good enough to delete the file, the best we can do is report
+    // it
+    if (!(await isValidXva(path))) {
+      console.warn('Potential broken XVA', path)
+      console.warn('')
+    }
+  })
+
+  const unusedVhds = new Set(vhds)
+  const unusedXvas = new Set(xvas)
+
+  // compile the list of unused XVAs and VHDs, and remove backup metadata which
+  // reference a missing XVA/VHD
+  await asyncMap(jsons, async json => {
+    const metadata = JSON.parse(await fs.readFile(json))
+    const { mode } = metadata
+    if (mode === 'full') {
+      const linkedXva = resolve(vmDir, metadata.xva)
+
+      if (xvas.has(linkedXva)) {
+        unusedXvas.delete(linkedXva)
+      } else {
+        console.warn('Error while checking backup', json)
+        console.warn('  missing file', linkedXva)
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    } else if (mode === 'delta') {
+      const linkedVhds = (() => {
+        const { vhds } = metadata
+        return Object.keys(vhds).map(key => resolve(vmDir, vhds[key]))
+      })()
+
+      // FIXME: find better approach by keeping as much of the backup as
+      // possible (existing disks) even if one disk is missing
+      if (linkedVhds.every(_ => vhds.has(_))) {
+        linkedVhds.forEach(_ => unusedVhds.delete(_))
+      } else {
+        console.warn('Error while checking backup', json)
+        const missingVhds = linkedVhds.filter(_ => !vhds.has(_))
+        console.warn(
+          '  %i/%i missing VHDs',
+          missingVhds.length,
+          linkedVhds.length
+        )
+        missingVhds.forEach(vhd => {
+          console.warn('  ', vhd)
+        })
+        force && console.warn('  deleting…')
+        console.warn('')
+        force && (await handler.unlink(json))
+      }
+    }
+  })
+
+  // TODO: parallelize by vm/job/vdi
+  const unusedVhdsDeletion = []
+  {
+    // VHD chains (as list from child to ancestor) to merge indexed by last
+    // ancestor
+    const vhdChainsToMerge = { __proto__: null }
+
+    const toCheck = new Set(unusedVhds)
+
+    const getUsedChildChainOrDelete = vhd => {
+      if (vhd in vhdChainsToMerge) {
+        const chain = vhdChainsToMerge[vhd]
+        delete vhdChainsToMerge[vhd]
+        return chain
+      }
+
+      if (!unusedVhds.has(vhd)) {
+        return [vhd]
+      }
+
+      // no longer needs to be checked
+      toCheck.delete(vhd)
+
+      const child = vhdChildren[vhd]
+      if (child !== undefined) {
+        const chain = getUsedChildChainOrDelete(child)
+        if (chain !== undefined) {
+          chain.push(vhd)
+          return chain
+        }
+      }
+
+      console.warn('Unused VHD', vhd)
+      force && console.warn('  deleting…')
+      console.warn('')
+      force && unusedVhdsDeletion.push(handler.unlink(vhd))
+    }
+
+    toCheck.forEach(vhd => {
+      vhdChainsToMerge[vhd] = getUsedChildChainOrDelete(vhd)
+    })
+
+    Object.keys(vhdChainsToMerge).forEach(key => {
+      const chain = vhdChainsToMerge[key]
+      if (chain !== undefined) {
+        unusedVhdsDeletion.push(mergeVhdChain(chain))
+      }
+    })
+  }
+
+  await Promise.all([
+    unusedVhdsDeletion,
+    asyncMap(unusedXvas, path => {
+      console.warn('Unused XVA', path)
+      force && console.warn('  deleting…')
+      console.warn('')
+      return force && handler.unlink(path)
+    }),
+    asyncMap(xvaSums, path => {
+      // no need to handle checksums for XVAs deleted by the script, they will be handled by `unlink()`
+      if (!xvas.has(path.slice(0, -'.checksum'.length))) {
+        console.warn('Unused XVA checksum', path)
+        force && console.warn('  deleting…')
+        console.warn('')
+        return force && handler.unlink(path)
+      }
+    }),
+  ])
+}
+
+// -----------------------------------------------------------------------------
+
+module.exports = async function main(args) {
+  const opts = getopts(args, {
+    alias: {
+      force: 'f',
+    },
+    boolean: ['force'],
+    default: {
+      force: false,
+    },
+  })
+
+  ;({ force } = opts)
+  await asyncMap(opts._, async vmDir => {
+    vmDir = resolve(vmDir)
+
+    // TODO: implement this in `xo-server`, not easy because not compatible with
+    // `@xen-orchestra/fs`.
+    const release = await lockfile.lock(vmDir)
+    try {
+      await handleVm(vmDir)
+    } catch (error) {
+      console.error('handleVm', vmDir, error)
+    } finally {
+      await release()
+    }
+  })
+}

@xen-orchestra/backups-cli/commands/create-symlink-index.js

@@ -0,0 +1,28 @@
+const filenamify = require('filenamify')
+const get = require('lodash/get')
+const { dirname, join, relative } = require('path')
+
+const asyncMap = require('../_asyncMap')
+const { mktree, readdir2, readFile, symlink2 } = require('../_fs')
+
+module.exports = async function createSymlinkIndex([backupDir, fieldPath]) {
+  const indexDir = join(backupDir, 'indexes', filenamify(fieldPath))
+  await mktree(indexDir)
+
+  await asyncMap(await readdir2(backupDir), async vmDir =>
+    asyncMap(
+      (await readdir2(vmDir)).filter(_ => _.endsWith('.json')),
+      async json => {
+        const metadata = JSON.parse(await readFile(json))
+        const value = get(metadata, fieldPath)
+        if (value !== undefined) {
+          const target = relative(indexDir, dirname(json))
+          const path = join(indexDir, filenamify(String(value)))
+          await symlink2(target, path).catch(error => {
+            console.warn('symlink(%s, %s)', target, path, error)
+          })
+        }
+      }
+    )
+  )
+}

@xen-orchestra/backups-cli/index.js

@@ -0,0 +1,19 @@
+#!/usr/bin/env node
+
+require('./_composeCommands')({
+  'clean-vms': {
+    get main() {
+      return require('./commands/clean-vms')
+    },
+    usage: '[--force] xo-vm-backups/*',
+  },
+  'create-symlink-index': {
+    get main() {
+      return require('./commands/create-symlink-index')
+    },
+    usage: 'xo-vm-backups <field path>',
+  },
+})(process.argv.slice(2), 'xo-backups').catch(error => {
+  console.error('main', error)
+  process.exitCode = 1
+})

@xen-orchestra/backups-cli/package.json

@@ -0,0 +1,41 @@
+{
+  "private": false,
+  "bin": {
+    "xo-backups": "index.js"
+  },
+  "preferGlobal": true,
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "dependencies": {
+    "@xen-orchestra/backups": "^0.1.1",
+    "@xen-orchestra/fs": "^0.10.4",
+    "filenamify": "^4.1.0",
+    "getopts": "^2.2.5",
+    "lodash": "^4.17.15",
+    "promise-toolbox": "^0.15.0",
+    "proper-lockfile": "^4.1.1",
+    "vhd-lib": "^0.7.2"
+  },
+  "engines": {
+    "node": ">=7.10.1"
+  },
+  "files": [
+    "commands",
+    "*.js"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/backups-cli",
+  "name": "@xen-orchestra/backups-cli",
+  "repository": {
+    "directory": "@xen-orchestra/backups-cli",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "version": "0.0.0",
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/backups/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/backups
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/backups)](https://npmjs.org/package/@xen-orchestra/backups) ![License](https://badgen.net/npm/license/@xen-orchestra/backups) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/backups)](https://bundlephobia.com/result?p=@xen-orchestra/backups) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/backups)](https://npmjs.org/package/@xen-orchestra/backups)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/backups):
+
+```
+> npm install --save @xen-orchestra/backups
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/backups/extractIdsFromSimplePattern.js

@@ -0,0 +1,30 @@
+function extractIdsFromSimplePattern(pattern) {
+  if (pattern === undefined) {
+    return []
+  }
+
+  if (pattern !== null && typeof pattern === 'object') {
+    let keys = Object.keys(pattern)
+
+    if (keys.length === 1 && keys[0] === 'id') {
+      pattern = pattern.id
+      if (typeof pattern === 'string') {
+        return [pattern]
+      }
+      if (pattern !== null && typeof pattern === 'object') {
+        keys = Object.keys(pattern)
+        if (
+          keys.length === 1 &&
+          keys[0] === '__or' &&
+          Array.isArray((pattern = pattern.__or)) &&
+          pattern.every(_ => typeof _ === 'string')
+        ) {
+          return pattern
+        }
+      }
+    }
+  }
+
+  throw new Error('invalid pattern')
+}
+exports.extractIdsFromSimplePattern = extractIdsFromSimplePattern

@xen-orchestra/backups/filenameDate.js

@@ -0,0 +1,6 @@
+const { utcFormat, utcParse } = require('d3-time-format')
+
+// Format a date in ISO 8601 in a safe way to be used in filenames
+// (even on Windows).
+exports.formatFilenameDate = utcFormat('%Y%m%dT%H%M%SZ')
+exports.parseFilenameDate = utcParse('%Y%m%dT%H%M%SZ')

@xen-orchestra/backups/getOldEntries.js

@@ -0,0 +1,7 @@
+// returns all entries but the last retention-th
+exports.getOldEntries = (retention, entries) =>
+  entries === undefined
+    ? []
+    : retention > 0
+    ? entries.slice(0, -retention)
+    : entries

@xen-orchestra/backups/isValidXva.js

@@ -0,0 +1,65 @@
+const assert = require('assert')
+const fs = require('fs-extra')
+
+const isGzipFile = async fd => {
+  // https://tools.ietf.org/html/rfc1952.html#page-5
+  const magicNumber = Buffer.allocUnsafe(2)
+  assert.strictEqual(
+    (await fs.read(fd, magicNumber, 0, magicNumber.length, 0)).bytesRead,
+    magicNumber.length
+  )
+  return magicNumber[0] === 31 && magicNumber[1] === 139
+}
+
+// TODO: better check?
+//
+// our heuristic is not good enough, there has been some false positives
+// (detected as invalid by us but valid by `tar` and imported with success),
+// either THOUGH THEY MAY HAVE BEEN COMPRESSED FILES:
+// - these files were normal but the check is incorrect
+// - these files were invalid but without data loss
+// - these files were invalid but with silent data loss
+//
+// maybe reading the end of the file looking for a file named
+// /^Ref:\d+/\d+\.checksum$/ and then validating the tar structure from it
+//
+// https://github.com/npm/node-tar/issues/234#issuecomment-538190295
+const isValidTar = async (size, fd) => {
+  if (size <= 1024 || size % 512 !== 0) {
+    return false
+  }
+
+  const buf = Buffer.allocUnsafe(1024)
+  assert.strictEqual(
+    (await fs.read(fd, buf, 0, buf.length, size - buf.length)).bytesRead,
+    buf.length
+  )
+  return buf.every(_ => _ === 0)
+}
+
+// TODO: find an heuristic for compressed files
+const isValidXva = async path => {
+  try {
+    const fd = await fs.open(path, 'r')
+    try {
+      const { size } = await fs.fstat(fd)
+      if (size < 20) {
+        // neither a valid gzip not tar
+        return false
+      }
+
+      return (await isGzipFile(fd))
+        ? true // gzip files cannot be validated at this time
+        : await isValidTar(size, fd)
+    } finally {
+      fs.close(fd).catch(noop)
+    }
+  } catch (error) {
+    // never throw, log and report as valid to avoid side effects
+    console.error('isValidXva', path, error)
+    return true
+  }
+}
+exports.isValidXva = isValidXva
+
+const noop = Function.prototype

@xen-orchestra/backups/package.json

@@ -0,0 +1,27 @@
+{
+  "private": false,
+  "name": "@xen-orchestra/backups",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/backups",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/backups",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.1",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "dependencies": {
+    "d3-time-format": "^2.2.3",
+    "fs-extra": "^9.0.0"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/backups/watchStreamSize.js

@@ -0,0 +1,11 @@
+exports.watchStreamSize = stream => {
+  const container = { size: 0 }
+  const isPaused = stream.isPaused()
+  stream.on('data', data => {
+    container.size += data.length
+  })
+  if (isPaused) {
+    stream.pause()
+  }
+  return container
+}

@xen-orchestra/cr-seed-cli/README.md

@@ -0,0 +1,28 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/cr-seed-cli
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/cr-seed-cli)](https://npmjs.org/package/@xen-orchestra/cr-seed-cli) ![License](https://badgen.net/npm/license/@xen-orchestra/cr-seed-cli) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/cr-seed-cli)](https://bundlephobia.com/result?p=@xen-orchestra/cr-seed-cli) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/cr-seed-cli)](https://npmjs.org/package/@xen-orchestra/cr-seed-cli)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/cr-seed-cli):
+
+```
+> npm install --global @xen-orchestra/cr-seed-cli
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/cr-seed-cli/index.js

@@ -5,7 +5,7 @@ const { NULL_REF, Xapi } = require('xen-api')
 
 const pkg = require('./package.json')
 
-Xapi.prototype.getVmDisks = async function(vm) {
+Xapi.prototype.getVmDisks = async function (vm) {
   const disks = { __proto__: null }
   await Promise.all([
     ...vm.VBDs.map(async vbdRef => {

@xen-orchestra/cr-seed-cli/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/cr-seed-cli",
   "version": "0.2.0",
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/cr-seed-cli",
@@ -14,11 +15,17 @@
   "bin": {
     "xo-cr-seed": "./index.js"
   },
+  "preferGlobal": true,
   "dependencies": {
     "golike-defer": "^0.4.1",
-    "xen-api": "^0.26.0"
+    "xen-api": "^0.28.5"
   },
   "scripts": {
     "postversion": "npm publish"
+  },
+  "license": "AGPL-3.0-or-later",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/cron/README.md

@@ -1,4 +1,8 @@
-# @xen-orchestra/cron [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/cron
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/cron)](https://npmjs.org/package/@xen-orchestra/cron) ![License](https://badgen.net/npm/license/@xen-orchestra/cron) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/cron)](https://bundlephobia.com/result?p=@xen-orchestra/cron) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/cron)](https://npmjs.org/package/@xen-orchestra/cron)
 
 > Focused, well maintained, cron parser/scheduler
 
@@ -10,13 +14,14 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/cron)
 > npm install --save @xen-orchestra/cron
 ```
 
+## Usage
+
 ### Pattern syntax
 
 ```
 <minute> <hour> <day of month> <month> <day of week>
 ```
 
-
 Each entry can be:
 
 - a single value
@@ -29,12 +34,12 @@ A wildcard (`*`) can be used as a shortcut for the whole range
 Step values can be used in conjunctions with ranges. For instance,
 `1-7/2` is the same as `1,3,5,7`.
 
-| Field            | Allowed values |
-|------------------|----------------|
-| minute           | 0-59           |
-| hour             | 0-23           |
-| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …) |
-| month            | 0-11           |
+| Field            | Allowed values                                                     |
+| ---------------- | ------------------------------------------------------------------ |
+| minute           | 0-59                                                               |
+| hour             | 0-23                                                               |
+| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …)                           |
+| month            | 0-11                                                               |
 | day of week      | 0-7 (0 and 7 both mean Sunday) or 3-letter names (`mon`, `tue`, …) |
 
 > Note: the month range is 0-11 to be compatible with
@@ -110,28 +115,9 @@ job.start()
 job.stop()
 ```
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
-```
-
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
@@ -142,4 +128,4 @@ You may:
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/cron/USAGE.md

@@ -0,0 +1,98 @@
+### Pattern syntax
+
+```
+<minute> <hour> <day of month> <month> <day of week>
+```
+
+Each entry can be:
+
+- a single value
+- a range (`0-23` or `*/2`)
+- a list of values/ranges (`1,8-12`)
+
+A wildcard (`*`) can be used as a shortcut for the whole range
+(`first-last`).
+
+Step values can be used in conjunctions with ranges. For instance,
+`1-7/2` is the same as `1,3,5,7`.
+
+| Field            | Allowed values                                                     |
+| ---------------- | ------------------------------------------------------------------ |
+| minute           | 0-59                                                               |
+| hour             | 0-23                                                               |
+| day of the month | 1-31 or 3-letter names (`jan`, `feb`, …)                           |
+| month            | 0-11                                                               |
+| day of week      | 0-7 (0 and 7 both mean Sunday) or 3-letter names (`mon`, `tue`, …) |
+
+> Note: the month range is 0-11 to be compatible with
+> [cron](https://github.com/kelektiv/node-cron), it does not appear to
+> be very standard though.
+
+### API
+
+`createSchedule(pattern: string, zone: string = 'utc'): Schedule`
+
+> Create a new schedule.
+
+- `pattern`: the pattern to use, see [the syntax](#pattern-syntax)
+- `zone`: the timezone to use, use `'local'` for the local timezone
+
+```js
+import { createSchedule } from '@xen-orchestra/cron'
+
+const schedule = createSchedule('0 0 * * sun', 'America/New_York')
+```
+
+`Schedule#createJob(fn: Function): Job`
+
+> Create a new job from this schedule.
+
+- `fn`: function to execute, if it returns a promise, it will be
+  awaited before scheduling the next run.
+
+```js
+const job = schedule.createJob(() => {
+  console.log(new Date())
+})
+```
+
+`Schedule#next(n: number): Array<Date>`
+
+> Returns the next dates matching this schedule.
+
+- `n`: number of dates to return
+
+```js
+schedule.next(2)
+// [ 2018-02-11T05:00:00.000Z, 2018-02-18T05:00:00.000Z ]
+```
+
+`Schedule#startJob(fn: Function): () => void`
+
+> Start a new job from this schedule and return a function to stop it.
+
+- `fn`: function to execute, if it returns a promise, it will be
+  awaited before scheduling the next run.
+
+```js
+const stopJob = schedule.startJob(() => {
+  console.log(new Date())
+})
+stopJob()
+```
+
+`Job#start(): void`
+
+> Start this job.
+
+```js
+job.start()
+```
+
+`Job#stop(): void`
+
+> Stop this job.
+
+```js
+job.stop()
+```

@xen-orchestra/cron/package.json

@@ -1,6 +1,7 @@
 {
+  "private": false,
   "name": "@xen-orchestra/cron",
-  "version": "1.0.3",
+  "version": "1.0.6",
   "license": "ISC",
   "description": "Focused, well maintained, cron parser/scheduler",
   "keywords": [
@@ -22,8 +23,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@isonoe.net"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -46,8 +47,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/cron/src/index.js

@@ -7,7 +7,21 @@ const MAX_DELAY = 2 ** 31 - 1
 
 class Job {
   constructor(schedule, fn) {
+    let scheduledDate
     const wrapper = () => {
+      const now = Date.now()
+      if (scheduledDate > now) {
+        // we're early, delay
+        //
+        // no need to check _isEnabled, we're just delaying the existing timeout
+        //
+        // see https://github.com/vatesfr/xen-orchestra/issues/4625
+        this._timeout = setTimeout(wrapper, scheduledDate - now)
+        return
+      }
+
+      this._isRunning = true
+
       let result
       try {
         result = fn()
@@ -22,23 +36,36 @@ class Job {
       }
     }
     const scheduleNext = () => {
-      const delay = schedule._nextDelay()
-      this._timeout =
-        delay < MAX_DELAY
-          ? setTimeout(wrapper, delay)
-          : setTimeout(scheduleNext, MAX_DELAY)
+      this._isRunning = false
+
+      if (this._isEnabled) {
+        const now = schedule._createDate()
+        scheduledDate = +next(schedule._schedule, now)
+        const delay = scheduledDate - now
+        this._timeout =
+          delay < MAX_DELAY
+            ? setTimeout(wrapper, delay)
+            : setTimeout(scheduleNext, MAX_DELAY)
+      }
     }
 
+    this._isEnabled = false
+    this._isRunning = false
     this._scheduleNext = scheduleNext
     this._timeout = undefined
   }
 
   start() {
     this.stop()
-    this._scheduleNext()
+
+    this._isEnabled = true
+    if (!this._isRunning) {
+      this._scheduleNext()
+    }
   }
 
   stop() {
+    this._isEnabled = false
     clearTimeout(this._timeout)
   }
 }
@@ -68,11 +95,6 @@ class Schedule {
     return dates
   }
 
-  _nextDelay() {
-    const now = this._createDate()
-    return next(this._schedule, now) - now
-  }
-
   startJob(fn) {
     const job = this.createJob(fn)
     job.start()

@xen-orchestra/cron/src/index.spec.js

@@ -0,0 +1,78 @@
+/* eslint-env jest */
+
+import { createSchedule } from './'
+
+const wrap = value => () => value
+
+describe('issues', () => {
+  let originalDateNow
+  beforeAll(() => {
+    originalDateNow = Date.now
+  })
+  afterAll(() => {
+    Date.now = originalDateNow
+    originalDateNow = undefined
+  })
+
+  test('stop during async execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const schedule = createSchedule('* * * * *')
+    const job = schedule.createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+
+    resolve()
+    await promise
+
+    jest.runAllTimers()
+    expect(nCalls).toBe(1)
+  })
+
+  test('stop then start during async job execution', async () => {
+    let nCalls = 0
+    let resolve, promise
+
+    const schedule = createSchedule('* * * * *')
+    const job = schedule.createJob(() => {
+      ++nCalls
+
+      // eslint-disable-next-line promise/param-names
+      promise = new Promise(r => {
+        resolve = r
+      })
+      return promise
+    })
+
+    job.start()
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+
+    expect(nCalls).toBe(1)
+
+    job.stop()
+    job.start()
+
+    resolve()
+    await promise
+
+    Date.now = wrap(+schedule.next(1)[0])
+    jest.runAllTimers()
+    expect(nCalls).toBe(2)
+  })
+})

@xen-orchestra/defined/README.md

@@ -1,49 +1,28 @@
-# ${pkg.name} [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/defined
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/defined)](https://npmjs.org/package/@xen-orchestra/defined) ![License](https://badgen.net/npm/license/@xen-orchestra/defined) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/defined)](https://bundlephobia.com/result?p=@xen-orchestra/defined) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/defined)](https://npmjs.org/package/@xen-orchestra/defined)
 
 ## Install
 
-Installation of the [npm package](https://npmjs.org/package/${pkg.name}):
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/defined):
 
 ```
-> npm install --save ${pkg.name}
-```
-
-## Usage
-
-**TODO**
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+> npm install --save @xen-orchestra/defined
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/defined/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/defined",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -34,8 +35,8 @@
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/emit-async/README.md

@@ -1,6 +1,8 @@
-# @xen-orchestra/emit-async [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/emit-async
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/emit-async)](https://npmjs.org/package/@xen-orchestra/emit-async) ![License](https://badgen.net/npm/license/@xen-orchestra/emit-async) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/emit-async)](https://bundlephobia.com/result?p=@xen-orchestra/emit-async) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/emit-async)](https://npmjs.org/package/@xen-orchestra/emit-async)
 
 ## Install
 
@@ -29,43 +31,27 @@ await ee.emitAsync('start')
 
 // by default, it will rejects as soon as one listener reject, you can customise
 // error handling though:
-await ee.emitAsync({
-  onError (error) {
-    console.warn(error)
-  }
-}, 'start')
-```
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+await ee.emitAsync(
+  {
+    onError(error) {
+      console.warn(error)
+    },
+  },
+  'start'
+)
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/emit-async/USAGE.md

@@ -0,0 +1,26 @@
+```js
+import EE from 'events'
+import emitAsync from '@xen-orchestra/emit-async'
+
+const ee = new EE()
+ee.emitAsync = emitAsync
+
+ee.on('start', async function () {
+  // whatever
+})
+
+// similar to EventEmmiter#emit() but returns a promise which resolves when all
+// listeners have resolved
+await ee.emitAsync('start')
+
+// by default, it will rejects as soon as one listener reject, you can customise
+// error handling though:
+await ee.emitAsync(
+  {
+    onError(error) {
+      console.warn(error)
+    },
+  },
+  'start'
+)
+```

@xen-orchestra/emit-async/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/emit-async",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -33,8 +34,8 @@
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/fs/README.md

@@ -0,0 +1,30 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/fs
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/fs)](https://npmjs.org/package/@xen-orchestra/fs) ![License](https://badgen.net/npm/license/@xen-orchestra/fs) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/fs)](https://bundlephobia.com/result?p=@xen-orchestra/fs) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/fs)](https://npmjs.org/package/@xen-orchestra/fs)
+
+> The File System for Xen Orchestra backups.
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/fs):
+
+```
+> npm install --global @xen-orchestra/fs
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/fs/package.json

@@ -1,7 +1,8 @@
 {
+  "private": false,
   "name": "@xen-orchestra/fs",
-  "version": "0.9.0",
-  "license": "AGPL-3.0",
+  "version": "0.10.4",
+  "license": "AGPL-3.0-or-later",
   "description": "The File System for Xen Orchestra backups.",
   "keywords": [],
   "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/fs",
@@ -18,18 +19,19 @@
     "dist/"
   ],
   "engines": {
-    "node": ">=6"
+    "node": ">=8.10"
   },
   "dependencies": {
-    "@marsaud/smb2": "^0.14.0",
-    "@sindresorhus/df": "^2.1.0",
+    "@marsaud/smb2": "^0.15.0",
+    "@sindresorhus/df": "^3.1.1",
     "@xen-orchestra/async-map": "^0.0.0",
     "decorator-synchronized": "^0.5.0",
-    "execa": "^1.0.0",
-    "fs-extra": "^8.0.1",
-    "get-stream": "^4.0.0",
+    "execa": "^4.0.2",
+    "fs-extra": "^9.0.0",
+    "get-stream": "^5.1.0",
+    "limit-concurrency-decorator": "^0.4.0",
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.12.1",
+    "promise-toolbox": "^0.15.0",
     "readable-stream": "^3.0.6",
     "through2": "^3.0.0",
     "tmp": "^0.1.0",
@@ -40,14 +42,15 @@
     "@babel/core": "^7.0.0",
     "@babel/plugin-proposal-decorators": "^7.1.6",
     "@babel/plugin-proposal-function-bind": "^7.0.0",
+    "@babel/plugin-proposal-nullish-coalescing-operator": "^7.4.4",
     "@babel/preset-env": "^7.0.0",
     "@babel/preset-flow": "^7.0.0",
     "async-iterator-to-stream": "^1.1.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^7.0.2",
     "dotenv": "^8.0.0",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -57,5 +60,9 @@
     "predev": "yarn run clean",
     "prepare": "yarn run build",
     "postversion": "npm publish"
+  },
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   }
 }

@xen-orchestra/fs/src/_mount.js

@@ -31,10 +31,7 @@ export default class MountHandler extends LocalHandler {
     }
     this._realPath = join(
       mountsDir,
-      remote.id ||
-        Math.random()
-          .toString(36)
-          .slice(2)
+      remote.id || Math.random().toString(36).slice(2)
     )
   }
 
@@ -75,9 +72,12 @@ export default class MountHandler extends LocalHandler {
 
     try {
       const { type, device, options, env } = this._params
+
+      // Linux mount is more flexible in which order the mount arguments appear.
+      // But FreeBSD requires this order of the arguments.
       await this._execa(
         'mount',
-        ['-t', type, device, realPath, '-o', options],
+        ['-o', options, '-t', type, device, realPath],
         {
           env: {
             LANG: 'C',

@xen-orchestra/fs/src/abstract.js

@@ -4,6 +4,7 @@
 import getStream from 'get-stream'
 
 import asyncMap from '@xen-orchestra/async-map'
+import limit from 'limit-concurrency-decorator'
 import path from 'path'
 import synchronized from 'decorator-synchronized'
 import { fromCallback, fromEvent, ignoreErrors, timeout } from 'promise-toolbox'
@@ -31,6 +32,7 @@ const computeRate = (hrtime: number[], size: number) => {
 }
 
 const DEFAULT_TIMEOUT = 6e5 // 10 min
+const DEFAULT_MAX_PARALLEL_OPERATIONS = 10
 
 const ignoreEnoent = error => {
   if (error == null || error.code !== 'ENOENT') {
@@ -83,6 +85,25 @@ export default class RemoteHandlerAbstract {
       }
     }
     ;({ timeout: this._timeout = DEFAULT_TIMEOUT } = options)
+
+    const sharedLimit = limit(
+      options.maxParallelOperations ?? DEFAULT_MAX_PARALLEL_OPERATIONS
+    )
+    this.closeFile = sharedLimit(this.closeFile)
+    this.getInfo = sharedLimit(this.getInfo)
+    this.getSize = sharedLimit(this.getSize)
+    this.list = sharedLimit(this.list)
+    this.mkdir = sharedLimit(this.mkdir)
+    this.openFile = sharedLimit(this.openFile)
+    this.outputFile = sharedLimit(this.outputFile)
+    this.read = sharedLimit(this.read)
+    this.readFile = sharedLimit(this.readFile)
+    this.rename = sharedLimit(this.rename)
+    this.rmdir = sharedLimit(this.rmdir)
+    this.truncate = sharedLimit(this.truncate)
+    this.unlink = sharedLimit(this.unlink)
+    this.write = sharedLimit(this.write)
+    this.writeFile = sharedLimit(this.writeFile)
   }
 
   // Public members
@@ -97,7 +118,7 @@ export default class RemoteHandlerAbstract {
   }
 
   async closeFile(fd: FileDescriptor): Promise<void> {
-    await timeout.call(this._closeFile(fd.fd), this._timeout)
+    await this.__closeFile(fd)
   }
 
   async createOutputStream(
@@ -262,30 +283,15 @@ export default class RemoteHandlerAbstract {
   }
 
   async mkdir(dir: string): Promise<void> {
-    dir = normalizePath(dir)
-    try {
-      await this._mkdir(dir)
-    } catch (error) {
-      if (error == null || error.code !== 'EEXIST') {
-        throw error
-      }
-
-      // this operation will throw if it's not already a directory
-      await this._list(dir)
-    }
+    await this.__mkdir(normalizePath(dir))
   }
 
   async mktree(dir: string): Promise<void> {
     await this._mktree(normalizePath(dir))
   }
 
-  async openFile(path: string, flags: string): Promise<FileDescriptor> {
-    path = normalizePath(path)
-
-    return {
-      fd: await timeout.call(this._openFile(path, flags), this._timeout),
-      path,
-    }
+  openFile(path: string, flags: string): Promise<FileDescriptor> {
+    return this.__openFile(path, flags)
   }
 
   async outputFile(
@@ -368,7 +374,7 @@ export default class RemoteHandlerAbstract {
   async test(): Promise<Object> {
     const SIZE = 1024 * 1024 * 10
     const testFileName = normalizePath(`${Date.now()}.test`)
-    const data = await fromCallback(cb => randomBytes(SIZE, cb))
+    const data = await fromCallback(randomBytes, SIZE)
     let step = 'write'
     try {
       const writeStart = process.hrtime()
@@ -434,6 +440,34 @@ export default class RemoteHandlerAbstract {
     await this._writeFile(normalizePath(file), data, { flags })
   }
 
+  // Methods that can be called by private methods to avoid parallel limit on public methods
+
+  async __closeFile(fd: FileDescriptor): Promise<void> {
+    await timeout.call(this._closeFile(fd.fd), this._timeout)
+  }
+
+  async __mkdir(dir: string): Promise<void> {
+    try {
+      await this._mkdir(dir)
+    } catch (error) {
+      if (error == null || error.code !== 'EEXIST') {
+        throw error
+      }
+
+      // this operation will throw if it's not already a directory
+      await this._list(dir)
+    }
+  }
+
+  async __openFile(path: string, flags: string): Promise<FileDescriptor> {
+    path = normalizePath(path)
+
+    return {
+      fd: await timeout.call(this._openFile(path, flags), this._timeout),
+      path,
+    }
+  }
+
   // Methods that can be implemented by inheriting classes
 
   async _closeFile(fd: mixed): Promise<void> {
@@ -482,7 +516,7 @@ export default class RemoteHandlerAbstract {
 
   async _mktree(dir: string): Promise<void> {
     try {
-      return await this.mkdir(dir)
+      return await this.__mkdir(dir)
     } catch (error) {
       if (error.code !== 'ENOENT') {
         throw error
@@ -565,13 +599,13 @@ export default class RemoteHandlerAbstract {
   async _write(file: File, buffer: Buffer, position: number): Promise<void> {
     const isPath = typeof file === 'string'
     if (isPath) {
-      file = await this.openFile(file, 'r+')
+      file = await this.__openFile(file, 'r+')
     }
     try {
       return await this._writeFd(file, buffer, position)
     } finally {
       if (isPath) {
-        await this.closeFile(file)
+        await this.__closeFile(file)
       }
     }
   }
@@ -614,7 +648,7 @@ function createPrefixWrapperMethods() {
       return
     }
 
-    descriptor.value = function() {
+    descriptor.value = function () {
       let path
       if (arguments.length !== 0 && typeof (path = arguments[0]) === 'string') {
         arguments[0] = this._resolve(path)

@xen-orchestra/fs/src/fs.spec.js

@@ -28,7 +28,7 @@ const unsecureRandomBytes = n => {
 
 const TEST_DATA_LEN = 1024
 const TEST_DATA = unsecureRandomBytes(TEST_DATA_LEN)
-const createTestDataStream = asyncIteratorToStream(function*() {
+const createTestDataStream = asyncIteratorToStream(function* () {
   yield TEST_DATA
 })
 
@@ -86,7 +86,7 @@ handlers.forEach(url => {
     describe('#createOutputStream()', () => {
       it('creates parent dir if missing', async () => {
         const stream = await handler.createOutputStream('dir/file')
-        await fromCallback(cb => pipeline(createTestDataStream(), stream, cb))
+        await fromCallback(pipeline, createTestDataStream(), stream)
         await expect(await handler.readFile('dir/file')).toEqual(TEST_DATA)
       })
     })
@@ -106,7 +106,7 @@ handlers.forEach(url => {
     describe('#createWriteStream()', () => {
       testWithFileDescriptor('file', 'wx', async ({ file, flags }) => {
         const stream = await handler.createWriteStream(file, { flags })
-        await fromCallback(cb => pipeline(createTestDataStream(), stream, cb))
+        await fromCallback(pipeline, createTestDataStream(), stream)
         await expect(await handler.readFile('file')).toEqual(TEST_DATA)
       })
 
@@ -219,6 +219,12 @@ handlers.forEach(url => {
         const error = await rejectionOf(handler.outputFile('file', ''))
         expect(error.code).toBe('EEXIST')
       })
+
+      it("shouldn't timeout in case of the respect of the parallel execution restriction", async () => {
+        const handler = getHandler({ url }, { maxParallelOperations: 1 })
+        await handler.sync()
+        await handler.outputFile(`xo-fs-tests-${Date.now()}/test`, '')
+      }, 40)
     })
 
     describe('#read()', () => {

@xen-orchestra/fs/src/local.js

@@ -47,8 +47,19 @@ export default class LocalHandler extends RemoteHandlerAbstract {
     })
   }
 
-  _getInfo() {
-    return df.file(this._getFilePath('/'))
+  async _getInfo() {
+    // df.file() resolves with an object with the following properties:
+    // filesystem, type, size, used, available, capacity and mountpoint.
+    // size, used, available and capacity may be `NaN` so we remove any `NaN`
+    // value from the object.
+    const info = await df.file(this._getFilePath('/'))
+    Object.keys(info).forEach(key => {
+      if (Number.isNaN(info[key])) {
+        delete info[key]
+      }
+    })
+
+    return info
   }
 
   async _getSize(file) {

@xen-orchestra/log/README.md

@@ -1,6 +1,8 @@
-# @xen-orchestra/log [![Build Status](https://travis-ci.org/vatesfr/xen-orchestra.png?branch=master)](https://travis-ci.org/vatesfr/xen-orchestra)
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/log
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/log)](https://npmjs.org/package/@xen-orchestra/log) ![License](https://badgen.net/npm/license/@xen-orchestra/log) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/log)](https://bundlephobia.com/result?p=@xen-orchestra/log) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/log)](https://npmjs.org/package/@xen-orchestra/log)
 
 ## Install
 
@@ -15,7 +17,7 @@ Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/log):
 Everywhere something should be logged:
 
 ```js
-import createLogger from '@xen-orchestra/log'
+import { createLogger } from '@xen-orchestra/log'
 
 const log = createLogger('my-module')
 
@@ -24,11 +26,25 @@ log.info('this information is relevant to the user')
 log.warn('something went wrong but did not prevent current action')
 log.error('something went wrong')
 log.fatal('service/app is going down')
+
+// you can add contextual info
+log.debug('new API request', {
+  method: 'foo',
+  params: [ 'bar', 'baz' ]
+  user: 'qux'
+})
+
+// by convention, errors go into the `error` field
+log.error('could not join server', {
+  error,
+  server: 'example.org',
+})
 ```
 
 Then, at application level, configure the logs are handled:
 
 ```js
+import { createLogger } from '@xen-orchestra/log'
 import { configure, catchGlobalErrors } from '@xen-orchestra/log/configure'
 import transportConsole from '@xen-orchestra/log/transports/console'
 import transportEmail from '@xen-orchestra/log/transports/email'
@@ -37,13 +53,10 @@ const transport = transportEmail({
   service: 'gmail',
   auth: {
     user: 'jane.smith@gmail.com',
-    pass: 'H&NbECcpXF|pyXe#%ZEb'
+    pass: 'H&NbECcpXF|pyXe#%ZEb',
   },
   from: 'jane.smith@gmail.com',
-  to: [
-    'jane.smith@gmail.com',
-    'sam.doe@yahoo.com'
-  ]
+  to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
 })
 
 configure([
@@ -53,19 +66,19 @@ configure([
     // matched against the namespace of the logs
     filter: process.env.DEBUG,
 
-    transport: transportConsole()
+    transport: transportConsole(),
   },
   {
     // only levels >= warn
     level: 'warn',
 
-    transport
-  }
+    transport,
+  },
 ])
 
 // send all global errors (uncaught exceptions, warnings, unhandled rejections)
-// to this transport
-catchGlobalErrors(transport)
+// to this logger
+catchGlobalErrors(createLogger('app'))
 ```
 
 ### Transports
@@ -91,18 +104,17 @@ Configuration:
 ```js
 import transportEmail from '@xen-orchestra/log/transports/email'
 
-configure(transportEmail({
-  service: 'gmail',
-  auth: {
-    user: 'jane.smith@gmail.com',
-    pass: 'H&NbECcpXF|pyXe#%ZEb'
-  },
-  from: 'jane.smith@gmail.com',
-  to: [
-    'jane.smith@gmail.com',
-    'sam.doe@yahoo.com'
-  ]
-}))
+configure(
+  transportEmail({
+    service: 'gmail',
+    auth: {
+      user: 'jane.smith@gmail.com',
+      pass: 'H&NbECcpXF|pyXe#%ZEb',
+    },
+    from: 'jane.smith@gmail.com',
+    to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+  })
+)
 ```
 
 #### Syslog
@@ -125,36 +137,17 @@ configure(transportSyslog())
 configure(transportSyslog('tcp://syslog.company.lan'))
 ```
 
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
-```
-
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](https://github.com/vatesfr/xo-web/issues/)
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-ISC © [Vates SAS](https://vates.fr)
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/log/USAGE.md

@@ -0,0 +1,122 @@
+Everywhere something should be logged:
+
+```js
+import { createLogger } from '@xen-orchestra/log'
+
+const log = createLogger('my-module')
+
+log.debug('only useful for debugging')
+log.info('this information is relevant to the user')
+log.warn('something went wrong but did not prevent current action')
+log.error('something went wrong')
+log.fatal('service/app is going down')
+
+// you can add contextual info
+log.debug('new API request', {
+  method: 'foo',
+  params: [ 'bar', 'baz' ]
+  user: 'qux'
+})
+
+// by convention, errors go into the `error` field
+log.error('could not join server', {
+  error,
+  server: 'example.org',
+})
+```
+
+Then, at application level, configure the logs are handled:
+
+```js
+import { createLogger } from '@xen-orchestra/log'
+import { configure, catchGlobalErrors } from '@xen-orchestra/log/configure'
+import transportConsole from '@xen-orchestra/log/transports/console'
+import transportEmail from '@xen-orchestra/log/transports/email'
+
+const transport = transportEmail({
+  service: 'gmail',
+  auth: {
+    user: 'jane.smith@gmail.com',
+    pass: 'H&NbECcpXF|pyXe#%ZEb',
+  },
+  from: 'jane.smith@gmail.com',
+  to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+})
+
+configure([
+  {
+    // if filter is a string, then it is pattern
+    // (https://github.com/visionmedia/debug#wildcards) which is
+    // matched against the namespace of the logs
+    filter: process.env.DEBUG,
+
+    transport: transportConsole(),
+  },
+  {
+    // only levels >= warn
+    level: 'warn',
+
+    transport,
+  },
+])
+
+// send all global errors (uncaught exceptions, warnings, unhandled rejections)
+// to this logger
+catchGlobalErrors(createLogger('app'))
+```
+
+### Transports
+
+#### Console
+
+```js
+import transportConsole from '@xen-orchestra/log/transports/console'
+
+configure(transportConsole())
+```
+
+#### Email
+
+Optional dependency:
+
+```
+> yarn add nodemailer pretty-format
+```
+
+Configuration:
+
+```js
+import transportEmail from '@xen-orchestra/log/transports/email'
+
+configure(
+  transportEmail({
+    service: 'gmail',
+    auth: {
+      user: 'jane.smith@gmail.com',
+      pass: 'H&NbECcpXF|pyXe#%ZEb',
+    },
+    from: 'jane.smith@gmail.com',
+    to: ['jane.smith@gmail.com', 'sam.doe@yahoo.com'],
+  })
+)
+```
+
+#### Syslog
+
+Optional dependency:
+
+```
+> yarn add split-host syslog-client
+```
+
+Configuration:
+
+```js
+import transportSyslog from '@xen-orchestra/log/transports/syslog'
+
+// By default, log to udp://localhost:514
+configure(transportSyslog())
+
+// But TCP, a different host, or a different port can be used
+configure(transportSyslog('tcp://syslog.company.lan'))
+```

@xen-orchestra/log/package.json

@@ -1,6 +1,7 @@
 {
+  "private": false,
   "name": "@xen-orchestra/log",
-  "version": "0.1.4",
+  "version": "0.2.0",
   "license": "ISC",
   "description": "",
   "keywords": [],
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -31,16 +32,16 @@
   },
   "dependencies": {
     "lodash": "^4.17.4",
-    "promise-toolbox": "^0.12.1"
+    "promise-toolbox": "^0.15.0"
   },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
+    "cross-env": "^7.0.2",
     "index-modules": "^0.3.0",
-    "rimraf": "^2.6.2"
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -48,7 +49,7 @@
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
     "prebuild": "yarn run clean",
     "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build",
+    "prepare": "yarn run build",
     "postversion": "npm publish"
   }
 }

@xen-orchestra/log/src/configure.js

@@ -12,14 +12,15 @@ const createTransport = config => {
   if (Array.isArray(config)) {
     const transports = config.map(createTransport)
     const { length } = transports
-    return function() {
+    return function () {
       for (let i = 0; i < length; ++i) {
         transports[i].apply(this, arguments)
       }
     }
   }
 
-  let { filter, transport } = config
+  let { filter } = config
+  let transport = createTransport(config.transport)
   const level = resolve(config.level)
 
   if (filter !== undefined) {
@@ -29,14 +30,14 @@ const createTransport = config => {
     }
 
     const orig = transport
-    transport = function(log) {
+    transport = function (log) {
       if ((level !== undefined && log.level >= level) || filter(log)) {
         return orig.apply(this, arguments)
       }
     }
   } else if (level !== undefined) {
     const orig = transport
-    transport = function(log) {
+    transport = function (log) {
       if (log.level >= level) {
         return orig.apply(this, arguments)
       }
@@ -51,11 +52,12 @@ const symbol =
     ? Symbol.for('@xen-orchestra/log')
     : '@@@xen-orchestra/log'
 
+const { env } = process
 global[symbol] = createTransport({
   // display warnings or above, and all that are enabled via DEBUG or
   // NODE_DEBUG env
-  filter: process.env.DEBUG || process.env.NODE_DEBUG,
-  level: LEVELS.INFO,
+  filter: [env.DEBUG, env.NODE_DEBUG].filter(Boolean).join(','),
+  level: resolve(env.LOG_LEVEL, LEVELS.INFO),
 
   transport: createConsoleTransport(),
 })

@xen-orchestra/log/src/index.js

@@ -1,5 +1,5 @@
 import createTransport from './transports/console'
-import LEVELS from './levels'
+import LEVELS, { resolve } from './levels'
 
 const symbol =
   typeof Symbol !== 'undefined'
@@ -9,7 +9,8 @@ if (!(symbol in global)) {
   // the default behavior, without requiring `configure` is to avoid
   // logging anything unless it's a real error
   const transport = createTransport()
-  global[symbol] = log => log.level > LEVELS.WARN && transport(log)
+  const level = resolve(process.env.LOG_LEVEL, LEVELS.WARN)
+  global[symbol] = log => log.level >= level && transport(log)
 }
 
 // -------------------------------------------------------------------
@@ -37,7 +38,7 @@ const { prototype } = Logger
 for (const name in LEVELS) {
   const level = LEVELS[name]
 
-  prototype[name.toLowerCase()] = function(message, data) {
+  prototype[name.toLowerCase()] = function (message, data) {
     if (typeof message !== 'string') {
       if (message instanceof Error) {
         data = { error: message }
@@ -53,13 +54,13 @@ for (const name in LEVELS) {
   }
 }
 
-prototype.wrap = function(message, fn) {
+prototype.wrap = function (message, fn) {
   const logger = this
   const warnAndRethrow = error => {
     logger.warn(message, { error })
     throw error
   }
-  return function() {
+  return function () {
     try {
       const result = fn.apply(this, arguments)
       const then = result != null && result.then
@@ -72,5 +73,5 @@ prototype.wrap = function(message, fn) {
   }
 }
 
-const createLogger = namespace => new Logger(namespace)
+export const createLogger = namespace => new Logger(namespace)
 export { createLogger as default }

@xen-orchestra/log/src/levels.js

@@ -13,11 +13,22 @@ for (const name in LEVELS) {
   NAMES[LEVELS[name]] = name
 }
 
-export const resolve = level => {
-  if (typeof level === 'string') {
-    level = LEVELS[level.toUpperCase()]
+// resolves to the number representation of a level
+//
+// returns `defaultLevel` if invalid
+export const resolve = (level, defaultLevel) => {
+  const type = typeof level
+  if (type === 'number') {
+    if (level in NAMES) {
+      return level
+    }
+  } else if (type === 'string') {
+    const nLevel = LEVELS[level.toUpperCase()]
+    if (nLevel !== undefined) {
+      return nLevel
+    }
   }
-  return level
+  return defaultLevel
 }
 
 Object.freeze(LEVELS)

@xen-orchestra/log/src/transports/console.js

@@ -1,24 +1,107 @@
 import LEVELS, { NAMES } from '../levels'
 
-// Bind console methods (necessary for browsers)
-const debugConsole = console.log.bind(console)
-const infoConsole = console.info.bind(console)
-const warnConsole = console.warn.bind(console)
-const errorConsole = console.error.bind(console)
+const { DEBUG, ERROR, FATAL, INFO, WARN } = LEVELS
 
-const { ERROR, INFO, WARN } = LEVELS
+let formatLevel, formatNamespace
+if (
+  process.stdout !== undefined &&
+  process.stdout.isTTY &&
+  process.stderr !== undefined &&
+  process.stderr.isTTY
+) {
+  const ansi = (style, str) => `\x1b[${style}m${str}\x1b[0m`
+
+  const LEVEL_STYLES = {
+    [DEBUG]: '2',
+    [ERROR]: '1;31',
+    [FATAL]: '1;31',
+    [INFO]: '1',
+    [WARN]: '1;33',
+  }
+  formatLevel = level => {
+    const style = LEVEL_STYLES[level]
+    const name = NAMES[level]
+    return style === undefined ? name : ansi(style, name)
+  }
+
+  const NAMESPACE_COLORS = [
+    196,
+    202,
+    208,
+    214,
+    220,
+    226,
+    190,
+    154,
+    118,
+    82,
+    46,
+    47,
+    48,
+    49,
+    50,
+    51,
+    45,
+    39,
+    33,
+    27,
+    21,
+    57,
+    93,
+    129,
+    165,
+    201,
+    200,
+    199,
+    198,
+    197,
+  ]
+  formatNamespace = namespace => {
+    // https://werxltd.com/wp/2010/05/13/javascript-implementation-of-javas-string-hashcode-method/
+    let hash = 0
+    for (let i = 0, n = namespace.length; i < n; ++i) {
+      hash = ((hash << 5) - hash + namespace.charCodeAt(i)) | 0
+    }
+    // // select a hue (HSV)
+    // const h = (Math.abs(hash) % 20) * 18
+    // // convert to RGB
+    // const f = (n, k = (n + h / 60) % 6) =>
+    //   Math.round(255 * (1 - Math.max(Math.min(k, 4 - k, 1), 0)))
+    // const r = f(5)
+    // const g = f(3)
+    // const b = f(1)
+    // return ansi(`38;2;${r};${g};${b}`, namespace)
+    return ansi(
+      `1;38;5;${NAMESPACE_COLORS[Math.abs(hash) % NAMESPACE_COLORS.length]}`,
+      namespace
+    )
+  }
+} else {
+  formatLevel = str => NAMES[str]
+  formatNamespace = str => str
+}
 
 const consoleTransport = ({ data, level, namespace, message, time }) => {
   const fn =
+    /* eslint-disable no-console */
     level < INFO
-      ? debugConsole
+      ? console.log
       : level < WARN
-      ? infoConsole
+      ? console.info
       : level < ERROR
-      ? warnConsole
-      : errorConsole
+      ? console.warn
+      : console.error
+  /* eslint-enable no-console */
 
-  fn('%s - %s - [%s] %s', time.toISOString(), namespace, NAMES[level], message)
-  data != null && fn(data)
+  const args = [
+    time.toISOString(),
+    formatNamespace(namespace),
+    formatLevel(level),
+    message,
+  ]
+  if (data != null) {
+    args.push(data)
+  }
+  fn.apply(console, args)
 }
 export default () => consoleTransport

@xen-orchestra/log/src/transports/syslog.js

@@ -1,7 +1,6 @@
 import fromCallback from 'promise-toolbox/fromCallback'
-import splitHost from 'split-host' // eslint-disable-line node/no-extraneous-import node/no-missing-import
-import startsWith from 'lodash/startsWith'
-import { createClient, Facility, Severity, Transport } from 'syslog-client' // eslint-disable-line node/no-extraneous-import node/no-missing-import
+import splitHost from 'split-host'
+import { createClient, Facility, Severity, Transport } from 'syslog-client'
 
 import LEVELS from '../levels'
 
@@ -19,10 +18,10 @@ const facility = Facility.User
 export default target => {
   const opts = {}
   if (target !== undefined) {
-    if (startsWith(target, 'tcp://')) {
+    if (target.startsWith('tcp://')) {
       target = target.slice(6)
       opts.transport = Transport.Tcp
-    } else if (startsWith(target, 'udp://')) {
+    } else if (target.startsWith('udp://')) {
       target = target.slice(6)
       opts.transport = Transport.Udp
     }

@xen-orchestra/log/src/utils.js

@@ -13,10 +13,7 @@ export const evalTemplate = (tpl, data) => {
 // -------------------------------------------------------------------
 
 const compileGlobPatternFragment = pattern =>
-  pattern
-    .split('*')
-    .map(escapeRegExp)
-    .join('.*')
+  pattern.split('*').map(escapeRegExp).join('.*')
 
 export const compileGlobPattern = pattern => {
   const no = []

@xen-orchestra/mixin/README.md

@@ -1,49 +1,28 @@
-# ${pkg.name} [![Build Status](https://travis-ci.org/${pkg.shortGitHubPath}.png?branch=master)](https://travis-ci.org/${pkg.shortGitHubPath})
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
 
-> ${pkg.description}
+# @xen-orchestra/mixin
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/mixin)](https://npmjs.org/package/@xen-orchestra/mixin) ![License](https://badgen.net/npm/license/@xen-orchestra/mixin) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/mixin)](https://bundlephobia.com/result?p=@xen-orchestra/mixin) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/mixin)](https://npmjs.org/package/@xen-orchestra/mixin)
 
 ## Install
 
-Installation of the [npm package](https://npmjs.org/package/${pkg.name}):
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/mixin):
 
 ```
-> npm install --save ${pkg.name}
-```
-
-## Usage
-
-**TODO**
-
-## Development
-
-```
-# Install dependencies
-> yarn
-
-# Run the tests
-> yarn test
-
-# Continuously compile
-> yarn dev
-
-# Continuously run the tests
-> yarn dev-test
-
-# Build for production (automatically called by npm install)
-> yarn build
+> npm install --save @xen-orchestra/mixin
 ```
 
 ## Contributions
 
-Contributions are *very* welcomed, either on the documentation or on
+Contributions are _very_ welcomed, either on the documentation or on
 the code.
 
 You may:
 
-- report any [issue](${pkg.bugs})
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
   you've encountered;
 - fork and create a pull request.
 
 ## License
 
-${pkg.license} © [${pkg.author.name}](${pkg.author.url})
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/mixin/package.json

@@ -1,4 +1,5 @@
 {
+  "private": false,
   "name": "@xen-orchestra/mixin",
   "version": "0.0.0",
   "license": "ISC",
@@ -12,8 +13,8 @@
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Julien Fontanet",
-    "email": "julien.fontanet@vates.fr"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
@@ -36,8 +37,8 @@
     "@babel/preset-env": "^7.0.0",
     "babel-plugin-dev": "^1.0.0",
     "babel-plugin-lodash": "^3.3.2",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.6.2"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",

@xen-orchestra/self-signed/README.md

@@ -0,0 +1,46 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/self-signed
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/self-signed)](https://npmjs.org/package/@xen-orchestra/self-signed) ![License](https://badgen.net/npm/license/@xen-orchestra/self-signed) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/self-signed)](https://bundlephobia.com/result?p=@xen-orchestra/self-signed) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/self-signed)](https://npmjs.org/package/@xen-orchestra/self-signed)
+
+> Minimalist wrapper around openssl to generate a self signed certificate
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/self-signed):
+
+```
+> npm install --save @xen-orchestra/self-signed
+```
+
+## Usage
+
+```js
+import { genSelfSigned } from '@xen-orchestra/self-signed'
+
+console.log(await genSelfSigned())
+// {
+//   cert: '-----BEGIN CERTIFICATE-----\n' +
+//     // content…
+//     '-----END CERTIFICATE-----\n',
+//   key: '-----BEGIN RSA PRIVATE KEY-----\n' +
+//     // content…
+//     '-----END RSA PRIVATE KEY-----\n'
+// }
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/self-signed/USAGE.md

@@ -0,0 +1,13 @@
+```js
+import { genSelfSigned } from '@xen-orchestra/self-signed'
+
+console.log(await genSelfSigned())
+// {
+//   cert: '-----BEGIN CERTIFICATE-----\n' +
+//     // content…
+//     '-----END CERTIFICATE-----\n',
+//   key: '-----BEGIN RSA PRIVATE KEY-----\n' +
+//     // content…
+//     '-----END RSA PRIVATE KEY-----\n'
+// }
+```

@xen-orchestra/self-signed/index.js

@@ -0,0 +1,25 @@
+const { execFile } = require('child_process')
+
+const openssl = (cmd, args, { input, ...opts } = {}) =>
+  new Promise((resolve, reject) => {
+    const child = execFile('openssl', [cmd, ...args], opts, (error, stdout) =>
+      error != null ? reject(error) : resolve(stdout)
+    )
+    if (input !== undefined) {
+      child.stdin.end(input)
+    }
+  })
+
+exports.genSelfSignedCert = async () => {
+  const key = await openssl('genrsa', ['2048'])
+  return {
+    cert: await openssl(
+      'req',
+      ['-batch', '-new', '-key', '-', '-x509', '-days', '360', '-nodes'],
+      {
+        input: key,
+      }
+    ),
+    key,
+  }
+}

@xen-orchestra/self-signed/package.json

@@ -0,0 +1,24 @@
+{
+  "private": false,
+  "name": "@xen-orchestra/self-signed",
+  "description": "Minimalist wrapper around openssl to generate a self signed certificate",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/self-signed",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/self-signed",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "version": "0.1.0",
+  "engines": {
+    "node": ">=8.10"
+  },
+  "scripts": {
+    "postversion": "npm publish --access public"
+  },
+  "license": "ISC",
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/template/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/template/README.md

@@ -0,0 +1,50 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/template
+
+[![Package Version](https://badgen.net/npm/v/@xen-orchestra/template)](https://npmjs.org/package/@xen-orchestra/template) ![License](https://badgen.net/npm/license/@xen-orchestra/template) [![PackagePhobia](https://badgen.net/bundlephobia/minzip/@xen-orchestra/template)](https://bundlephobia.com/result?p=@xen-orchestra/template) [![Node compatibility](https://badgen.net/npm/node/@xen-orchestra/template)](https://npmjs.org/package/@xen-orchestra/template)
+
+## Install
+
+Installation of the [npm package](https://npmjs.org/package/@xen-orchestra/template):
+
+```
+> npm install --save @xen-orchestra/template
+```
+
+## Usage
+
+Create a string replacer based on a pattern and a list of rules.
+
+```js
+const myReplacer = compileTemplate('{name}_COPY_{name}_{id}_%%', {
+  '{name}': vm => vm.name_label,
+  '{id}': vm => vm.id,
+  '%': (_, i) => i,
+})
+
+const newString = myReplacer(
+  {
+    name_label: 'foo',
+    id: 42,
+  },
+  32
+)
+
+newString === 'foo_COPY_{name}_42_32%' // true
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[ISC](https://spdx.org/licenses/ISC) © [Vates SAS](https://vates.fr)

@xen-orchestra/template/USAGE.md

@@ -0,0 +1,19 @@
+Create a string replacer based on a pattern and a list of rules.
+
+```js
+const myReplacer = compileTemplate('{name}_COPY_{name}_{id}_%%', {
+  '{name}': vm => vm.name_label,
+  '{id}': vm => vm.id,
+  '%': (_, i) => i,
+})
+
+const newString = myReplacer(
+  {
+    name_label: 'foo',
+    id: 42,
+  },
+  32
+)
+
+newString === 'foo_COPY_{name}_42_32%' // true
+```

@xen-orchestra/template/package.json

@@ -1,46 +1,36 @@
 {
-  "name": "xo-server-cloud",
-  "version": "0.2.4",
+  "private": false,
+  "name": "@xen-orchestra/template",
+  "version": "0.1.0",
   "license": "ISC",
-  "description": "",
-  "keywords": [
-    "cloud",
-    "orchestra",
-    "plugin",
-    "xen",
-    "xen-orchestra",
-    "xo-server"
-  ],
-  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/packages/xo-server-cloud",
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/template",
   "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
   "repository": {
-    "directory": "packages/xo-server-cloud",
+    "directory": "@xen-orchestra/template",
     "type": "git",
     "url": "https://github.com/vatesfr/xen-orchestra.git"
   },
   "author": {
-    "name": "Pierre Donias",
-    "email": "pierre.donias@gmail.com"
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
   },
   "preferGlobal": false,
   "main": "dist/",
-  "bin": {},
   "files": [
     "dist/"
   ],
+  "browserslist": [
+    ">2%"
+  ],
   "engines": {
     "node": ">=6"
   },
-  "dependencies": {
-    "http-request-plus": "^0.8.0",
-    "jsonrpc-websocket-client": "^0.5.0"
-  },
   "devDependencies": {
     "@babel/cli": "^7.0.0",
     "@babel/core": "^7.0.0",
     "@babel/preset-env": "^7.0.0",
-    "cross-env": "^5.1.3",
-    "rimraf": "^2.5.4"
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
   },
   "scripts": {
     "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
@@ -48,7 +38,10 @@
     "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
     "prebuild": "yarn run clean",
     "predev": "yarn run prebuild",
-    "prepublishOnly": "yarn run build"
+    "prepublishOnly": "yarn run build",
+    "postversion": "npm publish --access public"
   },
-  "private": true
+  "dependencies": {
+    "lodash": "^4.17.15"
+  }
 }

@xen-orchestra/template/src/index.js

@@ -0,0 +1,19 @@
+import escapeRegExp from 'lodash/escapeRegExp'
+
+const compareLengthDesc = (a, b) => b.length - a.length
+
+export function compileTemplate(pattern, rules) {
+  const matches = Object.keys(rules)
+    .sort(compareLengthDesc)
+    .map(escapeRegExp)
+    .join('|')
+  const regExp = new RegExp(`\\\\(?:\\\\|${matches})|${matches}`, 'g')
+  return (...params) =>
+    pattern.replace(regExp, match => {
+      if (match[0] === '\\') {
+        return match.slice(1)
+      }
+      const rule = rules[match]
+      return typeof rule === 'function' ? rule(...params) : rule
+    })
+}

@xen-orchestra/template/src/index.spec.js

@@ -0,0 +1,14 @@
+/* eslint-env jest */
+import { compileTemplate } from '.'
+
+it("correctly replaces the template's variables", () => {
+  const replacer = compileTemplate(
+    '{property}_\\{property}_\\\\{property}_{constant}_%_FOO',
+    {
+      '{property}': obj => obj.name,
+      '{constant}': 1235,
+      '%': (_, i) => i,
+    }
+  )
+  expect(replacer({ name: 'bar' }, 5)).toBe('bar_{property}_\\bar_1235_5_FOO')
+})

@xen-orchestra/upload-ova/.babelrc.js

@@ -0,0 +1,3 @@
+module.exports = require('../../@xen-orchestra/babel-config')(
+  require('./package.json')
+)

@xen-orchestra/upload-ova/.npmignore

@@ -0,0 +1,24 @@
+/benchmark/
+/benchmarks/
+*.bench.js
+*.bench.js.map
+
+/examples/
+example.js
+example.js.map
+*.example.js
+*.example.js.map
+
+/fixture/
+/fixtures/
+*.fixture.js
+*.fixture.js.map
+*.fixtures.js
+*.fixtures.js.map
+
+/test/
+/tests/
+*.spec.js
+*.spec.js.map
+
+__snapshots__/

@xen-orchestra/upload-ova/README.md

@@ -0,0 +1,63 @@
+<!-- DO NOT EDIT MANUALLY, THIS FILE HAS BEEN GENERATED -->
+
+# @xen-orchestra/upload-ova
+
+> Basic CLI to upload ova files to Xen-Orchestra
+
+## Usage
+
+```
+Usage:
+
+  xo-upload-ova --register [--expiresIn duration] <XO-Server URL> <username> [<password>]
+    Registers the XO instance to use.
+
+    --expiresIn duration
+      Can be used to change the validity duration of the
+      authorization token (default: one month).
+
+  xo-upload-ova --unregister
+    Remove stored credentials.
+
+  xo-upload-ova --inspect <file>
+    Displays the data that would be imported from the ova.
+
+  xo-upload-ova --upload <file> <sr> [--override <key>=<value> [<key>=<value>]+]
+    Actually imports the VM contained in <file> to the Storage Repository <sr>.
+    Some parameters can be overridden from the file, consult --inspect to get the list.
+    Note: --override has to come last. By default arguments are string, prefix them with <json:> to type
+    them, ex. " --override nameLabel='new VM'  memory=json:67108864 disks.vmdisk1.capacity=json:134217728"
+
+xo-upload-ova v0.1.0
+
+```
+
+#### Register your XO instance
+
+```
+> xo-upload-ova --register http://xo.my-company.net admin@admin.net admin
+Successfully logged with admin@admin.net
+```
+
+Note: only a token will be saved in the configuration file.
+
+#### Import your .ova file
+
+```
+> xo-upload-ova --upload dsl.ova a7c630bf-b38c-489e-d3c3-e62507948980 --override 'nameLabel=dsl ' descriptionLabel='short desc' memory=json:671088640 disks.vmdisk1.descriptionLabel='disk description' disks.vmdisk1.capacity=json:1342177280
+```
+
+## Contributions
+
+Contributions are _very_ welcomed, either on the documentation or on
+the code.
+
+You may:
+
+- report any [issue](https://github.com/vatesfr/xen-orchestra/issues)
+  you've encountered;
+- fork and create a pull request.
+
+## License
+
+[AGPL-3.0-or-later](https://spdx.org/licenses/AGPL-3.0-or-later) © [Vates SAS](https://vates.fr)

@xen-orchestra/upload-ova/USAGE.md

@@ -0,0 +1,40 @@
+```
+Usage:
+
+  xo-upload-ova --register [--expiresIn duration] <XO-Server URL> <username> [<password>]
+    Registers the XO instance to use.
+
+    --expiresIn duration
+      Can be used to change the validity duration of the
+      authorization token (default: one month).
+
+  xo-upload-ova --unregister
+    Remove stored credentials.
+
+  xo-upload-ova --inspect <file>
+    Displays the data that would be imported from the ova.
+
+  xo-upload-ova --upload <file> <sr> [--override <key>=<value> [<key>=<value>]+]
+    Actually imports the VM contained in <file> to the Storage Repository <sr>.
+    Some parameters can be overridden from the file, consult --inspect to get the list.
+    Note: --override has to come last. By default arguments are string, prefix them with <json:> to type
+    them, ex. " --override nameLabel='new VM'  memory=json:67108864 disks.vmdisk1.capacity=json:134217728"
+
+xo-upload-ova v0.1.0
+
+```
+
+#### Register your XO instance
+
+```
+> xo-upload-ova --register http://xo.my-company.net admin@admin.net admin
+Successfully logged with admin@admin.net
+```
+
+Note: only a token will be saved in the configuration file.
+
+#### Import your .ova file
+
+```
+> xo-upload-ova --upload dsl.ova a7c630bf-b38c-489e-d3c3-e62507948980 --override 'nameLabel=dsl ' descriptionLabel='short desc' memory=json:671088640 disks.vmdisk1.descriptionLabel='disk description' disks.vmdisk1.capacity=json:1342177280
+```

@xen-orchestra/upload-ova/package.json

@@ -0,0 +1,75 @@
+{
+  "name": "@xen-orchestra/upload-ova",
+  "version": "0.1.3",
+  "license": "AGPL-3.0-or-later",
+  "description": "Basic CLI to upload ova files to Xen-Orchestra",
+  "keywords": [
+    "import",
+    "orchestra",
+    "ova",
+    "xcp-ng",
+    "xcp",
+    "xen-orchestra",
+    "xen-server",
+    "xen",
+    "xo"
+  ],
+  "homepage": "https://github.com/vatesfr/xen-orchestra/tree/master/@xen-orchestra/upload-ova",
+  "bugs": "https://github.com/vatesfr/xen-orchestra/issues",
+  "repository": {
+    "directory": "@xen-orchestra/upload-ova",
+    "type": "git",
+    "url": "https://github.com/vatesfr/xen-orchestra.git"
+  },
+  "preferGlobal": true,
+  "main": "dist/",
+  "bin": {
+    "xo-upload-ova": "dist/index.js"
+  },
+  "files": [
+    "dist/"
+  ],
+  "engines": {
+    "node": ">=8.10"
+  },
+  "dependencies": {
+    "chalk": "^2.2.0",
+    "exec-promise": "^0.7.0",
+    "fs-extra": "^9.0.0",
+    "fs-promise": "^2.0.3",
+    "get-stream": "^4.1.0",
+    "http-request-plus": "^0.8.0",
+    "human-format": "^0.10.0",
+    "l33teral": "^3.0.3",
+    "lodash": "^4.17.4",
+    "nice-pipe": "0.0.0",
+    "pretty-ms": "^4.0.0",
+    "progress-stream": "^2.0.0",
+    "pw": "^0.0.4",
+    "strip-indent": "^2.0.0",
+    "xdg-basedir": "^3.0.0",
+    "xo-lib": "^0.9.0",
+    "xo-vmdk-to-vhd": "^1.2.0"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.0.0",
+    "@babel/core": "^7.0.0",
+    "@babel/preset-env": "^7.0.0",
+    "@babel/preset-flow": "^7.0.0",
+    "babel-plugin-lodash": "^3.3.2",
+    "cross-env": "^7.0.2",
+    "rimraf": "^3.0.0"
+  },
+  "scripts": {
+    "build": "cross-env NODE_ENV=production babel --source-maps --out-dir=dist/ src/",
+    "dev": "cross-env NODE_ENV=development babel --watch --source-maps --out-dir=dist/ src/",
+    "prebuild": "rimraf dist/",
+    "predev": "yarn run prebuild",
+    "prepublishOnly": "yarn run build"
+  },
+  "private": true,
+  "author": {
+    "name": "Vates SAS",
+    "url": "https://vates.fr"
+  }
+}

@xen-orchestra/upload-ova/src/config.js

@@ -0,0 +1,44 @@
+'use strict'
+
+// ===================================================================
+
+import assign from 'lodash/assign'
+import l33t from 'l33teral'
+import xdgBasedir from 'xdg-basedir'
+
+import { mkdirp, readFile, writeFile } from 'fs-extra'
+
+const configPath = xdgBasedir.config + '/xo-upload-ova'
+const configFile = configPath + '/config.json'
+
+export async function load() {
+  try {
+    return JSON.parse(await readFile(configFile))
+  } catch (e) {
+    return {}
+  }
+}
+
+export async function get(path) {
+  const config = await load()
+  return l33t(config).tap(path)
+}
+
+export async function save(config) {
+  await mkdirp(configPath)
+  await writeFile(configFile, JSON.stringify(config))
+}
+
+export async function set(data) {
+  const config = await load()
+  await save(assign(config, data))
+}
+
+export async function unset(paths) {
+  const config = await load()
+  const l33tConfig = l33t(config)
+  ;[].concat(paths).forEach(function (path) {
+    l33tConfig.purge(path, true)
+  })
+  return save(config)
+}

@xen-orchestra/upload-ova/src/index.js

@@ -0,0 +1,308 @@
+#!/usr/bin/env node
+
+/* eslint no-console: "off" */
+
+import chalk from 'chalk'
+import execPromise from 'exec-promise'
+import { createReadStream } from 'fs'
+import { stat } from 'fs-promise'
+import getStream from 'get-stream'
+import hrp from 'http-request-plus'
+import humanFormat from 'human-format'
+import l33t from 'l33teral'
+import isObject from 'lodash/isObject'
+import getKeys from 'lodash/keys'
+import startsWith from 'lodash/startsWith'
+import nicePipe from 'nice-pipe'
+import prettyMs from 'pretty-ms'
+import progressStream from 'progress-stream'
+import pw from 'pw'
+import stripIndent from 'strip-indent'
+import { URL } from 'url'
+import Xo from 'xo-lib'
+import { parseOVAFile } from 'xo-vmdk-to-vhd'
+
+import pkg from '../package'
+import {
+  load as loadConfig,
+  set as setConfig,
+  unset as unsetConfig,
+} from './config'
+
+function help() {
+  return stripIndent(
+    `
+    Usage:
+
+      $name --register [--expiresIn duration] <XO-Server URL> <username> [<password>]
+        Registers the XO instance to use.
+
+        --expiresIn duration
+          Can be used to change the validity duration of the
+          authorization token (default: one month).
+
+      $name --unregister
+        Remove stored credentials.
+
+      $name --inspect <file>
+        Displays the data that would be imported from the ova.
+
+      $name --upload <file> <sr> [--override <key>=<value> [<key>=<value>]+]
+        Actually imports the VM contained in <file> to the Storage Repository <sr>.
+        Some parameters can be overridden from the file, consult --inspect to get the list.
+        Note: --override has to come last. By default arguments are string, prefix them with <json:> to type
+        them, ex. " --override nameLabel='new VM'  memory=json:67108864 disks.vmdisk1.capacity=json:134217728"
+
+    $name v$version
+  `
+  ).replace(/<([^>]+)>|\$(\w+)/g, function (_, arg, key) {
+    if (arg) {
+      return '<' + chalk.yellow(arg) + '>'
+    }
+
+    if (key === 'name') {
+      return chalk.bold(pkg[key])
+    }
+
+    return pkg[key]
+  })
+}
+
+async function connect() {
+  const { server, token } = await loadConfig()
+  if (server === undefined) {
+    throw new Error('no server to connect to!')
+  }
+
+  if (token === undefined) {
+    throw new Error('no token available')
+  }
+
+  const xo = new Xo({ url: server })
+  await xo.open()
+  await xo.signIn({ token })
+  return xo
+}
+
+export function unregister() {
+  return unsetConfig(['server', 'token'])
+}
+
+export async function register(args) {
+  let expiresIn
+  if (args[0] === '--expiresIn') {
+    expiresIn = args[1]
+    args = args.slice(2)
+  }
+
+  const [
+    url,
+    email,
+    password = await new Promise(resolve => {
+      process.stdout.write('Password: ')
+      pw(resolve)
+    }),
+  ] = args
+
+  const xo = new Xo({ url })
+  await xo.open()
+  await xo.signIn({ email, password })
+  console.log('Successfully logged with', xo.user.email)
+
+  await setConfig({
+    server: url,
+    token: await xo.call('token.create', { expiresIn }),
+  })
+}
+
+function nodeStringDecoder(buffer, encoder) {
+  return Buffer.from(buffer).toString(encoder)
+}
+
+export async function inspect(args) {
+  const file = args[0]
+  const data = await parseOVAFile(
+    new NodeParsableFile(file, (await stat(file)).size),
+    nodeStringDecoder,
+    true
+  )
+  console.log('file metadata:', data)
+}
+
+function parseOverride(args) {
+  const flag = args.shift()
+  if (flag !== '--override') {
+    throw new Error('Third argument has to be --override')
+  }
+
+  if (args.length === 0) {
+    throw new Error('Missing actual override')
+  }
+  const overrides = {}
+  for (const definition of args) {
+    const index = definition.indexOf('=')
+    const key = definition.slice(0, index)
+    let value = definition.slice(index + 1)
+    if (startsWith(value, 'json:')) {
+      value = JSON.parse(value.slice(5))
+    }
+    overrides[key] = value
+  }
+  return overrides
+}
+
+export async function upload(args) {
+  const file = args.shift()
+  const srId = args.shift()
+  let overrides = {}
+  if (args.length > 1) {
+    overrides = parseOverride(args)
+  }
+
+  const data = await parseOVAFile(
+    new NodeParsableFile(file, (await stat(file)).size),
+    nodeStringDecoder
+  )
+  const params = { sr: srId }
+  const xo = await connect()
+  const getXoObject = async filter =>
+    Object.values(await xo.call('xo.getAllObjects', { filter }))[0]
+  const sr = await getXoObject({ id: srId })
+  const pool = await getXoObject({ id: sr.$poolId })
+  const master = await getXoObject({ id: pool.master })
+  const pif = await getXoObject({
+    type: 'PIF',
+    management: true,
+    $host: master.id,
+  })
+  data.networks = data.networks.map(() => pif.$network)
+  console.log('data', data)
+  const l33tData = l33t(data)
+  const overridesKeys = Object.keys(overrides)
+  const missingKeys = overridesKeys.filter(k => !l33tData.probe(k))
+  if (missingKeys.length) {
+    // eslint-disable-next-line no-throw-literal
+    throw `those override keys don't exist in the metadata: ${missingKeys}`
+  }
+  for (const key of overridesKeys) {
+    l33tData.plant(key, overrides[key])
+  }
+  data.disks = Object.values(data.disks)
+  params.data = l33tData.obj
+  params.type = 'ova'
+  const method = 'vm.import'
+
+  // FIXME: do not use private properties.
+  const baseUrl = xo._url.replace(/^ws/, 'http')
+
+  const result = await xo.call(method, params)
+  let keys, key, url
+  if (isObject(result) && (keys = getKeys(result)).length === 1) {
+    key = keys[0]
+
+    if (key === '$sendTo') {
+      if (typeof file !== 'string') {
+        // eslint-disable-next-line no-throw-literal
+        throw 'file parameter should be a path'
+      }
+      url = new URL(result[key], baseUrl)
+
+      const { size: length } = await stat(file)
+      const input = nicePipe([
+        createReadStream(file),
+        progressStream(
+          {
+            length,
+            time: 1e3,
+          },
+          printProgress
+        ),
+      ])
+
+      try {
+        return await hrp
+          .post(url.toString(), {
+            body: input,
+            headers: {
+              'content-length': length,
+            },
+          })
+          .readAll('utf-8')
+      } catch (e) {
+        console.log('ERROR', e)
+        console.log('ERROR content', await e.response.readAll('utf-8'))
+        throw e
+      }
+    }
+  }
+}
+
+export class NodeParsableFile {
+  constructor(fileName, fileLength = Infinity) {
+    this._fileName = fileName
+    this._start = 0
+    this._end = fileLength
+  }
+
+  slice(start, end) {
+    const newFile = new NodeParsableFile(this._fileName)
+    newFile._start = start < 0 ? this._end + start : this._start + start
+    newFile._end = end < 0 ? this._end + end : this._start + end
+    return newFile
+  }
+
+  async read() {
+    const result = await getStream.buffer(
+      createReadStream(this._fileName, {
+        start: this._start,
+        end: this._end - 1,
+      })
+    )
+    // crazy stuff to get a browser-compatible ArrayBuffer from a node buffer
+    // https://stackoverflow.com/a/31394257/72637
+    return result.buffer.slice(
+      result.byteOffset,
+      result.byteOffset + result.byteLength
+    )
+  }
+}
+
+const humanFormatOpts = {
+  unit: 'B',
+  scale: 'binary',
+}
+
+function printProgress(progress) {
+  if (progress.length) {
+    console.warn(
+      '%s% of %s @ %s/s - ETA %s',
+      Math.round(progress.percentage),
+      humanFormat(progress.length, humanFormatOpts),
+      humanFormat(progress.speed, humanFormatOpts),
+      prettyMs(progress.eta * 1e3)
+    )
+  } else {
+    console.warn(
+      '%s @ %s/s',
+      humanFormat(progress.transferred, humanFormatOpts),
+      humanFormat(progress.speed, humanFormatOpts)
+    )
+  }
+}
+
+export default async function main(args) {
+  if (!args || !args.length || args[0] === '-h' || args[0] === '--help') {
+    return help()
+  }
+  const fnName = args[0].replace(/^--|-\w/g, match =>
+    match === '--' ? '' : match[1].toUpperCase()
+  )
+  if (fnName in exports) {
+    return exports[fnName](args.slice(1))
+  }
+  return help()
+}
+
+if (!module.parent) {
+  execPromise(main)
+}

CHANGELOG.md

@@ -1,25 +1,605 @@
 # ChangeLog
 
-## **next**
+## **5.47.1** (2020-06-02)
+
+![Channel: latest](https://badgen.net/badge/channel/latest/yellow)
+
+### Bug fixes
+
+- [auth-ldap] Sign in was broken in XO 5.47.0 (PR [#5039](https://github.com/vatesfr/xen-orchestra/pull/5039))
+
+### Released packages
+
+- xo-server-auth-ldap 0.8.1
+
+## **5.47.0** (2020-05-29)
+
+### Highlights
+
+- [Proxy] Ability to start a trial if no license available (PR [#5022](https://github.com/vatesfr/xen-orchestra/pull/5022))
+- [Home/VM] Ability to list VMs which are (not) backed up [#4777](https://github.com/vatesfr/xen-orchestra/issues/4777) (PR [#4974](https://github.com/vatesfr/xen-orchestra/pull/4974))
+- [SDN Controller] Ability to choose host as preferred center at private network creation [#4991](https://github.com/vatesfr/xen-orchestra/issues/4991) (PR [#5000](https://github.com/vatesfr/xen-orchestra/pull/5000))
+- [Plugin/auth-ldap] Support `StartTLS` [#4999](https://github.com/vatesfr/xen-orchestra/issues/4999)
+- [XO config export] Ability to encrypt the exported file (PR [#4997](https://github.com/vatesfr/xen-orchestra/pull/4997))
+- [Backup] Improve listing performance (PR [#4985](https://github.com/vatesfr/xen-orchestra/pull/4985))
+- [Audit] Record failed connection attempts [#4844](https://github.com/vatesfr/xen-orchestra/issues/4844) (PR [#4900](https://github.com/vatesfr/xen-orchestra/pull/4900))
+- [OVA import] Add support for OVA 2.0 file format (PR [#4921](https://github.com/vatesfr/xen-orchestra/pull/4921))
+- [XOA/licenses] Display proxy licenses (PR [#4944](https://github.com/vatesfr/xen-orchestra/pull/4944))
+- [Usage report] Include CSV raw data files to the sent email [#4970](https://github.com/vatesfr/xen-orchestra/issues/4970) (PR [#4979](https://github.com/vatesfr/xen-orchestra/pull/4979))
 
 ### Enhancements
 
+- [VM] Move boot order setting from Disk tab to Advanced tab [#1523](https://github.com/vatesfr/xen-orchestra/issues/1523#issuecomment-563141573) (PR [#4975](https://github.com/vatesfr/xen-orchestra/pull/4975))
+- [Network selector] Display pool's name [#4885](https://github.com/vatesfr/xen-orchestra/issues/4885) (PR [#4990](https://github.com/vatesfr/xen-orchestra/pull/4990))
+- [Modal] Don't close pop-up forms when you click outside or press escape (PR [#5002](https://github.com/vatesfr/xen-orchestra/pull/5002))
+
+### Bug fixes
+
+- Fix mounting of NFS remote in FreeBSD (PR [#4988](https://github.com/vatesfr/xen-orchestra/issues/4988))
+- [Remotes] Fix "remote is disabled" error on getting the remotes info (commit [eb2f429964d7adc264bf678c37e49a856454388e](https://github.com/vatesfr/xen-orchestra/commit/eb2f429964d7adc264bf678c37e49a856454388e))
+- Fix default filters not being set in all tables (PR [#4994](https://github.com/vatesfr/xen-orchestra/pull/4994))
+- [SDN Controller] Broken encrypted tunnels after host reboot [#4996](https://github.com/vatesfr/xen-orchestra/pull/4996)
+- Don't log server's credentials in case of `SESSION_AUTHENTICATION_FAILED` error (PR [#4995](https://github.com/vatesfr/xen-orchestra/pull/4995))
+- [Plugin/perf-alert] Fix compatibility of the alert messages with XenCenter (PR [#5004](https://github.com/vatesfr/xen-orchestra/pull/5004))
+- [Plugin/backup-reports] Fix `No recipients defined` error when recipients defined at plugin level (PR [#4998](https://github.com/vatesfr/xen-orchestra/pull/4998))
+- [Snapshots] Fix reverts sometimes being stuck (PR [#5027](https://github.com/vatesfr/xen-orchestra/pull/5027))
+
+### Released packages
+
+- xo-server-audit 0.4.0
+- xo-vmdk-to-vhd 1.2.0
+- xo-server-backup-reports 0.16.6
+- xo-server-perf-alert 0.2.2
+- xen-api 0.28.5
+- xo-server-auth-ldap 0.8.0
+- xo-server-sdn-controller 0.4.2
+- xo-server-usage-report 0.8.0
+- @xen-orchestra/fs 0.10.4
+- xo-server 5.60.0
+- xo-web 5.60.0
+
+## **5.46.0** (2020-04-30)
+
+![Channel: stable](https://badgen.net/badge/channel/stable/green)
+
+### Highlights
+
+- [Internationalization] Italian translation (Thanks [@infodavide](https://github.com/infodavide)!) [#4908](https://github.com/vatesfr/xen-orchestra/issues/4908) (PRs [#4931](https://github.com/vatesfr/xen-orchestra/pull/4931) [#4932](https://github.com/vatesfr/xen-orchestra/pull/4932))
+- [Proxy] Associate a license to the deployed proxy (PR [#4912](https://github.com/vatesfr/xen-orchestra/pull/4912))
+- [OVA import] Fix memory hogging behavior when the destination SR is slower than the file upload. (PR [#4920](https://github.com/vatesfr/xen-orchestra/pull/4920))
+
+### Enhancements
+
+- [Snapshot] Confirmation message before creating a snapshot with memory [#4914](https://github.com/vatesfr/xen-orchestra/issues/4914) (PR [#4917](https://github.com/vatesfr/xen-orchestra/pull/4917))
+- Automatic generation of self signed certificate if `autoCert` is not `false` in `xo-server`'s configuration in the corresponding `http.listen` section (PR [#4954](https://github.com/vatesfr/xen-orchestra/pull/4954))
+- [Self] Better error when not enough available resources (PR [#4952](https://github.com/vatesfr/xen-orchestra/pull/4952))
+- [Backup/run job] Confirmation modal: show the number of VMs that will be backed up (PR [#4875](https://github.com/vatesfr/xen-orchestra/pull/4875))
+
+### Bug fixes
+
+- [Backup] Fix TLS error (`unsupported protocol`) when XenServer <= 6.5 is used as target
+- [Patches] Hide patch `CH81` (upgrade patch) from the pool patches (PR [#4942](https://github.com/vatesfr/xen-orchestra/pull/4942))
+- [Proxy] Fix some `operation timed out` errors on (re)deploy [#4927](https://github.com/vatesfr/xen-orchestra/issues/4927) (PR [#4928](https://github.com/vatesfr/xen-orchestra/pull/4928))
+- [Backup] Fix some `cannot get the proxy VM IP` errors on backup's execution [#4927](https://github.com/vatesfr/xen-orchestra/issues/4927) (PR [#4928](https://github.com/vatesfr/xen-orchestra/pull/4928))
+- [XOA] Allow to access the license page when a XOA trial has ended (PR [#4941](https://github.com/vatesfr/xen-orchestra/pull/4941))
+
+### Released packages
+
+- xo-common 0.5.0
+- @xen-orchestra/self-signed 0.1.0
+- xo-vmdk-to-vhd 1.1.2
+- xo-server-audit 0.3.1
+- xen-api 0.28.4
+- xo-server 5.59.0
+- xo-web 5.59.0
+
+## **5.45.1** (2020-04-08)
+
+### Enhancements
+
+- [VDI migration]
+  - Remove 'Migrate all VDIs' checkbox (PR [#4876](https://github.com/vatesfr/xen-orchestra/pull/4876))
+  - [VM/disks]: Add bulk migration (PR [#4877](https://github.com/vatesfr/xen-orchestra/pull/4877))
+- [SAML] Possibility to pass [settings to the underlying library](https://github.com/bergie/passport-saml#config-parameter-details) via the `plugins.auth-saml.strategyOptions` section in `xo-server`'s configuration file
+
+### Bug fixes
+
+- Fix TLS error (`unsupported protocol`) with XenServer <= 6.5 and Node >= 12 for backups, consoles, and statistics [#4906](https://github.com/vatesfr/xen-orchestra/issues/4906)
+- [Audit] Fix "EACCES" error in case of changing the user that run "xo-server" [#4854](https://github.com/vatesfr/xen-orchestra/issues/4854) (PR [#4897](https://github.com/vatesfr/xen-orchestra/pull/4897))
+- [Patches] Reduce the amount of error logs related to missing patches (PR [#4911](https://github.com/vatesfr/xen-orchestra/pull/4911))
+
+### Released packages
+
+- xo-server-auth-saml 0.8.0
+- xo-server-audit 0.3.0
+- xo-server 5.58.2
+- xo-web 5.58.2
+
+## **5.45.0** (2020-03-31)
+
+### Highlights
+
+- [Proxy / Deploy] Ability to select the destination network [#4825](https://github.com/vatesfr/xen-orchestra/issues/4825) (PR [#4855](https://github.com/vatesfr/xen-orchestra/pull/4855))
+- [VM/backup] Show backup jobs [#4623](https://github.com/vatesfr/xen-orchestra/issues/4623) (PR [#4860](https://github.com/vatesfr/xen-orchestra/pull/4860))
+- [SR / Disks] Ability to migrate VDIs [#4455](https://github.com/vatesfr/xen-orchestra/issues/4455) (PR [#4696](https://github.com/vatesfr/xen-orchestra/pull/4696))
+- [VM migration] Ability to choose network for migration within a pool [#2028](https://github.com/vatesfr/xen-orchestra/issues/2028) (PR [#4828](https://github.com/vatesfr/xen-orchestra/pull/4828))
+- [XOA] Manage the XOA licenses from the xoa/licenses page (PR [#3717](https://github.com/vatesfr/xen-orchestra/pull/3717))
+
+### Enhancements
+
+- [Support] Link to create a new support ticket [#4234](https://github.com/vatesfr/xen-orchestra/issues/4234) (PR [#4833](https://github.com/vatesfr/xen-orchestra/pull/4833))
+- [Proxies] Ability to redeploy a proxy VM [#4825](https://github.com/vatesfr/xen-orchestra/issues/4825) (PR [#4725](https://github.com/vatesfr/xen-orchestra/pull/4725))
+- [Proxies/Deploy] Remove SRs not connected to an HVM-capable host from selection [#4825](https://github.com/vatesfr/xen-orchestra/issues/4825) (PR [#4849](https://github.com/vatesfr/xen-orchestra/pull/4849))
+- [Audit] Ability to export records [#4798](https://github.com/vatesfr/xen-orchestra/issues/4798) (PR [#4858](https://github.com/vatesfr/xen-orchestra/pull/4858))
+- [Audit] Improve integrity check feedback [#4798](https://github.com/vatesfr/xen-orchestra/issues/4798) (PR [#4879](https://github.com/vatesfr/xen-orchestra/pull/4879))
+- [Backup] **BETA** Ability to backup running VMs with their memory [#645](https://github.com/vatesfr/xen-orchestra/issues/645) (PR [#4252](https://github.com/vatesfr/xen-orchestra/pull/4252))
+- [Import] add CLI tool to import OVA files (PR [#3630](https://github.com/vatesfr/xen-orchestra/pull/3630))
+
+### Bug fixes
+
+- [XOSAN] Fix the installer (PR [#4839](https://github.com/vatesfr/xen-orchestra/pull/4839))
+- [OVA Import] Fix _no host available_ error when starting for imported VMs with low memory (PR [#4866](https://github.com/vatesfr/xen-orchestra/pull/4866))
+- [Self] When a Self Service related operation fails, always revert the quotas to what they were before the operation (PR [#4861](https://github.com/vatesfr/xen-orchestra/pull/4861))
+- [auth-{github,google,saml}] Don't require manually reloading the plugin for configuration changes to take effect [#4863](https://github.com/vatesfr/xen-orchestra/issues/4863) (PR [#4864](https://github.com/vatesfr/xen-orchestra/pull/4864))
+- [auth-ldap] Fix reading certificate authorities files [#3873](https://github.com/vatesfr/xen-orchestra/issues/3873)
+- [Backup NG / logs] Replace successful backup job status by failed status in case of missing VMs [#4857](https://github.com/vatesfr/xen-orchestra/issues/4857) (PR [#4862](https://github.com/vatesfr/xen-orchestra/pull/4862))
+- [Jobs] Fix "no value for `user_ip`" error on jobs execution (PR [#4878](https://github.com/vatesfr/xen-orchestra/pull/4878))
+- [Self] Properly take IP pools into account when computing quotas (PR [#4871](https://github.com/vatesfr/xen-orchestra/pull/4871))
+
+### Released packages
+
+- xo-vmdk-to-vhd 1.1.1
+- @xen-orchestra/upload-ova 0.1.3
+- @xen-orchestra/audit-core 0.1.1
+- xo-server-audit 0.2.0
+- xo-server-auth-github 0.2.2
+- xo-server-auth-google 0.2.2
+- xo-server-auth-ldap 0.7.1
+- xo-server-auth-saml 0.7.2
+- xo-server 5.58.1
+- xo-web 5.58.1
+
+## **5.44.1** (2020-03-05)
+
+### Enhancements
+
+- [Plugin] Show plugin description [#4569](https://github.com/vatesfr/xen-orchestra/issues/4569) (PR [#4832](https://github.com/vatesfr/xen-orchestra/pull/4832))
+
+### Bug fixes
+
+- [Backup reports] Fix backup report not sent in case of interrupted backup job (PR [#4772](https://github.com/vatesfr/xen-orchestra/pull/4772))
+- Fix TLS error (`unsupported protocol`) with XenServer <= 6.5 and Node >= 12 (PR [#8437](https://github.com/vatesfr/xen-orchestra/pull/8437))
+- [Metadata backup] Fix timeout when lots of pools are backed up [#4819](https://github.com/vatesfr/xen-orchestra/issues/4819) (PR [#4831](https://github.com/vatesfr/xen-orchestra/pull/4831))
+
+### Released packages
+
+- @xen-orchestra/fs v0.10.3
+- xen-api v0.28.3
+- xo-server-backup-reports v0.16.5
+- xo-server-perf-alert v0.2.1
+- xo-server-sdn-controller v0.4.1
+- xo-server-transport-icinga2 v0.1.1
+- xo-server-transport-nagios v0.1.1
+- xo-server-usage-report v0.7.5
+- xo-server-web-hooks v0.1.1
+- xo-server v5.57.3
+- xo-web v5.57.1
+
+## **5.44.0** (2020-02-28)
+
+### Highlights
+
+- [Audit log] Record side effects triggered by users [#4653](https://github.com/vatesfr/xen-orchestra/issues/4653) [#701](https://github.com/vatesfr/xen-orchestra/issues/701) (PR [#4740](https://github.com/vatesfr/xen-orchestra/pull/4740))
+- [SR/general] Clickable SR usage graph: shows the corresponding disks when you click on one of the sections [#4747](https://github.com/vatesfr/xen-orchestra/issues/4747) (PR [#4754](https://github.com/vatesfr/xen-orchestra/pull/4754))
+- [New VM] Ability to copy host BIOS strings [#4204](https://github.com/vatesfr/xen-orchestra/issues/4204) (PR [4755](https://github.com/vatesfr/xen-orchestra/pull/4755))
+- [New VM] Ability to set VM max vCPUS [#4703](https://github.com/vatesfr/xen-orchestra/issues/4703) (PR [#4729](https://github.com/vatesfr/xen-orchestra/pull/4729))
+
+### Enhancements
+
+- [SDN Controller] Automatically handle new, connected and disconnected servers (PR [#4677](https://github.com/vatesfr/xen-orchestra/pull/4677))
+- [Proxy] Support network configuration for the deployed proxy (PR [#4810](https://github.com/vatesfr/xen-orchestra/pull/4810))
+- [Menu] Display a warning icon in case of missing patches [#4475](https://github.com/vatesfr/xen-orchestra/issues/4475) (PR [#4683](https://github.com/vatesfr/xen-orchestra/pull/4683))
+
+### Bug fixes
+
+- [Usage Report] Fix wrong report date [#4779](https://github.com/vatesfr/xen-orchestra/issues/4779) (PR [#4799](https://github.com/vatesfr/xen-orchestra/pull/4799))
+- [SDN Controller] Fix plugin stuck loading [#4649](https://github.com/vatesfr/xen-orchestra/issues/4649) (PR [#4677](https://github.com/vatesfr/xen-orchestra/pull/4677))
+- [xo-server-logs] Fix `Cannot find module '../better-stacks'`
+
+### Released packages
+
+- xo-common v0.4.0
+- @xen-orchestra/audit-core v0.1.0
+- xo-server-audit v0.1.2
+- xo-server-auth-ldap v0.7.0
+- xo-server-usage-report v0.7.4
+- xo-server-sdn-controller v0.4.0
+- xo-server v5.57.2
+- xo-web v5.57.0
+
+## **5.43.3** (2020-03-06)
+
+### Bug fixes
+
+- [Backups] Fix an issue where DR and CR could stay stuck (commit [63739df](https://github.com/vatesfr/xen-orchestra/commit/63739df90369798f16b61bf96d1a89513c7edc77))
+
+### Released packages
+
+- xo-server v5.56.3
+
+## **5.43.2** (2020-02-11)
+
+### Bug fixes
+
+- [Proxy] Correctly call the proxy when running backups (PRs [#4791](https://github.com/vatesfr/xen-orchestra/pull/4791) & [#4792](https://github.com/vatesfr/xen-orchestra/pull/4792))
+
+### Released packages
+
+- xo-server v5.56.2
+
+## **5.43.1** (2020-02-06)
+
+### Bug fixes
+
+- [Self,IP pools] Fixed the creation being stuck and freezing XO (PR [#4776](https://github.com/vatesfr/xen-orchestra/pull/4776))
+- [SDN Controller] Ensure the correct PIF is used to create private networks tunnels [#4737](https://github.com/vatesfr/xen-orchestra/issues/4737) (PR [#4757](https://github.com/vatesfr/xen-orchestra/pull/4757))
+
+### Released packages
+
+- xo-server-sdn-controller v0.3.2
+- xo-server-auth-saml 0.7.1
+- xo-server v5.56.1
+- xo-web v5.56.2
+
+## **5.43.0** (2020-01-31)
+
+### Highlights
+
+- [Home] Allow to change the number of items per page [#4535](https://github.com/vatesfr/xen-orchestra/issues/4535) (PR [#4708](https://github.com/vatesfr/xen-orchestra/pull/4708))
+- [Tag] Adding a tag: ability to select from existing tags [#2810](https://github.com/vatesfr/xen-orchestra/issues/2810) (PR [#4530](https://github.com/vatesfr/xen-orchestra/pull/4530))
+- [Smart backup] Ability to manually add custom tags [#2810](https://github.com/vatesfr/xen-orchestra/issues/2810) (PR [#4648](https://github.com/vatesfr/xen-orchestra/pull/4648))
+- [Proxy] Ability to backup VMs via registered proxy [#4254](https://github.com/vatesfr/xen-orchestra/issues/4254) (PR [#4495](https://github.com/vatesfr/xen-orchestra/pull/4495))
+
+### Enhancements
+
+- [VM/Migrate] Ask user before forcing migration [#2136](https://github.com/vatesfr/xen-orchestra/issues/2136) (PR [#4364](https://github.com/vatesfr/xen-orchestra/pull/4364))
+
+### Bug fixes
+
+- [New network] Fix bonded network not linked to the slave hosts [#4529](https://github.com/vatesfr/xen-orchestra/issues/4529) (PR [#4756](https://github.com/vatesfr/xen-orchestra/pull/4756))
+
+### Dropped features
+
+- [Backup / Overview] Job cancellation will be disabled until we find a way to make it work [#4657](https://github.com/vatesfr/xen-orchestra/issues/4657) (PR [#4688](https://github.com/vatesfr/xen-orchestra/pull/4688))
+
+### Released packages
+
+- xo-common v0.3.0
+- xo-server v5.56.0
+- xo-web v5.56.1
+
+## **5.42.1** (2020-01-17)
+
+### Enhancements
+
+- [Snapshot] Fallback to normal snapshot if quiesce is not available [#4735](https://github.com/vatesfr/xen-orchestra/issues/4735) (PR [#4736](https://github.com/vatesfr/xen-orchestra/pull/4736)) \
+  Fixes compatibility with **Citrix Hypervisor 8.1**.
+- [Uncompressed full backup] Quick healthcheck of downloaded XVAs in case there was an undetected issue (PR [#4741](https://github.com/vatesfr/xen-orchestra/pull/4741))
+- [Backup] Make built-in concurrency limits configurable (PR [#4743](https://github.com/vatesfr/xen-orchestra/pull/4743)) \
+  Via the following entries in `xo-server`'s configuration file:
+  - `xapiOptions.vdiExportConcurrency`
+  - `xapiOptions.vmExportConcurrency`
+  - `xapiOptions.vmSnapshotConcurrency`
+
+### Released packages
+
+- xo-server v5.55.0
+- xo-web v5.55.0
+
+## **5.42.0** (2019-12-20)
+
+### Highlights
+
+- [SDN Controller] Allow private network creation on bond and VLAN (PR [#4682](https://github.com/vatesfr/xen-orchestra/pull/4682))
+- [Hub/recipes][ability to create a kubernetes cluster](https://xen-orchestra.com/blog/devblog-5-kubernetes-clutser-on-xo/) (PR [#4695](https://github.com/vatesfr/xen-orchestra/pull/4695))
+
+### Enhancements
+
+- [XOA] Display XOA build number [#4693](https://github.com/vatesfr/xen-orchestra/issues/4693) (PR [#4694](https://github.com/vatesfr/xen-orchestra/pull/4694))
+
+### Released packages
+
+- xo-server v5.54.0
+- xo-web v5.54.0
+
+## **5.41.0** (2019-11-29)
+
+### Highlights
+
+- [Backup NG] Make report recipients configurable in the backup settings [#4581](https://github.com/vatesfr/xen-orchestra/issues/4581) (PR [#4646](https://github.com/vatesfr/xen-orchestra/pull/4646))
+- [Host] Advanced Live Telemetry (PR [#4680](https://github.com/vatesfr/xen-orchestra/pull/4680))
+- [Plugin][web hooks](https://xen-orchestra.com/docs/web-hooks.html) [#1946](https://github.com/vatesfr/xen-orchestra/issues/1946) (PR [#3155](https://github.com/vatesfr/xen-orchestra/pull/3155))
+
+### Enhancements
+
+- [SAML] Setting to disable requested authentication context (helps with _Active Directory_) (PR [#4675](https://github.com/vatesfr/xen-orchestra/pull/4675))
+- The default sign-in page can be configured via `authentication.defaultSignInPage` (PR [#4678](https://github.com/vatesfr/xen-orchestra/pull/4678))
+- [SR] Allow import of VHD and VMDK disks [#4137](https://github.com/vatesfr/xen-orchestra/issues/4137) (PR [#4138](https://github.com/vatesfr/xen-orchestra/pull/4138) )
+
+### Bug fixes
+
+- [Metadata backup] Add 10 minutes timeout to avoid stuck jobs [#4657](https://github.com/vatesfr/xen-orchestra/issues/4657) (PR [#4666](https://github.com/vatesfr/xen-orchestra/pull/4666))
+- [Metadata backups] Fix out-of-date listing for 1 minute due to cache (PR [#4672](https://github.com/vatesfr/xen-orchestra/pull/4672))
+- [Delta backup] Limit the number of merged deltas per run to avoid interrupted jobs (PR [#4674](https://github.com/vatesfr/xen-orchestra/pull/4674))
+
+### Released packages
+
+- vhd-lib v0.7.2
+- xo-vmdk-to-vhd v0.1.8
+- xo-server-auth-ldap v0.6.6
+- xo-server-auth-saml v0.7.0
+- xo-server-backup-reports v0.16.4
+- xo-server-web-hooks v0.1.0
+- @xen-orchestra/fs v0.10.2
+- xo-server v5.53.0
+- xo-web v5.53.3
+
+## **5.40.2** (2019-11-22)
+
+### Enhancements
+
+- [Logs] Ability to report a bug with attached log (PR [#4201](https://github.com/vatesfr/xen-orchestra/pull/4201))
+- [Backup] Reduce _VDI chain protection error_ occurrence by being more tolerant (configurable via `xo-server`'s `xapiOptions.maxUncoalescedVdis` setting) [#4124](https://github.com/vatesfr/xen-orchestra/issues/4124) (PR [#4651](https://github.com/vatesfr/xen-orchestra/pull/4651))
+- [Tables] Always put the tables' search in the URL [#4542](https://github.com/vatesfr/xen-orchestra/issues/4542) (PR [#4637](https://github.com/vatesfr/xen-orchestra/pull/4637))
+
+### Bug fixes
+
+- [SDN controller] Prevent private network creation on bond slave PIF (Fixes https://github.com/xcp-ng/xcp/issues/300) (PR [4633](https://github.com/vatesfr/xen-orchestra/pull/4633))
+- [Metadata backup] Fix failed backup reported as successful [#4596](https://github.com/vatesfr/xen-orchestra/issues/4596) (PR [#4598](https://github.com/vatesfr/xen-orchestra/pull/4598))
+- [Backup NG] Fix "task cancelled" error when the backup job timeout exceeds 596 hours [#4662](https://github.com/vatesfr/xen-orchestra/issues/4662) (PR [#4663](https://github.com/vatesfr/xen-orchestra/pull/4663))
+- Fix `promise rejected with non-error` warnings in logs (PR [#4659](https://github.com/vatesfr/xen-orchestra/pull/4659))
+
+### Released packages
+
+- xen-api v0.27.3
+- xo-server-backup-reports v0.16.3
+- vhd-lib v0.7.1
+- xo-server v5.52.1
+- xo-web v5.52.0
+
+## **5.40.1** (2019-10-29)
+
+### Bug fixes
+
+- [XOSAN] Fix "Install Cloud plugin" warning (PR [#4631](https://github.com/vatesfr/xen-orchestra/pull/4631))
+
+### Released packages
+
+- xo-web v5.51.1
+
+## **5.40.0** (2019-10-29)
+
+### Breaking changes
+
+- `xo-server` requires Node 8.
+
+### Highlights
+
+- [Backup NG] Offline backup feature [#3449](https://github.com/vatesfr/xen-orchestra/issues/3449) (PR [#4470](https://github.com/vatesfr/xen-orchestra/pull/4470))
+- [Menu] Remove legacy backup entry [#4467](https://github.com/vatesfr/xen-orchestra/issues/4467) (PR [#4476](https://github.com/vatesfr/xen-orchestra/pull/4476))
+- [Hub] Ability to update existing template (PR [#4613](https://github.com/vatesfr/xen-orchestra/pull/4613))
+- [Support] Ability to open and close support tunnel from the user interface [#4513](https://github.com/vatesfr/xen-orchestra/issues/4513) (PR [#4616](https://github.com/vatesfr/xen-orchestra/pull/4616))
+
+### Enhancements
+
+- [Hub] Ability to select SR in hub VM installation (PR [#4571](https://github.com/vatesfr/xen-orchestra/pull/4571))
+- [Hub] Display more info about downloadable templates (PR [#4593](https://github.com/vatesfr/xen-orchestra/pull/4593))
+- [xo-server-transport-icinga2] Add support of [icinga2](https://icinga.com/docs/icinga2/latest/doc/12-icinga2-api/) for reporting services status [#4563](https://github.com/vatesfr/xen-orchestra/issues/4563) (PR [#4573](https://github.com/vatesfr/xen-orchestra/pull/4573))
+
+### Bug fixes
+
+- [SR] Fix `[object HTMLInputElement]` name after re-attaching a SR [#4546](https://github.com/vatesfr/xen-orchestra/issues/4546) (PR [#4550](https://github.com/vatesfr/xen-orchestra/pull/4550))
+- [Schedules] Prevent double runs [#4625](https://github.com/vatesfr/xen-orchestra/issues/4625) (PR [#4626](https://github.com/vatesfr/xen-orchestra/pull/4626))
+- [Schedules] Properly enable/disable on config import (PR [#4624](https://github.com/vatesfr/xen-orchestra/pull/4624))
+
+### Released packages
+
+- @xen-orchestra/cron v1.0.6
+- xo-server-transport-icinga2 v0.1.0
+- xo-server-sdn-controller v0.3.1
+- xo-server v5.51.1
+- xo-web v5.51.0
+
+### Dropped packages
+
+- xo-server-cloud : this package was useless for OpenSource installations because it required a complete XOA environment
+
+## **5.39.1** (2019-10-11)
+
+### Enhancements
+
+- [Support] Ability to check the XOA on the user interface [#4513](https://github.com/vatesfr/xen-orchestra/issues/4513) (PR [#4574](https://github.com/vatesfr/xen-orchestra/pull/4574))
+
+### Bug fixes
+
+- [VM/new-vm] Fix template selection on creating new VM for resource sets [#4565](https://github.com/vatesfr/xen-orchestra/issues/4565) (PR [#4568](https://github.com/vatesfr/xen-orchestra/pull/4568))
+- [VM] Clearer invalid cores per socket error [#4120](https://github.com/vatesfr/xen-orchestra/issues/4120) (PR [#4187](https://github.com/vatesfr/xen-orchestra/pull/4187))
+
+### Released packages
+
+- xo-web v5.50.3
+
+## **5.39.0** (2019-09-30)
+
+### Highlights
+
+- [VM/console] Add a button to connect to the VM via the local SSH client (PR [#4415](https://github.com/vatesfr/xen-orchestra/pull/4415))
+- [SDN Controller] Add possibility to encrypt private networks (PR [#4441](https://github.com/vatesfr/xen-orchestra/pull/4441))
+- [Backups] Improve performance by caching VM backups listing (PR [#4509](https://github.com/vatesfr/xen-orchestra/pull/4509))
+- [HUB] VM template store [#1918](https://github.com/vatesfr/xen-orchestra/issues/1918) (PR [#4442](https://github.com/vatesfr/xen-orchestra/pull/4442))
+
+### Enhancements
+
+- [SR/new] Clarify address formats [#4450](https://github.com/vatesfr/xen-orchestra/issues/4450) (PR [#4460](https://github.com/vatesfr/xen-orchestra/pull/4460))
+- [Backup NG/New] Show warning if zstd compression is not supported on a VM [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PRs [#4411](https://github.com/vatesfr/xen-orchestra/pull/4411))
+- [VM/disks] Don't hide disks that are attached to the same VM twice [#4400](https://github.com/vatesfr/xen-orchestra/issues/4400) (PR [#4414](https://github.com/vatesfr/xen-orchestra/pull/4414))
+- [SDN Controller] Ability to configure MTU for private networks (PR [#4491](https://github.com/vatesfr/xen-orchestra/pull/4491))
+- [VM Export] Filenames are now prefixed with datetime [#4503](https://github.com/vatesfr/xen-orchestra/issues/4503)
+- [Settings/Logs] Differenciate XS/XCP-ng errors from XO errors [#4101](https://github.com/vatesfr/xen-orchestra/issues/4101) (PR [#4385](https://github.com/vatesfr/xen-orchestra/pull/4385))
+- [Backups] Improve performance by caching logs consolidation (PR [#4541](https://github.com/vatesfr/xen-orchestra/pull/4541))
+- [New VM] Cloud Init available for all plans (PR [#4543](https://github.com/vatesfr/xen-orchestra/pull/4543))
+- [Servers] IPv6 addresses can be used [#4520](https://github.com/vatesfr/xen-orchestra/issues/4520) (PR [#4521](https://github.com/vatesfr/xen-orchestra/pull/4521)) \
+  Note: They must enclosed in brackets to differentiate with the port, e.g.: `[2001:db8::7334]` or `[ 2001:db8::7334]:4343`
+
+### Bug fixes
+
+- [PBD] Obfuscate cifs password from device config [#4384](https://github.com/vatesfr/xen-orchestra/issues/4384) (PR [#4401](https://github.com/vatesfr/xen-orchestra/pull/4401))
+- [XOSAN] Fix "invalid parameters" error on creating a SR (PR [#4478](https://github.com/vatesfr/xen-orchestra/pull/4478))
+- [Patching] Avoid overloading XCP-ng by reducing the frequency of yum update checks [#4358](https://github.com/vatesfr/xen-orchestra/issues/4358) (PR [#4477](https://github.com/vatesfr/xen-orchestra/pull/4477))
+- [Network] Fix inability to create a bonded network (PR [#4489](https://github.com/vatesfr/xen-orchestra/pull/4489))
+- [Backup restore & Replication] Don't copy `sm_config` to new VDIs which might leads to useless coalesces [#4482](https://github.com/vatesfr/xen-orchestra/issues/4482) (PR [#4484](https://github.com/vatesfr/xen-orchestra/pull/4484))
+- [Home] Fix intermediary "no results" display showed on filtering items [#4420](https://github.com/vatesfr/xen-orchestra/issues/4420) (PR [#4456](https://github.com/vatesfr/xen-orchestra/pull/4456)
+- [Backup NG/New schedule] Properly show user errors in the form [#3831](https://github.com/vatesfr/xen-orchestra/issues/3831) (PR [#4131](https://github.com/vatesfr/xen-orchestra/pull/4131))
+- [VM/Advanced] Fix `"vm.set_domain_type" is not a function` error on switching virtualization mode (PV/HVM) [#4348](https://github.com/vatesfr/xen-orchestra/issues/4348) (PR [#4504](https://github.com/vatesfr/xen-orchestra/pull/4504))
+- [Backup NG/logs] Show warning when zstd compression is selected but not supported [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PR [#4375](https://github.com/vatesfr/xen-orchestra/pull/4375)
+- [Patches] Fix patches installation for CH 8.0 (PR [#4511](https://github.com/vatesfr/xen-orchestra/pull/4511))
+- [Network] Fix inability to set a network name [#4514](https://github.com/vatesfr/xen-orchestra/issues/4514) (PR [4510](https://github.com/vatesfr/xen-orchestra/pull/4510))
+- [Backup NG] Fix race conditions that could lead to disabled jobs still running (PR [4510](https://github.com/vatesfr/xen-orchestra/pull/4510))
+- [XOA] Remove "Updates" and "Licenses" tabs for non admin users (PR [#4526](https://github.com/vatesfr/xen-orchestra/pull/4526))
+- [New VM] Ability to escape [cloud config template](https://xen-orchestra.com/blog/xen-orchestra-5-21/#cloudconfigtemplates) variables [#4486](https://github.com/vatesfr/xen-orchestra/issues/4486) (PR [#4501](https://github.com/vatesfr/xen-orchestra/pull/4501))
+- [Backup NG] Properly log and report if job is already running [#4497](https://github.com/vatesfr/xen-orchestra/issues/4497) (PR [4534](https://github.com/vatesfr/xen-orchestra/pull/4534))
+- [Host] Fix an issue where host was wrongly reporting time inconsistency (PR [#4540](https://github.com/vatesfr/xen-orchestra/pull/4540))
+
+### Released packages
+
+- xen-api v0.27.2
+- xo-server-cloud v0.3.0
+- @xen-orchestra/cron v1.0.4
+- xo-server-sdn-controller v0.3.0
+- @xen-orchestra/template v0.1.0
+- xo-server v5.50.1
+- xo-web v5.50.2
+
+## **5.38.0** (2019-08-29)
+
+### Enhancements
+
+- [VM/Attach disk] Display confirmation modal when VDI is already attached [#3381](https://github.com/vatesfr/xen-orchestra/issues/3381) (PR [#4366](https://github.com/vatesfr/xen-orchestra/pull/4366))
+- [Zstd]
+  - [VM/copy, VM/export] Only show zstd option when it's supported [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PRs [#4326](https://github.com/vatesfr/xen-orchestra/pull/4326) [#4368](https://github.com/vatesfr/xen-orchestra/pull/4368))
+  - [VM/Bulk copy] Show warning if zstd compression is not supported on a VM [#3892](https://github.com/vatesfr/xen-orchestra/issues/3892) (PR [#4346](https://github.com/vatesfr/xen-orchestra/pull/4346))
+- [VM import & Continuous Replication] Enable `guessVhdSizeOnImport` by default, this fix some `VDI_IO_ERROR` with XenServer 7.1 and XCP-ng 8.0 (PR [#4436](https://github.com/vatesfr/xen-orchestra/pull/4436))
+- [SDN Controller] Add possibility to create multiple GRE networks and VxLAN networks within a same pool (PR [#4435](https://github.com/vatesfr/xen-orchestra/pull/4435))
+- [SDN Controller] Add possibility to create cross-pool private networks (PR [#4405](https://github.com/vatesfr/xen-orchestra/pull/4405))
+
+### Bug fixes
+
+- [SR/General] Display VDI VM name in SR usage graph (PR [#4370](https://github.com/vatesfr/xen-orchestra/pull/4370))
+- [VM/Attach disk] Fix checking VDI mode (PR [#4373](https://github.com/vatesfr/xen-orchestra/pull/4373))
+- [VM revert] Snapshot before: add admin ACLs on created snapshot [#4331](https://github.com/vatesfr/xen-orchestra/issues/4331) (PR [#4391](https://github.com/vatesfr/xen-orchestra/pull/4391))
+- [Network] Fixed "invalid parameters" error when creating bonded network [#4425](https://github.com/vatesfr/xen-orchestra/issues/4425) (PR [#4429](https://github.com/vatesfr/xen-orchestra/pull/4429))
+
+### Released packages
+
+- xo-server-sdn-controller v0.2.0
+- xo-server-usage-report v0.7.3
+- xo-server v5.48.0
+- xo-web v5.48.1
+
+## **5.37.1** (2019-08-06)
+
+### Enhancements
+
+- [SDN Controller] Let the user choose on which PIF to create a private network (PR [#4379](https://github.com/vatesfr/xen-orchestra/pull/4379))
+
+### Bug fixes
+
+- [SDN Controller] Better detect host shutting down to adapt network topology (PR [#4314](https://github.com/vatesfr/xen-orchestra/pull/4314))
+- [SDN Controller] Add new hosts to pool's private networks (PR [#4382](https://github.com/vatesfr/xen-orchestra/pull/4382))
+
+### Released packages
+
+- xo-server-sdn-controller v0.1.2
+
+## **5.37.0** (2019-07-25)
+
+### Highlights
+
+- [Pool] Ability to add multiple hosts on the pool [#2402](https://github.com/vatesfr/xen-orchestra/issues/2402) (PR [#3716](https://github.com/vatesfr/xen-orchestra/pull/3716))
+- [SR/General] Improve SR usage graph [#3608](https://github.com/vatesfr/xen-orchestra/issues/3608) (PR [#3830](https://github.com/vatesfr/xen-orchestra/pull/3830))
+- [VM] Permission to revert to any snapshot for VM operators [#3928](https://github.com/vatesfr/xen-orchestra/issues/3928) (PR [#4247](https://github.com/vatesfr/xen-orchestra/pull/4247))
+- [Backup NG] Ability to bypass unhealthy VDI chains check [#4324](https://github.com/vatesfr/xen-orchestra/issues/4324) (PR [#4340](https://github.com/vatesfr/xen-orchestra/pull/4340))
+- [VM/console] Multiline copy/pasting [#4261](https://github.com/vatesfr/xen-orchestra/issues/4261) (PR [#4341](https://github.com/vatesfr/xen-orchestra/pull/4341))
+
+### Enhancements
+
+- [Stats] Ability to display last day stats [#4160](https://github.com/vatesfr/xen-orchestra/issues/4160) (PR [#4168](https://github.com/vatesfr/xen-orchestra/pull/4168))
+- [Settings/servers] Display servers connection issues [#4300](https://github.com/vatesfr/xen-orchestra/issues/4300) (PR [#4310](https://github.com/vatesfr/xen-orchestra/pull/4310))
+- [VM] Show current operations and progress [#3811](https://github.com/vatesfr/xen-orchestra/issues/3811) (PR [#3982](https://github.com/vatesfr/xen-orchestra/pull/3982))
+- [Backup NG/New] Generate default schedule if no schedule is specified [#4036](https://github.com/vatesfr/xen-orchestra/issues/4036) (PR [#4183](https://github.com/vatesfr/xen-orchestra/pull/4183))
+- [Host/Advanced] Ability to edit iSCSI IQN [#4048](https://github.com/vatesfr/xen-orchestra/issues/4048) (PR [#4208](https://github.com/vatesfr/xen-orchestra/pull/4208))
+- [VM,host] Improved state icons/pills (colors and tooltips) (PR [#4363](https://github.com/vatesfr/xen-orchestra/pull/4363))
+
+### Bug fixes
+
+- [Settings/Servers] Fix read-only setting toggling
+- [SDN Controller] Do not choose physical PIF without IP configuration for tunnels. (PR [#4319](https://github.com/vatesfr/xen-orchestra/pull/4319))
+- [Xen servers] Fix `no connection found for object` error if pool master is reinstalled [#4299](https://github.com/vatesfr/xen-orchestra/issues/4299) (PR [#4302](https://github.com/vatesfr/xen-orchestra/pull/4302))
+- [Backup-ng/restore] Display correct size for full VM backup [#4316](https://github.com/vatesfr/xen-orchestra/issues/4316) (PR [#4332](https://github.com/vatesfr/xen-orchestra/pull/4332))
+- [VM/tab-advanced] Fix CPU limits edition (PR [#4337](https://github.com/vatesfr/xen-orchestra/pull/4337))
+- [Remotes] Fix `EIO` errors due to massive parallel fs operations [#4323](https://github.com/vatesfr/xen-orchestra/issues/4323) (PR [#4330](https://github.com/vatesfr/xen-orchestra/pull/4330))
+- [VM/Advanced] Fix virtualization mode switch (PV/HVM) (PR [#4349](https://github.com/vatesfr/xen-orchestra/pull/4349))
+- [Task] fix hidden notification by search field [#3874](https://github.com/vatesfr/xen-orchestra/issues/3874) (PR [#4305](https://github.com/vatesfr/xen-orchestra/pull/4305)
+- [VM] Fail to change affinity (PR [#4361](https://github.com/vatesfr/xen-orchestra/pull/4361)
+- [VM] Number of CPUs not correctly changed on running VMs (PR [#4360](https://github.com/vatesfr/xen-orchestra/pull/4360)
+
+### Released packages
+
+- @xen-orchestra/fs v0.10.1
+- xo-server-sdn-controller v0.1.1
+- xen-api v0.27.1
+- xo-server v5.46.0
+- xo-web v5.46.0
+
+## **5.36.0** (2019-06-27)
+
+### Highlights
+
+- [SR/new] Create ZFS storage [#4260](https://github.com/vatesfr/xen-orchestra/issues/4260) (PR [#4266](https://github.com/vatesfr/xen-orchestra/pull/4266))
+- [Host/advanced] Fix host CPU hyperthreading detection [#4262](https://github.com/vatesfr/xen-orchestra/issues/4262) (PR [#4285](https://github.com/vatesfr/xen-orchestra/pull/4285))
 - [VM/Advanced] Ability to use UEFI instead of BIOS [#4264](https://github.com/vatesfr/xen-orchestra/issues/4264) (PR [#4268](https://github.com/vatesfr/xen-orchestra/pull/4268))
+- [Backup-ng/restore] Display size for full VM backup [#4009](https://github.com/vatesfr/xen-orchestra/issues/4009) (PR [#4245](https://github.com/vatesfr/xen-orchestra/pull/4245))
+- [Sr/new] Ability to select NFS version when creating NFS storage [#3951](https://github.com/vatesfr/xen-orchestra/issues/3951) (PR [#4277](https://github.com/vatesfr/xen-orchestra/pull/4277))
+- [Host/storages, SR/hosts] Display PBD details [#4264](https://github.com/vatesfr/xen-orchestra/issues/4161) (PR [#4268](https://github.com/vatesfr/xen-orchestra/pull/4284))
+- [auth-saml] Improve compatibility with Microsoft Azure Active Directory (PR [#4294](https://github.com/vatesfr/xen-orchestra/pull/4294))
+
+### Enhancements
+
+- [Host] Display warning when "Citrix Hypervisor" license has restrictions [#4251](https://github.com/vatesfr/xen-orchestra/issues/4164) (PR [#4235](https://github.com/vatesfr/xen-orchestra/pull/4279))
+- [VM/Backup] Create backup bulk action [#2573](https://github.com/vatesfr/xen-orchestra/issues/2573) (PR [#4257](https://github.com/vatesfr/xen-orchestra/pull/4257))
+- [Host] Display warning when host's time differs too much from XOA's time [#4113](https://github.com/vatesfr/xen-orchestra/issues/4113) (PR [#4173](https://github.com/vatesfr/xen-orchestra/pull/4173))
+- [VM/network] Display and set bandwidth rate-limit of a VIF [#4215](https://github.com/vatesfr/xen-orchestra/issues/4215) (PR [#4293](https://github.com/vatesfr/xen-orchestra/pull/4293))
+- [SDN Controller] New plugin which enables creating pool-wide private networks [xcp-ng/xcp#175](https://github.com/xcp-ng/xcp/issues/175) (PR [#4269](https://github.com/vatesfr/xen-orchestra/pull/4269))
 
 ### Bug fixes
 
 - [XOA] Don't require editing the _email_ field in case of re-registration (PR [#4259](https://github.com/vatesfr/xen-orchestra/pull/4259))
+- [Metadata backup] Missing XAPIs should trigger a failure job [#4281](https://github.com/vatesfr/xen-orchestra/issues/4281) (PR [#4283](https://github.com/vatesfr/xen-orchestra/pull/4283))
+- [iSCSI] Fix fibre channel paths display [#4291](https://github.com/vatesfr/xen-orchestra/issues/4291) (PR [#4303](https://github.com/vatesfr/xen-orchestra/pull/4303))
+- [New VM] Fix tooltips not displayed on disabled elements in some browsers (e.g. Google Chrome) [#4304](https://github.com/vatesfr/xen-orchestra/issues/4304) (PR [#4309](https://github.com/vatesfr/xen-orchestra/pull/4309))
 
 ### Released packages
 
-- xen-api v0.25.2
-- xo-server v5.43.0
-- xo-web v5.43.0
+- xo-server-auth-ldap v0.6.5
+- xen-api v0.26.0
+- xo-server-sdn-controller v0.1
+- xo-server-auth-saml v0.6.0
+- xo-server-backup-reports v0.16.2
+- xo-server v5.44.0
+- xo-web v5.44.0
 
 ## **5.35.0** (2019-05-29)
 
-![Channel: latest](https://badgen.net/badge/channel/latest/yellow)
-
 ### Enhancements
 
 - [VM/general] Display 'Started... ago' instead of 'Halted... ago' for paused state [#3750](https://github.com/vatesfr/xen-orchestra/issues/3750) (PR [#4170](https://github.com/vatesfr/xen-orchestra/pull/4170))
@@ -53,8 +633,6 @@
 
 ## **5.34.0** (2019-04-30)
 
-![Channel: stable](https://badgen.net/badge/channel/stable/green)
-
 ### Highlights
 
 - [Self/New VM] Add network config box to custom cloud-init [#3872](https://github.com/vatesfr/xen-orchestra/issues/3872) (PR [#4150](https://github.com/vatesfr/xen-orchestra/pull/4150))
@@ -78,9 +656,9 @@
 
 ### Bug fixes
 
-- [Continuous Replication] Fix VHD size guess for empty files [#4105](https://github.com/vatesfr/xen-orchestra/issues/4105)  (PR [#4107](https://github.com/vatesfr/xen-orchestra/pull/4107))
+- [Continuous Replication] Fix VHD size guess for empty files [#4105](https://github.com/vatesfr/xen-orchestra/issues/4105) (PR [#4107](https://github.com/vatesfr/xen-orchestra/pull/4107))
 - [Backup NG] Only display full backup interval in case of a delta backup (PR [#4125](https://github.com/vatesfr/xen-orchestra/pull/4107))
-- [Dashboard/Health] fix 'an error has occurred' on the storage state table [#4128](https://github.com/vatesfr/xen-orchestra/issues/4128)  (PR [#4132](https://github.com/vatesfr/xen-orchestra/pull/4132))
+- [Dashboard/Health] fix 'an error has occurred' on the storage state table [#4128](https://github.com/vatesfr/xen-orchestra/issues/4128) (PR [#4132](https://github.com/vatesfr/xen-orchestra/pull/4132))
 - [Menu] XOA: Fixed empty slot when menu is collapsed [#4012](https://github.com/vatesfr/xen-orchestra/issues/4012) (PR [#4068](https://github.com/vatesfr/xen-orchestra/pull/4068)
 - [Self/New VM] Fix missing templates when refreshing page [#3265](https://github.com/vatesfr/xen-orchestra/issues/3265) (PR [#3565](https://github.com/vatesfr/xen-orchestra/pull/3565))
 - [Home] No more false positives when select Tag on Home page [#4087](https://github.com/vatesfr/xen-orchestra/issues/4087) (PR [#4112](https://github.com/vatesfr/xen-orchestra/pull/4112))
@@ -116,7 +694,7 @@
 - Enable compression for HTTP requests (and initial objects fetch)
 - [VDI migration] Display same-pool SRs first in the selector [#3945](https://github.com/vatesfr/xen-orchestra/issues/3945) (PR [#3996](https://github.com/vatesfr/xen-orchestra/pull/3996))
 - [Home] Save the current page in url [#3993](https://github.com/vatesfr/xen-orchestra/issues/3993) (PR [#3999](https://github.com/vatesfr/xen-orchestra/pull/3999))
-- [VDI] Ensure suspend VDI is destroyed when destroying a VM  [#4027](https://github.com/vatesfr/xen-orchestra/issues/4027) (PR [#4038](https://github.com/vatesfr/xen-orchestra/pull/4038))
+- [VDI] Ensure suspend VDI is destroyed when destroying a VM [#4027](https://github.com/vatesfr/xen-orchestra/issues/4027) (PR [#4038](https://github.com/vatesfr/xen-orchestra/pull/4038))
 - [VM/disk]: Warning when 2 VDIs are on 2 different hosts' local SRs [#3911](https://github.com/vatesfr/xen-orchestra/issues/3911) (PR [#3969](https://github.com/vatesfr/xen-orchestra/pull/3969))
 - [Remotes] Benchmarks (read and write rate speed) added when remote is tested [#3991](https://github.com/vatesfr/xen-orchestra/issues/3991) (PR [#4015](https://github.com/vatesfr/xen-orchestra/pull/4015))
 - [Cloud Config] Support both NoCloud and Config Drive 2 datasources for maximum compatibility (PR [#4053](https://github.com/vatesfr/xen-orchestra/pull/4053))
@@ -191,7 +769,7 @@
 - [Home/VM] Show creation date of the VM on if it available [#3953](https://github.com/vatesfr/xen-orchestra/issues/3953) (PR [#3959](https://github.com/vatesfr/xen-orchestra/pull/3959))
 - [Notifications] Fix invalid notifications when not registered (PR [#3966](https://github.com/vatesfr/xen-orchestra/pull/3966))
 - [Import] Fix import of some OVA files [#3962](https://github.com/vatesfr/xen-orchestra/issues/3962) (PR [#3974](https://github.com/vatesfr/xen-orchestra/pull/3974))
-- [Servers] Fix *already connected error* after a server has been removed during connection [#3976](https://github.com/vatesfr/xen-orchestra/issues/3976) (PR [#3977](https://github.com/vatesfr/xen-orchestra/pull/3977))
+- [Servers] Fix _already connected error_ after a server has been removed during connection [#3976](https://github.com/vatesfr/xen-orchestra/issues/3976) (PR [#3977](https://github.com/vatesfr/xen-orchestra/pull/3977))
 - [Backup] Fix random _mount_ issues with NFS/SMB remotes [#3973](https://github.com/vatesfr/xen-orchestra/issues/3973) (PR [#4003](https://github.com/vatesfr/xen-orchestra/pull/4003))
 
 ### Released packages
@@ -268,7 +846,7 @@
 - [Self] Display sorted Resource Sets [#3818](https://github.com/vatesfr/xen-orchestra/issues/3818) (PR [#3823](https://github.com/vatesfr/xen-orchestra/pull/3823))
 - [Servers] Correctly report connecting status (PR [#3838](https://github.com/vatesfr/xen-orchestra/pull/3838))
 - [Servers] Fix cannot reconnect to a server after connection has been lost [#3839](https://github.com/vatesfr/xen-orchestra/issues/3839) (PR [#3841](https://github.com/vatesfr/xen-orchestra/pull/3841))
-- [New VM] Fix `NO_HOSTS_AVAILABLE()` error when creating  a VM on a local SR from template on another local SR [#3084](https://github.com/vatesfr/xen-orchestra/issues/3084) (PR [#3827](https://github.com/vatesfr/xen-orchestra/pull/3827))
+- [New VM] Fix `NO_HOSTS_AVAILABLE()` error when creating a VM on a local SR from template on another local SR [#3084](https://github.com/vatesfr/xen-orchestra/issues/3084) (PR [#3827](https://github.com/vatesfr/xen-orchestra/pull/3827))
 - [Backup NG] Fix typo in the form [#3854](https://github.com/vatesfr/xen-orchestra/issues/3854) (PR [#3855](https://github.com/vatesfr/xen-orchestra/pull/3855))
 - [New SR] No warning when creating a NFS SR on a path that is already used as NFS SR [#3844](https://github.com/vatesfr/xen-orchestra/issues/3844) (PR [#3851](https://github.com/vatesfr/xen-orchestra/pull/3851))
 - [New SR] No redirection if the SR creation failed or canceled [#3843](https://github.com/vatesfr/xen-orchestra/issues/3843) (PR [#3853](https://github.com/vatesfr/xen-orchestra/pull/3853))
@@ -280,7 +858,7 @@
 - [VM creation] Broken CloudInit config drive when VM created on local SR
 - [Legacy Backup] Fix error when restoring a backup
 - [Home] Fix `user.getAll` error when user is not admin [#3573](https://github.com/vatesfr/xen-orchestra/issues/3573) (PR [#3918](https://github.com/vatesfr/xen-orchestra/pull/3918))
-- [Backup NG] Fix restore issue when a disk has grown [#3910](https://github.com/vatesfr/xen-orchestra/issues/3910)  (PR [#3920](https://github.com/vatesfr/xen-orchestra/pull/3920))
+- [Backup NG] Fix restore issue when a disk has grown [#3910](https://github.com/vatesfr/xen-orchestra/issues/3910) (PR [#3920](https://github.com/vatesfr/xen-orchestra/pull/3920))
 - [Backup NG] Delete _importing_ VMs due to interrupted CR/DR (PR [#3923](https://github.com/vatesfr/xen-orchestra/pull/3923))
 
 ### Released packages
@@ -508,7 +1086,7 @@
 ### Enhancements
 
 - [Remotes] Test the remote automatically on changes [#3323](https://github.com/vatesfr/xen-orchestra/issues/3323) (PR [#3397](https://github.com/vatesfr/xen-orchestra/pull/3397))
-- [Remotes] Use *WORKGROUP* as default domain for new SMB remote (PR [#3398](https://github.com/vatesfr/xen-orchestra/pull/3398))
+- [Remotes] Use _WORKGROUP_ as default domain for new SMB remote (PR [#3398](https://github.com/vatesfr/xen-orchestra/pull/3398))
 - [Backup NG form] Display a tip to encourage users to create vms on a thin-provisioned storage [#3334](https://github.com/vatesfr/xen-orchestra/issues/3334) (PR [#3402](https://github.com/vatesfr/xen-orchestra/pull/3402))
 - [Backup NG form] improve schedule's form [#3138](https://github.com/vatesfr/xen-orchestra/issues/3138) (PR [#3359](https://github.com/vatesfr/xen-orchestra/pull/3359))
 - [Backup NG Overview] Display transferred and merged data size for backup jobs [#3340](https://github.com/vatesfr/xen-orchestra/issues/3340) (PR [#3408](https://github.com/vatesfr/xen-orchestra/pull/3408))
@@ -525,7 +1103,7 @@
 - [Backup NG] Don't fail on VMs with empty VBDs (like CDs or floppy disks) (PR [#3410](https://github.com/vatesfr/xen-orchestra/pull/3410))
 - [XOA updater] Fix issue where trial request would fail [#3407](https://github.com/vatesfr/xen-orchestra/issues/3407) (PR [#3412](https://github.com/vatesfr/xen-orchestra/pull/3412))
 - [Backup NG logs] Fix log's value not being updated in the copy and report button [#3273](https://github.com/vatesfr/xen-orchestra/issues/3273) (PR [#3360](https://github.com/vatesfr/xen-orchestra/pull/3360))
-- [Backup NG] Fix issue when *Delete first* was enabled for some of the remotes [#3424](https://github.com/vatesfr/xen-orchestra/issues/3424) (PR [#3427](https://github.com/vatesfr/xen-orchestra/pull/3427))
+- [Backup NG] Fix issue when _Delete first_ was enabled for some of the remotes [#3424](https://github.com/vatesfr/xen-orchestra/issues/3424) (PR [#3427](https://github.com/vatesfr/xen-orchestra/pull/3427))
 - [VM/host consoles] Work around a XenServer/XCP-ng issue which lead to some consoles not working [#3432](https://github.com/vatesfr/xen-orchestra/issues/3432) (PR [#3435](https://github.com/vatesfr/xen-orchestra/pull/3435))
 - [Backup NG] Remove extraneous snapshots in case of multiple schedules [#3132](https://github.com/vatesfr/xen-orchestra/issues/3132) (PR [#3439](https://github.com/vatesfr/xen-orchestra/pull/3439))
 - [Backup NG] Fix page reloaded on creating a schedule [#3461](https://github.com/vatesfr/xen-orchestra/issues/3461) (PR [#3462](https://github.com/vatesfr/xen-orchestra/pull/3462))
@@ -705,7 +1283,7 @@
 - Make cloud config templates available for all users [3147](https://github.com/vatesfr/xen-orchestra/issues/3147) (PR [3148](https://github.com/vatesfr/xen-orchestra/pull/3148))
 - [New VM] Only create the cloud config drive when its option is enabled [3161](https://github.com/vatesfr/xen-orchestra/issues/3161) (PR [3162](https://github.com/vatesfr/xen-orchestra/pull/3162))
 - Fix error when installing patches from the host or without a default SR (PR [3166](https://github.com/vatesfr/xen-orchestra/pull/3166))
-- [Backup NG] Fix SMB *Not implemented* issue [#3149](](https://github.com/vatesfr/xen-orchestra/issues/3149) (PR [3175](https://github.com/vatesfr/xen-orchestra/pull/3175))
+- [Backup NG] Fix SMB _Not implemented_ issue [#3149](<](https://github.com/vatesfr/xen-orchestra/issues/3149)> 'PR [3175](https://github.com/vatesfr/xen-orchestra/pull/3175')
 
 ### Released packages
 
@@ -819,10 +1397,9 @@
 - Hook/action if an export stream is cut [#1929](https://github.com/vatesfr/xen-orchestra/issues/1929)
 - Backup paths should not contain tags but job ids [#1854](https://github.com/vatesfr/xen-orchestra/issues/1854)
 - Add a button to delete a backup [#1751](https://github.com/vatesfr/xen-orchestra/issues/1751)
-- Dashboard available for Pool and Host level  [#1631](https://github.com/vatesfr/xen-orchestra/issues/1631)
-- UI Enhancement - VM list - Allways show the Toolbar  [#1581](https://github.com/vatesfr/xen-orchestra/issues/1581)
-- xoa-updater --register:  unable to define proxy using the CLI [#873](https://github.com/vatesfr/xen-orchestra/issues/873)
-
+- Dashboard available for Pool and Host level [#1631](https://github.com/vatesfr/xen-orchestra/issues/1631)
+- UI Enhancement - VM list - Allways show the Toolbar [#1581](https://github.com/vatesfr/xen-orchestra/issues/1581)
+- xoa-updater --register: unable to define proxy using the CLI [#873](https://github.com/vatesfr/xen-orchestra/issues/873)
 
 ### Bugs
 
@@ -863,7 +1440,7 @@
 - Set a self-service VM at "share" after creation [#2589](https://github.com/vatesfr/xen-orchestra/issues/2589)
 - [Backup logs] Improve Unhealthy VDI Chain message [#2586](https://github.com/vatesfr/xen-orchestra/issues/2586)
 - [SortedTable] Put sort criteria in URL like the filter [#2584](https://github.com/vatesfr/xen-orchestra/issues/2584)
-- Cant attach XenTools on User side.  [#2503](https://github.com/vatesfr/xen-orchestra/issues/2503)
+- Cant attach XenTools on User side. [#2503](https://github.com/vatesfr/xen-orchestra/issues/2503)
 - Pool filter for health view [#2302](https://github.com/vatesfr/xen-orchestra/issues/2302)
 - [Smart Backup] Improve feedback [#2253](https://github.com/vatesfr/xen-orchestra/issues/2253)
 - Backup jobs stuck if no space left on NFS remote [#2116](https://github.com/vatesfr/xen-orchestra/issues/2116)
@@ -894,7 +1471,7 @@
 - Move VM In to/Out of Self Service Group [#1913](https://github.com/vatesfr/xen-orchestra/issues/1913)
 - Two factor auth [#1897](https://github.com/vatesfr/xen-orchestra/issues/1897)
 - token.create should accept an expiration [#1769](https://github.com/vatesfr/xen-orchestra/issues/1769)
-- Self Service User -  User don't have quota in his dashboard [#1538](https://github.com/vatesfr/xen-orchestra/issues/1538)
+- Self Service User - User don't have quota in his dashboard [#1538](https://github.com/vatesfr/xen-orchestra/issues/1538)
 - Remove CoffeeScript in xo-server [#189](https://github.com/vatesfr/xen-orchestra/issues/189)
 - Better Handling of suspending VMs from the Home screen [#2547](https://github.com/vatesfr/xen-orchestra/issues/2547)
 - [xen-api] Stronger reconnection policy [#2410](https://github.com/vatesfr/xen-orchestra/issues/2410)
@@ -913,7 +1490,6 @@
 - TZ selector is not used for backup schedule preview [#2464](https://github.com/vatesfr/xen-orchestra/issues/2464)
 - Remove filter in VM/network view [#2548](https://github.com/vatesfr/xen-orchestra/issues/2548)
 
-
 ## **5.15.0** (2017-12-29)
 
 ### Enhancements
@@ -922,7 +1498,7 @@
 - Smart replace VDI.pool_migrate removed from XenServer 7.3 Free [#2541](https://github.com/vatesfr/xen-orchestra/issues/2541)
 - New memory constraints in XenServer 7.3 [#2540](https://github.com/vatesfr/xen-orchestra/issues/2540)
 - Link to Settings/Logs for admins in error notifications [#2516](https://github.com/vatesfr/xen-orchestra/issues/2516)
-- [Self Service] Do not use placehodlers to describe inputs  [#2509](https://github.com/vatesfr/xen-orchestra/issues/2509)
+- [Self Service] Do not use placehodlers to describe inputs [#2509](https://github.com/vatesfr/xen-orchestra/issues/2509)
 - Obfuscate password in log in LDAP plugin test [#2506](https://github.com/vatesfr/xen-orchestra/issues/2506)
 - Log rotation [#2492](https://github.com/vatesfr/xen-orchestra/issues/2492)
 - Continuous Replication TAG [#2473](https://github.com/vatesfr/xen-orchestra/issues/2473)
@@ -939,7 +1515,6 @@
 - Cloud config drive create fail on XenServer < 7 [#2478](https://github.com/vatesfr/xen-orchestra/issues/2478)
 - VM create fails due to missing vGPU id [#2466](https://github.com/vatesfr/xen-orchestra/issues/2466)
 
-
 ## **5.14.0** (2017-10-31)
 
 ### Enhancements
@@ -989,9 +1564,9 @@
 - Warning on SMB remote creation [#2316](https://github.com/vatesfr/xen-orchestra/issues/2316)
 - [Home | SortedTable] Add link to syntax doc in the filter input [#2305](https://github.com/vatesfr/xen-orchestra/issues/2305)
 - [SortedTable] Add optional binding of filter to an URL query [#2301](https://github.com/vatesfr/xen-orchestra/issues/2301)
-- [Home][Keyboard navigation] Allow selecting the objects [#2214](https://github.com/vatesfr/xen-orchestra/issues/2214)
+- [Home][keyboard navigation] Allow selecting the objects [#2214](https://github.com/vatesfr/xen-orchestra/issues/2214)
 - SR view / Disks: option to display non managed VDIs [#1724](https://github.com/vatesfr/xen-orchestra/issues/1724)
-- Continuous Replication Retention  [#1692](https://github.com/vatesfr/xen-orchestra/issues/1692)
+- Continuous Replication Retention [#1692](https://github.com/vatesfr/xen-orchestra/issues/1692)
 
 ### Bugs
 
@@ -999,7 +1574,7 @@
 - Errors in VM copy are not properly reported [#2347](https://github.com/vatesfr/xen-orchestra/issues/2347)
 - Removing a PIF IP fails [#2346](https://github.com/vatesfr/xen-orchestra/issues/2346)
 - Review and fix creating a VM from a snapshot [#2343](https://github.com/vatesfr/xen-orchestra/issues/2343)
-- iSCSI LUN Detection fails with authentification  [#2339](https://github.com/vatesfr/xen-orchestra/issues/2339)
+- iSCSI LUN Detection fails with authentification [#2339](https://github.com/vatesfr/xen-orchestra/issues/2339)
 - Fix PoolActionBar to add a new SR [#2307](https://github.com/vatesfr/xen-orchestra/issues/2307)
 - [VM migration] Error if default SR not accessible to target host [#2180](https://github.com/vatesfr/xen-orchestra/issues/2180)
 - A job shouldn't executable more than once at the same time [#2053](https://github.com/vatesfr/xen-orchestra/issues/2053)
@@ -1017,9 +1592,9 @@
 - [SortedTable] Add grouped actions feature [#2276](https://github.com/vatesfr/xen-orchestra/issues/2276)
 - Add a filter to the backups' log [#2246](https://github.com/vatesfr/xen-orchestra/issues/2246)
 - It should not be possible to migrate a halted VM. [#2233](https://github.com/vatesfr/xen-orchestra/issues/2233)
-- [Home][Keyboard navigation] Allow selecting the objects [#2214](https://github.com/vatesfr/xen-orchestra/issues/2214)
+- [Home][keyboard navigation] Allow selecting the objects [#2214](https://github.com/vatesfr/xen-orchestra/issues/2214)
 - Allow to set pool master [#2213](https://github.com/vatesfr/xen-orchestra/issues/2213)
-- Continuous Replication Retention  [#1692](https://github.com/vatesfr/xen-orchestra/issues/1692)
+- Continuous Replication Retention [#1692](https://github.com/vatesfr/xen-orchestra/issues/1692)
 
 ### Bugs
 
@@ -1100,8 +1675,7 @@
 - Select is "moving" [\#2142](https://github.com/vatesfr/xen-orchestra/issues/2142)
 - Select issue for affinity host [\#2141](https://github.com/vatesfr/xen-orchestra/issues/2141)
 - Dashboard Storage Usage incorrect [\#2123](https://github.com/vatesfr/xen-orchestra/issues/2123)
-- Detect unmerged *base copy* and prevent too long chains [\#2047](https://github.com/vatesfr/xen-orchestra/issues/2047)
-
+- Detect unmerged _base copy_ and prevent too long chains [\#2047](https://github.com/vatesfr/xen-orchestra/issues/2047)
 
 ## **5.8.0** (2017-04-28)
 
@@ -1163,7 +1737,7 @@
 
 - Missing objects should be displayed in backup edition [\#2052](https://github.com/vatesfr/xen-orchestra/issues/2052)
 - Search bar content changes while typing [\#2035](https://github.com/vatesfr/xen-orchestra/issues/2035)
-- VM.$guest_metrics.PV_drivers_up_to_date is deprecated in XS 7.1 [\#2024](https://github.com/vatesfr/xen-orchestra/issues/2024)
+- VM.\$guest_metrics.PV_drivers_up_to_date is deprecated in XS 7.1 [\#2024](https://github.com/vatesfr/xen-orchestra/issues/2024)
 - Bootable flag selection checkbox for extra disk not fetched [\#1994](https://github.com/vatesfr/xen-orchestra/issues/1994)
 - Home view − Changing type must reset paging [\#1993](https://github.com/vatesfr/xen-orchestra/issues/1993)
 - XOSAN menu item should only be displayed to admins [\#1968](https://github.com/vatesfr/xen-orchestra/issues/1968)
@@ -1249,7 +1823,7 @@ File level restore.
 - Use paginated table for backup jobs [\#1726](https://github.com/vatesfr/xen-orchestra/issues/1726)
 - SR view / Disks: should display snapshot VDIs [\#1723](https://github.com/vatesfr/xen-orchestra/issues/1723)
 - Restored VM should have an identifiable name [\#1719](https://github.com/vatesfr/xen-orchestra/issues/1719)
-- If host reboot action returns NO\_HOSTS\_AVAILABLE, ask to force [\#1717](https://github.com/vatesfr/xen-orchestra/issues/1717)
+- If host reboot action returns NO_HOSTS_AVAILABLE, ask to force [\#1717](https://github.com/vatesfr/xen-orchestra/issues/1717)
 - Hide xo-server timezone in backups [\#1706](https://github.com/vatesfr/xen-orchestra/issues/1706)
 - Enable hyperlink for Hostname for Issues [\#1700](https://github.com/vatesfr/xen-orchestra/issues/1700)
 - Pool/network - Modify column [\#1696](https://github.com/vatesfr/xen-orchestra/issues/1696)
@@ -1273,15 +1847,15 @@ File level restore.
 
 - Should jobs be accessible to non admins? [\#1759](https://github.com/vatesfr/xen-orchestra/issues/1759)
 - Schedules deletion is not working [\#1737](https://github.com/vatesfr/xen-orchestra/issues/1737)
-- Editing a job from the jobs overview page does not work  [\#1736](https://github.com/vatesfr/xen-orchestra/issues/1736)
-- Editing a schedule from jobs overview does not work  [\#1728](https://github.com/vatesfr/xen-orchestra/issues/1728)
+- Editing a job from the jobs overview page does not work [\#1736](https://github.com/vatesfr/xen-orchestra/issues/1736)
+- Editing a schedule from jobs overview does not work [\#1728](https://github.com/vatesfr/xen-orchestra/issues/1728)
 - ACLs not correctly imported [\#1722](https://github.com/vatesfr/xen-orchestra/issues/1722)
 - Some Bootstrap style broken [\#1721](https://github.com/vatesfr/xen-orchestra/issues/1721)
 - Not properly sign out on auth token expiration [\#1711](https://github.com/vatesfr/xen-orchestra/issues/1711)
 - Hosts/<UUID>/network status is incorrect [\#1702](https://github.com/vatesfr/xen-orchestra/issues/1702)
 - Patches application fails "Found : Moved Temporarily" [\#1701](https://github.com/vatesfr/xen-orchestra/issues/1701)
 - Password generation for user creation is not working [\#1678](https://github.com/vatesfr/xen-orchestra/issues/1678)
-- \#/dashboard/health Remove All Orphaned VDIs  [\#1622](https://github.com/vatesfr/xen-orchestra/issues/1622)
+- \#/dashboard/health Remove All Orphaned VDIs [\#1622](https://github.com/vatesfr/xen-orchestra/issues/1622)
 - Create a new SR - CIFS/SAMBA Broken [\#1615](https://github.com/vatesfr/xen-orchestra/issues/1615)
 - xo-cli --list-objects: truncated output ? 64k buffer limitation ? [\#1356](https://github.com/vatesfr/xen-orchestra/issues/1356)
 
@@ -1460,7 +2034,7 @@ File level restore.
 - Button to recompute resource sets limits [\#1287](https://github.com/vatesfr/xen-orchestra/issues/1287)
 - Credit scheduler CAP and weight configuration [\#1283](https://github.com/vatesfr/xen-orchestra/issues/1283)
 - Migration form problem on the /v5/vms/\_\_UUID\_\_ page when doing xenmotion inside a pool [\#1254](https://github.com/vatesfr/xen-orchestra/issues/1254)
-- /v5/\#/pools/\_\_UUID\_\_: patch table improvement  [\#1246](https://github.com/vatesfr/xen-orchestra/issues/1246)
+- /v5/\#/pools/\_\_UUID\_\_: patch table improvement [\#1246](https://github.com/vatesfr/xen-orchestra/issues/1246)
 - /v5/\#/hosts/\_\_UUID\_\_: patch list improvements ? [\#1245](https://github.com/vatesfr/xen-orchestra/issues/1245)
 - F\*cking patches, how do they work? [\#1236](https://github.com/vatesfr/xen-orchestra/issues/1236)
 - Change Default Filter [\#1235](https://github.com/vatesfr/xen-orchestra/issues/1235)
@@ -1515,7 +2089,7 @@ File level restore.
 - Scheduled jobs seems use GMT since 5.0 [\#1258](https://github.com/vatesfr/xen-orchestra/issues/1258)
 - Can't create a VM with disks on 2 different SRs [\#1257](https://github.com/vatesfr/xen-orchestra/issues/1257)
 - Graph display bug [\#1247](https://github.com/vatesfr/xen-orchestra/issues/1247)
-- /v5/#/hosts/__UUID__: Patch list not limited to the current pool [\#1244](https://github.com/vatesfr/xen-orchestra/issues/1244)
+- /v5/#/hosts/**UUID**: Patch list not limited to the current pool [\#1244](https://github.com/vatesfr/xen-orchestra/issues/1244)
 - Replication issues [\#1233](https://github.com/vatesfr/xen-orchestra/issues/1233)
 - VM creation install method disabled fields [\#1198](https://github.com/vatesfr/xen-orchestra/issues/1198)
 - Update icon shouldn't be displayed when menu is collapsed [\#1188](https://github.com/vatesfr/xen-orchestra/issues/1188)
@@ -1553,10 +2127,10 @@ File level restore.
 - Show HVM, PVM, PVHVM modes in guest details [\#806](https://github.com/vatesfr/xen-orchestra/issues/806)
 - Tree view: display cpu available/total for each host [\#696](https://github.com/vatesfr/xen-orchestra/issues/696)
 - Greenkeeper integration [\#667](https://github.com/vatesfr/xen-orchestra/issues/667)
-- Clarify vCPUs and RAM editor  [\#658](https://github.com/vatesfr/xen-orchestra/issues/658)
+- Clarify vCPUs and RAM editor [\#658](https://github.com/vatesfr/xen-orchestra/issues/658)
 - Backup LZ4 compression [\#647](https://github.com/vatesfr/xen-orchestra/issues/647)
 - Support enum in plugins configuration [\#638](https://github.com/vatesfr/xen-orchestra/issues/638)
-- Add configuration option to disable xoa-updater  [\#535](https://github.com/vatesfr/xen-orchestra/issues/535)
+- Add configuration option to disable xoa-updater [\#535](https://github.com/vatesfr/xen-orchestra/issues/535)
 - Use cursors to add more context to actions [\#523](https://github.com/vatesfr/xen-orchestra/issues/523)
 - Review UI for flat view [\#354](https://github.com/vatesfr/xen-orchestra/issues/354)
 - Review UI for the tree view [\#353](https://github.com/vatesfr/xen-orchestra/issues/353)
@@ -1566,7 +2140,7 @@ File level restore.
 - Ability to collapse pools/hosts in main view [\#173](https://github.com/vatesfr/xen-orchestra/issues/173)
 - Issue importing .xva VM via xo-web [\#1022](https://github.com/vatesfr/xen-orchestra/issues/1022)
 - Enhancement Proposal - Cancel In Progress Backups [\#1003](https://github.com/vatesfr/xen-orchestra/issues/1003)
-- Can't create VM with  CloudConfigDrive [\#917](https://github.com/vatesfr/xen-orchestra/issues/917)
+- Can't create VM with CloudConfigDrive [\#917](https://github.com/vatesfr/xen-orchestra/issues/917)
 - Auth: LDAP User causes problems [\#893](https://github.com/vatesfr/xen-orchestra/issues/893)
 - No tags in Continuous Replication [\#838](https://github.com/vatesfr/xen-orchestra/issues/838)
 - Delta backup Depth not working [\#802](https://github.com/vatesfr/xen-orchestra/issues/802)
@@ -1582,20 +2156,20 @@ File level restore.
 
 - vCPUs number when no tools installed [\#1089](https://github.com/vatesfr/xen-orchestra/issues/1089)
 - Config Drive textbox disappears when content is deleted [\#1012](https://github.com/vatesfr/xen-orchestra/issues/1012)
-- storage status not changed in host view page after disconnect/connect  [\#1009](https://github.com/vatesfr/xen-orchestra/issues/1009)
+- storage status not changed in host view page after disconnect/connect [\#1009](https://github.com/vatesfr/xen-orchestra/issues/1009)
 - Cannot Delete Logs From Backup Overview [\#1004](https://github.com/vatesfr/xen-orchestra/issues/1004)
 - \[v5.x\] Plugins configuration: optional non-used objects are sent [\#1000](https://github.com/vatesfr/xen-orchestra/issues/1000)
 - "@" char in remote password break the remote view [\#997](https://github.com/vatesfr/xen-orchestra/issues/997)
-- Handle MEMORY\_CONSTRAINT\_VIOLATION correctly [\#970](https://github.com/vatesfr/xen-orchestra/issues/970)
+- Handle MEMORY_CONSTRAINT_VIOLATION correctly [\#970](https://github.com/vatesfr/xen-orchestra/issues/970)
 - VM creation error on XenServer Dundee [\#964](https://github.com/vatesfr/xen-orchestra/issues/964)
 - Copy VMs doesn't display all SRs [\#945](https://github.com/vatesfr/xen-orchestra/issues/945)
-- Autopower\_on wrong value [\#937](https://github.com/vatesfr/xen-orchestra/issues/937)
+- Autopower_on wrong value [\#937](https://github.com/vatesfr/xen-orchestra/issues/937)
 - Correctly handle unknown users in group view [\#900](https://github.com/vatesfr/xen-orchestra/issues/900)
 - Importing into Dundee [\#887](https://github.com/vatesfr/xen-orchestra/issues/887)
 - update status - gui resize issue [\#803](https://github.com/vatesfr/xen-orchestra/issues/803)
 - Backup Remote Stores Problem [\#751](https://github.com/vatesfr/xen-orchestra/issues/751)
 - VM view is broken when changing a disk SR twice [\#670](https://github.com/vatesfr/xen-orchestra/issues/670)
-- console mouse sync  [\#280](https://github.com/vatesfr/xen-orchestra/issues/280)
+- console mouse sync [\#280](https://github.com/vatesfr/xen-orchestra/issues/280)
 
 ## **4.16.0** (2016-04-29)
 
@@ -1603,7 +2177,7 @@ Maintenance release
 
 ### Enhancements
 
-- TOO\_MANY\_PENDING\_TASKS [\#861](https://github.com/vatesfr/xen-orchestra/issues/861)
+- TOO_MANY_PENDING_TASKS [\#861](https://github.com/vatesfr/xen-orchestra/issues/861)
 
 ### Bug fixes
 
@@ -1644,7 +2218,7 @@ Load balancing, SMB delta support, advanced network operations...
 
 ### Bug fixes
 
-- Broken link to backup remote  [\#821](https://github.com/vatesfr/xen-orchestra/issues/821)
+- Broken link to backup remote [\#821](https://github.com/vatesfr/xen-orchestra/issues/821)
 - Issue with self-signed cert for email plugin [\#817](https://github.com/vatesfr/xen-orchestra/issues/817)
 - Plugins view, reset form and errors [\#815](https://github.com/vatesfr/xen-orchestra/issues/815)
 - HVM recovery mode is broken [\#794](https://github.com/vatesfr/xen-orchestra/issues/794)
@@ -1798,7 +2372,7 @@ Delta backup, CloudInit...
 - Allow editing PV args even when empty \(but only for PV VMs\) [\#557](https://github.com/vatesfr/xen-orchestra/issues/557)
 - Crashes when using legacy event system [\#556](https://github.com/vatesfr/xen-orchestra/issues/556)
 - XenServer patches check error for 6.1 [\#555](https://github.com/vatesfr/xen-orchestra/issues/555)
-- activation plugin xo-server-transport-email  [\#553](https://github.com/vatesfr/xen-orchestra/issues/553)
+- activation plugin xo-server-transport-email [\#553](https://github.com/vatesfr/xen-orchestra/issues/553)
 - Server error with JSON on 32 bits Dom0 [\#552](https://github.com/vatesfr/xen-orchestra/issues/552)
 - Cloud Config drive shouldn't be created on default SR [\#548](https://github.com/vatesfr/xen-orchestra/issues/548)
 - Deep properties cannot be edited in plugins configuration form [\#521](https://github.com/vatesfr/xen-orchestra/issues/521)
@@ -2066,7 +2640,7 @@ An issue in `xo-server` with the password of default admin account and also a UI
 
 ## **4.0.1** (2015-05-30)
 
-An issue with the updater in HTTPS was left in the *4.0.0*. This patch release fixed
+An issue with the updater in HTTPS was left in the _4.0.0_. This patch release fixed
 it.
 
 ### Bug fixes
@@ -2098,10 +2672,9 @@ it.
 - VM stats behavior more robust ([xo-web#250](https://github.com/vatesfr/xen-orchestra/issues/250))
 - XO not on the root of domain ([xo-web#254](https://github.com/vatesfr/xen-orchestra/issues/254))
 
-
 ## **3.9.1** (2015-04-21)
 
-A few bugs hve made their way into *3.9.0*, this minor release fixes
+A few bugs hve made their way into _3.9.0_, this minor release fixes
 them.
 
 ### Bug fixes
@@ -2152,13 +2725,13 @@ them.
 
 ### Bug fixes
 
-- fix *Invalid parameter(s)* message on the settings page ([xo-server#49](https://github.com/vatesfr/xo-server/issues/49))
+- fix _Invalid parameter(s)_ message on the settings page ([xo-server#49](https://github.com/vatesfr/xo-server/issues/49))
 - fix mouse clicks in console ([xo-web#205](https://github.com/vatesfr/xen-orchestra/issues/205))
 - fix user editing on the settings page ([xo-web#206](https://github.com/vatesfr/xen-orchestra/issues/206))
 
 ## **3.7.0** (2015-03-06)
 
-*Highlights in this release are the [initial ACLs implementation](https://xen-orchestra.com/blog/xen-orchestra-3-7-is-out-acls-in-early-access), [live migration for VDIs](https://xen-orchestra.com/blog/moving-vdi-in-live) and the ability to [create a new storage repository](https://xen-orchestra.com/blog/create-a-storage-repository-with-xen-orchestra/).*
+_Highlights in this release are the [initial ACLs implementation](https://xen-orchestra.com/blog/xen-orchestra-3-7-is-out-acls-in-early-access), [live migration for VDIs](https://xen-orchestra.com/blog/moving-vdi-in-live) and the ability to [create a new storage repository](https://xen-orchestra.com/blog/create-a-storage-repository-with-xen-orchestra/)._
 
 ### Enhancements
 
@@ -2185,7 +2758,7 @@ them.
 - fix console view on IE ([xo-web#184](https://github.com/vatesfr/xen-orchestra/issues/184))
 - fix out of sync objects in XO-Web ([xo-web#142](https://github.com/vatesfr/xen-orchestra/issues/142))
 - fix incorrect connection status displayed in login view ([xo-web#193](https://github.com/vatesfr/xen-orchestra/issues/193))
-- fix *flickering* tree view ([xo-web#194](https://github.com/vatesfr/xen-orchestra/issues/194))
+- fix _flickering_ tree view ([xo-web#194](https://github.com/vatesfr/xen-orchestra/issues/194))
 - single host pools should not have a dropdown menu in tree view ([xo-web#198](https://github.com/vatesfr/xen-orchestra/issues/198))
 
 ## **3.6.0** (2014-11-28)
@@ -2229,7 +2802,7 @@ them.
 
 ## **3.5.0** (2014-08-14)
 
-*[XO-Web](https://www.npmjs.org/package/xo-web) and [XO-Server](https://www.npmjs.org/package/xo-server) are now available as npm packages!*
+_[XO-Web](https://www.npmjs.org/package/xo-web) and [XO-Server](https://www.npmjs.org/package/xo-server) are now available as npm packages!_
 
 ### Enhancements
 
@@ -2255,9 +2828,9 @@ them.
 
 ## **3.4.0** (2014-05-22)
 
-*Highlight in this release is the new events system between XO-Web
+_Highlight in this release is the new events system between XO-Web
 and XO-Server which results in less bandwidth consumption as well as
-better performance and reactivity.*
+better performance and reactivity._
 
 ### Enhancements
 
@@ -2291,8 +2864,8 @@ better performance and reactivity.*
 
 ### Bug fixes
 
-- *Snapshot* not working in VM view ([#95](https://github.com/vatesfr/xen-orchestra/issues/95))
-- Host *Reboot*/*Restart toolstack*/*Shutdown* not working in main view ([#97](https://github.com/vatesfr/xen-orchestra/issues/97))
+- _Snapshot_ not working in VM view ([#95](https://github.com/vatesfr/xen-orchestra/issues/95))
+- Host _Reboot_/_Restart toolstack_/_Shutdown_ not working in main view ([#97](https://github.com/vatesfr/xen-orchestra/issues/97))
 - Bower cannot install `angular` automatically due to a version conflict ([#101](https://github.com/vatesfr/xen-orchestra/issues/101))
 - Bower installs an incorrect version of `angular-animate` ([#102](https://github.com/vatesfr/xen-orchestra/issues/102))
 
@@ -2320,7 +2893,7 @@ better performance and reactivity.*
 
 - in VM view, interfaces' network should be displayed ([#64](https://github.com/vatesfr/xen-orchestra/issues/64))
 - middle-click or `Ctrl`+click should open new windows (even on pseudo-links) ([#66](https://github.com/vatesfr/xen-orchestra/issues/66))
-- lists should use natural sorting (e.g. *VM 2* before *VM 10*) ([#69](https://github.com/vatesfr/xen-orchestra/issues/69))
+- lists should use natural sorting (e.g. _VM 2_ before _VM 10_) ([#69](https://github.com/vatesfr/xen-orchestra/issues/69))
 
 ### Bug fixes
 
@@ -2328,7 +2901,7 @@ better performance and reactivity.*
 - it makes no sense to remove a stand-alone host from a pool (58)
 - in VM view, the migrate button is not working ([#59](https://github.com/vatesfr/xen-orchestra/issues/59))
 - pool and host names overflow their box in the main view ([#63](https://github.com/vatesfr/xen-orchestra/issues/63))
-- in host view, interfaces incorrectly named *networks* and VLAN not shown ([#70](https://github.com/vatesfr/xen-orchestra/issues/70))
+- in host view, interfaces incorrectly named _networks_ and VLAN not shown ([#70](https://github.com/vatesfr/xen-orchestra/issues/70))
 - VM suspended state is not properly handled ([#71](https://github.com/vatesfr/xen-orchestra/issues/71))
 - unauthenticated users should not be able to access to consoles ([#73](https://github.com/vatesfr/xen-orchestra/issues/73))
 - incorrect scroll (under the navbar) when the view changes ([#74](https://github.com/vatesfr/xen-orchestra/issues/74))

CHANGELOG.unreleased.md

@@ -1,32 +1,56 @@
 > This file contains all changes that have not been released yet.
+>
+> Keep in mind the changelog is addressed to **users** and should be
+> understandable by them.
 
 ### Enhancements
 
-- [Backup-ng/restore] Display size for full VM backup [#4009](https://github.com/vatesfr/xen-orchestra/issues/4009) (PR [#4245](https://github.com/vatesfr/xen-orchestra/pull/4245))
-- [Sr/new] Ability to select NFS version when creating NFS storage [#3951](https://github.com/vatesfr/xen-orchestra/issues/3951) (PR [#4277](https://github.com/vatesfr/xen-orchestra/pull/4277))
-- [auth-saml] Improve compatibility with Microsoft Azure Active Directory (PR [#4294](https://github.com/vatesfr/xen-orchestra/pull/4294))
-- [Host] Display warning when "Citrix Hypervisor" license has restrictions [#4251](https://github.com/vatesfr/xen-orchestra/issues/4164) (PR [#4235](https://github.com/vatesfr/xen-orchestra/pull/4279))
-- [VM/Backup] Create backup bulk action [#2573](https://github.com/vatesfr/xen-orchestra/issues/2573) (PR [#4257](https://github.com/vatesfr/xen-orchestra/pull/4257))
-- [Sr/new] Ability to select NFS version when creating NFS storage [#3951](https://github.com/vatesfr/xen-orchestra/issues/#3951) (PR [#4277](https://github.com/vatesfr/xen-orchestra/pull/4277))
-- [SR/new] Create ZFS storage [#4260](https://github.com/vatesfr/xen-orchestra/issues/4260) (PR [#4266](https://github.com/vatesfr/xen-orchestra/pull/4266))
-- [Host] Display warning when host's time differs too much from XOA's time [#4113](https://github.com/vatesfr/xen-orchestra/issues/4113) (PR [#4173](https://github.com/vatesfr/xen-orchestra/pull/4173))
-- [Host/storages, SR/hosts] Display PBD details [#4264](https://github.com/vatesfr/xen-orchestra/issues/4161) (PR [#4268](https://github.com/vatesfr/xen-orchestra/pull/4284))
-- [VM/network] Display and set bandwidth rate-limit of a VIF [#4215](https://github.com/vatesfr/xen-orchestra/issues/4215) (PR [#4293](https://github.com/vatesfr/xen-orchestra/pull/4293))
-- [SDN Controller] New plugin which enables creating pool-wide private networks [xcp-ng/xcp#175](https://github.com/xcp-ng/xcp/issues/175) (PR [#4269](https://github.com/vatesfr/xen-orchestra/pull/4269))
+> Users must be able to say: “Nice enhancement, I'm eager to test it”
+
+- [VM/Network] Show IP addresses in front of their VIFs [#4882](https://github.com/vatesfr/xen-orchestra/issues/4882) (PR [#5003](https://github.com/vatesfr/xen-orchestra/pull/5003))
+- [VM] Ability to protect VM from accidental deletion [#4773](https://github.com/vatesfr/xen-orchestra/issues/4773)
+- [Plugin] Disable test plugin action when the plugin is not loaded (PR [#5038](https://github.com/vatesfr/xen-orchestra/pull/5038))
+- [Home/Template] Ability to copy/clone VM templates [#4734](https://github.com/vatesfr/xen-orchestra/issues/4734) (PR [#5006](https://github.com/vatesfr/xen-orchestra/pull/5006))
+- [VM/bulk copy] Add fast clone option (PR [#5006](https://github.com/vatesfr/xen-orchestra/pull/5006))
+- [VM] Differentiate PV drivers detection from management agent detection [#4783](https://github.com/vatesfr/xen-orchestra/issues/4783) (PR [#5007](https://github.com/vatesfr/xen-orchestra/pull/5007))
+- [Home/VM] Homogenize the list of backed up VMs with the normal list (PR [#5046](https://github.com/vatesfr/xen-orchestra/pull/5046)
+- [SR/Disks] Add tooltip for disabled migration (PR [#4884](https://github.com/vatesfr/xen-orchestra/pull/4884))
+- [SR/Advanced, SR selector] Show thin/thick provisioning [#2208](https://github.com/vatesfr/xen-orchestra/issues/2208) (PR [#5081](https://github.com/vatesfr/xen-orchestra/pull/5081))
 
 ### Bug fixes
 
-- [Metadata backup] Missing XAPIs should trigger a failure job [#4281](https://github.com/vatesfr/xen-orchestra/issues/4281) (PR [#4283](https://github.com/vatesfr/xen-orchestra/pull/4283))
-- [Host/advanced] Fix host CPU hyperthreading detection [#4262](https://github.com/vatesfr/xen-orchestra/issues/4262) (PR [#4285](https://github.com/vatesfr/xen-orchestra/pull/4285))
-- [iSCSI] Fix fibre channel paths display [#4291](https://github.com/vatesfr/xen-orchestra/issues/4291) (PR [#4303](https://github.com/vatesfr/xen-orchestra/pull/4303))
-- [New VM] Fix tooltips not displayed on disabled elements in some browsers (e.g. Google Chrome) [#4304](https://github.com/vatesfr/xen-orchestra/issues/4304) (PR [#4309](https://github.com/vatesfr/xen-orchestra/pull/4309))
+> Users must be able to say: “I had this issue, happy to know it's fixed”
 
-### Released packages
+- [VM/Creation] Fix `insufficient space` which could happened when moving and resizing disks (PR [#5044](https://github.com/vatesfr/xen-orchestra/pull/5044))
+- [VM/General] Fix displayed IPV6 instead of IPV4 in case of an old version of XenServer (PR [#5036](https://github.com/vatesfr/xen-orchestra/pull/5036)))
+- [Host/Load-balancer] Fix VM migration condition: free memory in the destination host must be greater or equal to used VM memory (PR [#5054](https://github.com/vatesfr/xen-orchestra/pull/5054))
+- [Home] Broken "Import VM" link [#5055](https://github.com/vatesfr/xen-orchestra/issues/5055) (PR [#5056](https://github.com/vatesfr/xen-orchestra/pull/5056))
+- [Home/SR] Fix inability to edit SRs' name [#5057](https://github.com/vatesfr/xen-orchestra/issues/5057) (PR [#5058](https://github.com/vatesfr/xen-orchestra/pull/5058))
+- [Backup] Fix huge logs in case of Continuous Replication or Disaster Recovery errors (PR [#5069](https://github.com/vatesfr/xen-orchestra/pull/5069))
+- [Notification] Fix same notification showing again as unread (PR [#5067](https://github.com/vatesfr/xen-orchestra/pull/5067))
+- [SDN Controller] Fix broken private network creation when specifiyng a preferred center [#5076](https://github.com/vatesfr/xen-orchestra/issues/5076) (PRs [#5079](https://github.com/vatesfr/xen-orchestra/pull/5079) & [#5080](https://github.com/vatesfr/xen-orchestra/pull/5080))
+- [Import/VMDK] Import of VMDK disks has been broken since 5.45.0 (PR [#5087](https://github.com/vatesfr/xen-orchestra/pull/5087))
+- [Remotes] Fix not displayed used/total disk (PR [#5093](https://github.com/vatesfr/xen-orchestra/pull/5093))
 
-- xo-server-auth-ldap v0.6.5
-- xen-api v0.26.0
-- xo-server-sdn-controller v0.1
-- xo-server-auth-saml v0.6.0
-- xo-server-backup-reports v0.16.2
-- xo-server v5.44.0
-- xo-web v5.44.0
+### Packages to release
+
+> Packages will be released in the order they are here, therefore, they should
+> be listed by inverse order of dependency.
+>
+> Rule of thumb: add packages on top.
+>
+> The format is the following: - `$packageName` `$version`
+>
+> Where `$version` is
+>
+> - patch: if the change is a bug fix or a simple code improvement
+> - minor: if the change is a new feature
+> - major: if the change breaks compatibility
+>
+> In case of conflict, the highest (lowest in previous list) `$version` wins.
+
+- xo-server-audit minor
+- xo-server-sdn-controller patch
+- xo-server-load-balancer patch
+- xo-server minor
+- xo-web minor

CODE_OF_CONDUCT.md

@@ -8,19 +8,19 @@ In the interest of fostering an open and welcoming environment, we as contributo
 
 Examples of behavior that contributes to creating a positive environment include:
 
-* Using welcoming and inclusive language
-* Being respectful of differing viewpoints and experiences
-* Gracefully accepting constructive criticism
-* Focusing on what is best for the community
-* Showing empathy towards other community members
+- Using welcoming and inclusive language
+- Being respectful of differing viewpoints and experiences
+- Gracefully accepting constructive criticism
+- Focusing on what is best for the community
+- Showing empathy towards other community members
 
 Examples of unacceptable behavior by participants include:
 
-* The use of sexualized language or imagery and unwelcome sexual attention or advances
-* Trolling, insulting/derogatory comments, and personal or political attacks
-* Public or private harassment
-* Publishing others' private information, such as a physical or electronic address, without explicit permission
-* Other conduct which could reasonably be considered inappropriate in a professional setting
+- The use of sexualized language or imagery and unwelcome sexual attention or advances
+- Trolling, insulting/derogatory comments, and personal or political attacks
+- Public or private harassment
+- Publishing others' private information, such as a physical or electronic address, without explicit permission
+- Other conduct which could reasonably be considered inappropriate in a professional setting
 
 ## Our Responsibilities